{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "95d3830b-be64-4113-d622-6681d11b3ba4",
          "code": "13476364",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13476364",
          "code_system": "PUBCHEM",
          "references": [
            "e91eb6bd-795d-d1d2-d408-5f6f46074552"
          ]
        },
        {
          "uuid": "7600718b-68db-4156-9e40-bd878a3a8a3d",
          "code": "104832-72-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=104832-72-6",
          "code_system": "CAS",
          "references": [
            "01f3dd44-01ba-88cb-84e2-ac09c80f3528"
          ]
        },
        {
          "uuid": "5e6d4a64-0968-41e7-b828-a5b81fdd34b0",
          "code": "9CKD1JE38R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "841daef6-d018-12d1-59fb-98ed9e3123e1",
          "code": "9CKD1JE38R",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(9CKD1JE38R)",
          "code_system": "DAILYMED",
          "references": [
            "f4108d22-d73e-38f7-fd94-a3354fea46ab"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f2e37088-ded1-4baa-b86c-58ee26124d65",
          "type": "ACTIVE MOIETY",
          "references": [
            "01f3dd44-01ba-88cb-84e2-ac09c80f3528"
          ],
          "related_substance": {
            "uuid": "59cb0ece-e60f-4eee-9959-4227ce356aff",
            "refuuid": "adb363b9-f919-43fe-9c7e-fd5b55ff737d",
            "name": "TOCOPHERYL GLUCOSIDE",
            "unii": "9CKD1JE38R",
            "linking_id": "9CKD1JE38R",
            "ref_pname": "TOCOPHERYL GLUCOSIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d4016e71-f2ba-4624-ab5d-04bf21c2ac36",
          "type": "METABOLITE ACTIVE->PRODRUG",
          "references": [
            "01f3dd44-01ba-88cb-84e2-ac09c80f3528"
          ],
          "related_substance": {
            "uuid": "d2ea64e3-0c73-4abd-9431-2913b38609b5",
            "refuuid": "d892b64e-3573-4e4c-b87c-0cf7f98c3073",
            "name": ".ALPHA.-TOCOPHEROL, D-",
            "unii": "N9PR3490H9",
            "linking_id": "N9PR3490H9",
            "ref_pname": ".ALPHA.-TOCOPHEROL, D-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "50a0dfb6-a543-fae2-2d1d-3bf7fc3e9387",
          "name": "(2R)-3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-YL .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "(2R)-3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-YL .BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01f3dd44-01ba-88cb-84e2-ac09c80f3528"
          ],
          "display_name": false
        },
        {
          "uuid": "545bc62c-d990-3432-b663-aca77fa1989f",
          "name": ".ALPHA.-TOCOPHEROL GLUCOSIDE",
          "stdName": ".ALPHA.-TOCOPHEROL GLUCOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01f3dd44-01ba-88cb-84e2-ac09c80f3528"
          ],
          "display_name": false
        },
        {
          "uuid": "e794ed37-7871-b373-40f5-bd49acdd914a",
          "name": ".ALPHA.-TOCOPHERYL .BETA.-D-GLUCOPYRANOSIDE, D-",
          "stdName": ".ALPHA.-TOCOPHERYL .BETA.-D-GLUCOPYRANOSIDE, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01f3dd44-01ba-88cb-84e2-ac09c80f3528"
          ],
          "display_name": false
        },
        {
          "uuid": "7e4be0af-43ba-735b-fb56-3227f13e57dc",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, (2R)-3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-YL",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, (2R)-3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-((4R,8R)-4,8,12-TRIMETHYLTRIDECYL)-2H-1-BENZOPYRAN-6-YL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01f3dd44-01ba-88cb-84e2-ac09c80f3528"
          ],
          "display_name": false
        },
        {
          "uuid": "24740562-4bfc-1aa5-db63-564115036c75",
          "name": "D-.ALPHA.-TOCOPHERYL .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "D-.ALPHA.-TOCOPHERYL .BETA.-D-GLUCOPYRANOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01f3dd44-01ba-88cb-84e2-ac09c80f3528"
          ],
          "display_name": false
        },
        {
          "uuid": "5c0fa0e8-8c59-293e-fd8e-1c69b3dbf382",
          "name": "TOCOPHERYL GLUCOSIDE",
          "stdName": "TOCOPHERYL GLUCOSIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "332209c8-0547-e511-af2a-c4d5ebef508f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "adfbd17a-741d-419f-b59b-cc82d9da107e",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "01f3dd44-01ba-88cb-84e2-ac09c80f3528",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "332209c8-0547-e511-af2a-c4d5ebef508f",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e91eb6bd-795d-d1d2-d408-5f6f46074552",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "f4108d22-d73e-38f7-fd94-a3354fea46ab",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "211fe708-b9b5-ec6f-1a58-4b49a98320da",
          "id": "211fe708-b9b5-ec6f-1a58-4b49a98320da",
          "molfile": "\n  Marvin  01132101522D          \n\n 42 44  0  0  1  0            999 V2000\n   12.1496   -2.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1496   -3.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7881   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5045   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7881   -4.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4266   -3.3046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8596   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5045   -4.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1496   -5.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4266   -5.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0715   -3.8206    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.8596   -5.3878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1496   -6.4327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0715   -4.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7165   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7165   -4.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2146   -4.8718    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.3550   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2146   -3.8335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5761   -5.3878    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.9935   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5761   -3.3175    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.5761   -6.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9312   -4.8718    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.6385   -3.8206    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.5761   -2.2791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9312   -3.8335    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2862   -5.3878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2770   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6385   -4.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9312   -1.7567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2862   -3.3175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9219   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5669   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2119   -3.8206    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   19.8504   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2119   -4.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4954   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1403   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7853   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4238   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7853   -4.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 11 16  1  1  0  0  0\n 17 12  1  1  0  0  0\n 15 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 20 23  1  6  0  0  0\n 20 24  1  0  0  0  0\n 21 25  1  0  0  0  0\n 22 26  1  1  0  0  0\n 22 27  1  0  0  0  0\n 24 27  1  0  0  0  0\n 24 28  1  1  0  0  0\n 25 29  1  0  0  0  0\n 25 30  1  1  0  0  0\n 26 31  1  0  0  0  0\n 27 32  1  6  0  0  0\n 29 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  0  0  0  0\n 35 37  1  1  0  0  0\n 36 38  1  0  0  0  0\n 38 39  1  0  0  0  0\n 39 40  1  0  0  0  0\n 40 41  1  0  0  0  0\n 40 42  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O",
          "formula": "C35H60O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fa2a8004-398d-4226-9a38-6e143c9f1296"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "592.848",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "adb363b9-f919-43fe-9c7e-fd5b55ff737d",
      "version": "10",
      "structure": {
        "id": "87c40545-cd36-b60d-fe29-04fe4e56441c",
        "molfile": ".beta.-D-Glucopyranoside, (2R)-3,4-dihydro-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8...\n  Marvin  01132107032D          \n\n 42 44  0  0  1  0            999 V2000\n   12.1496   -2.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1496   -3.3046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7881   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5045   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7881   -4.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4266   -3.3046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8596   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5045   -4.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1496   -5.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4266   -5.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0715   -3.8206    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.8596   -5.3878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1496   -6.4327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0715   -4.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7165   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7165   -4.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2146   -4.8718    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.3550   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2146   -3.8335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5761   -5.3878    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.9935   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5761   -3.3175    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.5761   -6.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9312   -4.8718    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.6385   -3.8206    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.5761   -2.2791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9312   -3.8335    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2862   -5.3878    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2770   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6385   -4.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9312   -1.7567    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2862   -3.3175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9219   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5669   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2119   -3.8206    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   19.8504   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2119   -4.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4954   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1403   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7853   -3.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4238   -3.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7853   -4.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 11 16  1  1  0  0  0\n 15 18  1  0  0  0  0\n 17 12  1  1  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 20 23  1  6  0  0  0\n 20 24  1  0  0  0  0\n 21 25  1  0  0  0  0\n 22 26  1  1  0  0  0\n 22 27  1  0  0  0  0\n 24 27  1  0  0  0  0\n 24 28  1  1  0  0  0\n 25 29  1  0  0  0  0\n 25 30  1  1  0  0  0\n 26 31  1  0  0  0  0\n 27 32  1  6  0  0  0\n 29 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  0  0  0  0\n 35 37  1  1  0  0  0\n 36 38  1  0  0  0  0\n 38 39  1  0  0  0  0\n 39 40  1  0  0  0  0\n 40 41  1  0  0  0  0\n 40 42  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(c(C)c(C)c2O1)O[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O",
        "formula": "C35H60O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "592.848",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "332209c8-0547-e511-af2a-c4d5ebef508f",
          "01f3dd44-01ba-88cb-84e2-ac09c80f3528"
        ],
        "stereo_centers": 8
      },
      "unii": "9CKD1JE38R"
    }
  ]
}