{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "92e11f6b-d568-4469-aba5-9cc59614a596",
          "code": "67747-09-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=67747-09-5",
          "code_system": "CAS",
          "references": [
            "57cf741e-d744-403e-adf9-7b600fc27853",
            "e1a72e4f-fc3f-41cb-bcf7-7a54ea355b4f"
          ]
        },
        {
          "uuid": "08f7c3c1-3465-4e28-81a4-ae900aea6e8e",
          "code": "C045362",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67045362",
          "code_system": "MESH",
          "references": [
            "57cf741e-d744-403e-adf9-7b600fc27853"
          ]
        },
        {
          "uuid": "9d67d087-a9b7-41fe-8d69-6df3ee5e2baf",
          "code": "128851",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3561",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "57cf741e-d744-403e-adf9-7b600fc27853"
          ]
        },
        {
          "uuid": "e3331bbc-760c-47d4-a916-126356e7d56c",
          "code": "266-994-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.060.885",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "57cf741e-d744-403e-adf9-7b600fc27853"
          ]
        },
        {
          "uuid": "9fd183a8-67e6-4432-a5f2-37214d066c68",
          "code": "m9148",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9148?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "57cf741e-d744-403e-adf9-7b600fc27853"
          ]
        },
        {
          "uuid": "c817ec72-02e8-4d2b-9c83-33541e39ce78",
          "code": "73665",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73665",
          "code_system": "PUBCHEM",
          "references": [
            "57cf741e-d744-403e-adf9-7b600fc27853"
          ]
        },
        {
          "uuid": "f55b536c-fc82-e391-0d42-7cf32e829b72",
          "code": "DTXSID4024270",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4024270",
          "code_system": "EPA CompTox",
          "references": [
            "d4e98c5d-ae18-b77d-46a2-d28e97df804f"
          ]
        },
        {
          "uuid": "d7ec6b7d-2dfd-43aa-8766-c393bb59005c",
          "code": "99SFL01YCL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8b92f935-be7a-ba0b-36af-5dced5580000",
          "code": "Prochloraz",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Prochloraz",
          "code_system": "WIKIPEDIA",
          "references": [
            "b1a37997-8541-fc7a-e64e-ec8bc401ab13"
          ]
        },
        {
          "uuid": "dd466452-5352-5da7-616b-56e08cabebc4",
          "code": "prochloraz",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/prochloraz.html",
          "code_system": "ALANWOOD",
          "references": [
            "3547d91e-833b-d464-7a8e-03d4d6c65eec"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cb48aeea-0939-4f15-8fcf-0ac6e7cf4c12",
          "name": "BTS-40542",
          "stdName": "BTS-40542",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4321471d-ed46-490c-a252-fa3e1d33ad1c",
            "3f4824d2-ef37-4aa6-a616-20d85bb4ecb4"
          ],
          "display_name": false
        },
        {
          "uuid": "c9288f73-2291-499a-88ac-ff67731e828d",
          "name": "N-PROPYL-N-(2-(2,4,6-TRICHLOROPHENOXY)ETHYL)-1H-IMIDAZOLE-1-CARBOXAMIDE",
          "stdName": "N-PROPYL-N-(2-(2,4,6-TRICHLOROPHENOXY)ETHYL)-1H-IMIDAZOLE-1-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41b25430-2f09-415c-9c15-5e054892fa91",
            "7f88297d-f129-4934-9875-8ad837a23319"
          ],
          "display_name": false
        },
        {
          "uuid": "ed65893d-bd60-42c1-8667-f5e27a4437ca",
          "name": "N-PROPYL-N-(2-(2,4,6-TRICHLOROPHENOXY)ETHYL)IMIDAZOLE-1-CARBOXAMIDE",
          "stdName": "N-PROPYL-N-(2-(2,4,6-TRICHLOROPHENOXY)ETHYL)IMIDAZOLE-1-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41b25430-2f09-415c-9c15-5e054892fa91",
            "799acef6-ea26-425f-8ef3-d7baaf38d8e2"
          ],
          "display_name": false
        },
        {
          "uuid": "f8d0a3c4-a511-4730-b01d-fc2eca7b5692",
          "name": "PROCHLORAZ",
          "stdName": "PROCHLORAZ",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbb3bc9f-bcfe-48fb-92d1-e8198940e62d",
            "4b6057a6-404f-48d8-9b9b-c90ed772551a",
            "f6c19814-28bc-4305-baea-19b13babb9ea",
            "4861a4bc-9aab-48b7-ae1d-1c732eacabc0",
            "e6cee95f-e428-4beb-a9a8-a8fc6539a633",
            "3f4824d2-ef37-4aa6-a616-20d85bb4ecb4"
          ],
          "display_name": true
        },
        {
          "uuid": "5fbac1cf-520d-4afc-9196-7479264e5a36",
          "name": "PROCHLORAZ [ISO]",
          "stdName": "PROCHLORAZ [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbb3bc9f-bcfe-48fb-92d1-e8198940e62d",
            "3f4824d2-ef37-4aa6-a616-20d85bb4ecb4"
          ],
          "display_name": false
        },
        {
          "uuid": "96e2a620-1c47-449e-a066-7311564e80f3",
          "name": "PROCHLORAZ [MI]",
          "stdName": "PROCHLORAZ [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6cee95f-e428-4beb-a9a8-a8fc6539a633",
            "3f4824d2-ef37-4aa6-a616-20d85bb4ecb4"
          ],
          "display_name": false
        },
        {
          "uuid": "0a953bf8-aa1d-4d1c-aed7-e70735881395",
          "name": "SPORTAK",
          "stdName": "SPORTAK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4321471d-ed46-490c-a252-fa3e1d33ad1c",
            "3f4824d2-ef37-4aa6-a616-20d85bb4ecb4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "41b25430-2f09-415c-9c15-5e054892fa91",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "799acef6-ea26-425f-8ef3-d7baaf38d8e2",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f88297d-f129-4934-9875-8ad837a23319",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4861a4bc-9aab-48b7-ae1d-1c732eacabc0",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6cee95f-e428-4beb-a9a8-a8fc6539a633",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f4824d2-ef37-4aa6-a616-20d85bb4ecb4",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4321471d-ed46-490c-a252-fa3e1d33ad1c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbb3bc9f-bcfe-48fb-92d1-e8198940e62d",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57cf741e-d744-403e-adf9-7b600fc27853",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6e239a7-6994-4152-afcb-c634182c2e0b",
          "citation": "SRS import [99SFL01YCL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=99SFL01YCL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390979000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc409d73-ac2c-436f-a611-f5c4ef946588",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b6057a6-404f-48d8-9b9b-c90ed772551a",
          "citation": "PROCHLORAZ [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f6c19814-28bc-4305-baea-19b13babb9ea",
          "citation": "PROCHLORAZ [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d4e98c5d-ae18-b77d-46a2-d28e97df804f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=67747-09-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b1a37997-8541-fc7a-e64e-ec8bc401ab13",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "3547d91e-833b-d464-7a8e-03d4d6c65eec",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "e1a72e4f-fc3f-41cb-bcf7-7a54ea355b4f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "588e8bbf-3a14-4601-8b50-2cdbc96e2d37",
          "id": "588e8bbf-3a14-4601-8b50-2cdbc96e2d37",
          "molfile": "\n  Marvin  01132104362D          \n\n 23 24  0  0  0  0            999 V2000\n    6.8401   -3.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2533   -3.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0788   -3.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4872   -4.5670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0763   -5.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2494   -5.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8413   -5.9939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0193   -5.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6079   -5.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0321   -4.5617    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7831   -5.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3717   -5.9919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5449   -5.9919    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7791   -6.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6073   -6.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0264   -7.4283    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.3187   -4.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7297   -3.8511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7307   -5.2814    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5594   -5.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8141   -6.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1481   -6.5457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4801   -6.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 17  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 15  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 23  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\nM  END",
          "smiles": "CCCN(CCOc1c(cc(cc1Cl)Cl)Cl)C(=O)n2ccnc2",
          "formula": "C15H16Cl3N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "46054169-6ed2-4bec-b9ce-3f6f2846f272"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "376.6658",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d794635b-45e6-4b4f-be7e-d6f1f303e779",
      "version": "5",
      "structure": {
        "id": "657747cf-2587-4fd7-abe4-d4689a3dedc9",
        "molfile": "\n  Marvin  01132105172D          \n\n 23 24  0  0  0  0            999 V2000\n    7.2494   -5.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0763   -5.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4872   -4.5670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3187   -4.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7297   -3.8511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7307   -5.2814    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4801   -6.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1481   -6.5457    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8141   -6.0612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5594   -5.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0788   -3.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2533   -3.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8401   -3.1474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8413   -5.9939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0193   -5.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6079   -5.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0321   -4.5617    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7831   -5.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3717   -5.9919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7791   -6.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6073   -6.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0264   -7.4283    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.5449   -5.9919    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10  6  1  0  0  0  0\n  3 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 15 21  2  0  0  0  0\n 19 23  1  0  0  0  0\nM  END",
        "smiles": "CCCN(CCOc1c(cc(cc1Cl)Cl)Cl)C(=O)n2ccnc2",
        "formula": "C15H16Cl3N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "376.6658",
        "optical_activity": "NONE",
        "references": [
          "c6e239a7-6994-4152-afcb-c634182c2e0b",
          "bc409d73-ac2c-436f-a611-f5c4ef946588"
        ],
        "stereo_centers": 0
      },
      "unii": "99SFL01YCL"
    }
  ]
}