{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e7bb0b41-1346-43da-82d5-b7cb9bdada7f",
          "code": "77472-70-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77472-70-9",
          "code_system": "CAS",
          "references": [
            "d99ee4bb-0dd3-473d-a75e-b60c47c02f1f",
            "0cdb96b5-915d-4ee9-aca4-78902f52be11"
          ]
        },
        {
          "uuid": "31dbd732-00df-4f50-9124-b1c0e0abad8c",
          "code": "C96852",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C96852",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d99ee4bb-0dd3-473d-a75e-b60c47c02f1f"
          ]
        },
        {
          "uuid": "a21b9612-945a-421b-98fc-c59581e80e67",
          "code": "SUB126212",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "d99ee4bb-0dd3-473d-a75e-b60c47c02f1f"
          ]
        },
        {
          "uuid": "04f4fe74-33af-45ad-913b-92319cc79862",
          "code": "9111",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=9111",
          "code_system": "INN",
          "references": [
            "d99ee4bb-0dd3-473d-a75e-b60c47c02f1f"
          ]
        },
        {
          "uuid": "bf6700b8-30ed-4a49-8056-e2905c76874d",
          "code": "Phenylpiracetam",
          "comments": "A small number of low-scale clinical studies have shown possible links between prescription of phenylpiracetam and improvement in a number of encephalopathic conditions, including lesions of cerebral blood pathways, traumatic brain injury and certain types of glioma. Phenylpiracetam reverses the depressant effects of the benzodiazepine diazepam, increases operant behavior, inhibits post-rotational nystagmus, prevents retrograde amnesia, and has anticonvulsant properties. Phenylpiracetam is typically prescribed as a general stimulant or to increase tolerance to extreme temperatures and stress.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phenylpiracetam",
          "code_system": "WIKIPEDIA",
          "references": [
            "d99ee4bb-0dd3-473d-a75e-b60c47c02f1f"
          ]
        },
        {
          "uuid": "949fb6d8-e118-4d7b-95d2-a3fd7fab6015",
          "code": "FONTURACETAM",
          "comments": "Phenylpiracetam is one of the most peculiar and stimulating nootropics currently available, it has effects very similar to stacking Adderall and piracetam. Due to its added Phenyl group, it influences dopamine receptors in the brain, and therefore carries much the same effect. It also targets memory, focus and overall brain health, phenylpiraceatm is bar none one of my favorite nootropics for these reasons, it is available in 90 capsules as well as a cheaper sampler pack version.",
          "type": "PRIMARY",
          "url": "https://smartdrugsforcollege.com/top-nine-nootropics-available-in-2014/",
          "code_system": "MANUFACTURER PRODUCT INFORMATION",
          "references": [
            "d99ee4bb-0dd3-473d-a75e-b60c47c02f1f"
          ]
        },
        {
          "uuid": "3089ae5e-4e12-4d7e-b036-a4d6f47e255f",
          "code": "132441",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/132441",
          "code_system": "PUBCHEM",
          "references": [
            "d99ee4bb-0dd3-473d-a75e-b60c47c02f1f"
          ]
        },
        {
          "uuid": "6f0b0da2-4a85-174b-d2f4-60f6c0b84b42",
          "code": "C1509",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Neuroprotective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1509",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6978f461-266c-0980-bd70-76d7428969ec"
          ]
        },
        {
          "uuid": "e6d66515-185b-463b-b55d-c237f84a86bc",
          "code": "99QW5JU66Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d322d802-61e4-4661-239d-cc1bd7ad6f34",
          "code": "4049 (Number of products:6)",
          "comments": "Dietary Supplement Label Database|other|phenylpiracetam",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=4049&item=phenylpiracetam",
          "code_system": "DSLD",
          "references": [
            "6978f461-266c-0980-bd70-76d7428969ec"
          ]
        },
        {
          "uuid": "35dd1865-2fcb-7517-49c9-e51067120cba",
          "code": "DTXSID30868438",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30868438",
          "code_system": "EPA CompTox",
          "references": [
            "6978f461-266c-0980-bd70-76d7428969ec"
          ]
        },
        {
          "uuid": "ae1b4b68-537f-8687-d97c-e50c5fd879ca",
          "code": "100000151722",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "64171e3a-5c9c-c622-1398-83dfd929c177"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "abeab9ca-9c63-4ff5-85b3-c39f81d20d6f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a5b189fb-31d1-4b22-b56f-88ce8ee351c3",
            "refuuid": "768a205e-ac00-4537-9b94-62a0bc20777a",
            "name": "FONTURACETAM",
            "unii": "99QW5JU66Y",
            "linking_id": "99QW5JU66Y",
            "ref_pname": "FONTURACETAM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "79f3297d-bc9c-4324-bd2f-9869aad25a50",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "89570e53-3b07-45b3-b7bf-930cd2256a65",
            "refuuid": "1ca383ec-a6e4-4c79-b4dc-1ee117c37687",
            "name": "FONTURACETAM, (R)-",
            "unii": "X4X99EKB3S",
            "linking_id": "X4X99EKB3S",
            "ref_pname": "FONTURACETAM, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1868fcfe-6840-456c-8f4d-ca0577aaeec5",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "5387c025-c37b-46ce-9ef9-21203fa25a9e",
            "refuuid": "8607fe13-49bc-40fa-af9b-ef0b79803459",
            "name": "FONTURACETAM, (S)-",
            "unii": "JH0YWN170P",
            "linking_id": "JH0YWN170P",
            "ref_pname": "FONTURACETAM, (S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0b62146b-4fbd-4766-a4d8-1180390ed986",
          "name": "(R,S)-2-(2-OXO-4-PHENYLPYRROLIDIN-1-YL)ACETAMIDE",
          "stdName": "(R,S)-2-(2-OXO-4-PHENYLPYRROLIDIN-1-YL)ACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "460b4610-3fa1-4660-acc5-1ee2f839a455",
            "f2db4f5e-f253-4252-be9b-1d2b78acb4cc"
          ],
          "display_name": false
        },
        {
          "uuid": "e554bf7d-44f9-479c-8f63-b5245430bd9f",
          "name": "1-PYRROLIDINEACETAMIDE, 2-OXO-4-PHENYL-",
          "stdName": "1-PYRROLIDINEACETAMIDE, 2-OXO-4-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a635a0-0342-46fd-9ffc-734ea00a15fd",
            "f2db4f5e-f253-4252-be9b-1d2b78acb4cc"
          ],
          "display_name": false
        },
        {
          "uuid": "66251384-a559-4d0a-847d-78c7adb6d6df",
          "name": "2-(2-OXO-4-PHENYL-PYRROLIDIN-1-YL)ACETAMIDE",
          "stdName": "2-(2-OXO-4-PHENYL-PYRROLIDIN-1-YL)ACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5d0d8f1-738e-4f1e-9c37-163b7a7f1f49",
            "f2db4f5e-f253-4252-be9b-1d2b78acb4cc"
          ],
          "display_name": false
        },
        {
          "uuid": "e639119e-e762-4232-b5c8-2b77f5b1de35",
          "name": "4-PHENYLPIRACETAM",
          "stdName": "4-PHENYLPIRACETAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "51cd4d56-070d-4d51-a8c7-151effbad7e8",
            "ec6f83a5-6894-49f3-a830-155e249e7679",
            "f2db4f5e-f253-4252-be9b-1d2b78acb4cc"
          ],
          "display_name": false
        },
        {
          "uuid": "61890f77-67b6-a3cc-e784-74fcd38ed89a",
          "name": "4-Phenylpiracetam [WHO-DD]",
          "stdName": "4-PHENYLPIRACETAM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "17cd73bb-fcf5-6148-2f54-22bdea357966"
          ],
          "display_name": false
        },
        {
          "uuid": "9f0ca210-8684-480c-9bfd-6f8f18c05cca",
          "name": "CARPHEDON",
          "stdName": "CARPHEDON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a635a0-0342-46fd-9ffc-734ea00a15fd",
            "f2db4f5e-f253-4252-be9b-1d2b78acb4cc"
          ],
          "display_name": false
        },
        {
          "uuid": "b190f89a-ccef-465f-b685-5bb11ab4d150",
          "name": "CARPHEDONE",
          "stdName": "CARPHEDONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a635a0-0342-46fd-9ffc-734ea00a15fd",
            "f2db4f5e-f253-4252-be9b-1d2b78acb4cc"
          ],
          "display_name": false
        },
        {
          "uuid": "b19f8dad-4c3d-4e4e-9128-484a2d2080d1",
          "name": "FONTURACETAM",
          "stdName": "FONTURACETAM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cb2783f-c1da-410b-9a78-4d3fb8843165",
            "227f5116-784d-4244-b5c3-016eb314440a",
            "009221f7-f450-4c83-bf2b-05ea2c3793cb",
            "8f031386-c536-43ad-b491-678d02bc5249",
            "0aff6a0e-fb11-4c8b-985d-1ae2bfdde567",
            "b5adf8d5-7084-4cd8-afff-5cc4b568b888"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "51de3242-7439-4a59-8443-d3b5e61d9ae5",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "a68e6615-ad58-43ee-962b-81b459c682ae",
          "name": "FONTURACETAM [MART.]",
          "stdName": "FONTURACETAM [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cb2783f-c1da-410b-9a78-4d3fb8843165"
          ],
          "display_name": false
        },
        {
          "uuid": "a43684d8-f9ad-4940-b0a7-9b9162fd66d7",
          "name": "PHENOTROPYL",
          "stdName": "PHENOTROPYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40a635a0-0342-46fd-9ffc-734ea00a15fd",
            "f2db4f5e-f253-4252-be9b-1d2b78acb4cc"
          ],
          "display_name": false
        },
        {
          "uuid": "57631f65-ea66-442e-ac20-e86fb29d05cb",
          "name": "PHENYLPIRACETAM",
          "stdName": "PHENYLPIRACETAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "460b4610-3fa1-4660-acc5-1ee2f839a455",
            "f2db4f5e-f253-4252-be9b-1d2b78acb4cc"
          ],
          "display_name": false
        },
        {
          "uuid": "3552a779-1756-40a2-be35-868d8404aa4e",
          "name": "RAC-2-((4R)-2-OXO-4-PHENYLPYROLIDIN-1-YL)ACETAMIDE",
          "stdName": "RAC-2-((4R)-2-OXO-4-PHENYLPYROLIDIN-1-YL)ACETAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0aff6a0e-fb11-4c8b-985d-1ae2bfdde567"
          ],
          "display_name": false
        },
        {
          "uuid": "644a6034-9097-4391-9d0b-954d580a0ab2",
          "name": "fonturacetam [INN]",
          "stdName": "FONTURACETAM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "009221f7-f450-4c83-bf2b-05ea2c3793cb",
            "2bbdb75f-58f1-4ae4-9796-fa00869a576a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0aff6a0e-fb11-4c8b-985d-1ae2bfdde567",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "227f5116-784d-4244-b5c3-016eb314440a",
          "citation": "Prop List 101, 2009",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "009221f7-f450-4c83-bf2b-05ea2c3793cb",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9cb2783f-c1da-410b-9a78-4d3fb8843165",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec6f83a5-6894-49f3-a830-155e249e7679",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2db4f5e-f253-4252-be9b-1d2b78acb4cc",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "460b4610-3fa1-4660-acc5-1ee2f839a455",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40a635a0-0342-46fd-9ffc-734ea00a15fd",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5d0d8f1-738e-4f1e-9c37-163b7a7f1f49",
          "citation": "CHEMDRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d99ee4bb-0dd3-473d-a75e-b60c47c02f1f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390771000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "edde638c-f533-4d69-9312-2369f22e52a5",
          "citation": "SRS import [99QW5JU66Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=99QW5JU66Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390771000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f031386-c536-43ad-b491-678d02bc5249",
          "citation": "FONTURACETAM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b5adf8d5-7084-4cd8-afff-5cc4b568b888",
          "citation": "FONTURACETAM [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "51cd4d56-070d-4d51-a8c7-151effbad7e8",
          "citation": "4-PHENYLPIRACETAM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "64171e3a-5c9c-c622-1398-83dfd929c177",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "6978f461-266c-0980-bd70-76d7428969ec",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0cdb96b5-915d-4ee9-aca4-78902f52be11",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2bbdb75f-58f1-4ae4-9796-fa00869a576a",
          "citation": "INN Proposed List 104",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL104.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "17cd73bb-fcf5-6148-2f54-22bdea357966",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "83dede03-55cb-4f44-a79f-77952f2b1e9f",
          "id": "83dede03-55cb-4f44-a79f-77952f2b1e9f",
          "molfile": "\n  Marvin  01132106502D          \n\n 16 17  0  0  0  0            999 V2000\n    0.8231   -2.4619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0028   -2.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3315   -3.3037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4832   -1.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3036   -1.9704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8566   -1.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6062   -1.6924    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -2.5222   -2.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7150   -2.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3782   -3.4387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3213   -1.2810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0378   -1.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7526   -1.2815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7514   -0.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0396   -0.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3242   -0.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  9  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 11  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C2CC(=O)N(C2)CC(=O)N",
          "formula": "C12H14N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "db3207a4-64f6-4cae-a8b7-546741b3f1da"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "218.2522",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "768a205e-ac00-4537-9b94-62a0bc20777a",
      "version": "12",
      "structure": {
        "id": "3b2226ea-ec62-4273-8ca8-a9e0e4d329b6",
        "molfile": "\n  Marvin  01132103082D          \n\n 16 17  0  0  0  0            999 V2000\n   -4.7514   -0.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.7526   -1.2815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0378   -1.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3213   -1.2810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3242   -0.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.0396   -0.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6062   -1.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5222   -2.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7150   -2.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3036   -1.9704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8566   -1.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3782   -3.4387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4832   -1.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0028   -2.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8231   -2.4619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3315   -3.3037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  7  1  0  0  0  0\n  5  6  2  0  0  0  0\n  9 12  2  0  0  0  0\n  6  1  1  0  0  0  0\n 10 13  1  0  0  0  0\n  1  2  2  0  0  0  0\n 13 14  1  0  0  0  0\n  4  7  1  0  0  0  0\n 14 15  1  0  0  0  0\n  7  8  1  0  0  0  0\n 14 16  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C2CC(=O)N(C2)CC(=O)N",
        "formula": "C12H14N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "218.2522",
        "optical_activity": "( + / - )",
        "references": [
          "0aff6a0e-fb11-4c8b-985d-1ae2bfdde567",
          "edde638c-f533-4d69-9312-2369f22e52a5",
          "2bbdb75f-58f1-4ae4-9796-fa00869a576a"
        ],
        "stereo_centers": 1
      },
      "unii": "99QW5JU66Y"
    }
  ]
}