{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0ef6fa48-242e-4379-8bc5-a7b7c0d24888",
          "code": "77-22-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77-22-5",
          "code_system": "CAS",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92",
            "b171c008-243f-4dee-98e2-ee08ea905228"
          ]
        },
        {
          "uuid": "7e40c167-d4a6-41c3-97c9-cac6fb15ef68",
          "code": "C004519",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67004519",
          "code_system": "MESH",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92"
          ]
        },
        {
          "uuid": "1f908b44-34b4-4114-8cf4-85304d26a55a",
          "code": "145",
          "comments": "LiverTox|Respiratory|Allergy symptoms|Anticholinergic",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/Caramiphen.htm",
          "code_system": "LIVERTOX",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92"
          ]
        },
        {
          "uuid": "d6c75849-d30e-4e20-81c0-ea3cfee92662",
          "code": "SUB06085MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92"
          ]
        },
        {
          "uuid": "6b891d49-ac1d-4418-8d68-e5bf1aa0b5dd",
          "code": "1268",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1268",
          "code_system": "INN",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92"
          ]
        },
        {
          "uuid": "644df614-3e65-4601-9f2f-4471aceb339f",
          "code": "C81594",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81594",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92"
          ]
        },
        {
          "uuid": "9276487b-e773-4ac4-9b76-39119414bcd2",
          "code": "20191",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/20191/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92"
          ]
        },
        {
          "uuid": "7f7789a3-d996-4def-8fb7-2468139bbb69",
          "code": "m3048",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3048?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92"
          ]
        },
        {
          "uuid": "cbd3e533-98c8-442c-8b73-00b8370fa986",
          "code": "CHEMBL61946",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL61946",
          "code_system": "ChEMBL",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92"
          ]
        },
        {
          "uuid": "ab3701be-8c71-4f67-ae36-15ccd660ab73",
          "code": "201-013-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.922",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92"
          ]
        },
        {
          "uuid": "86e858e1-0dff-4620-b8d3-dcf9024b31c3",
          "code": "6472",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6472",
          "code_system": "PUBCHEM",
          "references": [
            "e2a1d039-576c-44ce-8ddc-86e045bd8a92"
          ]
        },
        {
          "uuid": "90617b29-e12b-e18f-02e6-cb2db0d3f852",
          "code": "Caramiphen",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Caramiphen",
          "code_system": "WIKIPEDIA",
          "references": [
            "15551b23-0c28-7f37-8dc7-972a06bd37ac"
          ]
        },
        {
          "uuid": "45cde285-14d7-cd4f-838d-b6e421f22d36",
          "code": "DTXSID0022729",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0022729",
          "code_system": "EPA CompTox",
          "references": [
            "f5aca9ae-bc09-c0f9-de8a-f0440dfeaa06"
          ]
        },
        {
          "uuid": "10cf065e-839f-d0a6-88c5-8934c3968ee9",
          "code": "C66917",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Respiratory System[C78273]|Antitussive Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66917",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cc0a8dd7-c6ea-5f9a-c948-7b58d63eaf62"
          ]
        },
        {
          "uuid": "29afefc7-57ec-4294-a4bc-56d14da6374e",
          "code": "97J7NP0XJY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fd09fd1a-e7c9-4d99-6ace-9c248a0d3181",
          "code": "486",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/486",
          "code_system": "DRUG CENTRAL",
          "references": [
            "cc0a8dd7-c6ea-5f9a-c948-7b58d63eaf62"
          ]
        },
        {
          "uuid": "2c3a5d8a-04c9-0a19-2b6c-b15d166b2a82",
          "code": "DB11504",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB11504",
          "code_system": "DRUG BANK",
          "references": [
            "cc0a8dd7-c6ea-5f9a-c948-7b58d63eaf62"
          ]
        },
        {
          "uuid": "488486cd-aef0-58ea-8c17-85b8cd43cb84",
          "code": "100000081627",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "dfe71624-b051-52ba-e5ae-f3a941b5e803"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d50f6481-cf33-47e0-be80-846191b492e1",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "80fafcae-5d18-461b-8e67-8ced9eb1ae4a",
            "refuuid": "849433cb-ed81-4843-9fe8-17f0cf1bbb98",
            "name": "CARAMIPHEN",
            "unii": "97J7NP0XJY",
            "linking_id": "97J7NP0XJY",
            "ref_pname": "CARAMIPHEN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5cc9ed32-bea1-46ed-bef1-566ce288d2d8",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "85231e90-e32b-4037-8ceb-5cd87f828ee6",
            "refuuid": "651e014d-f0cb-4692-8ef0-a947453a4a67",
            "name": "CARAMIPHEN EDISYLATE",
            "unii": "09TQU5PG95",
            "linking_id": "09TQU5PG95",
            "ref_pname": "CARAMIPHEN EDISYLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "99411e7d-2018-4800-85f8-c81abbb19c95",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "0bf29076-d0ce-4c77-972d-837eaaa01d40",
            "refuuid": "325cfae8-2515-45ee-ada9-e2492550b732",
            "name": "CARAMIPHEN HYDROCHLORIDE",
            "unii": "4858SN190E",
            "linking_id": "4858SN190E",
            "ref_pname": "CARAMIPHEN HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a8724864-dfba-4edc-8166-5b9777912d27",
          "name": "1-PHENYLCYCLOPENTANECARBOXYLIC ACID 2-(DIETHYLAMINO)ETHYL ESTER",
          "stdName": "1-PHENYLCYCLOPENTANECARBOXYLIC ACID 2-(DIETHYLAMINO)ETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3024a68-0a46-43b3-9c09-c37d3e918d04",
            "fb697938-cd8d-4ed4-8a05-5f5918236fab"
          ],
          "display_name": false
        },
        {
          "uuid": "e83467d2-356c-4d9b-a9e4-c116e8d3f23b",
          "name": "2-DIETHYLAMINOETHYL 1-PHENYLCYCLOPENTANE-1-CARBOXYLATE",
          "stdName": "2-DIETHYLAMINOETHYL 1-PHENYLCYCLOPENTANE-1-CARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "39e528ed-f4c1-48af-9176-10a9dfdcc99e"
          ],
          "display_name": false
        },
        {
          "uuid": "1abed6ff-f110-427a-ad9d-587e7a5fabb5",
          "name": "CARAMIPHEN",
          "stdName": "CARAMIPHEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3024a68-0a46-43b3-9c09-c37d3e918d04",
            "edbe25d6-745e-4171-91d1-7942379022c6",
            "efd20dc3-272a-4b4c-b70c-ad14add8dac4",
            "2df89c3a-4200-4ddc-93c4-2558011d0ac5",
            "4ebec3c1-b3c1-4ea2-9360-a53aa1823d08",
            "f60120be-e13f-4e1b-867d-fdeaf7e1fb84",
            "bf403732-2b31-4dfa-a1d3-87ea708ae3fa",
            "39e528ed-f4c1-48af-9176-10a9dfdcc99e",
            "693dfe3f-30cc-404f-b916-333db0d0b83c",
            "e081c111-0b37-4acb-8b55-27c663029dc1"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "d52dc4fe-37b1-44b8-92c5-e766b8e6ddd7",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "8706031a-0302-4c2c-a43d-993a5d89b2fe",
          "name": "CARAMIPHEN [MI]",
          "stdName": "CARAMIPHEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3024a68-0a46-43b3-9c09-c37d3e918d04",
            "e081c111-0b37-4acb-8b55-27c663029dc1"
          ],
          "display_name": false
        },
        {
          "uuid": "b995d2e2-c328-4bf9-b6d9-01aa48de8380",
          "name": "CARAMIPHEN [VANDF]",
          "stdName": "CARAMIPHEN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "edbe25d6-745e-4171-91d1-7942379022c6",
            "e3024a68-0a46-43b3-9c09-c37d3e918d04"
          ],
          "display_name": false
        },
        {
          "uuid": "5ac02c46-b720-2b45-d9bc-8415c8c2f01c",
          "name": "Caramiphen [WHO-DD]",
          "stdName": "CARAMIPHEN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b19e4d19-208a-5fdd-0ca3-c8cab90099b8"
          ],
          "display_name": false
        },
        {
          "uuid": "d542dcfb-abc3-4038-83a6-4ad0519d6d12",
          "name": "DIETHYLAMINOETHYL 1-PHENYLCYCLOPENTANE-1-CARBOXYLATE",
          "stdName": "DIETHYLAMINOETHYL 1-PHENYLCYCLOPENTANE-1-CARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3024a68-0a46-43b3-9c09-c37d3e918d04",
            "fb697938-cd8d-4ed4-8a05-5f5918236fab"
          ],
          "display_name": false
        },
        {
          "uuid": "2941b943-59a4-41ff-98ff-cc950198e451",
          "name": "caramiphen [INN]",
          "stdName": "CARAMIPHEN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "693dfe3f-30cc-404f-b916-333db0d0b83c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "39e528ed-f4c1-48af-9176-10a9dfdcc99e",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fb697938-cd8d-4ed4-8a05-5f5918236fab",
          "citation": "Merck Index 14th Edition",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3024a68-0a46-43b3-9c09-c37d3e918d04",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "693dfe3f-30cc-404f-b916-333db0d0b83c",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e081c111-0b37-4acb-8b55-27c663029dc1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f60120be-e13f-4e1b-867d-fdeaf7e1fb84",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "edbe25d6-745e-4171-91d1-7942379022c6",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2a1d039-576c-44ce-8ddc-86e045bd8a92",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02b86ed5-0d81-43ca-b131-9663abe1db2e",
          "citation": "SRS import [97J7NP0XJY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=97J7NP0XJY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf403732-2b31-4dfa-a1d3-87ea708ae3fa",
          "citation": "CARAMIPHEN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2df89c3a-4200-4ddc-93c4-2558011d0ac5",
          "citation": "CARAMIPHEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4ebec3c1-b3c1-4ea2-9360-a53aa1823d08",
          "citation": "CARAMIPHEN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "efd20dc3-272a-4b4c-b70c-ad14add8dac4",
          "citation": "CARAMIPHEN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "15551b23-0c28-7f37-8dc7-972a06bd37ac",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Caramiphen",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f5aca9ae-bc09-c0f9-de8a-f0440dfeaa06",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=77-22-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cc0a8dd7-c6ea-5f9a-c948-7b58d63eaf62",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b171c008-243f-4dee-98e2-ee08ea905228",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b19e4d19-208a-5fdd-0ca3-c8cab90099b8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "dfe71624-b051-52ba-e5ae-f3a941b5e803",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7f0856ff-d1d7-4a7a-90df-deff5b6296ee",
          "id": "7f0856ff-d1d7-4a7a-90df-deff5b6296ee",
          "molfile": "\n  Marvin  01132106362D          \n\n 21 22  0  0  0  0            999 V2000\n    8.3770   -9.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6672  -10.3400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9463   -9.9407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9130   -9.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6413   -8.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2144  -10.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4935   -9.9592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7948  -10.3954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0628   -9.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0517   -9.1607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3604  -10.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5619  -10.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5878  -11.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3752  -11.7485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8632  -11.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9427   -9.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1256   -9.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7190   -8.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1256   -8.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9649   -8.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3788   -8.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 15 11  1  0  0  0  0\n 16 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 21 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)CCOC(=O)C1(CCCC1)c2ccccc2",
          "formula": "C18H27NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "382e16fb-0a2c-493d-8adb-f365ddc0c0f9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "289.4132",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "849433cb-ed81-4843-9fe8-17f0cf1bbb98",
      "version": "11",
      "structure": {
        "id": "f26dc550-b073-40ca-8855-dd293232dfc3",
        "molfile": "\n  Marvin  01132112342D          \n\n 21 22  0  0  0  0            999 V2000\n    3.3604  -10.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0628   -9.9814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9427   -9.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0517   -9.1607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7948  -10.3954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9463   -9.9407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8632  -11.0830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5619  -10.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4935   -9.9592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2144  -10.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3788   -8.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1256   -9.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6672  -10.3400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9130   -9.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5878  -11.5045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3752  -11.7485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3770   -9.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6413   -8.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7190   -8.9610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9649   -8.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1256   -8.2550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  3  2  0  0  0  0\n 12  3  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16  7  1  0  0  0  0\n 17 13  1  0  0  0  0\n 18 14  1  0  0  0  0\n 19 12  2  0  0  0  0\n 20 11  1  0  0  0  0\n 21 19  1  0  0  0  0\n 16 15  1  0  0  0  0\n 21 20  2  0  0  0  0\nM  END",
        "smiles": "CCN(CC)CCOC(=O)C1(CCCC1)c2ccccc2",
        "formula": "C18H27NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "289.4132",
        "optical_activity": "NONE",
        "references": [
          "02b86ed5-0d81-43ca-b131-9663abe1db2e",
          "39e528ed-f4c1-48af-9176-10a9dfdcc99e",
          "693dfe3f-30cc-404f-b916-333db0d0b83c"
        ],
        "stereo_centers": 0
      },
      "unii": "97J7NP0XJY"
    }
  ]
}