{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d87b2b54-8a29-4dcf-b54e-8b21e9ffe88a",
          "code": "585-99-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=585-99-9",
          "code_system": "CAS",
          "references": [
            "12a17b56-7f12-49b0-96a0-f4798321a1ee",
            "f0f2414d-4824-4601-ade7-e56609f00850"
          ]
        },
        {
          "uuid": "c69fe763-b80b-4c54-9630-676bdc924436",
          "code": "MELIBIOSE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Melibiose",
          "code_system": "WIKIPEDIA",
          "references": [
            "12a17b56-7f12-49b0-96a0-f4798321a1ee"
          ]
        },
        {
          "uuid": "b72197ea-6aeb-4a84-8c1f-7bece6f728d8",
          "code": "209-568-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.700",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "12a17b56-7f12-49b0-96a0-f4798321a1ee"
          ]
        },
        {
          "uuid": "18c5c2ac-c295-4df8-919b-959101cc77c0",
          "code": "m7158",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7158?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "12a17b56-7f12-49b0-96a0-f4798321a1ee"
          ]
        },
        {
          "uuid": "76ba2c10-0923-406b-8019-a5cc45975174",
          "code": "5460027",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5460027",
          "code_system": "PUBCHEM",
          "references": [
            "12a17b56-7f12-49b0-96a0-f4798321a1ee"
          ]
        },
        {
          "uuid": "fd9eb566-e6bb-49fd-9ca5-15d4792162e0",
          "code": "9B1VBE526I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "128e24f4-8fa5-1939-3d1d-3ef6e87b88ab",
          "code": "28053",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28053",
          "code_system": "CHEBI",
          "references": [
            "9372aa57-d068-dab3-3187-acf5d9b82333"
          ]
        },
        {
          "uuid": "59f420b9-847c-aa38-4624-ee8beee30eb7",
          "code": "2028",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2028",
          "code_system": "NSC",
          "references": [
            "e2a70142-1af8-2277-458f-88b6467144a3"
          ]
        },
        {
          "uuid": "adbc8637-3b72-5368-89f8-99d10c24d1c5",
          "code": "DTXSID101014653",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID101014653",
          "code_system": "EPA CompTox",
          "references": [
            "9372aa57-d068-dab3-3187-acf5d9b82333"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "540aee39-3b4a-4358-9bbf-a58bfbf5ea45",
          "name": "(2R,3S,4R,5R)-2,3,4,5-TETRAHYDROXY-6-(((2S,3R,4S,5R,6R)-3,4,5-TRIHYDROXY-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-2-YL)OXY)HEXANAL",
          "stdName": "(2R,3S,4R,5R)-2,3,4,5-TETRAHYDROXY-6-(((2S,3R,4S,5R,6R)-3,4,5-TRIHYDROXY-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-2-YL)OXY)HEXANAL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db2c47ea-6f12-4c2b-b09c-7af8b735d82a",
            "0ff98a3a-49e5-4663-b1fc-94476288c4d9"
          ],
          "display_name": false
        },
        {
          "uuid": "3660614f-e798-42dc-b9e9-762a12774738",
          "name": "(3R,4S,5S,6R)-6-((((2S,3R,4S,5R,6R)-3,4,5-TRIHYDROXY-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-2-YL)OXY)METHYL)TETRAHYDRO-2H-PYRAN-2,3,4,5-TETRAOL",
          "stdName": "(3R,4S,5S,6R)-6-((((2S,3R,4S,5R,6R)-3,4,5-TRIHYDROXY-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-2-YL)OXY)METHYL)TETRAHYDRO-2H-PYRAN-2,3,4,5-TETRAOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db2c47ea-6f12-4c2b-b09c-7af8b735d82a",
            "0ff98a3a-49e5-4663-b1fc-94476288c4d9"
          ],
          "display_name": false
        },
        {
          "uuid": "c7ecfd59-134a-4adc-9333-7ef5cc2fb0ea",
          "name": "D-GLUCOSE, 6-O-.ALPHA.-D-GALACTOPYRANOSYL-",
          "stdName": "D-GLUCOSE, 6-O-.ALPHA.-D-GALACTOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12f8f89-0969-45b2-86e2-71569eb73bee",
            "0ff98a3a-49e5-4663-b1fc-94476288c4d9"
          ],
          "display_name": false
        },
        {
          "uuid": "08e444a5-a9f8-4e0c-817b-52bf0be7e171",
          "name": "MELIBIOSE",
          "stdName": "MELIBIOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22ab6cb5-d240-454a-a64d-30d57e3b85f3",
            "183db050-4815-453a-beeb-325a842cfb7b",
            "58914d2c-2147-46ff-a5e0-b7bf475372ae",
            "2c12ac49-dbeb-4927-8187-79545ef1110b",
            "54f4e82e-231c-4658-85aa-92f9e15d9e10",
            "0ff98a3a-49e5-4663-b1fc-94476288c4d9"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "371bc323-ec8a-44b0-afeb-86d888754f03",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "898d2066-979a-4215-948b-87be94ce1227",
          "name": "MELIBIOSE [MI]",
          "stdName": "MELIBIOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58914d2c-2147-46ff-a5e0-b7bf475372ae",
            "0ff98a3a-49e5-4663-b1fc-94476288c4d9"
          ],
          "display_name": false
        },
        {
          "uuid": "f2e6ae92-5ebf-4d42-ab9c-6e588849a8fe",
          "name": "NSC-2028",
          "stdName": "NSC-2028",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12f8f89-0969-45b2-86e2-71569eb73bee",
            "0ff98a3a-49e5-4663-b1fc-94476288c4d9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "183db050-4815-453a-beeb-325a842cfb7b",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "58914d2c-2147-46ff-a5e0-b7bf475372ae",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ff98a3a-49e5-4663-b1fc-94476288c4d9",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c12f8f89-0969-45b2-86e2-71569eb73bee",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c12ac49-dbeb-4927-8187-79545ef1110b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db2c47ea-6f12-4c2b-b09c-7af8b735d82a",
          "citation": "CHEMBIODRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12a17b56-7f12-49b0-96a0-f4798321a1ee",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391028000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c248845-46b8-4c4f-aaad-14cf8b27d1a1",
          "citation": "SRS import [9B1VBE526I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9B1VBE526I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391028000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b376fb69-193c-4ff9-a510-859c5c03c112",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22ab6cb5-d240-454a-a64d-30d57e3b85f3",
          "citation": "MELIBIOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "54f4e82e-231c-4658-85aa-92f9e15d9e10",
          "citation": "MELIBIOSE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f0f2414d-4824-4601-ade7-e56609f00850",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9372aa57-d068-dab3-3187-acf5d9b82333",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e2a70142-1af8-2277-458f-88b6467144a3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a839a0ad-cd29-487d-86bf-209715dbd91f",
          "id": "a839a0ad-cd29-487d-86bf-209715dbd91f",
          "molfile": "\n  Marvin  01132108442D          \n\n 23 23  0  0  1  0            999 V2000\n    6.5626  -12.5634    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.1502  -13.2779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1502  -11.8490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3252  -11.8490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9126  -11.1345    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.3252  -10.4200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9126   -9.7055    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.3252   -8.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9126   -8.2765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0876   -9.7055    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.6752   -8.9910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6752  -10.4200    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.8502  -10.4200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0876  -11.1345    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.6752  -11.8490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3876  -12.5634    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.8002  -11.8490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8002  -13.2779    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.3876  -13.9924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6252  -13.2779    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.0376  -12.5634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0376  -13.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8626  -13.9923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 16  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  6  0  0  0\n  5  6  1  0  0  0  0\n 14  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n 10  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  6  0  0  0\n 16 17  1  1  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO[C@@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O)O)O",
          "formula": "C12H22O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bf57fe6e-d4b9-44f3-a615-192f17095581"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "342.297",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "17d3adaf-0747-4f90-8975-9ef9eed984c2",
      "version": "6",
      "structure": {
        "id": "4f5bdcf0-312b-4a48-aca5-bd17a60af373",
        "molfile": "\n  Marvin  01132104082D          \n\n 23 23  0  0  1  0            999 V2000\n    4.9126  -11.1345    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.9126   -9.7055    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0876   -9.7055    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.6752  -10.4200    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.0876  -11.1345    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5626  -12.5634    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3876  -12.5634    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.8002  -13.2779    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.6252  -13.2779    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3252  -10.4200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3252   -8.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9126   -8.2765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6752   -8.9910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8502  -10.4200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6752  -11.8490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3252  -11.8490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1502  -11.8490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8002  -11.8490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3876  -13.9924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0376  -12.5634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0376  -13.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8626  -13.9923    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1502  -13.2779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10  2  1  0  0  0  0\n  2 11  1  1  0  0  0\n 11 12  1  0  0  0  0\n  3 13  1  1  0  0  0\n  4 14  1  1  0  0  0\n  5 15  1  6  0  0  0\n  1 16  1  6  0  0  0\n  6 17  1  0  0  0  0\n 16 17  1  0  0  0  0\n  7 18  1  1  0  0  0\n  8 19  1  1  0  0  0\n  9 20  1  1  0  0  0\n 21  9  1  0  0  0  0\n 21 22  2  0  0  0  0\n  6 23  1  6  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO[C@@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O)O)O",
        "formula": "C12H22O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "342.297",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9c248845-46b8-4c4f-aaad-14cf8b27d1a1",
          "b376fb69-193c-4ff9-a510-859c5c03c112"
        ],
        "stereo_centers": 9
      },
      "unii": "9B1VBE526I"
    }
  ]
}