{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "cae0dc8c-c82f-4ed7-b34f-2cca95e3571d", "code": "N02AB02", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Phenylpiperidine derivatives|pethidine", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AB02&showdescription=yes", "code_system": "WHO-ATC", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "b30d55d4-97f6-4f6d-a494-918d1e7e4c22", "code": "N0000175684", "comments": "Cellular or Molecular Interactions [MoA]|Receptor Interactions [MoA]|G-Protein-linked Receptor Interactions [MoA]|Opioid Receptor Interactions [MoA]|Opioid Agonists [MoA]|Full Opioid Agonists [MoA]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175684", "code_system": "NDF-RT", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "a89ffd67-b94a-466c-b7c6-7d61ca3b4046", "code": "N0000175690", "comments": "Established Pharmacologic Class [EPC]|Opioid Agonist [EPC]", "type": "PRIMARY", "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175690", "code_system": "NDF-RT", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "4a99cd31-728c-41cd-90a4-24e5151bd7df", "code": "QN02AG03", "comments": "VATC|ANALGESICS|OPIOIDS|Opioids in combination with antispasmodics|pethidine and antispasmodics", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AG03&showdescription=yes", "code_system": "WHO-VATC", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "bcb96374-6eb6-4f3b-963d-e4c8bfa70aea", "code": "QN02AB72", "comments": "VATC|ANALGESICS|OPIOIDS|Phenylpiperidine derivatives|pethidine, combinations with psycholeptics", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AB72&showdescription=yes", "code_system": "WHO-VATC", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "318a6f99-64a5-47d8-b777-c65ccab9f469", "code": "57-42-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=57-42-1", "code_system": "CAS", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1", "4b45b0d8-e840-48cd-a348-da385d2ca388" ] }, { "uuid": "a780db1c-d5b2-4d5c-b649-62a248e76399", "code": "C71632", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71632", "code_system": "NCI_THESAURUS", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "a240c210-a071-49e8-be2d-6e9cf1834276", "code": "D008614", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68008614", "code_system": "MESH", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "a4b7f4f9-d84e-4a67-a279-60b6732f64fc", "code": "NBK548764", "comments": "LiverTox|Analgesic|Severe pain|Opiate", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/NBK548764/", "code_system": "LIVERTOX", "references": [ "5f38057f-dc11-c5fc-9d98-a59758f41b87" ] }, { "uuid": "6397d7a5-0362-4e6c-8195-66ed4bcd2070", "code": "PETHIDINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Pethidine", "code_system": "WIKIPEDIA", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "b2802615-89a3-481d-b138-79539f26f209", "code": "N02AB52", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Phenylpiperidine derivatives|pethidine, combinations excl. psycholeptics", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AB52&showdescription=yes", "code_system": "WHO-ATC", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "a241a5c9-04e4-405f-9028-04d3926cce64", "code": "N02AB72", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Phenylpiperidine derivatives|pethidine, combinations with psycholeptics", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AB72&showdescription=yes", "code_system": "WHO-ATC", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "ffb849f0-200c-4149-ad78-52f4fd3c0c3e", "code": "N02AG03", "comments": "ATC|NERVOUS SYSTEM|ANALGESICS|OPIOIDS|Opioids in combination with antispasmodics|pethidine and antispasmodics", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=N02AG03&showdescription=yes", "code_system": "WHO-ATC", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "d2bb4e1f-311b-4b22-bb87-f71d82f02937", "code": "QN02AB52", "comments": "VATC|ANALGESICS|OPIOIDS|Phenylpiperidine derivatives|pethidine, combinations excl. psycholeptics", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AB52&showdescription=yes", "code_system": "WHO-VATC", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "bcba3a47-382f-4698-a717-da8417b98664", "code": "QN02AB02", "comments": "VATC|ANALGESICS|OPIOIDS|Phenylpiperidine derivatives|pethidine", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN02AB02&showdescription=yes", "code_system": "WHO-VATC", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "ce4ccc0f-a685-4a40-bc21-59b38526ade2", "code": "SUB09738MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "563865ba-e0f1-4db8-ab1d-1fd0217380f3", "code": "411", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=411", "code_system": "INN", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "abf984dd-2f63-4a6e-b4dc-6bbd2e5e04a9", "code": "9230", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.12 Schedule II.|Opiates", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "5d27457b-e0fa-426f-8389-36f7d09eb8c8", "code": "200-329-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.299", "code_system": "ECHA (EC/EINECS)", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "439a5dfe-b409-412a-a5ad-098e6d99fe49", "code": "7221", "type": "PRIMARY", "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7221", "code_system": "IUPHAR", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "31507a14-9921-4294-9cdc-0cf20e8e4e72", "code": "6754", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6754/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "d205e60d-22f5-40cd-97f5-2b307df85284", "code": "m7186", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m7186?q=authorize", "code_system": "MERCK INDEX", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "7b787401-6c46-4bf8-a56b-2833d818d47d", "code": "DB00454", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB00454", "code_system": "DRUG BANK", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "9f4ba3d3-21d8-47d0-bc32-b9b4e7c663f1", "code": "CHEMBL607", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL607", "code_system": "ChEMBL", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "8d981e87-67b6-492b-894c-f626779c3a50", "code": "4058", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4058", "code_system": "PUBCHEM", "references": [ "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1" ] }, { "uuid": "bf94bad3-686a-3ed9-e000-bad6f81d26b2", "code": "3116", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3116", "code_system": "HSDB", "references": [ "bb915bb4-3cee-d54b-e8f4-c5eb95ec0727" ] }, { "uuid": "308600c2-2b09-6914-8ba4-9cf74aaa6aba", "code": "DTXSID9023253", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9023253", "code_system": "EPA CompTox", "references": [ "c50f4495-4d6d-747e-b69b-0fc08ccb6621" ] }, { "uuid": "8dfcd082-3aa9-4a04-52c0-58300d3fab0a", "code": "C67413", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413", "code_system": "NCI_THESAURUS", "references": [ "5f38057f-dc11-c5fc-9d98-a59758f41b87" ] }, { "uuid": "b953d305-4839-4550-a11c-53cf233ac93f", "code": "9E338QE28F", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "7c48f9fd-bb98-8a08-b76e-2bd544490c80", "code": "Meperidine", "type": "PRIMARY", "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM365/", "code_system": "LACTMED", "references": [ "5f38057f-dc11-c5fc-9d98-a59758f41b87" ] }, { "uuid": "e248e398-56fe-3cb1-3a65-73abe09499fa", "code": "1690", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/1690", "code_system": "DRUG CENTRAL", "references": [ "5f38057f-dc11-c5fc-9d98-a59758f41b87" ] }, { "uuid": "f1354c20-d5f4-928e-5e2c-5cec3f561d34", "code": "6754", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6754", "code_system": "CHEBI", "references": [ "5f38057f-dc11-c5fc-9d98-a59758f41b87" ] }, { "uuid": "addd5467-fc46-1e70-2ee2-b1aacd12203a", "code": "9E338QE28F", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=9E338QE28F", "code_system": "DAILYMED", "references": [ "a94eb04d-9877-b2f2-20a3-0357a9d9ab66" ] }, { "uuid": "3b507fe2-1451-8fb4-3d61-f767dc9de461", "code": "100000082223", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "91cf24a7-a179-5909-5cf9-29a6ccc66491" ] } ], "substance_class": "chemical", "references": [ { "uuid": "99eca017-568f-4f22-ac6e-9a026b74c467", "citation": "http://en.wikipedia.org/wiki/Pethidine", "url": "http://en.wikipedia.org/wiki/Pethidine", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "14ab2994-da2e-4c33-9343-0538eb6fa326", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "52d7488f-df86-4d42-855e-d7fb2b518760", "citation": "INN Proposed List 4", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL04.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2d54a3c1-3cec-4e07-9813-04b01b36ee68", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ebb2473c-8f27-4cbe-b979-9c8a2b9b1ce1", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5c048a24-7feb-4c6b-9472-f257794170e6", "citation": "D08343", "doc_type": "KEGG", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "19b9a136-89ad-47a6-8128-93c6eda56a28", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3b930700-5b32-4fb2-8be6-866108eed5a2", "citation": "SCIFINDER", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "950327d7-39f9-4537-859b-cf815fbbe50f", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5e86411c-58a5-41c6-bb8d-96283b5956e2", "citation": "NDF-RT", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fd2318a1-9fc7-408a-b71c-5cf57ad6f346", "citation": "INCB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "80bfbf8a-e548-4c50-8621-560497ebf505", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6edf2a98-bcf1-4ba3-99c8-97fcaf989eb1", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389649000, "tags": [ "NOMEN" ] }, { "uuid": "b0a9096e-c2a4-43d1-9f70-6a0630bc999e", "citation": "INTERNATIONAL NARCOTICS CONTROL BOARD - YELLOW LIST; ANNEX TO FORMS A, B AND C; 52ND EDITION, DECEMBER 2013; HTTP://WWW.INCB.ORG/", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7ae8bc07-ef65-4d7f-b31b-79e16f7d271c", "citation": "SRS import [9E338QE28F]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9E338QE28F", "doc_type": "SRS", "public_domain": true, "document_date": 1493389649000, "tags": [ "NOMEN" ] }, { "uuid": "8ea416d1-50c5-49d6-97b4-e1412ae1bcfd", "citation": "PETHIDINE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "fcd000af-bc25-49c5-beac-02785201f02d", "citation": "MEPERIDINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "6950e5cf-d30d-44ea-8a46-782944692ccf", "citation": "MEPERIDINE [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "aa374d94-73d2-4fe9-9c92-2f66f23337cb", "citation": "PETHIDINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d3324c17-f1fc-4c01-a371-dd436713b0b1", "citation": "MEPERIDINE [VANDF]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "bb915bb4-3cee-d54b-e8f4-c5eb95ec0727", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+57-42-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4aa85a9a-ca8a-34d2-748d-b21e838b0d9b", "citation": "Pharmacol Rev 65:578–640, April 2013", "url": "http://dx.doi.org/10.1124/pr.111.005439", "doc_type": "JA", "public_domain": true }, { "uuid": "c50f4495-4d6d-747e-b69b-0fc08ccb6621", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57-42-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4d00bcee-2d5e-a2c2-e2ce-78343c990978", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+57-42-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2a4750e3-f250-bd43-8478-1965a9a8f2b1", "citation": "Drug Information Handbook, 2016-2017 - 25th edition; Lexicomp Drug Reference Handbook; ISBN13: 9781591953531", "doc_type": "BOOK", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5f38057f-dc11-c5fc-9d98-a59758f41b87", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "4b45b0d8-e840-48cd-a348-da385d2ca388", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "a97ad532-06b0-7419-0e52-e36962f2372b", "citation": "Ramírez, Jacqueline, et al. \"CYP2B6, CYP3A4, and CYP2C19 are responsible for the in vitro N-demethylation of meperidine in human liver microsomes.\" Drug metabolism and disposition 32.9 (2004): 930-936.", "url": "http://dmd.aspetjournals.org/content/dmd/32/9/930.full.pdf", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a9d003e0-3168-0a97-e9e5-86c4f683915e", "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2019/021171s032lbl.pdf", "doc_type": "FDA APPROVED DRUG LABEL", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1d14ab57-809f-4746-a75c-5aade45d147c", "citation": "WIK", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bb814738-0e92-4868-b3f1-0454f6124cfa", "citation": "WIK", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d8d655f9-b3d9-cd91-685a-28b6cf0290e1", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "a94eb04d-9877-b2f2-20a3-0357a9d9ab66", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "91cf24a7-a179-5909-5cf9-29a6ccc66491", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "08375545-7673-4722-b05a-16f731ca1db7", "id": "08375545-7673-4722-b05a-16f731ca1db7", "molfile": "\n Marvin 01132100422D \n\n 18 19 0 0 0 0 999 V2000\n 0.6850 -3.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1399 -3.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.5800 -3.8185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4049 -3.7951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8014 -3.0693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8538 -4.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.6029 -4.8736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5884 -5.7014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8538 -6.1416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.8538 -6.9664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1718 -5.7014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1718 -4.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5796 -4.0924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2762 -4.5209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0137 -4.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.0195 -3.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2995 -2.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5884 -3.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 12 6 1 0 0 0 0\n 13 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 18 13 2 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "CCOC(=O)C1(CCN(C)CC1)c2ccccc2", "formula": "C15H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e7b233ce-c2fc-4013-8a09-89471c2e8de8" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "247.3333", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "92fbe18b-5a2e-430c-ac63-ddec80e3de5b", "version": "25", "structure": { "id": "43e4bb43-3269-4d56-9214-eef2df684325", "molfile": "\n Marvin 01132103352D \n\n 18 19 0 0 0 0 999 V2000\n 15.1004 -3.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5493 -2.9536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1004 -5.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7825 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3514 -4.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3747 -3.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1528 -2.2279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3659 -4.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7825 -4.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3742 -2.9770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1004 -6.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3659 -2.4261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6781 -3.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8143 -2.2775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6392 -2.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9405 -3.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6548 -2.0209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9348 -2.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 8 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 1 1 0 0 0 0\n 7 2 2 0 0 0 0\n 8 5 1 0 0 0 0\n 9 4 1 0 0 0 0\n 10 2 1 0 0 0 0\n 11 3 1 0 0 0 0\n 12 6 2 0 0 0 0\n 13 6 1 0 0 0 0\n 14 10 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 13 2 0 0 0 0\n 17 12 1 0 0 0 0\n 18 16 1 0 0 0 0\n 9 3 1 0 0 0 0\n 18 17 2 0 0 0 0\nM END", "smiles": "CCOC(=O)C1(CCN(C)CC1)c2ccccc2", "formula": "C15H21NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "247.3333", "optical_activity": "NONE", "references": [ "7ae8bc07-ef65-4d7f-b31b-79e16f7d271c", "14ab2994-da2e-4c33-9343-0538eb6fa326", "52d7488f-df86-4d42-855e-d7fb2b518760" ], "stereo_centers": 0 }, "unii": "9E338QE28F", "relationships": [ { "uuid": "140f812c-f167-45f1-a87d-d6292f3943d7", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "f68bb974-e5ee-4a17-a7de-7d7a91d4e764", "refuuid": "92fbe18b-5a2e-430c-ac63-ddec80e3de5b", "name": "MEPERIDINE", "unii": "9E338QE28F", "linking_id": "9E338QE28F", "ref_pname": "MEPERIDINE", "substance_class": "reference" } }, { "uuid": "60a47299-7135-496c-a276-1587085a3ef6", "amount": { "uuid": "f5bd321c-61b2-456c-94a7-9f808d36a899", "type": "RELATIONSHIP_AMOUNT", "average": 87 }, "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)", "type": "SALT/SOLVATE->PARENT", "references": [ "b0a9096e-c2a4-43d1-9f70-6a0630bc999e" ], "related_substance": { "uuid": "3dbfdb42-1e87-4697-ac74-67d1ba6fa43f", "refuuid": "deb24cf9-264e-4243-a9e7-89954e426eaa", "name": "MEPERIDINE HYDROCHLORIDE", "unii": "N8E7F7Q170", "linking_id": "N8E7F7Q170", "ref_pname": "MEPERIDINE HYDROCHLORIDE", "substance_class": "reference" } }, { "uuid": "8c9b0190-b8fc-4df4-b939-72d24e4c2502", "amount": { "uuid": "cf30850a-fe8f-4703-83c1-3be9f2b2d4e8", "average": 44, "units": "%" }, "type": "BINDER->LIGAND", "references": [ "4aa85a9a-ca8a-34d2-748d-b21e838b0d9b" ], "related_substance": { "uuid": "1aefbd85-ce8a-4806-b390-2a297a243026", "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30", "name": "PLASMA PROTEIN FRACTION (HUMAN)", "unii": "6D53G0FD0Z", "linking_id": "6D53G0FD0Z", "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)", "substance_class": "reference" } }, { "uuid": "6c30122e-1a3e-4516-9efb-2a8aade2dcb0", "type": "METABOLIC ENZYME->SUBSTRATE", "interaction_type": "MINOR", "references": [ "a97ad532-06b0-7419-0e52-e36962f2372b" ], "related_substance": { "uuid": "a9fcc621-00e9-4546-a806-5b82250dc1fa", "refuuid": "4f746c19-0e0a-447a-beda-d28b91d6f23e", "name": "CYTOCHROME P450 2C19", "unii": "081I12ZA58", "linking_id": "081I12ZA58", "ref_pname": "CYTOCHROME P450 2C19", "substance_class": "reference" } }, { "uuid": "1a9ee330-bf02-4ad3-8dca-b53a524e487e", "type": "METABOLIC ENZYME->SUBSTRATE", "interaction_type": "MAJOR", "references": [ "a9d003e0-3168-0a97-e9e5-86c4f683915e", "a97ad532-06b0-7419-0e52-e36962f2372b" ], "related_substance": { "uuid": "e49dc103-5784-403d-a095-b4edd6bee025", "refuuid": "4275827d-e329-4907-95b5-7d690692872a", "name": "CYTOCHROME P450 3A4", "unii": "PUO0521HZV", "linking_id": "PUO0521HZV", "ref_pname": "CYTOCHROME P450 3A4", "substance_class": "reference" } }, { "uuid": "c0be7aec-2772-4170-974c-0af3f2a76ddf", "type": "METABOLIC ENZYME->SUBSTRATE", "interaction_type": "MAJOR", "references": [ "a9d003e0-3168-0a97-e9e5-86c4f683915e", "a97ad532-06b0-7419-0e52-e36962f2372b" ], "related_substance": { "uuid": "58f4c501-2647-49a4-b62f-81fe22ec8bec", "refuuid": "83e3f07e-be5b-48ac-be08-0c68c20e8bf0", "name": "CYTOCHROME P450 2B6", "unii": "0UY97CSG1T", "linking_id": "0UY97CSG1T", "ref_pname": "CYTOCHROME P450 2B6", "substance_class": "reference" } }, { "uuid": "d73a4785-c40c-411a-a277-411a274faa5d", "amount": { "uuid": "570f1977-ef36-4561-b8df-6b75b23c8fc0" }, "type": "DERIVATIVE->PARENT", "references": [ "bb814738-0e92-4868-b3f1-0454f6124cfa" ], "related_substance": { "uuid": "e9a73059-2fb5-4ece-9b0a-6d548957397c", "refuuid": "a400fe68-0172-44bb-a880-c11230da22ef", "name": "4-Fluoropethidine", "unii": "2PA8LN9987", "linking_id": "2PA8LN9987", "ref_pname": "4-Fluoropethidine" } } ], "names": [ { "uuid": "9b09b6b0-9aa3-4426-a756-4894199de055", "name": "1-METHYL-4-PHENYLPIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER", "stdName": "1-METHYL-4-PHENYLPIPERIDINE-4-CARBOXYLIC ACID ETHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fd2318a1-9fc7-408a-b71c-5cf57ad6f346" ], "display_name": false }, { "uuid": "63edb3d2-2db5-471a-aa61-209fc7d131c1", "name": "4-PIPERIDINECARBOXYLIC ACID, 1-METHYL-4-PHENYL-, ETHYL ESTER", "stdName": "4-PIPERIDINECARBOXYLIC ACID, 1-METHYL-4-PHENYL-, ETHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "14ab2994-da2e-4c33-9343-0538eb6fa326" ], "display_name": false }, { "uuid": "794f7773-8ce4-48cb-8111-10b60335377b", "name": "ETHYL 1-METHYL-4-PHENYLISONIPECOTATE", "stdName": "ETHYL 1-METHYL-4-PHENYLISONIPECOTATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "14ab2994-da2e-4c33-9343-0538eb6fa326" ], "display_name": false }, { "uuid": "c4d2bce7-0c55-4510-b1b2-07869e6f719d", "name": "ETHYL 1-METHYL-4-PHENYLPIPERIDINE-4-CARBOXYLATE", "stdName": "ETHYL 1-METHYL-4-PHENYLPIPERIDINE-4-CARBOXYLATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "80bfbf8a-e548-4c50-8621-560497ebf505" ], "display_name": false }, { "uuid": "1c9c6bc6-b182-4050-a4a2-39c1c76036ba", "name": "IDS-NP-001", "stdName": "IDS-NP-001", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "fd2318a1-9fc7-408a-b71c-5cf57ad6f346" ], "display_name": false }, { "uuid": "81a383ff-a18a-4e84-9797-9803bf6879c1", "name": "ISONIPECAINE", "stdName": "ISONIPECAINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "80bfbf8a-e548-4c50-8621-560497ebf505" ], "display_name": false }, { "uuid": "844844cd-e993-4dbf-a907-92be25e0a3ac", "name": "ISONIPECOTIC ACID, 1-METHYL-4-PHENYL-, ETHYL ESTER", "stdName": "ISONIPECOTIC ACID, 1-METHYL-4-PHENYL-, ETHYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3b930700-5b32-4fb2-8be6-866108eed5a2" ], "display_name": false }, { "uuid": "01352994-9167-49c3-87bf-6131b19f4d1a", "name": "MEPERIDINE", "stdName": "MEPERIDINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2d54a3c1-3cec-4e07-9813-04b01b36ee68", "6950e5cf-d30d-44ea-8a46-782944692ccf", "14ab2994-da2e-4c33-9343-0538eb6fa326", "19b9a136-89ad-47a6-8128-93c6eda56a28", "d3324c17-f1fc-4c01-a371-dd436713b0b1", "fcd000af-bc25-49c5-beac-02785201f02d", "5e86411c-58a5-41c6-bb8d-96283b5956e2" ], "display_name": true }, { "uuid": "a2245c68-a9da-48b1-af69-4b240d7df833", "name": "MEPERIDINE [HSDB]", "stdName": "MEPERIDINE [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "19b9a136-89ad-47a6-8128-93c6eda56a28" ], "display_name": false }, { "uuid": "252c8044-6bf6-48cb-84eb-f8c06ea41bb8", "name": "MEPERIDINE [MI]", "stdName": "MEPERIDINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2d54a3c1-3cec-4e07-9813-04b01b36ee68" ], "display_name": false }, { "uuid": "a2d5b585-455d-47c0-8333-4cef0accbef2", "name": "MEPERIDINE [VANDF]", "stdName": "MEPERIDINE [VANDF]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5e86411c-58a5-41c6-bb8d-96283b5956e2" ], "display_name": false }, { "uuid": "b0bc4f2e-18e5-4296-a822-ce236794f7fc", "name": "MEPERIDOL", "stdName": "MEPERIDOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3b930700-5b32-4fb2-8be6-866108eed5a2" ], "display_name": false }, { "uuid": "609b0a57-58a6-486b-b30b-748488a62799", "name": "PETHANOL", "stdName": "PETHANOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3b930700-5b32-4fb2-8be6-866108eed5a2" ], "display_name": false }, { "uuid": "1abaf504-86f4-4344-b848-a03391a962dd", "name": "PETHIDINE", "stdName": "PETHIDINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "950327d7-39f9-4537-859b-cf815fbbe50f", "aa374d94-73d2-4fe9-9c92-2f66f23337cb", "8ea416d1-50c5-49d6-97b4-e1412ae1bcfd", "99eca017-568f-4f22-ac6e-9a026b74c467", "52d7488f-df86-4d42-855e-d7fb2b518760" ], "display_name": false, "domains": [ "drug" ], "name_orgs": [ { "uuid": "4d545ed9-7e6f-476e-95a5-0b286b635e5e", "name_org": "INN" } ] }, { "uuid": "c3eb2ec1-bfdf-4112-a331-4f4cb4d1e0e2", "name": "PETHIDINE DBL", "stdName": "PETHIDINE DBL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5c048a24-7feb-4c6b-9472-f257794170e6", "ebb2473c-8f27-4cbe-b979-9c8a2b9b1ce1" ], "display_name": false }, { "uuid": "8235c2bb-9741-48a7-9671-fcee7dd14377", "name": "PETHIDINETER", "stdName": "PETHIDINETER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3b930700-5b32-4fb2-8be6-866108eed5a2" ], "display_name": false }, { "uuid": "eb6c1c76-a9de-3750-e717-b8790af72801", "name": "Pethidine [WHO-DD]", "stdName": "PETHIDINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d8d655f9-b3d9-cd91-685a-28b6cf0290e1" ], "display_name": false }, { "uuid": "36ff5e8a-b00c-46a0-84f7-3533ae3ace45", "name": "RENAUDIN", "stdName": "RENAUDIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3b930700-5b32-4fb2-8be6-866108eed5a2" ], "display_name": false }, { "uuid": "f84a542c-40bf-4995-9ad2-b279f5d67e35", "name": "pethidine [INN]", "stdName": "PETHIDINE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "52d7488f-df86-4d42-855e-d7fb2b518760" ], "display_name": false } ], "properties": [ { "uuid": "32a0a7d7-b571-4e5f-b37c-bece9106a213", "name": "Biological Half-life", "defining": false, "parameters": [ { "uuid": "3e214594-765b-48a0-a38b-2f4e122c763e", "name": "Elimination", "type": "PHARMACOKINETIC", "value": { "uuid": "bce10d20-a6ec-4f94-b30d-58a327976d19", "average": 3.25, "high": 4, "low": 2.5, "units": "hours", "references": [], "non_numeric_value": "Terminal Phase: Adults" }, "references": [] }, { "uuid": "1099fe13-4b0a-4bda-ba45-30f37ed230ad", "name": "Elimination", "type": "PHARMACOKINETIC", "value": { "uuid": "a5e57868-df71-4b43-a5f8-04d0ead06056", "average": 9, "high": 11, "low": 7, "units": "hours", "references": [], "non_numeric_value": "Liver disease" }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "2a4750e3-f250-bd43-8478-1965a9a8f2b1" ] } ] } ] }