{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2107af1b-4ba4-4ba0-be87-273f8f49b612",
          "code": "104037-85-6",
          "type": "NON-SPECIFIC SUBSTITUTION",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=104037-85-6",
          "code_system": "CAS",
          "references": [
            "b3a74102-5764-40b1-8f84-70df89c88089",
            "89981124-4b35-4f5d-8c59-9bcc279af90e"
          ]
        },
        {
          "uuid": "0bd31abe-f086-4eca-a672-8d21b4e0cc4f",
          "code": "125778-19-0",
          "type": "NON-SPECIFIC SUBSTITUTION",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=125778-19-0",
          "code_system": "CAS",
          "references": [
            "b3a74102-5764-40b1-8f84-70df89c88089",
            "e1278648-bb47-43e2-b299-0bc105c4a29a"
          ]
        },
        {
          "uuid": "ba40a329-09fa-4081-9d4f-8fbcaef7f745",
          "code": "111753-60-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=111753-60-7",
          "code_system": "CAS",
          "references": [
            "b3a74102-5764-40b1-8f84-70df89c88089",
            "20571d96-8dda-4710-8e7a-685553d314f5"
          ]
        },
        {
          "uuid": "3cc92b4e-81bd-434e-a6c3-f6ebbbf5da73",
          "code": "4100752",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4100752",
          "code_system": "PUBCHEM",
          "references": [
            "b3a74102-5764-40b1-8f84-70df89c88089"
          ]
        },
        {
          "uuid": "576f62c0-4ef9-4fe3-8972-216997f8362d",
          "code": "9D297714YE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "48681e4e-7269-9bc1-7222-0d3cb8af7d28",
          "code": "DTXSID60869413",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60869413",
          "code_system": "EPA CompTox",
          "references": [
            "807663f2-c972-d1cf-6ab9-59601aec3af0"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e358df57-1816-4ce5-8edb-b611847560d2",
          "name": "2-((3-(1,3-BENZODIOXOL-5-YL)-2-METHYLPROPYLIDENE)AMINO)BENZOIC ACID METHYL ESTER",
          "stdName": "2-((3-(1,3-BENZODIOXOL-5-YL)-2-METHYLPROPYLIDENE)AMINO)BENZOIC ACID METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b76a317-3a3d-44f8-9142-3265ac2f7913",
            "d8715e1d-0222-4cb4-a41c-552b774aeff2"
          ],
          "display_name": true
        },
        {
          "uuid": "f94d4ecd-ea69-4a67-8578-14bf20872fdb",
          "name": "BENZOIC ACID, 2-((3-(1,3-BENZODIOXOL-5-YL)-2-METHYL-1-PROPENYL)AMINO)-, METHYL ESTER",
          "stdName": "BENZOIC ACID, 2-((3-(1,3-BENZODIOXOL-5-YL)-2-METHYL-1-PROPENYL)AMINO)-, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b76a317-3a3d-44f8-9142-3265ac2f7913",
            "eddd8a8e-f91a-4a4e-8090-81347111ad2b"
          ],
          "display_name": false
        },
        {
          "uuid": "399d7609-69ca-4e98-a8da-ee44333a1901",
          "name": "BENZOIC ACID, 2-((3-(1,3-BENZODIOXOL-5-YL)-2-METHYLPROPYLIDENE)AMINO)-, METHYL ESTER",
          "stdName": "BENZOIC ACID, 2-((3-(1,3-BENZODIOXOL-5-YL)-2-METHYLPROPYLIDENE)AMINO)-, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b76a317-3a3d-44f8-9142-3265ac2f7913",
            "eddd8a8e-f91a-4a4e-8090-81347111ad2b"
          ],
          "display_name": false
        },
        {
          "uuid": "e8f5ed15-ab61-43ca-ad18-73227c3bb660",
          "name": "HELIOFORTE",
          "stdName": "HELIOFORTE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b76a317-3a3d-44f8-9142-3265ac2f7913",
            "eddd8a8e-f91a-4a4e-8090-81347111ad2b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "eddd8a8e-f91a-4a4e-8090-81347111ad2b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1b76a317-3a3d-44f8-9142-3265ac2f7913",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8715e1d-0222-4cb4-a41c-552b774aeff2",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3a74102-5764-40b1-8f84-70df89c88089",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392170000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3ca44b2-f396-4365-8dcd-611525a8951d",
          "citation": "SRS import [9D297714YE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9D297714YE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392170000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08f11e78-2a40-4e5f-8991-6f8a26119892",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20571d96-8dda-4710-8e7a-685553d314f5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e1278648-bb47-43e2-b299-0bc105c4a29a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "89981124-4b35-4f5d-8c59-9bcc279af90e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "807663f2-c972-d1cf-6ab9-59601aec3af0",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0238a23e-91a8-49d5-b1f5-37f42fc57fb9",
          "id": "0238a23e-91a8-49d5-b1f5-37f42fc57fb9",
          "molfile": "\n  Marvin  01132100262D          \n\n 24 26  0  0  0  0            999 V2000\n    6.0817   -5.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3669   -4.6560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6521   -5.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6521   -5.8966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9419   -4.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2178   -5.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5122   -4.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5122   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2178   -3.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9419   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6521   -3.4201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3576   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0725   -3.4201    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.0725   -2.5946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7874   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5022   -3.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5022   -2.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2123   -2.1888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9272   -2.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6420   -2.1888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3569   -2.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3569   -3.4295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9272   -3.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2123   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 24  2  0  0  0  0\n 18 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 23  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "CC(Cc1ccc2c(c1)OCO2)/C=N/c3ccccc3C(=O)OC",
          "formula": "C19H19NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5d71e7fa-f353-46c0-9d62-b83935d355b8"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "325.3592",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "738af20c-035c-434c-8c6f-3394bebc483c",
      "version": "6",
      "structure": {
        "id": "007fcef2-031e-48ba-8849-35710b8b21cd",
        "molfile": "\n  Marvin  01132100202D          \n\n 24 26  0  0  0  0            999 V2000\n    2.5122   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5122   -4.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2178   -5.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9419   -4.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6521   -5.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6521   -5.8966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3669   -4.6560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0817   -5.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9419   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2178   -3.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6521   -3.4201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3576   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0725   -3.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7874   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5022   -3.4201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2123   -3.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9272   -3.4295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9272   -2.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2123   -2.1888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5022   -2.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6420   -2.1888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3569   -2.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3569   -3.4295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0725   -2.5946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  4  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  1 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 15 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 17 23  1  0  0  0  0\n 13 24  1  0  0  0  0\nM  END",
        "smiles": "CC(Cc1ccc2c(c1)OCO2)/C=N/c3ccccc3C(=O)OC",
        "formula": "C19H19NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "325.3592",
        "optical_activity": "( + / - )",
        "references": [
          "08f11e78-2a40-4e5f-8991-6f8a26119892",
          "a3ca44b2-f396-4365-8dcd-611525a8951d"
        ],
        "stereo_centers": 1
      },
      "unii": "9D297714YE"
    }
  ]
}