{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "095a667a-c1a4-49b6-9031-86a173b93e61",
          "code": "1086-80-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1086-80-2",
          "code_system": "CAS",
          "references": [
            "8fab909a-3e64-4b9f-9d3d-6de92f071244",
            "12c19ace-6690-4d4c-a7a4-3bf45ed15118"
          ]
        },
        {
          "uuid": "cf4ae9d2-8be1-4633-b3b7-e1f02b6543f2",
          "code": "m6928",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6928?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8fab909a-3e64-4b9f-9d3d-6de92f071244"
          ]
        },
        {
          "uuid": "8b4cc950-4004-48b0-bfeb-bc263bd4ab09",
          "code": "214-120-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.837",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8fab909a-3e64-4b9f-9d3d-6de92f071244"
          ]
        },
        {
          "uuid": "eb47f60e-c5e1-4bba-ad59-a56ff4835166",
          "code": "5326566",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5326566",
          "code_system": "PUBCHEM",
          "references": [
            "8fab909a-3e64-4b9f-9d3d-6de92f071244"
          ]
        },
        {
          "uuid": "1f347778-3f62-c356-303c-c32ba40949f6",
          "code": "DTXSID70148600",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70148600",
          "code_system": "EPA CompTox",
          "references": [
            "c51add46-6dd5-8e4f-18ad-4c81fcab7bbb"
          ]
        },
        {
          "uuid": "98d7887b-9422-44e3-e823-05823d07ce8f",
          "code": "DB04345",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB04345",
          "code_system": "DRUG BANK",
          "references": [
            "9b9b2a15-9d1d-c811-7601-7802ed1e110e"
          ]
        },
        {
          "uuid": "85160b3b-6e2f-4372-9a87-f5906853562c",
          "code": "99U1UDJ2HM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5e563fa3-9757-2d98-c30a-315ce5575030",
          "code": "17781",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17781",
          "code_system": "CHEBI",
          "references": [
            "9b9b2a15-9d1d-c811-7601-7802ed1e110e"
          ]
        },
        {
          "uuid": "10dc320c-8085-e119-7259-415322daf589",
          "code": "96911",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=96911",
          "code_system": "NSC",
          "references": [
            "971f16f5-c001-be48-ef44-30e6a5220bab"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4d5d78a6-0d50-4b3b-b6c5-1bbef87d104a",
          "amount": {
            "uuid": "c3d991cb-a168-4e14-8b62-5df259bc6dec",
            "type": "MOLE PERCENT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "comments": "correction factors: for the calculation of content, multiply the peak areas of the following impurity by the corresponding correction factor: impurity B = 1.4",
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "d81efe47-7dc5-3c87-64b8-28d8223c33a5"
          ],
          "related_substance": {
            "uuid": "de51cae8-2b10-412f-8c80-630f57307ed9",
            "refuuid": "abb070a4-f562-435a-b95f-913ea099be53",
            "name": "RIBOFLAVIN",
            "unii": "TLM2976OFR",
            "linking_id": "TLM2976OFR",
            "ref_pname": "RIBOFLAVIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "47c1755c-e61a-4cf2-bd46-581b914e86da",
          "name": "7,8-DIMETHYLALLOXAZINE",
          "stdName": "7,8-DIMETHYLALLOXAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f95aa9d-a6a0-454d-a3d3-ab4ac004890a",
            "f96d3399-5b27-4090-873c-617b5f35eaad"
          ],
          "display_name": false
        },
        {
          "uuid": "fceb2d77-796b-4301-9ba4-f33c05aa49c0",
          "name": "7,8-DIMETHYLBENZO(G)PTERIDINE-2,4-(1H,3H)-DIONE",
          "stdName": "7,8-DIMETHYLBENZO(G)PTERIDINE-2,4-(1H,3H)-DIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f95aa9d-a6a0-454d-a3d3-ab4ac004890a",
            "f96d3399-5b27-4090-873c-617b5f35eaad"
          ],
          "display_name": false
        },
        {
          "uuid": "a50b524e-b683-c81e-a6b7-0de8d28de0f0",
          "name": "7,8-DIMETHYLISOALLOXAZINE",
          "stdName": "7,8-DIMETHYLISOALLOXAZINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50e1e9c7-9c45-4d4c-6c1e-7639a9fbb121"
          ],
          "display_name": false
        },
        {
          "uuid": "fcb41b55-b884-6b80-ddd4-b86f9b3f20e9",
          "name": "ALLOXAZINE, 7,8-DIMETHYL-",
          "stdName": "ALLOXAZINE, 7,8-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50e1e9c7-9c45-4d4c-6c1e-7639a9fbb121"
          ],
          "display_name": false
        },
        {
          "uuid": "613716c6-9e74-cc27-de79-ba6efd60048a",
          "name": "BENZO(G)PTERIDINE-2,4(1H,3H)-DIONE, 7,8-DIMETHYL-",
          "stdName": "BENZO(G)PTERIDINE-2,4(1H,3H)-DIONE, 7,8-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50e1e9c7-9c45-4d4c-6c1e-7639a9fbb121"
          ],
          "display_name": false
        },
        {
          "uuid": "45630580-69e6-4380-abc5-689e75b012da",
          "name": "LUMICHROME",
          "stdName": "LUMICHROME",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f95aa9d-a6a0-454d-a3d3-ab4ac004890a",
            "c45dc173-9507-4b91-ba44-0bb701516f62",
            "de5531f0-f29b-4c56-b1fb-bd1c3ec88aa4",
            "cbe91976-a32b-4965-9eff-8b3e44e4eea7"
          ],
          "display_name": true
        },
        {
          "uuid": "cb39e70c-1c9a-4f7a-8ddc-17ebea0846eb",
          "name": "LUMICHROME [MI]",
          "stdName": "LUMICHROME [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5f95aa9d-a6a0-454d-a3d3-ab4ac004890a",
            "cbe91976-a32b-4965-9eff-8b3e44e4eea7"
          ],
          "display_name": false
        },
        {
          "uuid": "facd8b77-b83b-4c6d-9ed1-f9aec7af32a8",
          "name": "NSC-96911",
          "stdName": "NSC-96911",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0735049e-bdff-44f2-a5d7-903b39cd14fc",
            "5f95aa9d-a6a0-454d-a3d3-ab4ac004890a"
          ],
          "display_name": false
        },
        {
          "uuid": "d032fd76-7d3f-62ef-d3f2-27cee5b52358",
          "name": "RIBOFLAVIN IMPURITY B [EP IMPURITY]",
          "stdName": "RIBOFLAVIN IMPURITY B [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d81efe47-7dc5-3c87-64b8-28d8223c33a5"
          ],
          "display_name": false
        },
        {
          "uuid": "c6a6c735-88e6-11d5-d292-f960ecb6ccfe",
          "name": "RIBOFLAVIN LUMICHROME",
          "stdName": "RIBOFLAVIN LUMICHROME",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50e1e9c7-9c45-4d4c-6c1e-7639a9fbb121"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c45dc173-9507-4b91-ba44-0bb701516f62",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cbe91976-a32b-4965-9eff-8b3e44e4eea7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f95aa9d-a6a0-454d-a3d3-ab4ac004890a",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f96d3399-5b27-4090-873c-617b5f35eaad",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0735049e-bdff-44f2-a5d7-903b39cd14fc",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8fab909a-3e64-4b9f-9d3d-6de92f071244",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391022000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46dec8c2-b099-429f-9b40-be351960a228",
          "citation": "SRS import [99U1UDJ2HM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=99U1UDJ2HM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391022000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa9ab554-ab59-4204-9b33-3e90075df23d",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de5531f0-f29b-4c56-b1fb-bd1c3ec88aa4",
          "citation": "LUMICHROME [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c51add46-6dd5-8e4f-18ad-4c81fcab7bbb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1086-80-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "50e1e9c7-9c45-4d4c-6c1e-7639a9fbb121",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d81efe47-7dc5-3c87-64b8-28d8223c33a5",
          "citation": "European Pharmacopoeia Online 9.8, Riboflavin Monograph",
          "url": "http://online6.edqm.eu/ep908/",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "12c19ace-6690-4d4c-a7a4-3bf45ed15118",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9b9b2a15-9d1d-c811-7601-7802ed1e110e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "971f16f5-c001-be48-ef44-30e6a5220bab",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "13ccd936-3d5e-4a43-862c-5c76b7e258a9",
          "id": "13ccd936-3d5e-4a43-862c-5c76b7e258a9",
          "molfile": "\n  Marvin  01132101142D          \n\n 18 20  0  0  0  0            999 V2000\n    9.5690   -6.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8487   -5.7797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1377   -6.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4252   -5.7848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7054   -6.1899    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9965   -5.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2730   -6.1803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5644   -5.7611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8403   -6.1659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5644   -4.9320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2833   -4.5323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2833   -3.7069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9965   -4.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7093   -4.5416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4252   -4.9560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1352   -4.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8487   -4.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5620   -4.5435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2 17  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n 15  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 13  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc2c(cc1C)nc3c(c(=O)[nH]c(=O)[nH]3)n2",
          "formula": "C12H10N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a5e23aa5-ce06-4f8a-865f-2ffca6c72188"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "242.2339",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2db17a3d-5b5b-48c5-a5bf-82f49821fd29",
      "version": "9",
      "structure": {
        "id": "87064ad0-737b-4280-8b3f-306cb02f1079",
        "molfile": "\n  Marvin  01132107002D          \n\n 18 20  0  0  0  0            999 V2000\n    8.1370   -6.1938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8479   -5.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8479   -4.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1345   -4.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4245   -4.9555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4245   -5.7843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7048   -6.1893    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9960   -5.7749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2725   -6.1797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5640   -5.7606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8400   -6.1653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5640   -4.9316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2828   -4.5319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9960   -4.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7087   -4.5412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2828   -3.7066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5611   -4.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5681   -6.1864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  8  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15  5  1  0  0  0  0\n 13 16  2  0  0  0  0\n  3 17  1  0  0  0  0\n  2 18  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc2c(cc1C)nc3c(c(=O)[nH]c(=O)[nH]3)n2",
        "formula": "C12H10N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "242.2339",
        "optical_activity": "NONE",
        "references": [
          "fa9ab554-ab59-4204-9b33-3e90075df23d",
          "46dec8c2-b099-429f-9b40-be351960a228"
        ],
        "stereo_centers": 0
      },
      "unii": "99U1UDJ2HM"
    }
  ]
}