{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f4691a8a-d89f-4126-bdd0-3429e723fd4c",
          "code": "741-58-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=741-58-2",
          "code_system": "CAS",
          "references": [
            "96186f4c-d4df-4e2a-bb0e-4edd9f987027",
            "88b74631-ac0a-479e-a566-3ae64f73ea08"
          ]
        },
        {
          "uuid": "819cc3a8-e645-4bc4-92c8-ad3d7ef00e3a",
          "code": "BENSULIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bensulide",
          "code_system": "WIKIPEDIA",
          "references": [
            "96186f4c-d4df-4e2a-bb0e-4edd9f987027"
          ]
        },
        {
          "uuid": "abe8aaba-958d-46fa-864d-73a484a24c14",
          "code": "9801",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1407",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "96186f4c-d4df-4e2a-bb0e-4edd9f987027"
          ]
        },
        {
          "uuid": "022c8861-b113-4dad-8188-aeeef4523476",
          "code": "212-010-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.919",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "96186f4c-d4df-4e2a-bb0e-4edd9f987027"
          ]
        },
        {
          "uuid": "4c867f6a-1aa1-40e7-bdd4-27e91eac2ea9",
          "code": "12932",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12932",
          "code_system": "PUBCHEM",
          "references": [
            "96186f4c-d4df-4e2a-bb0e-4edd9f987027"
          ]
        },
        {
          "uuid": "609efe36-78bf-4b10-72f0-e6e8a22c647a",
          "code": "393",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/393",
          "code_system": "HSDB",
          "references": [
            "6fc688e6-7e5b-41ee-cb58-7ab6b80e6e32"
          ]
        },
        {
          "uuid": "a6b07cb9-9511-1c1d-d6b8-45e0f89f0b70",
          "code": "DTXSID9032329",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9032329",
          "code_system": "EPA CompTox",
          "references": [
            "6824e21b-2659-a5b7-50ef-0549c4af3965"
          ]
        },
        {
          "uuid": "916d74b7-a369-49e7-b610-2789de85862b",
          "code": "9882BW2Q2S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "67f0bca5-aa47-a098-d67f-2086f9992f6c",
          "code": "bensulide",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/bensulide.html",
          "code_system": "ALANWOOD",
          "references": [
            "824e6f10-ee60-f382-7c23-9797abaa6376"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "85dc200c-2685-44bb-86b7-c7c092a8ccd6",
          "name": "(N-(2-ETHYLTHIO)BENZENE SULFONAMIDO-S,O,O- DIISOPROPYLPHOSPHORODITHIOATE",
          "stdName": "(N-(2-ETHYLTHIO)BENZENE SULFONAMIDO-S,O,O- DIISOPROPYLPHOSPHORODITHIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08fbb627-00f1-4b30-a3f0-8c8d0ccf4833",
            "6a8cc240-882d-4149-9064-af47ee76cbc4"
          ],
          "display_name": false
        },
        {
          "uuid": "467fb074-41d5-4f3d-b2fe-18406bc4baa9",
          "name": "BENSULIDE",
          "stdName": "BENSULIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2820ef5d-d7d5-4f59-a1be-c02bf2747dc9",
            "08fbb627-00f1-4b30-a3f0-8c8d0ccf4833",
            "6a8cc240-882d-4149-9064-af47ee76cbc4",
            "ffa3b05a-ce1b-4cd5-a20f-5c64cc2853a1",
            "d88d9476-4bb5-4031-9e58-aab2504298f3",
            "aa0d2aa6-01c2-4af8-be0e-c9ba54e39c51"
          ],
          "display_name": true
        },
        {
          "uuid": "4486a0e9-8f93-467d-b74c-217e16f75738",
          "name": "BENSULIDE [HSDB]",
          "stdName": "BENSULIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08fbb627-00f1-4b30-a3f0-8c8d0ccf4833",
            "ffa3b05a-ce1b-4cd5-a20f-5c64cc2853a1"
          ],
          "display_name": false
        },
        {
          "uuid": "22e721ad-b917-4d63-a5bf-ea01974d330d",
          "name": "BENSULIDE [ISO]",
          "stdName": "BENSULIDE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08fbb627-00f1-4b30-a3f0-8c8d0ccf4833",
            "aa0d2aa6-01c2-4af8-be0e-c9ba54e39c51"
          ],
          "display_name": false
        },
        {
          "uuid": "b6482e0e-02fd-496e-ab1d-c4e2812c79c5",
          "name": "BENSUMEC",
          "stdName": "BENSUMEC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08fbb627-00f1-4b30-a3f0-8c8d0ccf4833",
            "6a8cc240-882d-4149-9064-af47ee76cbc4"
          ],
          "display_name": false
        },
        {
          "uuid": "73f6e9c1-ec6f-40a3-bfcb-ecd73ab2e465",
          "name": "BENZULFIDE",
          "stdName": "BENZULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08fbb627-00f1-4b30-a3f0-8c8d0ccf4833",
            "e21aa450-7490-43a0-9913-7d7e23a856b9"
          ],
          "display_name": false
        },
        {
          "uuid": "98694a58-fc87-44e7-b7b2-71dff9ef3fbd",
          "name": "BETASAN",
          "stdName": "BETASAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08fbb627-00f1-4b30-a3f0-8c8d0ccf4833",
            "6a8cc240-882d-4149-9064-af47ee76cbc4"
          ],
          "display_name": false
        },
        {
          "uuid": "114d0d1b-72a4-4e92-992e-aad8b9835448",
          "name": "PHOSPHORODITHIOIC ACID-O,O-BIS(1-METHYLETHYL)-S-(2-((PHENYLSULFONYL)AMINO)ETHYL)ESTER",
          "stdName": "PHOSPHORODITHIOIC ACID-O,O-BIS(1-METHYLETHYL)-S-(2-((PHENYLSULFONYL)AMINO)ETHYL)ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08fbb627-00f1-4b30-a3f0-8c8d0ccf4833",
            "e21aa450-7490-43a0-9913-7d7e23a856b9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6a8cc240-882d-4149-9064-af47ee76cbc4",
          "citation": "DOSE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "08fbb627-00f1-4b30-a3f0-8c8d0ccf4833",
          "citation": "DOSE",
          "doc_type": "DOSE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e21aa450-7490-43a0-9913-7d7e23a856b9",
          "citation": "SITTIGS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ffa3b05a-ce1b-4cd5-a20f-5c64cc2853a1",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa0d2aa6-01c2-4af8-be0e-c9ba54e39c51",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96186f4c-d4df-4e2a-bb0e-4edd9f987027",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390175000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71537af5-191d-4d1d-a9bb-a0b27b75a5e7",
          "citation": "SRS import [9882BW2Q2S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9882BW2Q2S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390175000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d88d9476-4bb5-4031-9e58-aab2504298f3",
          "citation": "BENSULIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2820ef5d-d7d5-4f59-a1be-c02bf2747dc9",
          "citation": "BENSULIDE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6fc688e6-7e5b-41ee-cb58-7ab6b80e6e32",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+741-58-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6824e21b-2659-a5b7-50ef-0549c4af3965",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=741-58-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "824e6f10-ee60-f382-7c23-9797abaa6376",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "88b74631-ac0a-479e-a566-3ae64f73ea08",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6fce30af-90fe-4e30-bbd5-886f6f8aef65",
          "id": "6fce30af-90fe-4e30-bbd5-886f6f8aef65",
          "molfile": "\n  Marvin  01132105482D          \n\n 23 23  0  0  0  0            999 V2000\n    3.6383    0.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0138   -0.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6197   -1.0160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3520   -0.4319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5877   -0.4319    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5877    0.3883    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5877   -1.2894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5877   -1.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1563   -2.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0719   -2.4794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8513   -0.4319    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4878    0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2983    0.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5748    1.0035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4230    1.0222    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4230    0.2051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3950    1.8611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2432    1.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6534    0.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4767    0.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9117    0.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5109    1.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6813    1.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  5  1  0  0  0  0\n  5 11  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 15  2  0  0  0  0\n 18 15  1  0  0  0  0\n 19 18  1  0  0  0  0\n 23 18  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "CC(C)OP(=S)(OC(C)C)SCCNS(=O)(=O)c1ccccc1",
          "formula": "C14H24NO4PS3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "806165c3-cd55-4aa7-936b-412fe5c37a79"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "397.5172",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f1f75abf-f7f5-4a8d-bfae-a212740b9105",
      "version": "5",
      "structure": {
        "id": "efca269a-67e6-4a95-b1c9-a102954bbeb9",
        "molfile": "\n  Marvin  01132112262D          \n\n 23 23  0  0  0  0            999 V2000\n   -1.4230    1.0222    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5877   -0.4319    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5877    0.3883    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4230    0.2051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3950    1.8611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2432    1.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5748    1.0035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5877   -1.2894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3520   -0.4319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8513   -0.4319    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2983    0.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4878    0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0138   -0.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5877   -1.9605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6813    1.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6534    0.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6383    0.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6197   -1.0160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1563   -2.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0719   -2.4794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4767    0.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5109    1.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9117    0.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2 10  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  2  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15  6  2  0  0  0  0\n 16  6  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 13  1  0  0  0  0\n 19 14  1  0  0  0  0\n 20 14  1  0  0  0  0\n 21 16  2  0  0  0  0\n 22 15  1  0  0  0  0\n 23 21  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
        "smiles": "CC(C)OP(=S)(OC(C)C)SCCNS(=O)(=O)c1ccccc1",
        "formula": "C14H24NO4PS3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "397.5172",
        "optical_activity": "NONE",
        "references": [
          "71537af5-191d-4d1d-a9bb-a0b27b75a5e7",
          "e21aa450-7490-43a0-9913-7d7e23a856b9"
        ],
        "stereo_centers": 0
      },
      "unii": "9882BW2Q2S"
    }
  ]
}