{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "de0d9909-e0dc-4736-bd0a-0c894f1a15e9",
          "code": "27619-97-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=27619-97-2",
          "code_system": "CAS",
          "references": [
            "cf8efc15-6151-487a-aff7-78bf82d544ec",
            "84df9b0a-5a94-4eae-a596-5a72038c3e39"
          ]
        },
        {
          "uuid": "5632d018-a211-41ef-86cd-d0afbb5c0ca1",
          "code": "248-580-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.149",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cf8efc15-6151-487a-aff7-78bf82d544ec"
          ]
        },
        {
          "uuid": "51d3e0cd-31b8-405b-8db6-a065148260b0",
          "code": "119688",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119688",
          "code_system": "PUBCHEM",
          "references": [
            "cf8efc15-6151-487a-aff7-78bf82d544ec"
          ]
        },
        {
          "uuid": "55d14785-a1ff-7258-7cda-b874feb28d86",
          "code": "DTXSID6067331",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6067331",
          "code_system": "EPA CompTox",
          "references": [
            "e8887cd9-951b-9935-225f-f5a03f06bdfe"
          ]
        },
        {
          "uuid": "96f59dea-644f-4b73-9546-ee374d2c42a8",
          "code": "9E5JL7S7WY",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "ff38fbaf-bc9b-4903-bb79-aaa88f754898"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c1507347-12df-4778-af42-f4159d723ccf",
          "name": "1-Octanesulfonic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-",
          "stdName": "1-OCTANESULFONIC ACID, 3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffcde57f-08e3-4e0a-a96b-b9cdde7c9463",
            "ce78195f-b8b0-4c92-98d3-95cde3f20eb5"
          ],
          "display_name": false
        },
        {
          "uuid": "940f7338-b5ec-4075-817d-c6ad564778ff",
          "name": "1-Octanesulphonic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-",
          "stdName": "1-OCTANESULPHONIC ACID, 3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff38fbaf-bc9b-4903-bb79-aaa88f754898"
          ],
          "display_name": false
        },
        {
          "uuid": "61314d45-cc89-48f7-ab0b-f982ab1f560a",
          "name": "1H,1H,2H,2H-PERFLUOROOCTANESULFONIC ACID",
          "stdName": "1H,1H,2H,2H-PERFLUOROOCTANESULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffcde57f-08e3-4e0a-a96b-b9cdde7c9463",
            "ce78195f-b8b0-4c92-98d3-95cde3f20eb5"
          ],
          "display_name": false
        },
        {
          "uuid": "0029703e-e615-4abf-82c1-ee2fc296a23d",
          "name": "2-(PERFLUOROHEXYL)ETHANE-1-SULFONIC ACID",
          "stdName": "2-(PERFLUOROHEXYL)ETHANE-1-SULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffcde57f-08e3-4e0a-a96b-b9cdde7c9463",
            "ce78195f-b8b0-4c92-98d3-95cde3f20eb5"
          ],
          "display_name": false
        },
        {
          "uuid": "4e7d542c-46b5-4033-8e9b-b043f066d8cf",
          "name": "2-(PERFLUOROHEXYL)ETHANESULFONIC ACID",
          "stdName": "2-(PERFLUOROHEXYL)ETHANESULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffcde57f-08e3-4e0a-a96b-b9cdde7c9463",
            "ce78195f-b8b0-4c92-98d3-95cde3f20eb5"
          ],
          "display_name": false
        },
        {
          "uuid": "b66cab72-0965-436e-b644-e726ca9c9237",
          "name": "3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTANE-1-SULFONIC ACID",
          "stdName": "3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTANE-1-SULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffcde57f-08e3-4e0a-a96b-b9cdde7c9463",
            "ce78195f-b8b0-4c92-98d3-95cde3f20eb5"
          ],
          "display_name": false
        },
        {
          "uuid": "56603284-ca5c-41d3-a679-3604d542a8c9",
          "name": "3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTANESULFONIC ACID",
          "stdName": "3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTANESULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffcde57f-08e3-4e0a-a96b-b9cdde7c9463",
            "ce78195f-b8b0-4c92-98d3-95cde3f20eb5"
          ],
          "display_name": false
        },
        {
          "uuid": "650b3392-1659-42e1-a16c-ded226757379",
          "name": "3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanesulfonic acid",
          "stdName": "3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUORO-1-OCTANESULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84df9b0a-5a94-4eae-a596-5a72038c3e39"
          ],
          "display_name": false
        },
        {
          "uuid": "7ef5ac0c-d13b-4f21-936b-a047cb87ffd1",
          "name": "3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-1-octanesulphonic acid",
          "stdName": "3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUORO-1-OCTANESULPHONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84df9b0a-5a94-4eae-a596-5a72038c3e39"
          ],
          "display_name": false
        },
        {
          "uuid": "a96b7442-8929-408b-840e-d6068c6901c5",
          "name": "3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctanesulphonic acid",
          "stdName": "3,3,4,4,5,5,6,6,7,7,8,8,8-TRIDECAFLUOROOCTANESULPHONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff38fbaf-bc9b-4903-bb79-aaa88f754898"
          ],
          "display_name": false
        },
        {
          "uuid": "ec36cf60-d5bb-4cee-b509-cd88054a6810",
          "name": "THPFOS",
          "stdName": "THPFOS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff38fbaf-bc9b-4903-bb79-aaa88f754898"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "ce78195f-b8b0-4c92-98d3-95cde3f20eb5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ffcde57f-08e3-4e0a-a96b-b9cdde7c9463",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf8efc15-6151-487a-aff7-78bf82d544ec",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391007000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff38fbaf-bc9b-4903-bb79-aaa88f754898",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8887cd9-951b-9935-225f-f5a03f06bdfe",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=27619-97-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "84df9b0a-5a94-4eae-a596-5a72038c3e39",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "99c53153-e34c-4eaa-83f9-3a5074fdd458",
          "id": "99c53153-e34c-4eaa-83f9-3a5074fdd458",
          "molfile": "\n  Marvin  01132107592D          \n\n 25 24  0  0  0  0            999 V2000\n    3.3822   -5.8011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0966   -5.3978    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5049   -6.1172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6934   -4.6832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8161   -4.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5239   -5.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2374   -5.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7119   -4.3751    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7725   -4.3825    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0910   -5.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6116   -6.1465    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5559   -6.1342    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2328   -4.8655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7073   -4.2295    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7630   -4.2368    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2272   -5.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7449   -6.0846    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6905   -6.0734    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3728   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8569   -4.1695    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9126   -4.1796    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2160   -5.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9360   -4.9034    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7322   -5.9443    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6841   -5.9292    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
          "smiles": "C(CS(=O)(=O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F",
          "formula": "C8H5F13O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "df4755a8-6000-4ef0-a477-1f274fcde28b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "428.1691",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "74940c6b-55f7-48aa-9461-420d592e25a0",
      "version": "5",
      "structure": {
        "id": "11d7e326-1940-4938-a857-107644f00a71",
        "molfile": "\n  Marvin  01132101092D          \n\n 25 24  0  0  0  0            999 V2000\n    4.5049   -6.1172    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0966   -5.3978    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6934   -4.6832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3822   -5.8011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8161   -4.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5239   -5.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2374   -5.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7119   -4.3751    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7725   -4.3825    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0910   -5.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6116   -6.1465    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5559   -6.1342    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2328   -4.8655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7073   -4.2295    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7630   -4.2368    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2272   -5.4510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7449   -6.0846    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6905   -6.0734    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3728   -4.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8569   -4.1695    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9126   -4.1796    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2160   -5.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9360   -4.9034    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7322   -5.9443    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6841   -5.9292    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
        "smiles": "C(CS(=O)(=O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F",
        "formula": "C8H5F13O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "428.1691",
        "optical_activity": "NONE",
        "references": [
          "ff38fbaf-bc9b-4903-bb79-aaa88f754898"
        ],
        "stereo_centers": 0
      },
      "unii": "9E5JL7S7WY"
    }
  ]
}