{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1e09391f-11a8-4956-b0f8-4320c48c5c08",
          "code": "18309-32-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=18309-32-5",
          "code_system": "CAS",
          "references": [
            "ac3aaed1-73a0-4962-b465-45324e32b095",
            "45597e4b-8a8b-4e2f-8caf-8c692718ffa7"
          ]
        },
        {
          "uuid": "52345e81-aa2b-4c4d-bb71-3614a15c6ced",
          "code": "C052875",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67052875",
          "code_system": "MESH",
          "references": [
            "ac3aaed1-73a0-4962-b465-45324e32b095"
          ]
        },
        {
          "uuid": "896b4a66-b13c-43d0-9dc0-5074ad39b6df",
          "code": "VERBENONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Verbenone",
          "code_system": "WIKIPEDIA",
          "references": [
            "ac3aaed1-73a0-4962-b465-45324e32b095"
          ]
        },
        {
          "uuid": "508b9971-9e7d-4e43-b956-bc6c70e343a8",
          "code": "128986",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4393",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "ac3aaed1-73a0-4962-b465-45324e32b095"
          ]
        },
        {
          "uuid": "a56e63a5-2261-4834-ae25-7be0d08d8605",
          "code": "242-195-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.038.344",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ac3aaed1-73a0-4962-b465-45324e32b095"
          ]
        },
        {
          "uuid": "98ea93e5-1b39-446d-a589-029399214ac6",
          "code": "m11424",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11424?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ac3aaed1-73a0-4962-b465-45324e32b095"
          ]
        },
        {
          "uuid": "879394e1-a795-4f09-83d1-066e72d25dcf",
          "code": "65724",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65724",
          "code_system": "PUBCHEM",
          "references": [
            "ac3aaed1-73a0-4962-b465-45324e32b095"
          ]
        },
        {
          "uuid": "5a144832-6a60-4a8c-8ebf-bb6d144146ed",
          "code": "99S17893UW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4855a8b7-5436-b964-5a49-b4be8410c7a3",
          "code": "9955",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9955",
          "code_system": "CHEBI",
          "references": [
            "5dd4574b-8fc7-357c-9c7e-6570ff5b5eec"
          ]
        },
        {
          "uuid": "08752691-7263-733f-b513-75e63838ed19",
          "code": "DTXSID30885024",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30885024",
          "code_system": "EPA CompTox",
          "references": [
            "5dd4574b-8fc7-357c-9c7e-6570ff5b5eec"
          ]
        },
        {
          "uuid": "c7c4305a-96cf-cc47-dcbf-525a3645aaf4",
          "code": "36846",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=36846",
          "code_system": "NSC",
          "references": [
            "e8d9b1be-5e3a-ed2d-af5a-78c5227bf8cb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "acd2decb-79a7-4c05-9927-a1cd30e1a433",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "6fae40db-0d68-4d82-afe8-70027330c797",
            "refuuid": "826c6379-7a38-442a-a2e6-16e454f53104",
            "name": "VERBENA OFFICINALIS FLOWERING TOP",
            "unii": "311PNK9CDZ",
            "linking_id": "311PNK9CDZ",
            "ref_pname": "VERBENA OFFICINALIS FLOWERING TOP",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0564f30f-e5e5-4b98-9992-653627249407",
          "amount": {
            "uuid": "4f12c292-4f15-41b3-9331-9e26dc6bc649"
          },
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "2ffcd770-cf41-44d1-aaee-5600c01b68dd",
            "refuuid": "577fe639-c200-49f9-a213-65264a38a872",
            "name": "VERBENONE, (±)-",
            "unii": "IFV46DXC6U",
            "linking_id": "IFV46DXC6U",
            "ref_pname": "VERBENONE, (±)-"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b23fc2b8-27ee-4d84-88bb-1dfd55da4c17",
          "name": "(+)-.ALPHA.-VERBENONE",
          "stdName": "(+)-.ALPHA.-VERBENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "5de02a9a-5d01-47c9-802c-370f129efccb"
          ],
          "display_name": false
        },
        {
          "uuid": "bc3bbe9d-aed2-4825-b64d-78c5b8ca00b9",
          "name": "(+)-VERBENONE",
          "stdName": "(+)-VERBENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "5de02a9a-5d01-47c9-802c-370f129efccb"
          ],
          "display_name": false
        },
        {
          "uuid": "cac66f2b-6553-4b06-aebf-8c3b36ed21e9",
          "name": "(1R)-(+)-VERBENONE",
          "stdName": "(1R)-(+)-VERBENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "5de02a9a-5d01-47c9-802c-370f129efccb"
          ],
          "display_name": false
        },
        {
          "uuid": "96db79b4-dde9-4f12-9e35-42e5bf48196e",
          "name": "(1R,5R)-VERBENONE",
          "stdName": "(1R,5R)-VERBENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "5de02a9a-5d01-47c9-802c-370f129efccb"
          ],
          "display_name": false
        },
        {
          "uuid": "d9d00d84-c593-4a8e-905f-16b9441963da",
          "name": "(R)-(+)-.ALPHA.-VERBENONE",
          "stdName": "(R)-(+)-.ALPHA.-VERBENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "5de02a9a-5d01-47c9-802c-370f129efccb"
          ],
          "display_name": false
        },
        {
          "uuid": "c13b3c9b-a93d-44c1-a81a-3facee4ad0af",
          "name": "(R)-(+)-VERBENONE",
          "stdName": "(R)-(+)-VERBENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "5de02a9a-5d01-47c9-802c-370f129efccb"
          ],
          "display_name": false
        },
        {
          "uuid": "82e31c68-08fa-418e-8179-742d11d6bf81",
          "name": "2-PINEN-4-ONE, (1R,5R)-(+)-",
          "stdName": "2-PINEN-4-ONE, (1R,5R)-(+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "5de02a9a-5d01-47c9-802c-370f129efccb"
          ],
          "display_name": false
        },
        {
          "uuid": "a38f25a0-c74e-475c-a858-c549ad05023e",
          "name": "BICYCLO(3.1.1)HEPT-3-EN-2-ONE, 4,6,6-TRIMETHYL-, (1R)-",
          "stdName": "BICYCLO(3.1.1)HEPT-3-EN-2-ONE, 4,6,6-TRIMETHYL-, (1R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "5de02a9a-5d01-47c9-802c-370f129efccb"
          ],
          "display_name": false
        },
        {
          "uuid": "c4e39132-9027-4e1c-8ed3-0599963d28e1",
          "name": "BICYCLO(3.1.1)HEPT-3-EN-2-ONE, 4,6,6-TRIMETHYL-, (1R,5R)-",
          "stdName": "BICYCLO(3.1.1)HEPT-3-EN-2-ONE, 4,6,6-TRIMETHYL-, (1R,5R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "5de02a9a-5d01-47c9-802c-370f129efccb"
          ],
          "display_name": false
        },
        {
          "uuid": "753fc8e1-c78f-40a9-a9ee-ec70ee8e8947",
          "name": "D-VERBENONE [MI]",
          "stdName": "D-VERBENONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "e05bbf58-2291-48d2-be89-e0a2927ec380"
          ],
          "display_name": false
        },
        {
          "uuid": "3d3947f9-9c13-4a6f-a2e2-ad0758caa217",
          "name": "NSC-36846",
          "stdName": "NSC-36846",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e"
          ],
          "display_name": false
        },
        {
          "uuid": "11ba6570-58c7-42f7-af3b-afea78068fb0",
          "name": "VERBENONE, (+)-",
          "stdName": "VERBENONE, (+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af7a849-6046-40ef-9534-645d57db697e",
            "c6bc6138-d008-449c-aca1-782795a0cff8"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "5de02a9a-5d01-47c9-802c-370f129efccb",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7af7a849-6046-40ef-9534-645d57db697e",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6bc6138-d008-449c-aca1-782795a0cff8",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e05bbf58-2291-48d2-be89-e0a2927ec380",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac3aaed1-73a0-4962-b465-45324e32b095",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e1c300a-1bc6-4fbf-aed3-014699a7da16",
          "citation": "SRS import [99S17893UW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=99S17893UW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45597e4b-8a8b-4e2f-8caf-8c692718ffa7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5dd4574b-8fc7-357c-9c7e-6570ff5b5eec",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e8d9b1be-5e3a-ed2d-af5a-78c5227bf8cb",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "efee1a41-00c0-4a04-8175-c2a3b944d995",
          "id": "efee1a41-00c0-4a04-8175-c2a3b944d995",
          "molfile": "\n  Marvin  01132112272D          \n\n 11 12  0  0  1  0            999 V2000\n    7.4668   -1.9923    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.3396   -2.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7505   -3.2276    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.4668   -3.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4668   -4.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1785   -3.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1785   -2.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7632   -1.8225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7505   -2.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5440   -1.6114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9595   -2.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  7  1  0  0  0  0\n  1  9  1  0  0  0  0\n  3  2  1  1  0  0  0\n  3  4  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
          "smiles": "CC1=CC(=O)[C@@H]2C[C@H]1C2(C)C",
          "formula": "C10H14O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "896f820f-22a8-4948-9512-9fd8143bc007"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "150.2179",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bcbbd173-f325-4080-bbd7-d962a5301265",
      "version": "8",
      "structure": {
        "id": "da1aa65d-abf2-4706-a30a-cdecb0d29837",
        "molfile": "\n  Marvin  01132111192D          \n\n 11 12  0  0  1  0            999 V2000\n    6.5440   -1.6114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7505   -2.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9595   -2.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4668   -1.9923    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3396   -2.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7505   -3.2276    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.4668   -3.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4668   -4.4629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1785   -3.2276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1785   -2.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7632   -1.8225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  5  1  1  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10  4  1  0  0  0  0\n  2  6  1  0  0  0  0\nM  END",
        "smiles": "CC1=CC(=O)[C@@H]2C[C@H]1C2(C)C",
        "formula": "C10H14O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "150.2179",
        "optical_activity": "( + )",
        "references": [
          "5de02a9a-5d01-47c9-802c-370f129efccb",
          "6e1c300a-1bc6-4fbf-aed3-014699a7da16"
        ],
        "stereo_centers": 2
      },
      "unii": "99S17893UW"
    }
  ]
}