{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5dc91959-fdd8-4a0d-872b-1a30d404475d", "code": "77858-21-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=77858-21-0", "code_system": "CAS", "references": [ "1869c587-287b-409d-8488-a54c1ba570c9", "4ee578b1-2ed2-4f6c-99eb-d23463648097" ] }, { "uuid": "fb889d42-bc89-409d-8354-5cd82b1a659e", "code": "SUB00032MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "1869c587-287b-409d-8488-a54c1ba570c9" ] }, { "uuid": "90d515de-b168-48a8-bb0e-44c31b43c006", "code": "6915", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6915", "code_system": "INN", "references": [ "1869c587-287b-409d-8488-a54c1ba570c9" ] }, { "uuid": "90381755-09cf-4456-aba5-25bd93e593ab", "code": "278-778-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.071.596", "code_system": "ECHA (EC/EINECS)", "references": [ "1869c587-287b-409d-8488-a54c1ba570c9" ] }, { "uuid": "a38fb673-686d-4905-b31f-1d66a19eda9c", "code": "CHEMBL2107643", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2107643", "code_system": "ChEMBL", "references": [ "1869c587-287b-409d-8488-a54c1ba570c9" ] }, { "uuid": "68b10b64-d818-4e8f-b9a9-06159a2d0a88", "code": "72162", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72162", "code_system": "PUBCHEM", "references": [ "1869c587-287b-409d-8488-a54c1ba570c9" ] }, { "uuid": "ec54fc37-1e86-d26f-e0bf-633e69207fbb", "code": "DTXSID30228472", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30228472", "code_system": "EPA CompTox", "references": [ "6ee8a41b-0c9d-63d7-9826-843d2473483a" ] }, { "uuid": "c5bb8072-0038-da72-3bf7-c5737db11f9e", "code": "C152845", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152845", "code_system": "NCI_THESAURUS", "references": [ "ccb8c82d-94ef-0bb0-eedf-ea6aa5c40d85" ] }, { "uuid": "df0e7085-f8e5-42d1-b9c6-0fbe348a35d0", "code": "C26170", "comments": "Pharmacologic Substance[C1909]|Protective Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C26170", "code_system": "NCI_THESAURUS", "references": [ "4cdc82c8-e370-925d-c117-358507c335c3" ] }, { "uuid": "d2534860-a55d-5de2-4213-b752d2338d81", "code": "C78275", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C78275", "code_system": "NCI_THESAURUS", "references": [ "4cdc82c8-e370-925d-c117-358507c335c3" ] }, { "uuid": "8d44c5b1-5189-49c6-8e74-605042839654", "code": "9EQV0XQ79B", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "75e25910-dc6d-f99c-9c02-f3f67fc295d9", "code": "22087", "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of sickle cell disease", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=22087", "code_system": "FDA ORPHAN DRUG", "references": [ "4cdc82c8-e370-925d-c117-358507c335c3" ] }, { "uuid": "e11678d1-4162-82d3-d851-fd0776752475", "code": "100000079077", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "c7b3b35b-7aff-11a6-0c68-629eab16d703" ] } ], "relationships": [ { "uuid": "fbfe5d99-90c4-4df9-becc-90a1a22c7119", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "6f6a62d9-2ade-452c-8234-d556c799e9dd", "refuuid": "085db0b7-2e3f-4e49-a75b-b9e8f649987f", "name": "VELARESOL", "unii": "9EQV0XQ79B", "linking_id": "9EQV0XQ79B", "ref_pname": "VELARESOL", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "7dbb1b40-d13d-44b4-914d-ce4765be32b8", "name": "12C", "stdName": "12C", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "93404975-5274-4621-be04-489e8c27205f" ], "display_name": false }, { "uuid": "c07954eb-e9c7-41cd-9419-db7f1d44b72f", "name": "5-(2-FORMYL-3-HYDROXYPHENOXY)VALERIC ACID", "stdName": "5-(2-FORMYL-3-HYDROXYPHENOXY)VALERIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "93404975-5274-4621-be04-489e8c27205f" ], "display_name": false }, { "uuid": "9d490a5a-3310-45b1-8b28-af7c3fc4d9b7", "name": "VELARESOL", "stdName": "VELARESOL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "93404975-5274-4621-be04-489e8c27205f", "94aa78c2-e7e9-4337-b80e-98cd698f771d", "58dc9c5d-fa01-46ed-9b69-eae1e254c5f1", "fe3dc503-01f2-4c97-9007-f9ff258ef9c9", "1c937210-abc8-455f-a50d-3940849e7279" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "ef74e8f9-c5a2-4376-9cae-a68c29a6d738", "name_org": "INN" } ] }, { "uuid": "f5873080-1508-4e2f-938f-3e23b34e750e", "name": "VELARESOL [MART.]", "stdName": "VELARESOL [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1c937210-abc8-455f-a50d-3940849e7279" ], "display_name": false }, { "uuid": "28c15df9-f7d9-4df2-8362-fde0a895c069", "name": "velaresol [INN]", "stdName": "VELARESOL [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "94aa78c2-e7e9-4337-b80e-98cd698f771d" ], "display_name": false } ], "references": [ { "uuid": "93404975-5274-4621-be04-489e8c27205f", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "94aa78c2-e7e9-4337-b80e-98cd698f771d", "citation": "INN Proposed List 66", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL66.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1c937210-abc8-455f-a50d-3940849e7279", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1869c587-287b-409d-8488-a54c1ba570c9", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390519000, "tags": [ "NOMEN" ] }, { "uuid": "6d66d608-a1d0-4cfc-9414-ff15dd0923d1", "citation": "SRS import [9EQV0XQ79B]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9EQV0XQ79B", "doc_type": "SRS", "public_domain": true, "document_date": 1493390519000, "tags": [ "NOMEN" ] }, { "uuid": "fe3dc503-01f2-4c97-9007-f9ff258ef9c9", "citation": "VELARESOL [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "58dc9c5d-fa01-46ed-9b69-eae1e254c5f1", "citation": "VELARESOL [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6ee8a41b-0c9d-63d7-9826-843d2473483a", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=77858-21-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ccb8c82d-94ef-0bb0-eedf-ea6aa5c40d85", "citation": "NCIT", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "4cdc82c8-e370-925d-c117-358507c335c3", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "4ee578b1-2ed2-4f6c-99eb-d23463648097", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "c7b3b35b-7aff-11a6-0c68-629eab16d703", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "cf2a438b-fe5d-41c9-86c9-5bd27d18b412", "id": "cf2a438b-fe5d-41c9-86c9-5bd27d18b412", "molfile": "\n Marvin 01132110422D \n\n 17 17 0 0 0 0 999 V2000\n 7.1285 -1.2163 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4066 -1.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4066 -2.3736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6566 -1.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9650 -1.6159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2585 -1.1932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5412 -1.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8578 -1.2470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1456 -1.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1456 -2.4607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4238 -2.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6937 -2.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6937 -1.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4238 -1.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4391 -0.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1226 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 15 2 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 13 1 0 0 0 0\n 13 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\nM END", "smiles": "C(CCOc1cccc(c1C=O)O)CC(=O)O", "formula": "C12H14O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "68331db0-ffad-49ea-be5e-d871cb0ebf17" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "238.237", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "085db0b7-2e3f-4e49-a75b-b9e8f649987f", "version": "9", "structure": { "id": "f878fada-d940-4b31-8443-f3f9874cce69", "molfile": "\n Marvin 01132112532D \n\n 17 17 0 0 0 0 999 V2000\n 1.4239 -1.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6938 -1.6314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1458 -1.6314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4071 -1.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4392 -0.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1291 -1.2164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1228 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4071 -2.3738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.2676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8580 -1.2471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4239 -2.8733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6570 -1.1933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6938 -2.4507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1458 -2.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5415 -1.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9654 -1.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2588 -1.1933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 1 1 0 0 0 0\n 4 12 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 4 2 0 0 0 0\n 7 5 2 0 0 0 0\n 8 4 1 0 0 0 0\n 9 2 1 0 0 0 0\n 10 3 1 0 0 0 0\n 11 14 1 0 0 0 0\n 12 16 1 0 0 0 0\n 13 2 1 0 0 0 0\n 14 3 2 0 0 0 0\n 15 10 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 15 1 0 0 0 0\n 13 11 2 0 0 0 0\nM END", "smiles": "C(CCOc1cccc(c1C=O)O)CC(=O)O", "formula": "C12H14O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "238.237", "optical_activity": "NONE", "references": [ "93404975-5274-4621-be04-489e8c27205f", "6d66d608-a1d0-4cfc-9414-ff15dd0923d1", "94aa78c2-e7e9-4337-b80e-98cd698f771d" ], "stereo_centers": 0 }, "unii": "9EQV0XQ79B" } ] }