{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b804d013-0060-4ebf-a88e-31dff63ac9b3", "code": "359073-59-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=359073-59-9", "code_system": "CAS", "references": [ "f56970ea-66c1-406f-afa5-ee588a1f203f", "c907e8a5-f0c7-406b-b76f-f3118c106e1d" ] }, { "uuid": "f683f6a9-9c7b-4857-8b0c-76cf173af14e", "code": "57076571", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/57076571", "code_system": "PUBCHEM", "references": [ "f56970ea-66c1-406f-afa5-ee588a1f203f" ] }, { "uuid": "168f1d6d-aea1-4ba6-9b20-b609083fb8e2", "code": "9E3G7I53FI", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "29602cb6-529b-e56d-9b27-e77cb956ab2f", "code": "DTXSID20957325", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20957325", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "cfaf8f0f-6d73-44ef-ab15-0b7023a73b3a", "name": "(±)-DIHEXYLDECYL SEBACATE", "stdName": "(+/-)-DIHEXYLDECYL SEBACATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "49ec84fe-6270-4396-9b39-200b13ad7a7b" ], "display_name": false }, { "uuid": "5104b7a2-b3cb-491c-940c-cbe7ab27bc69", "name": "DECANEDIOIC ACID, 1,10-BIS(2-HEXYLDECYL) ESTER", "stdName": "DECANEDIOIC ACID, 1,10-BIS(2-HEXYLDECYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8c9e552b-4385-4973-bcc4-d20f07f1a3e4" ], "display_name": false }, { "uuid": "0895a2a5-72e1-414b-93b9-9815a81908ea", "name": "DECANEDIOIC ACID, BIS(2-HEXYLDECYL) ESTER", "stdName": "DECANEDIOIC ACID, BIS(2-HEXYLDECYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8c9e552b-4385-4973-bcc4-d20f07f1a3e4" ], "display_name": false }, { "uuid": "546ba2ca-8b80-4543-b2c1-ad75f97b655b", "name": "DIHEXYLDECYL SEBACATE", "stdName": "DIHEXYLDECYL SEBACATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "3267ebde-6ea2-498e-9e40-7993188230c9", "af165de2-f0a7-431b-a539-2458f0c66e97" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "50555ebf-2d1b-4def-8bc5-e73a9bdf5be5", "name_org": "INCI" } ] }, { "uuid": "5503d7f5-fc26-4173-86a5-766631861710", "name": "DS-1660", "stdName": "DS-1660", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "3267ebde-6ea2-498e-9e40-7993188230c9" ], "display_name": false } ], "references": [ { "uuid": "49ec84fe-6270-4396-9b39-200b13ad7a7b", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3267ebde-6ea2-498e-9e40-7993188230c9", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8c9e552b-4385-4973-bcc4-d20f07f1a3e4", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f56970ea-66c1-406f-afa5-ee588a1f203f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391494000, "tags": [ "NOMEN" ] }, { "uuid": "83d6120c-cd13-4051-b37b-5aac252392f7", "citation": "SRS import [9E3G7I53FI]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9E3G7I53FI", "doc_type": "SRS", "public_domain": true, "document_date": 1493391494000, "tags": [ "NOMEN" ] }, { "uuid": "af165de2-f0a7-431b-a539-2458f0c66e97", "citation": "DIHEXYLDECYL SEBACATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c907e8a5-f0c7-406b-b76f-f3118c106e1d", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "eb9e07fa-19d2-43bc-bf66-600db1292825", "id": "eb9e07fa-19d2-43bc-bf66-600db1292825", "molfile": "\n Marvin 01132112112D \n\n 46 45 0 0 0 0 999 V2000\n 15.1775 -12.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1775 -11.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4630 -11.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4630 -10.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7485 -9.8055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7485 -8.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0340 -8.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0340 -7.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3195 -7.3305 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.6051 -7.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6051 -8.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8906 -8.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8906 -9.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1761 -10.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1761 -11.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3195 -6.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0340 -6.0930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0340 -5.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3195 -4.8556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7485 -4.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7485 -4.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0340 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3195 -4.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6050 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8906 -4.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1761 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4617 -4.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7472 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7472 -2.7930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0327 -4.0305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3183 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6038 -4.0305 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 5.8893 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1748 -4.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4604 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7459 -4.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0314 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3169 -4.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6038 -4.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8893 -5.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8893 -6.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1748 -6.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1748 -7.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4604 -7.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4604 -8.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7459 -8.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 16 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 2 0 0 0 0\n 30 28 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 32 39 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCCCC)COC(=O)CCCCCCCCC(=O)OCC(CCCCCC)CCCCCCCC", "formula": "C42H82O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "ae3a4e60-84de-49e7-9bb9-87d12c37b294" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "651.0997", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "bd38446d-b303-4418-a78d-6107ccbb584d", "version": "4", "structure": { "id": "856025b8-48a1-4f69-a743-a67baedc7851", "molfile": "\n Marvin 01132106552D \n\n 46 45 0 0 0 0 999 V2000\n 13.0340 -5.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0340 -6.0930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3195 -6.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3195 -7.3305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0340 -7.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0340 -8.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7485 -8.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7485 -9.8055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4630 -10.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4630 -11.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1775 -11.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1775 -12.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6051 -7.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6051 -8.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8906 -8.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8906 -9.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1761 -10.2180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1761 -11.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3195 -4.8556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7485 -4.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7485 -4.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0340 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3195 -4.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6050 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3169 -4.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7472 -2.7930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0314 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7459 -4.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4604 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1748 -4.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8893 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7459 -8.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4604 -8.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4604 -7.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1748 -7.3306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1748 -6.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8893 -6.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8893 -5.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6038 -4.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6038 -4.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3183 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0327 -4.0305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7472 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4617 -4.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1761 -3.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8906 -4.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 4 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 1 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 46 24 1 0 0 0 0\n 27 25 1 0 0 0 0\n 43 26 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 40 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 1 20 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCCCC)COC(=O)CCCCCCCCC(=O)OCC(CCCCCC)CCCCCCCC", "formula": "C42H82O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "651.0997", "optical_activity": "UNSPECIFIED", "references": [ "83d6120c-cd13-4051-b37b-5aac252392f7", "8c9e552b-4385-4973-bcc4-d20f07f1a3e4" ], "stereo_centers": 2 }, "unii": "9E3G7I53FI" } ] }