{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "97751aa8-73d2-47e3-96d1-7c6c117d54e1",
          "code": "786-19-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=786-19-6",
          "code_system": "CAS",
          "references": [
            "aa1b8733-50f4-44b7-9b94-f160d483dda6",
            "17a87230-337e-4109-b820-f7650a517b10"
          ]
        },
        {
          "uuid": "35a51e63-8525-41f6-a183-392c882350f4",
          "code": "C006901",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67006901",
          "code_system": "MESH",
          "references": [
            "aa1b8733-50f4-44b7-9b94-f160d483dda6"
          ]
        },
        {
          "uuid": "8a3222e5-f4d9-4cc6-bacd-99dd231f1e6f",
          "code": "CARBOPHENOTHION",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Carbophenothion",
          "code_system": "WIKIPEDIA",
          "references": [
            "aa1b8733-50f4-44b7-9b94-f160d483dda6"
          ]
        },
        {
          "uuid": "4b5830c5-5939-43d9-8f0d-d253e2144889",
          "code": "SUB06613MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "aa1b8733-50f4-44b7-9b94-f160d483dda6"
          ]
        },
        {
          "uuid": "098089a9-0ebe-4b61-9e80-2fdbe3aff3d1",
          "code": "58102",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1756",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "aa1b8733-50f4-44b7-9b94-f160d483dda6"
          ]
        },
        {
          "uuid": "38fd9935-6d09-4f06-b920-2f8377cf1bf8",
          "code": "2854",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2854",
          "code_system": "INN",
          "references": [
            "aa1b8733-50f4-44b7-9b94-f160d483dda6"
          ]
        },
        {
          "uuid": "f9489b9e-79b4-4f1a-8617-ca552d26dbb1",
          "code": "m622",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m622?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "aa1b8733-50f4-44b7-9b94-f160d483dda6"
          ]
        },
        {
          "uuid": "930cfdb6-3da4-4c85-a881-d77b20c1522b",
          "code": "CHEMBL452866",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL452866",
          "code_system": "ChEMBL",
          "references": [
            "aa1b8733-50f4-44b7-9b94-f160d483dda6"
          ]
        },
        {
          "uuid": "7ab30893-a993-41e9-be62-ef944ed693d0",
          "code": "212-324-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.204",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "aa1b8733-50f4-44b7-9b94-f160d483dda6"
          ]
        },
        {
          "uuid": "50c2284f-edb8-4921-b0bf-6f70267383ce",
          "code": "13081",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13081",
          "code_system": "PUBCHEM",
          "references": [
            "aa1b8733-50f4-44b7-9b94-f160d483dda6"
          ]
        },
        {
          "uuid": "e1c6a806-f0da-a27c-2e6e-6eadaa2f44b6",
          "code": "958",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/958",
          "code_system": "HSDB",
          "references": [
            "3024e515-16a9-b499-de75-10bdb24857c3"
          ]
        },
        {
          "uuid": "73780b34-a300-ae24-283f-06c33f78d44a",
          "code": "DTXSID7022120",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7022120",
          "code_system": "EPA CompTox",
          "references": [
            "c0c46f2a-cc3a-7744-f69f-c14ad69cfcdf"
          ]
        },
        {
          "uuid": "f783c628-5db6-d602-c7e8-21993828b44d",
          "code": "C171860",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C171860",
          "code_system": "NCI_THESAURUS",
          "references": [
            "75d11501-3f5c-7477-56a1-e20f4579c74f"
          ]
        },
        {
          "uuid": "1768fc8c-4210-489e-a40d-c746c936a221",
          "code": "998NGA2Q61",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8c6ae20e-9f33-fc1f-a684-aa0380ffb566",
          "code": "100000084586",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "96344ef0-0982-f9e8-69af-5a18235fd7d8"
          ]
        },
        {
          "uuid": "13623530-b938-c8fa-db33-ab7f928aef21",
          "code": "carbophenothion",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/carbophenothion.html",
          "code_system": "ALANWOOD",
          "references": [
            "ca076eb1-89b7-032d-ee64-c5b65e4c6983"
          ]
        },
        {
          "uuid": "980f6e8a-96f8-3ced-8b67-06e8f1f240e1",
          "code": "231691",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=231691",
          "code_system": "NSC",
          "references": [
            "d5e90eb7-0e84-9197-c091-1e32d98d2c68"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "60007333-8adf-42d7-8260-2fd0e2636d04",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f0502b43-467f-41a5-966e-c5df8981cef6",
            "refuuid": "6bf978a8-a828-4d5c-9ed5-384dd3be314b",
            "name": "CARBOFENOTION",
            "unii": "998NGA2Q61",
            "linking_id": "998NGA2Q61",
            "ref_pname": "CARBOFENOTION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d20d61b4-afad-4ca6-9949-4614e9382b2d",
          "name": "CARBOFENOTION",
          "stdName": "CARBOFENOTION",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "989f98bd-6661-4c49-9ae5-ee83ebcb26e7",
            "2ce4fe2c-6301-4799-8437-b0627171a8fe",
            "dd931c16-f6b2-46d9-9008-d404b5d758bf"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "72fb4378-a2e4-4b34-bd2e-e6116ba72fb9",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "6e405ae2-5b12-432f-a917-a57e941d3c22",
          "name": "CARBOPHENOTHION",
          "stdName": "CARBOPHENOTHION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41251ee7-4ab4-49d3-b6e3-5435256e4eca",
            "923d2bb0-4be6-45d6-ba21-fa0438d55c3c",
            "47f948b3-5523-421f-9bb3-e4c319c5e1fc",
            "dddf7f00-6565-4b54-809b-27aa31461b90",
            "ae657096-fd1d-4303-a7bd-ba6082da79df",
            "9bc3c401-0af2-4536-aaa6-40389e5c6e5f",
            "ca6f1e2a-3d47-4c57-a956-cecb1a67a2c3",
            "188e6d5f-4f72-4e22-a93f-cc0cf304639b"
          ],
          "display_name": false
        },
        {
          "uuid": "a1b07b3b-093a-49f3-ad5f-ef7846d85a45",
          "name": "CARBOPHENOTHION [HSDB]",
          "stdName": "CARBOPHENOTHION [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dddf7f00-6565-4b54-809b-27aa31461b90",
            "188e6d5f-4f72-4e22-a93f-cc0cf304639b"
          ],
          "display_name": false
        },
        {
          "uuid": "a19cd052-615d-4bea-ade8-692d9a120189",
          "name": "CARBOPHENOTHION [ISO]",
          "stdName": "CARBOPHENOTHION [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae657096-fd1d-4303-a7bd-ba6082da79df",
            "188e6d5f-4f72-4e22-a93f-cc0cf304639b"
          ],
          "display_name": false
        },
        {
          "uuid": "a9b2b836-459b-41ef-af63-cc821380efe9",
          "name": "CARBOPHENOTHION [MI]",
          "stdName": "CARBOPHENOTHION [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41251ee7-4ab4-49d3-b6e3-5435256e4eca",
            "188e6d5f-4f72-4e22-a93f-cc0cf304639b"
          ],
          "display_name": false
        },
        {
          "uuid": "2dcae18b-0092-482b-a465-d47c0f6f26af",
          "name": "NSC-231691",
          "stdName": "NSC-231691",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "400ed97f-7c2e-473d-9023-db39deee86bf",
            "188e6d5f-4f72-4e22-a93f-cc0cf304639b"
          ],
          "display_name": false
        },
        {
          "uuid": "dfd560e8-3015-4ab2-a55e-4ce78bbb8194",
          "name": "R 1303",
          "stdName": "R 1303",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a28486ac-be27-48ec-a674-04bff6b3ac40",
            "188e6d5f-4f72-4e22-a93f-cc0cf304639b"
          ],
          "display_name": false
        },
        {
          "uuid": "5ac0724b-9626-42da-add9-102f0573962c",
          "name": "R-1303",
          "stdName": "R-1303",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "989f98bd-6661-4c49-9ae5-ee83ebcb26e7"
          ],
          "display_name": false
        },
        {
          "uuid": "ad9f1ac8-4993-4577-a00f-2364fc4bcac2",
          "name": "S-(((4-CHLOROPHENYL)THIO)METHYL) O,O-DIETHYL PHOSPHORODITHIOATE",
          "stdName": "S-(((4-CHLOROPHENYL)THIO)METHYL) O,O-DIETHYL PHOSPHORODITHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fae205c-52c7-4b34-bdc8-69f3fe27bf2b",
            "48ac1df1-5c8b-413d-b37b-7ee0ad3e913a"
          ],
          "display_name": false
        },
        {
          "uuid": "0519b278-757a-4107-aeab-0039697adaa4",
          "name": "S-(((P-CHLOROPHENYL)THIO)METHYL) O,O-DIETHYL PHOSPHORODITHIOATE",
          "stdName": "S-(((P-CHLOROPHENYL)THIO)METHYL) O,O-DIETHYL PHOSPHORODITHIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "989f98bd-6661-4c49-9ae5-ee83ebcb26e7"
          ],
          "display_name": false
        },
        {
          "uuid": "f0a3b455-dfc9-41ea-bc82-e980fdb84a9d",
          "name": "S-4-CHLOROPHENYLTHIOMETHYL O,O-DIETHYL PHOSPHORODITHIOATE",
          "stdName": "S-4-CHLOROPHENYLTHIOMETHYL O,O-DIETHYL PHOSPHORODITHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b25988ae-fa4b-416e-9ab8-c82c1194d1c8",
            "48ac1df1-5c8b-413d-b37b-7ee0ad3e913a"
          ],
          "display_name": false
        },
        {
          "uuid": "b7fde7cb-dab2-40b1-8e35-13c91bb383d3",
          "name": "carbofenotion [INN]",
          "stdName": "CARBOFENOTION [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ce4fe2c-6301-4799-8437-b0627171a8fe"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "989f98bd-6661-4c49-9ae5-ee83ebcb26e7",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "48ac1df1-5c8b-413d-b37b-7ee0ad3e913a",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fae205c-52c7-4b34-bdc8-69f3fe27bf2b",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b25988ae-fa4b-416e-9ab8-c82c1194d1c8",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ce4fe2c-6301-4799-8437-b0627171a8fe",
          "citation": "INN Proposed List 23",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL23.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9bc3c401-0af2-4536-aaa6-40389e5c6e5f",
          "citation": "BAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "188e6d5f-4f72-4e22-a93f-cc0cf304639b",
          "citation": "BAN",
          "doc_type": "BAN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dddf7f00-6565-4b54-809b-27aa31461b90",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41251ee7-4ab4-49d3-b6e3-5435256e4eca",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae657096-fd1d-4303-a7bd-ba6082da79df",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "400ed97f-7c2e-473d-9023-db39deee86bf",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a28486ac-be27-48ec-a674-04bff6b3ac40",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa1b8733-50f4-44b7-9b94-f160d483dda6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389712000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "376f1279-441a-4df6-90a4-a30d018b724b",
          "citation": "SRS import [998NGA2Q61]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=998NGA2Q61",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389712000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd931c16-f6b2-46d9-9008-d404b5d758bf",
          "citation": "CARBOFENOTION [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "47f948b3-5523-421f-9bb3-e4c319c5e1fc",
          "citation": "CARBOPHENOTHION [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ca6f1e2a-3d47-4c57-a956-cecb1a67a2c3",
          "citation": "CARBOPHENOTHION [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "923d2bb0-4be6-45d6-ba21-fa0438d55c3c",
          "citation": "CARBOPHENOTHION [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3024e515-16a9-b499-de75-10bdb24857c3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+786-19-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c0c46f2a-cc3a-7744-f69f-c14ad69cfcdf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=786-19-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "75d11501-3f5c-7477-56a1-e20f4579c74f",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "17a87230-337e-4109-b820-f7650a517b10",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ca076eb1-89b7-032d-ee64-c5b65e4c6983",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "d5e90eb7-0e84-9197-c091-1e32d98d2c68",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "96344ef0-0982-f9e8-69af-5a18235fd7d8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1bfa31c4-c358-4468-88ea-5bf83471dcfa",
          "id": "1bfa31c4-c358-4468-88ea-5bf83471dcfa",
          "molfile": "\n  Marvin  01132101382D          \n\n 18 18  0  0  0  0            999 V2000\n    0.0000   -2.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7256   -1.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7541   -1.1066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4771   -0.7152    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0262   -0.0182    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1224   -0.2099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8947   -0.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5477    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0395   -1.3165    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8480   -1.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4155   -1.7363    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2241   -1.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4495   -0.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2658   -0.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8307   -1.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6341   -0.9796    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5846   -1.9617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7838   -2.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  9  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 18 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CCOP(=S)(OCC)SCSc1ccc(cc1)Cl",
          "formula": "C11H16ClO2PS3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "72ea223f-f6ce-4400-8892-6574f0bef1b8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "342.8689",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6bf978a8-a828-4d5c-9ed5-384dd3be314b",
      "version": "9",
      "structure": {
        "id": "090a4bcb-8c48-47fa-a194-fc3ce4e96cfc",
        "molfile": "\n  Marvin  01132100442D          \n\n 18 18  0  0  0  0            999 V2000\n    1.4771   -0.7152    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0395   -1.3165    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0262   -0.0182    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8480   -1.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7541   -1.1066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1224   -0.2099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4155   -1.7363    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2241   -1.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8307   -1.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6341   -0.9796    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.7838   -2.1483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4495   -0.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2658   -0.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5846   -1.9617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7256   -1.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8947   -0.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5477    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12  8  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 11  1  0  0  0  0\n 15  5  1  0  0  0  0\n 16  6  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 16  1  0  0  0  0\n 14  9  2  0  0  0  0\nM  END",
        "smiles": "CCOP(=S)(OCC)SCSc1ccc(cc1)Cl",
        "formula": "C11H16ClO2PS3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "342.8689",
        "optical_activity": "NONE",
        "references": [
          "989f98bd-6661-4c49-9ae5-ee83ebcb26e7",
          "376f1279-441a-4df6-90a4-a30d018b724b",
          "2ce4fe2c-6301-4799-8437-b0627171a8fe"
        ],
        "stereo_centers": 0
      },
      "unii": "998NGA2Q61"
    }
  ]
}