{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8de86b83-e93b-4dde-b2a6-a8332802b73c",
          "code": "868839-23-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=868839-23-0",
          "code_system": "CAS",
          "references": [
            "377d50c6-4f11-453f-8795-a3d0c45f7028",
            "08fe5e7b-f69a-4934-84ea-c3e0a127f7d3"
          ]
        },
        {
          "uuid": "9c80b7bf-cd2d-48e7-b3d8-d20cb3721fe7",
          "code": "1427011",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1427011/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "377d50c6-4f11-453f-8795-a3d0c45f7028"
          ]
        },
        {
          "uuid": "e700dd1e-c51d-4b4a-81f2-f0dc980fefc9",
          "code": "11855339",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11855339",
          "code_system": "PUBCHEM",
          "references": [
            "377d50c6-4f11-453f-8795-a3d0c45f7028"
          ]
        },
        {
          "uuid": "2e20cb6d-7c03-43b6-b919-bc587bfa8700",
          "code": "991Z19V2OD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b0d11057-f9cc-e2fc-90c4-df227c7f7f8e",
          "code": "991Z19V2OD",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=991Z19V2OD",
          "code_system": "DAILYMED",
          "references": [
            "fd088d0a-1269-7783-2b6b-59fca11b97ed"
          ]
        },
        {
          "uuid": "28b600fa-c269-6b57-c7b3-54b7b6672c1d",
          "code": "300000000261",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0cbcea75-1f3a-68d2-9615-dc99908f7c5d"
          ]
        },
        {
          "uuid": "b3e3e630-c84e-fda2-495d-8c73a2e866b1",
          "code": "DTXSID501007165",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501007165",
          "code_system": "EPA CompTox",
          "references": [
            "00aceae0-5c91-15ec-5e47-6cd4830e1e0f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f9fda834-97b9-4441-9d2f-7de2c653c2d3",
          "name": "2-PROPYLHEPTYL CAPRYLATE",
          "stdName": "2-PROPYLHEPTYL CAPRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2aedfff8-952a-46d7-8be3-033e73158172",
            "cfda9a1f-2a72-4f73-a5d5-207d26ad3cb4"
          ],
          "display_name": false
        },
        {
          "uuid": "5708471a-31f5-4ade-ae94-1e5cfb4a31e1",
          "name": "CETIOL SENSOFT",
          "stdName": "CETIOL SENSOFT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2aedfff8-952a-46d7-8be3-033e73158172",
            "cfda9a1f-2a72-4f73-a5d5-207d26ad3cb4"
          ],
          "display_name": false
        },
        {
          "uuid": "3b723160-b4b9-4ebe-8cf5-f4fc0ad62213",
          "name": "OCTANOIC ACID, 4-METHYL-2-PENTYLBUTYL ESTER",
          "stdName": "OCTANOIC ACID, 4-METHYL-2-PENTYLBUTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3525537-cc4c-46fc-8d5e-47321f71b3cb",
            "cfda9a1f-2a72-4f73-a5d5-207d26ad3cb4"
          ],
          "display_name": false
        },
        {
          "uuid": "599b6439-7503-4696-9e31-2be154ea7a61",
          "name": "PROPYLHEPTYL CAPRYLATE",
          "stdName": "PROPYLHEPTYL CAPRYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66d0c5fb-6aa1-4f34-b8de-3e35e020d1da",
            "4793a8d6-b4d6-42d4-9839-445ef1cb8ece",
            "0cd9543c-5d6b-4c8c-92b0-790effcd77f9",
            "cfda9a1f-2a72-4f73-a5d5-207d26ad3cb4"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d14cd4f6-ffdd-44ab-8d1b-bec5f0504077",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "f3525537-cc4c-46fc-8d5e-47321f71b3cb",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cfda9a1f-2a72-4f73-a5d5-207d26ad3cb4",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2aedfff8-952a-46d7-8be3-033e73158172",
          "citation": "http://www.gmzinc.com/uploads/docs/MSDS_Cetiol%20Sensoft.pdf",
          "url": "http://www.gmzinc.com/uploads/docs/MSDS_Cetiol%20Sensoft.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0cd9543c-5d6b-4c8c-92b0-790effcd77f9",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66d0c5fb-6aa1-4f34-b8de-3e35e020d1da",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "377d50c6-4f11-453f-8795-a3d0c45f7028",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391045000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5216a8c3-908e-4172-8d96-eacff1bfba71",
          "citation": "SRS import [991Z19V2OD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=991Z19V2OD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391045000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4793a8d6-b4d6-42d4-9839-445ef1cb8ece",
          "citation": "PROPYLHEPTYL CAPRYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0cbcea75-1f3a-68d2-9615-dc99908f7c5d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "08fe5e7b-f69a-4934-84ea-c3e0a127f7d3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fd088d0a-1269-7783-2b6b-59fca11b97ed",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "00aceae0-5c91-15ec-5e47-6cd4830e1e0f",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "446ee717-18bb-41e2-ae1f-ff4434468fde",
          "id": "446ee717-18bb-41e2-ae1f-ff4434468fde",
          "molfile": "\n  Marvin  01132103362D          \n\n 20 19  0  0  0  0            999 V2000\n    2.7384   -7.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4546   -7.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1657   -7.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8818   -7.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5933   -7.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3090   -7.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0205   -7.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7361   -7.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7361   -6.3188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4523   -7.5553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1639   -7.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8795   -7.5553    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.8795   -8.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5911   -8.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5911   -9.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5911   -7.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3067   -7.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0182   -7.1449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7297   -7.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4408   -7.1450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCC(=O)OCC(CCC)CCCCC",
          "formula": "C18H36O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4c2e3230-2853-4eeb-9789-201833234f3e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "284.4779",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5fa5609f-9ba2-45e4-8f4f-b63aa21cbc67",
      "version": "10",
      "structure": {
        "id": "d19d319c-2aa0-4c65-8171-27363230ec28",
        "molfile": "\n  Marvin  01132110502D          \n\n 20 19  0  0  0  0            999 V2000\n    2.7382   -7.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4543   -7.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1654   -7.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8814   -7.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5928   -7.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3085   -7.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0199   -7.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7355   -7.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4516   -7.5547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1631   -7.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8787   -7.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5902   -7.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3058   -7.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0172   -7.1443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7286   -7.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4397   -7.1444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8787   -8.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5902   -8.7914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5902   -9.6174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7355   -6.3183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 11 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n  8 20  2  0  0  0  0\nM  END",
        "smiles": "CCCCCCCC(=O)OCC(CCC)CCCCC",
        "formula": "C18H36O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "284.4779",
        "optical_activity": "( + / - )",
        "references": [
          "0cd9543c-5d6b-4c8c-92b0-790effcd77f9",
          "5216a8c3-908e-4172-8d96-eacff1bfba71"
        ],
        "stereo_centers": 1
      },
      "unii": "991Z19V2OD"
    }
  ]
}