{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7ef3c2ff-3664-4484-9e78-a94af9080f19",
          "code": "4926-55-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4926-55-0",
          "code_system": "CAS",
          "references": [
            "96ab5d7e-4f1b-4341-98ad-27be54f0ec98",
            "b2580dee-9bb5-4225-abf2-46c12c0c9542"
          ]
        },
        {
          "uuid": "d9d8818e-1274-4869-b141-d566786c0c7c",
          "code": "C99821",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C99821",
          "code_system": "NCI_THESAURUS",
          "references": [
            "96ab5d7e-4f1b-4341-98ad-27be54f0ec98"
          ]
        },
        {
          "uuid": "bfb5a272-b64f-4d2f-b0e5-0f764f985bec",
          "code": "225-555-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.023.232",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "96ab5d7e-4f1b-4341-98ad-27be54f0ec98"
          ]
        },
        {
          "uuid": "a56804d1-a2ba-4b08-974b-c674b0cbb0db",
          "code": "78637",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/78637",
          "code_system": "PUBCHEM",
          "references": [
            "96ab5d7e-4f1b-4341-98ad-27be54f0ec98"
          ]
        },
        {
          "uuid": "e24e740e-1d1e-3062-2a3e-aea22eee41bf",
          "code": "DTXSID0063650",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0063650",
          "code_system": "EPA CompTox",
          "references": [
            "7039b58b-45a3-02e5-742d-c596566fa052"
          ]
        },
        {
          "uuid": "398ba93d-349d-d287-eab7-c9bc4c5ce1e8",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1bee6d1c-6b11-df5e-8202-d229942fdab0"
          ]
        },
        {
          "uuid": "ffe103f2-76d2-d285-d393-4ccf88b6443f",
          "code": "2386335",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2386335/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c415b6f1-d550-08d3-1683-b367041af8bb"
          ]
        },
        {
          "uuid": "ea4b8134-16cf-402e-ba58-bc783718dd6e",
          "code": "9FVT2KMV9O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6d293945-88f2-4ff6-f6da-870b39b513fd",
          "code": "68401",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=68401",
          "code_system": "NSC",
          "references": [
            "3bc79988-3a6d-409d-0ec1-ae42d9ec99b2"
          ]
        },
        {
          "uuid": "c53fe0de-c67e-7fbf-6eca-99a115c2cf2d",
          "code": "33878",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=33878",
          "code_system": "NSC",
          "references": [
            "3bc79988-3a6d-409d-0ec1-ae42d9ec99b2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ce095a5d-0580-4581-9286-dec6be5e3797",
          "name": "2-((2-NITROPHENYL)AMINO)ETHANOL",
          "stdName": "2-((2-NITROPHENYL)AMINO)ETHANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "1f8c836f-a713-4a17-96f5-ae4f71727144"
          ],
          "display_name": false
        },
        {
          "uuid": "c245f63b-77df-43b8-a385-47f2b712775b",
          "name": "COLOREX HCY2",
          "stdName": "COLOREX HCY2",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "6094518e-7971-4401-9ff4-d9875e2f2460"
          ],
          "display_name": false
        },
        {
          "uuid": "98082395-6d3a-40c3-819a-e02a0ae4dec4",
          "name": "COVARIANE JAUNE W 1122",
          "stdName": "COVARIANE JAUNE W 1122",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "6094518e-7971-4401-9ff4-d9875e2f2460"
          ],
          "display_name": false
        },
        {
          "uuid": "d24e89ac-8958-41ed-9d22-f2bd7e8cdc6c",
          "name": "ETHANOL, 2-((2-NITROPHENYL)AMINO)-",
          "stdName": "ETHANOL, 2-((2-NITROPHENYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "1f8c836f-a713-4a17-96f5-ae4f71727144"
          ],
          "display_name": false
        },
        {
          "uuid": "56ada1dd-4270-42d7-a459-7ead496c758b",
          "name": "ETHANOL, 2-(O-NITROANILINO)-",
          "stdName": "ETHANOL, 2-(O-NITROANILINO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "1f8c836f-a713-4a17-96f5-ae4f71727144"
          ],
          "display_name": false
        },
        {
          "uuid": "5003bc15-d6b4-4161-a5da-1be7cffa9859",
          "name": "HC YELLOW 2",
          "stdName": "HC YELLOW 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "1f8c836f-a713-4a17-96f5-ae4f71727144"
          ],
          "display_name": false
        },
        {
          "uuid": "c6b16378-9b50-4447-a76f-4723d7d46a95",
          "name": "HC YELLOW NO. 2",
          "stdName": "HC YELLOW NO. 2",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "6094518e-7971-4401-9ff4-d9875e2f2460",
            "88c5289c-358a-4002-a34a-320130dce70b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b711108e-ad50-4fdf-934b-9b084e7a7e21",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8aab77fc-2fc6-41dc-a75e-9cd85ad750cb",
          "name": "JAROCOL YELLOW 2",
          "stdName": "JAROCOL YELLOW 2",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "6094518e-7971-4401-9ff4-d9875e2f2460"
          ],
          "display_name": false
        },
        {
          "uuid": "7ec7c931-be6e-4af1-8f56-ad6efcebf832",
          "name": "N-(2'-HYDROXYETHYL)-2-NITROANILINE",
          "stdName": "N-(2'-HYDROXYETHYL)-2-NITROANILINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "1f8c836f-a713-4a17-96f5-ae4f71727144"
          ],
          "display_name": false
        },
        {
          "uuid": "e9bf20fb-6e9e-437d-86f4-fb5d98dc2cfd",
          "name": "N-(2-HYDROXYETHYL)-2-NITROANILINE",
          "stdName": "N-(2-HYDROXYETHYL)-2-NITROANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6094518e-7971-4401-9ff4-d9875e2f2460"
          ],
          "display_name": false
        },
        {
          "uuid": "a02ae882-1c8f-46df-89c1-35b4ea987351",
          "name": "N-(2-HYDROXYETHYL)-O-NITROANILINE",
          "stdName": "N-(2-HYDROXYETHYL)-O-NITROANILINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "1f8c836f-a713-4a17-96f5-ae4f71727144"
          ],
          "display_name": false
        },
        {
          "uuid": "173c3050-8c71-49dd-a062-0516d44867b6",
          "name": "NSC-33878",
          "stdName": "NSC-33878",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "1f8c836f-a713-4a17-96f5-ae4f71727144"
          ],
          "display_name": false
        },
        {
          "uuid": "b185b333-1b48-42ff-ace3-d29661c3ac95",
          "name": "NSC-68401",
          "stdName": "NSC-68401",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "1f8c836f-a713-4a17-96f5-ae4f71727144"
          ],
          "display_name": false
        },
        {
          "uuid": "7962ffbc-90ab-4960-b2b3-7eda6562fcbd",
          "name": "O-NITRO-N-(2-HYDROXYETHYL)ANILINE",
          "stdName": "O-NITRO-N-(2-HYDROXYETHYL)ANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
            "1f8c836f-a713-4a17-96f5-ae4f71727144"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6094518e-7971-4401-9ff4-d9875e2f2460",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6f6e4086-dc37-49cf-8dc7-6eda24a81921",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f8c836f-a713-4a17-96f5-ae4f71727144",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96ab5d7e-4f1b-4341-98ad-27be54f0ec98",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391042000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e2251da-b414-4de7-9ede-0e2d4aa0ef40",
          "citation": "SRS import [9FVT2KMV9O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9FVT2KMV9O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391042000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f532032-2626-49b8-8c2a-31724c3ac72e",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88c5289c-358a-4002-a34a-320130dce70b",
          "citation": "HC YELLOW NO. 2 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7039b58b-45a3-02e5-742d-c596566fa052",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4926-55-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1bee6d1c-6b11-df5e-8202-d229942fdab0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c415b6f1-d550-08d3-1683-b367041af8bb",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "b2580dee-9bb5-4225-abf2-46c12c0c9542",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3bc79988-3a6d-409d-0ec1-ae42d9ec99b2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7dd1525f-ab90-d726-415c-6f024f920d72",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a60a0c8c-8693-4134-af8a-540b04f1230b",
          "id": "a60a0c8c-8693-4134-af8a-540b04f1230b",
          "molfile": "\n  Marvin  01132108382D          \n\n 13 13  0  0  0  0            999 V2000\n    5.2752   -3.2101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9957   -3.6221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9957   -4.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7174   -4.8532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7174   -5.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0052   -6.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0052   -6.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7174   -7.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4361   -6.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4361   -6.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1498   -5.6773    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.8683   -6.0903    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.1498   -4.8581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  CHG  2  11   1  12  -1\nM  END",
          "smiles": "c1ccc(c(c1)NCCO)[N+](=O)[O-]",
          "formula": "C8H10N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "32e8dfab-09c7-4f82-b428-1d8d2a2097f5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "182.1769",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "82e1dc63-3e57-40fa-a3da-d7b03426398e",
      "version": "10",
      "structure": {
        "id": "9ee8ac32-f089-4161-aa70-6a7207ffefef",
        "molfile": "\n  Marvin  01132108152D          \n\n 13 13  0  0  0  0            999 V2000\n    8.8683   -6.0903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1498   -5.6773    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.1498   -4.8581    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.4361   -6.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7174   -5.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7174   -4.8532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9957   -4.4413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9957   -3.6221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2752   -3.2101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0052   -6.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0052   -6.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7174   -7.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4361   -6.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  5 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13  4  2  0  0  0  0\nM  CHG  2   2   1   3  -1\nM  END",
        "smiles": "c1ccc(c(c1)NCCO)[N+](=O)[O-]",
        "formula": "C8H10N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "182.1769",
        "optical_activity": "NONE",
        "references": [
          "3e2251da-b414-4de7-9ede-0e2d4aa0ef40",
          "6f532032-2626-49b8-8c2a-31724c3ac72e"
        ],
        "stereo_centers": 0
      },
      "unii": "9FVT2KMV9O"
    }
  ]
}