{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c4b6f50d-9352-4d03-a360-de2dfc887736", "code": "141-19-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=141-19-5", "code_system": "CAS", "references": [ "794718ab-dbd1-44bf-9258-8ffec513b8ec", "5deabf4c-4f2b-41aa-903a-4e0609dea65f" ] }, { "uuid": "cbace5ff-5a79-4836-81fe-da1718ea0872", "code": "205-467-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.971", "code_system": "ECHA (EC/EINECS)", "references": [ "794718ab-dbd1-44bf-9258-8ffec513b8ec" ] }, { "uuid": "c32998b4-413d-4b07-a970-3cd87e04aafd", "code": "67329", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67329", "code_system": "PUBCHEM", "references": [ "794718ab-dbd1-44bf-9258-8ffec513b8ec" ] }, { "uuid": "e131acbf-24e3-9cc1-099c-741b81135859", "code": "DTXSID6044802", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6044802", "code_system": "EPA CompTox", "references": [ "d2770fa3-afff-86cd-a308-20b5621b8335" ] }, { "uuid": "cd54d196-bbbe-473b-a889-e119d3e943f6", "code": "9D0TU0RR8Z", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "d93628d3-582f-4382-bbab-acb8e0de468f", "name": "BIS(2-BUTOXYETHYL) DECANEDIOATE", "stdName": "BIS(2-BUTOXYETHYL) DECANEDIOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ad06a7e4-c9a6-4d8c-b9d8-70adebbbf215" ], "display_name": false }, { "uuid": "575ee35e-71a8-4723-b4f4-9c991145fb3c", "name": "BIS(2-BUTOXYETHYL) SEBACATE", "stdName": "BIS(2-BUTOXYETHYL) SEBACATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b93cc171-c624-421b-918a-3c8e79e8b4b3" ], "display_name": true }, { "uuid": "97bdc397-e294-45c1-99c4-6a7ad59b172a", "name": "DECANEDIOIC ACID, 1,10-BIS(2-BUTOXYETHYL) ESTER", "stdName": "DECANEDIOIC ACID, 1,10-BIS(2-BUTOXYETHYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b93cc171-c624-421b-918a-3c8e79e8b4b3" ], "display_name": false }, { "uuid": "054ace5c-3076-435f-b988-9bc807d769aa", "name": "DECANEDIOIC ACID, BIS(2-BUTOXYETHYL) ESTER", "stdName": "DECANEDIOIC ACID, BIS(2-BUTOXYETHYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b93cc171-c624-421b-918a-3c8e79e8b4b3" ], "display_name": false }, { "uuid": "cf6da6e0-33f9-453f-8dfe-2415be886739", "name": "DI(ETHYLENE GLYCOL BUTYL ETHER) SEBACATE", "stdName": "DI(ETHYLENE GLYCOL BUTYL ETHER) SEBACATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b93cc171-c624-421b-918a-3c8e79e8b4b3" ], "display_name": false }, { "uuid": "e989fc2e-06b5-4976-93c7-edc33c3a587c", "name": "SEBACIC ACID, BIS(2-BUTOXYETHYL) ESTER", "stdName": "SEBACIC ACID, BIS(2-BUTOXYETHYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b93cc171-c624-421b-918a-3c8e79e8b4b3" ], "display_name": false } ], "references": [ { "uuid": "ad06a7e4-c9a6-4d8c-b9d8-70adebbbf215", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b93cc171-c624-421b-918a-3c8e79e8b4b3", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "794718ab-dbd1-44bf-9258-8ffec513b8ec", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392187000, "tags": [ "NOMEN" ] }, { "uuid": "c10ce20c-690c-4526-a051-5aa7b818561e", "citation": "SRS import [9D0TU0RR8Z]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9D0TU0RR8Z", "doc_type": "SRS", "public_domain": true, "document_date": 1493392187000, "tags": [ "NOMEN" ] }, { "uuid": "d2770fa3-afff-86cd-a308-20b5621b8335", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=141-19-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5deabf4c-4f2b-41aa-903a-4e0609dea65f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3c449afe-75f5-4803-97a6-6f74cf9a15e8", "id": "3c449afe-75f5-4803-97a6-6f74cf9a15e8", "molfile": "\n Marvin 01132103122D \n\n 28 27 0 0 0 0 999 V2000\n 0.0000 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7074 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4150 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1224 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8300 -0.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5374 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2449 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9524 -1.2381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6600 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6600 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3674 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0750 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7824 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4900 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1974 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9050 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6124 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3199 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0274 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0274 -2.0517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7349 -0.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4424 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1499 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8573 -1.2381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5649 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2723 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9799 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6873 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\nM END", "smiles": "CCCCOCCOC(=O)CCCCCCCCC(=O)OCCOCCCC", "formula": "C22H42O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fbb7fb07-5767-4be0-8f2d-e4ab59618989" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "402.5661", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "eff6339c-9534-4dfa-989e-ebe3d5dd8818", "version": "3", "structure": { "id": "d19a2d6b-53ef-4dc0-b84a-e2527b0a6445", "molfile": "\n Marvin 01132110502D \n\n 28 27 0 0 0 0 999 V2000\n 5.6600 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3674 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0750 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7824 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4900 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1974 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9050 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6124 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3199 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0274 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6600 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9524 -1.2381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0274 -2.0517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7349 -0.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2449 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5374 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8300 -0.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1224 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4150 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7074 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4424 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1499 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8573 -1.2381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5649 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2723 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9799 -0.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.6873 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 12 1 0 0 0 0\n 1 11 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 14 1 0 0 0 0\n 10 13 2 0 0 0 0\n 12 15 1 0 0 0 0\n 14 22 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\nM END", "smiles": "CCCCOCCOC(=O)CCCCCCCCC(=O)OCCOCCCC", "formula": "C22H42O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "402.5661", "optical_activity": "NONE", "references": [ "c10ce20c-690c-4526-a051-5aa7b818561e", "ad06a7e4-c9a6-4d8c-b9d8-70adebbbf215" ], "stereo_centers": 0 }, "unii": "9D0TU0RR8Z" } ] }