{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "86441c63-1d17-4f1f-a93a-8d68f12d926f", "code": "211-989-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.900", "code_system": "ECHA (EC/EINECS)", "references": [ "d602fc7f-6ebf-4a6e-940e-ba9a54aa8876" ] }, { "uuid": "ec656ea1-2092-48f3-891b-acbf0e35bcdc", "code": "12902", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12902", "code_system": "PUBCHEM", "references": [ "d602fc7f-6ebf-4a6e-940e-ba9a54aa8876" ] }, { "uuid": "3c059175-9a33-4b9b-b08c-cbd224a99b66", "code": "732-26-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=732-26-3", "code_system": "CAS", "references": [ "d602fc7f-6ebf-4a6e-940e-ba9a54aa8876", "00fe0b95-139b-43da-a12a-32aa9fe522cd" ] }, { "uuid": "748c7de6-1b7e-46db-8acd-53de2f193202", "code": "C019584", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67019584", "code_system": "MESH", "references": [ "d602fc7f-6ebf-4a6e-940e-ba9a54aa8876" ] }, { "uuid": "dace4590-34ba-995e-820b-5c7f4f4f8733", "code": "7727", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7727", "code_system": "HSDB", "references": [ "267d4dd6-17c8-ed31-d3e1-729dac83f02f" ] }, { "uuid": "1d832f77-3656-d370-bb91-5f2ec2978609", "code": "DTXSID2021311", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2021311", "code_system": "EPA CompTox", "references": [ "15a1c45e-40e9-8c94-b05a-770794e9a6e8" ] }, { "uuid": "9b6518fe-002d-43ad-88c4-c26dc861de02", "code": "99J2VIC675", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c402eb1f-b6a7-5e2b-f4a7-88de1110dfc5", "code": "2,4,6-Tri-tert-butylphenol", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/2,4,6-Tri-tert-butylphenol", "code_system": "WIKIPEDIA", "references": [ "f4837f81-89cd-4e99-7740-26ee580b9d8f" ] }, { "uuid": "3ff85ed8-6a50-0272-7f55-96d8ecff00d3", "code": "14459", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=14459", "code_system": "NSC", "references": [ "90be7f52-ae8e-9b0b-e963-b015d99512e2" ] }, { "uuid": "2a893a65-3749-d036-546d-ccdd96ccd048", "code": "1696164", "type": "PRIMARY", "url": "https://store.usp.org/product/1696164", "code_system": "RS_ITEM_NUM", "references": [ "0458f99a-4368-8648-cce5-2a354cd2db75" ] }, { "uuid": "f2d4b4fc-62db-abc6-ba12-4fe7fd13bf21", "code": "300000053000", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "a07ff568-a7d0-8d4e-f0e9-e36d273eaf5e" ] } ], "substance_class": "chemical", "names": [ { "uuid": "c7b6f1a9-c523-4285-a3b6-8dde9e0ba0e1", "name": "2,4,6-TRI-TERT-BUTYLPHENOL", "stdName": "2,4,6-TRI-TERT-BUTYLPHENOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bf62277c-4a43-4f5d-bb59-1f39aa738fb7", "f3b50505-d802-46bb-9ab5-840b26a43b74" ], "display_name": true }, { "uuid": "3a9f6457-2a13-489f-964b-7ee57a456c4c", "name": "2,4,6-TRIS(1,1-DIMETHYLETHYL)PHENOL [HSDB]", "stdName": "2,4,6-TRIS(1,1-DIMETHYLETHYL)PHENOL [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f3b50505-d802-46bb-9ab5-840b26a43b74", "3d8751f8-2a3f-451a-9b9e-ff6867bed2c0" ], "display_name": false }, { "uuid": "6b449e64-d94e-4be6-9deb-75e5c5e79abd", "name": "2,4,6-TRIS(TERT-BUTYL)PHENOL", "stdName": "2,4,6-TRIS(TERT-BUTYL)PHENOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f3b50505-d802-46bb-9ab5-840b26a43b74", "9f7038f0-1cbb-4e45-a15e-8d1203200aa2" ], "display_name": false }, { "uuid": "43488e87-6ced-415c-9479-f4201fc42316", "name": "NSC-14459", "stdName": "NSC-14459", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f3b50505-d802-46bb-9ab5-840b26a43b74", "017c84f3-8ce1-495b-a11f-43c3533b7986" ], "display_name": false }, { "uuid": "d073b814-fb9b-a81d-c07f-3e147e7ae11d", "name": "PHENOL, 2,4,6-TRIS(1,1-DIMETHYLETHYL)-", "stdName": "PHENOL, 2,4,6-TRIS(1,1-DIMETHYLETHYL)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "65eca112-885b-7d26-c33b-8042bbf1ce27" ], "display_name": false }, { "uuid": "f111aa2d-8efe-489c-9ce3-4d052c5ef253", "name": "TRI-TERT-BUTYLPHENOL, 2,4,6-", "stdName": "TRI-TERT-BUTYLPHENOL, 2,4,6-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d287bc45-0a56-4aa7-83b6-23c783c6ec56" ], "display_name": false } ], "references": [ { "uuid": "d287bc45-0a56-4aa7-83b6-23c783c6ec56", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "bf62277c-4a43-4f5d-bb59-1f39aa738fb7", "citation": "http://www.chemblink.com/products/732-26-3.htm", "url": "http://www.chemblink.com/products/732-26-3.htm", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f3b50505-d802-46bb-9ab5-840b26a43b74", "citation": "WEB PAGE", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3d8751f8-2a3f-451a-9b9e-ff6867bed2c0", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9f7038f0-1cbb-4e45-a15e-8d1203200aa2", "citation": "TOX 21", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "017c84f3-8ce1-495b-a11f-43c3533b7986", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d602fc7f-6ebf-4a6e-940e-ba9a54aa8876", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390939000, "tags": [ "NOMEN" ] }, { "uuid": "5d949f87-9183-4569-b804-4929fa719b88", "citation": "SRS import [99J2VIC675]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=99J2VIC675", "doc_type": "SRS", "public_domain": true, "document_date": 1493390939000, "tags": [ "NOMEN" ] }, { "uuid": "3c1a2606-a379-4188-ac36-a13aca97ce37", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "267d4dd6-17c8-ed31-d3e1-729dac83f02f", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+732-26-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "15a1c45e-40e9-8c94-b05a-770794e9a6e8", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=732-26-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "65eca112-885b-7d26-c33b-8042bbf1ce27", "citation": "tkb", "doc_type": "TOBACCO KNOWLEDGE BASE", "public_domain": true }, { "uuid": "f4837f81-89cd-4e99-7740-26ee580b9d8f", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "00fe0b95-139b-43da-a12a-32aa9fe522cd", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0458f99a-4368-8648-cce5-2a354cd2db75", "citation": "USP/NF", "doc_type": "USPNF", "public_domain": true }, { "uuid": "90be7f52-ae8e-9b0b-e963-b015d99512e2", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "a07ff568-a7d0-8d4e-f0e9-e36d273eaf5e", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7db1bdb2-c877-4d0a-b2c9-7b5f5b250378", "id": "7db1bdb2-c877-4d0a-b2c9-7b5f5b250378", "molfile": "\n Marvin 01132106312D \n\n 19 19 0 0 0 0 999 V2000\n 6.1330 -5.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9256 -5.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7872 -5.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9256 -6.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9256 -5.1693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2146 -4.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2146 -3.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9256 -3.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9256 -2.7061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6411 -3.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6411 -4.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3757 -3.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9439 -2.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0912 -3.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7856 -4.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4955 -3.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9117 -2.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0647 -4.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7672 -3.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 5 2 1 0 0 0 0\n 5 6 1 0 0 0 0\n 11 5 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 7 16 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 8 2 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 12 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 19 1 0 0 0 0\nM END", "smiles": "CC(C)(C)c1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C", "formula": "C18H30O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e7567f18-9b13-4857-b819-df6b2dd88015" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "262.4309", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "ba0aa2e4-dd4d-4b28-8103-3c9b8076d8ee", "version": "11", "structure": { "id": "5936911f-55d4-4a85-965f-abc7c33f8e0f", "molfile": "\n Marvin 01132104382D \n\n 19 19 0 0 0 0 999 V2000\n 7.6411 -3.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9256 -3.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2146 -3.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2146 -4.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9256 -5.1693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6411 -4.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9256 -5.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1330 -5.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7872 -5.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9256 -6.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4955 -3.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9117 -2.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0647 -4.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7672 -3.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9256 -2.7061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3757 -3.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9439 -2.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0912 -3.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7856 -4.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 1 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 3 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\n 2 15 1 0 0 0 0\n 1 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 16 19 1 0 0 0 0\nM END", "smiles": "CC(C)(C)c1cc(c(c(c1)C(C)(C)C)O)C(C)(C)C", "formula": "C18H30O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "262.4309", "optical_activity": "NONE", "references": [ "3c1a2606-a379-4188-ac36-a13aca97ce37", "5d949f87-9183-4569-b804-4929fa719b88" ], "stereo_centers": 0 }, "unii": "99J2VIC675" } ] }