{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "16f6f506-a0de-47a8-bd22-0faedce33661",
          "code": "70321-86-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=70321-86-7",
          "code_system": "CAS",
          "references": [
            "e2f9a6e3-75c4-4f3e-978f-ae7e15fee9d5",
            "af5c502a-1810-499a-840b-036cb4487c9e"
          ]
        },
        {
          "uuid": "566d6bb8-4652-4947-b964-7926b4d7561e",
          "code": "FCN NO. 184",
          "comments": "FCN|STABILIZER|RUBBER ARTICLES",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=184",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "e2f9a6e3-75c4-4f3e-978f-ae7e15fee9d5"
          ]
        },
        {
          "uuid": "aed81722-7fe9-4b65-b03e-f6cad1bf5802",
          "code": "274-570-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.067.769",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e2f9a6e3-75c4-4f3e-978f-ae7e15fee9d5"
          ]
        },
        {
          "uuid": "8a975ef5-6fd7-44c5-a3bd-0f3d80bed46d",
          "code": "112412",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/112412",
          "code_system": "PUBCHEM",
          "references": [
            "e2f9a6e3-75c4-4f3e-978f-ae7e15fee9d5"
          ]
        },
        {
          "uuid": "dffe2b69-94d8-4b7f-5bf2-8a807208ad1d",
          "code": "DTXSID2028985",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2028985",
          "code_system": "EPA CompTox",
          "references": [
            "23a4ac65-9458-3c88-e528-16ef09b4fd94"
          ]
        },
        {
          "uuid": "201ad06e-3cb2-45d6-9177-37d838fb7a76",
          "code": "9B1ZX3NU45",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e33832b8-45e7-4a69-9719-94dfef61832d",
          "name": "2-(2'-HYDROXY-3',5'-BIS(.ALPHA.,.ALPHA.-DIMETHYLBENZYL)PHENYL)BENZOTRIAZOLE",
          "stdName": "2-(2'-HYDROXY-3',5'-BIS(.ALPHA.,.ALPHA.-DIMETHYLBENZYL)PHENYL)BENZOTRIAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c708a198-0fac-423f-b9bc-b946c98c0433",
            "c9839dde-0723-40bc-bee0-8e9d366132fe"
          ],
          "display_name": false
        },
        {
          "uuid": "924eec91-8858-41a7-9550-1aa95a81adf3",
          "name": "2-(2-HYDROXY-3,5-DI(1,1-DIMETHYLBENZYL)PHENYL)-2H-BENZOTRIAZOLE",
          "stdName": "2-(2-HYDROXY-3,5-DI(1,1-DIMETHYLBENZYL)PHENYL)-2H-BENZOTRIAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c708a198-0fac-423f-b9bc-b946c98c0433",
            "c9839dde-0723-40bc-bee0-8e9d366132fe"
          ],
          "display_name": false
        },
        {
          "uuid": "daf3b78b-6944-4047-a190-cb5ef575e5a4",
          "name": "2-(2-HYDROXY-3,5-DI-.ALPHA.-CUMYLPHENYL)-2H-BENZOTRIAZOLE",
          "stdName": "2-(2-HYDROXY-3,5-DI-.ALPHA.-CUMYLPHENYL)-2H-BENZOTRIAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c708a198-0fac-423f-b9bc-b946c98c0433",
            "c9839dde-0723-40bc-bee0-8e9d366132fe"
          ],
          "display_name": false
        },
        {
          "uuid": "5a1dd342-9e7b-4619-9896-da47dbd3c255",
          "name": "2-(2H-BENZOTRIAZOL-2-YL)-4,6-BIS(.ALPHA.,.ALPHA.-DIMETHYLBENZYL)PHENOL",
          "stdName": "2-(2H-BENZOTRIAZOL-2-YL)-4,6-BIS(.ALPHA.,.ALPHA.-DIMETHYLBENZYL)PHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c708a198-0fac-423f-b9bc-b946c98c0433",
            "c9839dde-0723-40bc-bee0-8e9d366132fe"
          ],
          "display_name": false
        },
        {
          "uuid": "05698f2c-0f8e-4f56-8e3c-8ef556eca86b",
          "name": "2-(2H-BENZOTRIAZOL-2-YL)-4,6-BIS(1-METHYL-1-PHENYLETHYL)PHENOL",
          "stdName": "2-(2H-BENZOTRIAZOL-2-YL)-4,6-BIS(1-METHYL-1-PHENYLETHYL)PHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb147603-a63f-4e9a-a48f-c239fba50826"
          ],
          "display_name": true
        },
        {
          "uuid": "721c83f3-5707-4d7e-bfe5-d51f862e1797",
          "name": "2-(2H-BENZOTRIAZOL-2-YL)-4,6-BIS(1-METHYL-L-PHENYLETHYL)PHENOL",
          "stdName": "2-(2H-BENZOTRIAZOL-2-YL)-4,6-BIS(1-METHYL-L-PHENYLETHYL)PHENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c708a198-0fac-423f-b9bc-b946c98c0433",
            "c9839dde-0723-40bc-bee0-8e9d366132fe"
          ],
          "display_name": false
        },
        {
          "uuid": "51f7e7ea-0d02-4b6a-a745-7e644bd4e923",
          "name": "2-(3',5'-BIS(.ALPHA.,.ALPHA.-DIMETHYLBENZYL)-2'-HYDROXYPHENYL)BENZOTRIAZOLE",
          "stdName": "2-(3',5'-BIS(.ALPHA.,.ALPHA.-DIMETHYLBENZYL)-2'-HYDROXYPHENYL)BENZOTRIAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c708a198-0fac-423f-b9bc-b946c98c0433",
            "c9839dde-0723-40bc-bee0-8e9d366132fe"
          ],
          "display_name": false
        },
        {
          "uuid": "7cabb7e0-da97-453b-85c8-1b3d41a3ed25",
          "name": "BENZOTRIAZOLE BT",
          "stdName": "BENZOTRIAZOLE BT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c708a198-0fac-423f-b9bc-b946c98c0433",
            "c9839dde-0723-40bc-bee0-8e9d366132fe"
          ],
          "display_name": false
        },
        {
          "uuid": "9ad0ee6b-90e6-4b44-a14e-80332dd4a61e",
          "name": "PHENOL, 2-(2H-BENZOTRIAZOL-2-YL)-4,6-BIS(1-METHYL-1-PHENYLETHYL)-",
          "stdName": "PHENOL, 2-(2H-BENZOTRIAZOL-2-YL)-4,6-BIS(1-METHYL-1-PHENYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c708a198-0fac-423f-b9bc-b946c98c0433",
            "c9839dde-0723-40bc-bee0-8e9d366132fe"
          ],
          "display_name": false
        },
        {
          "uuid": "6f352faa-3027-48a0-ac2e-ed750d8adb9b",
          "name": "TINUVIN 234",
          "stdName": "TINUVIN 234",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c708a198-0fac-423f-b9bc-b946c98c0433",
            "c9839dde-0723-40bc-bee0-8e9d366132fe"
          ],
          "display_name": false
        },
        {
          "uuid": "d6121a9f-7b5c-428e-b121-ebaea1206301",
          "name": "UV 234 (ANTIOXIDANT)",
          "stdName": "UV 234 (ANTIOXIDANT)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c708a198-0fac-423f-b9bc-b946c98c0433",
            "c9839dde-0723-40bc-bee0-8e9d366132fe"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cb147603-a63f-4e9a-a48f-c239fba50826",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c9839dde-0723-40bc-bee0-8e9d366132fe",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c708a198-0fac-423f-b9bc-b946c98c0433",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2f9a6e3-75c4-4f3e-978f-ae7e15fee9d5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391025000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d4aff17-736d-4d58-9ea0-5221b37a0c1f",
          "citation": "SRS import [9B1ZX3NU45]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9B1ZX3NU45",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391025000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "478fb45a-296a-4f75-9f9f-c9e8f1071332",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23a4ac65-9458-3c88-e528-16ef09b4fd94",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=70321-86-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "af5c502a-1810-499a-840b-036cb4487c9e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "20b9b3b2-4e2f-479c-a8f9-c57eaea440ad",
          "id": "20b9b3b2-4e2f-479c-a8f9-c57eaea440ad",
          "molfile": "\n  Marvin  01132101512D          \n\n 34 38  0  0  0  0            999 V2000\n    4.5357   -5.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9490   -6.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2324   -6.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3576   -6.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9450   -7.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3527   -8.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1822   -8.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5946   -7.6221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1823   -6.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9493   -5.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6582   -6.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3782   -5.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3782   -4.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0934   -4.3678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6542   -4.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9493   -4.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6542   -3.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4836   -3.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6542   -2.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8294   -3.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4140   -2.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5904   -2.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1819   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5875   -3.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4209   -3.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0934   -6.0192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1786   -6.8426    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9914   -7.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4062   -7.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2357   -7.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6409   -7.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2262   -6.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4014   -6.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8539   -5.6844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n 10  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 16 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 26  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 25 20  2  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 26 34  1  0  0  0  0\n 28 27  2  0  0  0  0\n 28 29  1  0  0  0  0\n 33 28  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  2  0  0  0  0\n 32 33  1  0  0  0  0\n 34 33  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(c1ccccc1)c2cc(c(c(c2)-n3nc4ccccc4n3)O)C(C)(C)c5ccccc5",
          "formula": "C30H29N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "25d5f9c9-c0b5-4467-8648-c2e24088c8ce"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "447.5719",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5a05b637-130e-49f3-8e54-8c3efd3e1669",
      "version": "4",
      "structure": {
        "id": "5f934c5a-381b-4627-8686-a220f0d307d4",
        "molfile": "\n  Marvin  01132104572D          \n\n 34 38  0  0  0  0            999 V2000\n    8.0934   -4.3678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3782   -4.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6542   -4.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9493   -4.7788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9493   -5.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6582   -6.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3782   -5.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0934   -6.0192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8539   -5.6844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4014   -6.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9914   -7.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4062   -7.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2357   -7.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6409   -7.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2262   -6.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1786   -6.8426    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9490   -6.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3576   -6.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9450   -7.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3527   -8.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1822   -8.3267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5946   -7.6221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1823   -6.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5357   -5.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2324   -6.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6542   -3.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8294   -3.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4140   -2.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5904   -2.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1819   -3.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5875   -3.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4209   -3.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4836   -3.2093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6542   -2.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 10  1  0  0  0  0\n 11 16  2  0  0  0  0\n 16  8  1  0  0  0  0\n  5 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 18  2  0  0  0  0\n 17 24  1  0  0  0  0\n 17 25  1  0  0  0  0\n  3 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  2  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 31 32  1  0  0  0  0\n 32 27  2  0  0  0  0\n 26 33  1  0  0  0  0\n 26 34  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(c1ccccc1)c2cc(c(c(c2)-n3nc4ccccc4n3)O)C(C)(C)c5ccccc5",
        "formula": "C30H29N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "447.5719",
        "optical_activity": "NONE",
        "references": [
          "7d4aff17-736d-4d58-9ea0-5221b37a0c1f",
          "478fb45a-296a-4f75-9f9f-c9e8f1071332"
        ],
        "stereo_centers": 0
      },
      "unii": "9B1ZX3NU45"
    }
  ]
}