{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "90ca1d35-5d5f-4305-aa13-1b4853e6e3fb",
          "code": "13927-77-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13927-77-0",
          "code_system": "CAS",
          "references": [
            "94066b1e-9ba2-4292-b622-07140eb87edc",
            "d1501957-12b3-4849-9754-24e7f48463e1"
          ]
        },
        {
          "uuid": "62dbfaaf-caf2-4b46-8a0b-d4412ba71f46",
          "code": "237-696-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.034.255",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "94066b1e-9ba2-4292-b622-07140eb87edc"
          ]
        },
        {
          "uuid": "f4a71b93-2ded-218f-3487-a1549d73ce3f",
          "code": "2950",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2950",
          "code_system": "HSDB",
          "references": [
            "835aca0c-0904-9356-5e0a-efcf31a74965"
          ]
        },
        {
          "uuid": "3a77ba1f-5042-3dd9-205b-2f2758db0278",
          "code": "DTXSID2020927",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2020927",
          "code_system": "EPA CompTox",
          "references": [
            "9508f9a9-db2d-93e8-32a4-6a33d5351cc0"
          ]
        },
        {
          "uuid": "51270b93-2057-9bc9-a5f2-7ffdd2b809b8",
          "code": "4523766",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4523766",
          "code_system": "PUBCHEM",
          "references": [
            "5e449d92-e89a-ad61-bd96-7dc8b7eee526"
          ]
        },
        {
          "uuid": "97c049bc-2050-4bad-8c20-ca5b84263012",
          "code": "99D240X626",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b3e530ac-76a3-8046-c21b-6ee522b6bd24",
          "code": "4797",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4797",
          "code_system": "NSC",
          "references": [
            "b0e00fa3-1151-2854-f3de-a8a7e6722e05"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c3e6d73d-1b87-4e79-803d-c0f90fda5786",
          "name": "(DIBUTYLDITHIOCARBAMATO)NICKEL(II)",
          "stdName": "(DIBUTYLDITHIOCARBAMATO)NICKEL(II)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce417db-48f0-4dee-86c5-41ce5d340d21",
            "bb20218a-6526-4439-9c82-e95136f091e6"
          ],
          "display_name": false
        },
        {
          "uuid": "810b6d8b-d6d5-4cb7-9408-80e08abc394b",
          "name": "BIS(DIBUTYLDITHIOCARBAMATO)NICKEL",
          "stdName": "BIS(DIBUTYLDITHIOCARBAMATO)NICKEL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce417db-48f0-4dee-86c5-41ce5d340d21",
            "bb20218a-6526-4439-9c82-e95136f091e6"
          ],
          "display_name": false
        },
        {
          "uuid": "4910294b-1e46-4d7b-ba90-6a0a25db403d",
          "name": "CARBAMIC ACID, DIBUTYLDITHIO-, NICKEL SALT",
          "stdName": "CARBAMIC ACID, DIBUTYLDITHIO-, NICKEL SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce417db-48f0-4dee-86c5-41ce5d340d21",
            "bb20218a-6526-4439-9c82-e95136f091e6"
          ],
          "display_name": false
        },
        {
          "uuid": "9a4f12fe-a9db-4a92-a115-3c928f9f7975",
          "name": "CARBAMODITHIOIC ACID, DIBUTYL-, NICKEL(2+) SALT",
          "stdName": "CARBAMODITHIOIC ACID, DIBUTYL-, NICKEL(2+) SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce417db-48f0-4dee-86c5-41ce5d340d21",
            "bb20218a-6526-4439-9c82-e95136f091e6"
          ],
          "display_name": false
        },
        {
          "uuid": "5b7909ee-e48a-466a-bbe5-3cff3932e313",
          "name": "DIBUTYLDITHIOCARBAMIC ACID, NICKEL SALT",
          "stdName": "DIBUTYLDITHIOCARBAMIC ACID, NICKEL SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce417db-48f0-4dee-86c5-41ce5d340d21",
            "bb20218a-6526-4439-9c82-e95136f091e6"
          ],
          "display_name": false
        },
        {
          "uuid": "327a0281-e178-4dfa-943c-0097c210de10",
          "name": "NICKEL BIS(DIBUTYLDITHIOCARBAMATE)",
          "stdName": "NICKEL BIS(DIBUTYLDITHIOCARBAMATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce417db-48f0-4dee-86c5-41ce5d340d21",
            "bb20218a-6526-4439-9c82-e95136f091e6"
          ],
          "display_name": false
        },
        {
          "uuid": "f9874257-6fed-4fa7-8171-07bfe3513402",
          "name": "NICKEL DIBUTYLDITHIOCARBAMATE",
          "stdName": "NICKEL DIBUTYLDITHIOCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10193e7b-cc67-466c-86cb-eeb7d2f2527a"
          ],
          "display_name": true
        },
        {
          "uuid": "62b1349f-532c-4df5-9460-1c1acbdf0652",
          "name": "NICKEL, BIS(DIBUTYLCARBAMODITHIOATO-.KAPPA.S,.KAPPA.S')-, (SP-4-1)-",
          "stdName": "NICKEL, BIS(DIBUTYLCARBAMODITHIOATO-.KAPPA.S,.KAPPA.S')-, (SP-4-1)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce417db-48f0-4dee-86c5-41ce5d340d21",
            "bb20218a-6526-4439-9c82-e95136f091e6"
          ],
          "display_name": false
        },
        {
          "uuid": "ca033ad8-6135-4cd3-a508-be2b183edfda",
          "name": "NICKEL, BIS(DIBUTYLCARBAMODITHIOATO-S,S')-",
          "stdName": "NICKEL, BIS(DIBUTYLCARBAMODITHIOATO-S,S')-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce417db-48f0-4dee-86c5-41ce5d340d21",
            "bb20218a-6526-4439-9c82-e95136f091e6"
          ],
          "display_name": false
        },
        {
          "uuid": "78b872d9-89e1-43be-a491-4bc0a61ffcdd",
          "name": "NICKEL, BIS(DIBUTYLDITHIOCARBAMATO)- [HSDB]",
          "stdName": "NICKEL, BIS(DIBUTYLDITHIOCARBAMATO)- [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4250a2d0-341f-43fd-8719-342c0a1ac2d7",
            "bb20218a-6526-4439-9c82-e95136f091e6"
          ],
          "display_name": false
        },
        {
          "uuid": "27ee3fe2-7f1f-4c37-9f26-17df27a00701",
          "name": "NSC-4797",
          "stdName": "NSC-4797",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cce417db-48f0-4dee-86c5-41ce5d340d21",
            "bb20218a-6526-4439-9c82-e95136f091e6"
          ],
          "display_name": false
        },
        {
          "uuid": "1b7673f9-7af6-474b-ba63-a68647b38497",
          "name": "RYLEX NBC",
          "stdName": "RYLEX NBC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb20218a-6526-4439-9c82-e95136f091e6",
            "2ee2ca9f-9b78-4fa4-ad8b-7b3862e32437"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "10193e7b-cc67-466c-86cb-eeb7d2f2527a",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4250a2d0-341f-43fd-8719-342c0a1ac2d7",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb20218a-6526-4439-9c82-e95136f091e6",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cce417db-48f0-4dee-86c5-41ce5d340d21",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ee2ca9f-9b78-4fa4-ad8b-7b3862e32437",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94066b1e-9ba2-4292-b622-07140eb87edc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391038000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "170ff5a5-35d1-4940-a610-b4b0ab2b5915",
          "citation": "SRS import [99D240X626]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=99D240X626",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391038000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a64c3f3d-a6a8-4aa1-ba0a-8a58ea04f500",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "835aca0c-0904-9356-5e0a-efcf31a74965",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+13927-77-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9508f9a9-db2d-93e8-32a4-6a33d5351cc0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13927-77-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5e449d92-e89a-ad61-bd96-7dc8b7eee526",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "d1501957-12b3-4849-9754-24e7f48463e1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b0e00fa3-1151-2854-f3de-a8a7e6722e05",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0167b07a-f91f-4082-b31d-bc0e9168a95f",
          "id": "0167b07a-f91f-4082-b31d-bc0e9168a95f",
          "molfile": "\n  Marvin  01132100242D          \n\n  1  0  0  0  0  0            999 V2000\n   10.5367   -3.6502    0.0000 Ni  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ni+2]",
          "formula": "Ni",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "01d548a1-efef-44f8-a3db-2115d5b84dbc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "58.6934",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2a146a54-d3cb-43a3-ada1-16f5ecebd505",
          "id": "2a146a54-d3cb-43a3-ada1-16f5ecebd505",
          "molfile": "\n  Marvin  01132102172D          \n\n 12 11  0  0  0  0            999 V2000\n    4.8460   -2.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6710   -2.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0911   -2.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9106   -2.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3257   -3.5906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9106   -4.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0911   -4.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6710   -5.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8460   -5.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1604   -3.5906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7311   -3.0102    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7311   -4.1823    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
          "smiles": "CCCCN(CCCC)C(=S)S",
          "formula": "C9H19NS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "8c547f23-d492-4683-832f-d0d8146aa348"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "205.3864",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ba6ab464-e44e-4b1e-b194-a3f9442fa6a1",
      "version": "7",
      "structure": {
        "id": "ca9b1e7b-3d0b-497c-861e-2dd075e958cc",
        "molfile": "\n  Marvin  01132110282D          \n\n 25 22  0  0  0  0            999 V2000\n   10.5367   -3.6502    0.0000 Ni  0  2  0  0  0  0  0  0  0  0  0  0\n    8.7311   -3.0102    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1604   -3.5906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7311   -4.1823    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3257   -3.5906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9106   -2.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0911   -2.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6710   -2.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8460   -2.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9106   -4.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0911   -4.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6710   -5.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8460   -5.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7311   -3.0102    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1604   -3.5906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7311   -4.1823    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n    7.3257   -3.5906    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9106   -2.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0911   -2.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6710   -2.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8460   -2.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9106   -4.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0911   -4.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6710   -5.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8460   -5.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 22 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  CHG  3   1   2   4  -1  16  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  9  17  18  19  20  21  22  23  24  25\nM  SPA   1 12   2   3   4   5   6   7   8   9  10  11  12  13\nM  SDI   1  4    4.4260   -5.4374    4.4260   -1.7341\nM  SDI   1  4    9.1511   -1.7341    9.1511   -5.4374\nM  SMT   1 2\nM  END",
        "smiles": "CCCCN(CCCC)C(=S)[S-].CCCCN(CCCC)C(=S)[S-].[Ni+2]",
        "formula": "2C9H18NS2.Ni",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "467.4502",
        "optical_activity": "NONE",
        "references": [
          "170ff5a5-35d1-4940-a610-b4b0ab2b5915",
          "a64c3f3d-a6a8-4aa1-ba0a-8a58ea04f500"
        ],
        "stereo_centers": 0
      },
      "unii": "99D240X626"
    }
  ]
}