{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b576a17a-4586-4942-9fe3-cf09be23ca32",
          "code": "66-81-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=66-81-9",
          "code_system": "CAS",
          "references": [
            "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d",
            "bb504343-ed4d-40bf-b20b-df7ae2d61253"
          ]
        },
        {
          "uuid": "3caf6685-86a3-49d2-8753-27d7be9e9c25",
          "code": "D003513",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68003513",
          "code_system": "MESH",
          "references": [
            "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d"
          ]
        },
        {
          "uuid": "b41b2fbe-1b38-44a5-b9eb-c1c7f22220b2",
          "code": "CYCLOHEXIMIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cycloheximide",
          "code_system": "WIKIPEDIA",
          "references": [
            "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d"
          ]
        },
        {
          "uuid": "79feda8d-e614-4338-91f7-5cbebefb9ccb",
          "code": "SUB06242MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d"
          ]
        },
        {
          "uuid": "3379254c-dca6-4458-8888-4b4696964973",
          "code": "43401",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:698",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d"
          ]
        },
        {
          "uuid": "0da03985-6997-4026-a8c5-b9276b4aa2a8",
          "code": "4061",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4061",
          "code_system": "INN",
          "references": [
            "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d"
          ]
        },
        {
          "uuid": "efcbc3ae-39a7-44be-9e73-6e38d9bba49f",
          "code": "m3991",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3991?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d"
          ]
        },
        {
          "uuid": "c4d351dd-bfef-4be5-877a-ddb1661b7323",
          "code": "CHEMBL123292",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL123292",
          "code_system": "ChEMBL",
          "references": [
            "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d"
          ]
        },
        {
          "uuid": "435f038f-2ecd-47a5-9401-284c1815cc11",
          "code": "200-636-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.578",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d"
          ]
        },
        {
          "uuid": "eb393786-d483-4f02-9a41-ad17cb81a922",
          "code": "6197",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6197",
          "code_system": "PUBCHEM",
          "references": [
            "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d"
          ]
        },
        {
          "uuid": "421d3024-0f49-188e-30b9-609c2fb1007c",
          "code": "1552",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1552",
          "code_system": "HSDB",
          "references": [
            "b7a9cd6b-379d-a5e3-115c-6f41ad97f9c4"
          ]
        },
        {
          "uuid": "ba5d785d-c22a-ae9e-a3e3-e0271ffcae20",
          "code": "DTXSID6024882",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6024882",
          "code_system": "EPA CompTox",
          "references": [
            "c8b84645-6c1c-eb1f-9566-becd9bf89757"
          ]
        },
        {
          "uuid": "6d1bd34a-f5e2-36a1-5a56-31b6979eb19e",
          "code": "C171712",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C171712",
          "code_system": "NCI_THESAURUS",
          "references": [
            "580d50e9-4676-e352-ce84-c20a06d15cfc"
          ]
        },
        {
          "uuid": "ac8ba52e-8ee6-4b3d-b48a-2aa9bc8c1519",
          "code": "98600C0908",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "53480569-50b7-6c58-7b1e-0a471c952eea",
          "code": "27641",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27641",
          "code_system": "CHEBI",
          "references": [
            "adc84dbf-ac14-05ef-0478-6820a5e890e7"
          ]
        },
        {
          "uuid": "2b6161b3-aefb-503a-e1b6-e74489438039",
          "code": "100000081907",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "50d3b504-9b55-3169-0ba7-1c6fc720c8b0"
          ]
        },
        {
          "uuid": "8ee977d7-fb31-b5eb-b4df-c71d6297bae3",
          "code": "cycloheximide",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/cycloheximide.html",
          "code_system": "ALANWOOD",
          "references": [
            "fe8066aa-60fd-5f4e-0c45-ed8ea33d0bea"
          ]
        },
        {
          "uuid": "71f36788-83fa-ebce-1f3c-691f0942169b",
          "code": "185",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=185",
          "code_system": "NSC",
          "references": [
            "0cc96b99-ddef-aa31-c706-3c13f19160fe"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3cd35943-8a95-4e79-b7ce-c6c5d6d09d6c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8aac4d55-7276-407a-a2f3-69ea83aa8766",
            "refuuid": "e6fef8ac-a383-4a18-a0cb-58865eb68d4f",
            "name": "CYCLOHEXIMIDE",
            "unii": "98600C0908",
            "linking_id": "98600C0908",
            "ref_pname": "CYCLOHEXIMIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "81785a1a-12c1-449c-a612-5913ae68faf3",
          "name": "2,6-PIPERIDINEDIONE, 4-(2-(3,5-DIMETHYL-2-OXOCYCLOHEXYL)-2-HYDROXYETHYL)-, (1S-(1.ALPHA.(S*),3.ALPHA.,5.BETA.))-",
          "stdName": "2,6-PIPERIDINEDIONE, 4-(2-(3,5-DIMETHYL-2-OXOCYCLOHEXYL)-2-HYDROXYETHYL)-, (1S-(1.ALPHA.(S*),3.ALPHA.,5.BETA.))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1af9f6d2-02c8-4cfa-9014-23c54d3f5643"
          ],
          "display_name": false
        },
        {
          "uuid": "493c5673-6579-46ab-919f-13f4d643061d",
          "name": "3-[(R)-2-[(1S,3S,5S)-3,5-Dimethyl-2-oxocyclohexyl]-2-hydroxyethyl]glutarimide",
          "stdName": "3-((R)-2-((1S,3S,5S)-3,5-DIMETHYL-2-OXOCYCLOHEXYL)-2-HYDROXYETHYL)GLUTARIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1af9f6d2-02c8-4cfa-9014-23c54d3f5643"
          ],
          "display_name": false
        },
        {
          "uuid": "d8b9929b-9350-4ed4-8abb-dc2f01b4b6f4",
          "name": "4-((2R)-2-((1S,3S,5S)-3,5-DIMETHYL-2-OXOCYCLOHEXYL)-2-HYDROXYETHYL)-2,6-PIPERIDINEDIONE",
          "stdName": "4-((2R)-2-((1S,3S,5S)-3,5-DIMETHYL-2-OXOCYCLOHEXYL)-2-HYDROXYETHYL)-2,6-PIPERIDINEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8159ac7-e5f6-48e4-88a1-9be00b4b406c",
            "c8c613fe-703e-4b90-8dcd-45f045c65a99"
          ],
          "display_name": false
        },
        {
          "uuid": "e47c1861-be96-4264-b27d-e1fe5854fbb0",
          "name": "4-((2R)-2-((1S,3S,5S)-3,5-DIMETHYL-2-OXOCYCLOHEXYL)-2-HYDROXYETHYL)PIPERIDINE-2,6-DIONE",
          "stdName": "4-((2R)-2-((1S,3S,5S)-3,5-DIMETHYL-2-OXOCYCLOHEXYL)-2-HYDROXYETHYL)PIPERIDINE-2,6-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5dc4d6a1-28bb-4351-87b1-7d6a70ca157e",
            "c8c613fe-703e-4b90-8dcd-45f045c65a99"
          ],
          "display_name": false
        },
        {
          "uuid": "877405c9-beb7-4501-ab45-f28fc5582f56",
          "name": "CICLOHEXIMIDE",
          "stdName": "CICLOHEXIMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "57920ec7-60e7-4d02-b693-c214edfeca82",
            "432fb80f-cc65-483c-94b6-f6f03ce803ce",
            "d70eea88-205f-4034-b55e-9cb896d26116",
            "5a02a95a-0e83-4864-8369-b25eb3147805",
            "1a5ff765-7da1-4dcc-98f1-bd1e34b03bf8",
            "e34ec486-4c61-4031-8f43-6fc294eb4d3b"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "15523048-ab2f-4481-a78d-f3a15ef1b7a8",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "aa91656f-056d-4617-9e7b-179c6d976921",
          "name": "CICLOHEXIMIDE [MART.]",
          "stdName": "CICLOHEXIMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a02a95a-0e83-4864-8369-b25eb3147805"
          ],
          "display_name": false
        },
        {
          "uuid": "a1c4f49e-b89a-4f4b-bc1d-9dda99a99ad9",
          "name": "CYCLOHEXIMIDE",
          "stdName": "CYCLOHEXIMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74b25480-1407-46aa-866d-0ff478011e34",
            "0179186c-c8a1-4efd-8b22-231177ea0cde",
            "cf22e733-fd1c-40ab-b69f-d3a4679c6fe0",
            "00f2dc0f-58d7-495f-9a53-0d1f279b9f26",
            "63bcc4d6-2c12-4904-8a43-ad4d51bb57b2",
            "24f9c0c1-933e-44a0-b844-843e0599f1b3",
            "432fb80f-cc65-483c-94b6-f6f03ce803ce",
            "cee1ddad-4ec4-410d-a176-b00564ed78f7",
            "4fc0a519-5786-4ff5-80a8-55aa29648633",
            "33b2808b-7181-4235-826f-177a284ea7d0"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "2e8f16f9-e56d-42b9-a5fe-66fc221b663d",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "d56792ba-a19d-4903-ae90-4b6c836d1884",
          "name": "CYCLOHEXIMIDE [HSDB]",
          "stdName": "CYCLOHEXIMIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "432fb80f-cc65-483c-94b6-f6f03ce803ce",
            "cee1ddad-4ec4-410d-a176-b00564ed78f7"
          ],
          "display_name": false
        },
        {
          "uuid": "f575d3a3-a557-4c03-8408-8cd038cf583e",
          "name": "CYCLOHEXIMIDE [ISO]",
          "stdName": "CYCLOHEXIMIDE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "432fb80f-cc65-483c-94b6-f6f03ce803ce",
            "cf22e733-fd1c-40ab-b69f-d3a4679c6fe0"
          ],
          "display_name": false
        },
        {
          "uuid": "f640a84e-3b07-4f22-a21c-5ff1b7da4232",
          "name": "CYCLOHEXIMIDE [MI]",
          "stdName": "CYCLOHEXIMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "432fb80f-cc65-483c-94b6-f6f03ce803ce",
            "4fc0a519-5786-4ff5-80a8-55aa29648633"
          ],
          "display_name": false
        },
        {
          "uuid": "99eff54e-e2fc-4617-a0e1-e7edc041f5df",
          "name": "CYCLOHEXIMIDE [USAN]",
          "stdName": "CYCLOHEXIMIDE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24f9c0c1-933e-44a0-b844-843e0599f1b3"
          ],
          "display_name": false
        },
        {
          "uuid": "74eb665e-d10b-4a65-84b7-f6d5ca91db5b",
          "name": "NSC-185",
          "stdName": "NSC-185",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "432fb80f-cc65-483c-94b6-f6f03ce803ce",
            "334e5055-91c1-4d3c-a797-f2e015b722cb"
          ],
          "display_name": false
        },
        {
          "uuid": "a58579ed-08dc-4f06-a230-397ae2981dc4",
          "name": "U-4527",
          "stdName": "U-4527",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1af9f6d2-02c8-4cfa-9014-23c54d3f5643"
          ],
          "display_name": false
        },
        {
          "uuid": "5953eec9-7786-44cc-8217-b989c6f0576c",
          "name": "cicloheximide [INN]",
          "stdName": "CICLOHEXIMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e34ec486-4c61-4031-8f43-6fc294eb4d3b",
            "eedb287b-0e31-4f79-829d-6287814c6eda"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "63bcc4d6-2c12-4904-8a43-ad4d51bb57b2",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1af9f6d2-02c8-4cfa-9014-23c54d3f5643",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8c613fe-703e-4b90-8dcd-45f045c65a99",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5dc4d6a1-28bb-4351-87b1-7d6a70ca157e",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "57920ec7-60e7-4d02-b693-c214edfeca82",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "432fb80f-cc65-483c-94b6-f6f03ce803ce",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8159ac7-e5f6-48e4-88a1-9be00b4b406c",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e34ec486-4c61-4031-8f43-6fc294eb4d3b",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24f9c0c1-933e-44a0-b844-843e0599f1b3",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a02a95a-0e83-4864-8369-b25eb3147805",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fc0a519-5786-4ff5-80a8-55aa29648633",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cee1ddad-4ec4-410d-a176-b00564ed78f7",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf22e733-fd1c-40ab-b69f-d3a4679c6fe0",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "334e5055-91c1-4d3c-a797-f2e015b722cb",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d9a0a52-2a8f-464a-80cc-2dcf129d2d5d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6cff864f-4eec-4885-98be-de8bb5dfcbcf",
          "citation": "SRS import [98600C0908]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=98600C0908",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d70eea88-205f-4034-b55e-9cb896d26116",
          "citation": "CICLOHEXIMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "33b2808b-7181-4235-826f-177a284ea7d0",
          "citation": "CYCLOHEXIMIDE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a5ff765-7da1-4dcc-98f1-bd1e34b03bf8",
          "citation": "CICLOHEXIMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "00f2dc0f-58d7-495f-9a53-0d1f279b9f26",
          "citation": "CYCLOHEXIMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0179186c-c8a1-4efd-8b22-231177ea0cde",
          "citation": "CYCLOHEXIMIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74b25480-1407-46aa-866d-0ff478011e34",
          "citation": "CYCLOHEXIMIDE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b7a9cd6b-379d-a5e3-115c-6f41ad97f9c4",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+66-81-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c8b84645-6c1c-eb1f-9566-becd9bf89757",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=66-81-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "580d50e9-4676-e352-ce84-c20a06d15cfc",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "bb504343-ed4d-40bf-b20b-df7ae2d61253",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "eedb287b-0e31-4f79-829d-6287814c6eda",
          "citation": "INN Proposed List 36",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL36.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fe8066aa-60fd-5f4e-0c45-ed8ea33d0bea",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "adc84dbf-ac14-05ef-0478-6820a5e890e7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0cc96b99-ddef-aa31-c706-3c13f19160fe",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "50d3b504-9b55-3169-0ba7-1c6fc720c8b0",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "419364a1-56c2-4967-b2d9-43b9a6017069",
          "id": "419364a1-56c2-4967-b2d9-43b9a6017069",
          "molfile": "\n  Marvin  01132103282D          \n\n 20 21  0  0  1  0            999 V2000\n    4.5408   -2.9509    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.5408   -1.8999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2542   -3.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9674   -2.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6855   -3.3551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3942   -2.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1217   -3.3551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3942   -2.1186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6855   -1.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6855   -0.8680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9674   -2.1186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8180   -3.3551    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.1095   -2.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3914   -3.3503    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.6734   -2.9366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3914   -4.1778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1000   -4.5915    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.1000   -5.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8180   -4.1778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5313   -4.5915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 12  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n 11  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 19  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  1  0  0  0\n 17 19  1  0  0  0  0\n 20 19  2  0  0  0  0\nM  END",
          "smiles": "C[C@H]1C[C@H](C)C(=O)[C@@H](C1)[C@@H](CC2CC(=O)NC(=O)C2)O",
          "formula": "C15H23NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "08f967d0-35e6-467b-9b8a-0cc5c85c665e"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "281.348",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e6fef8ac-a383-4a18-a0cb-58865eb68d4f",
      "version": "10",
      "structure": {
        "id": "dee9df00-e139-4444-b5e9-b60e02554e7b",
        "molfile": "\n  Marvin  01132111332D          \n\n 21 22  0  0  1  0            999 V2000\n    3.8162   -3.3535    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.8162   -4.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0985   -4.5893    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.0985   -5.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3903   -4.1758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3903   -3.3487    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.1080   -2.9400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6726   -2.9352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5292   -4.5893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5387   -2.9495    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.2517   -3.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9646   -2.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9646   -2.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6824   -1.6946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3907   -2.1176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3907   -2.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6824   -3.3535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1179   -3.3535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6824   -0.8676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5387   -1.8990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7383   -3.9619    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  1  1  0  0  0  0\n  6  8  1  6  0  0  0\n  9  2  2  0  0  0  0\n 10  1  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 16  2  0  0  0  0\n 19 14  2  0  0  0  0\n 10 20  1  6  0  0  0\n  1 21  1  6  0  0  0\nM  END",
        "smiles": "C[C@H]1C[C@H](C)C(=O)[C@@]([H])(C1)[C@@H](CC2CC(=O)NC(=O)C2)O",
        "formula": "C15H23NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "281.348",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6cff864f-4eec-4885-98be-de8bb5dfcbcf",
          "1af9f6d2-02c8-4cfa-9014-23c54d3f5643",
          "eedb287b-0e31-4f79-829d-6287814c6eda"
        ],
        "stereo_centers": 4
      },
      "unii": "98600C0908"
    }
  ]
}