{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "314a787d-f24c-46fc-87b7-696108589501", "code": "187269-40-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=187269-40-5", "code_system": "CAS", "references": [ "72565575-db98-4627-987a-e62b3f371f0d", "a57213e5-057c-49fa-b433-7b54346b459e" ] }, { "uuid": "568785e3-6e56-4e51-ab9c-1de723716bab", "code": "C72942", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C72942", "code_system": "NCI_THESAURUS", "references": [ "72565575-db98-4627-987a-e62b3f371f0d" ] }, { "uuid": "7295d46c-6d1b-4ee4-b29a-1bdb3bff58b8", "code": "C496819", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67496819", "code_system": "MESH", "references": [ "72565575-db98-4627-987a-e62b3f371f0d" ] }, { "uuid": "23040606-2895-49e8-912d-a4cf6f560419", "code": "8074", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=8074", "code_system": "INN", "references": [ "72565575-db98-4627-987a-e62b3f371f0d" ] }, { "uuid": "7f8529c4-253a-4ced-8b8d-62a8ae692c43", "code": "m2496", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m2496?q=authorize", "code_system": "MERCK INDEX", "references": [ "72565575-db98-4627-987a-e62b3f371f0d" ] }, { "uuid": "84ecc4bd-ce35-4d67-b46f-bf57a914f24f", "code": "CHEMBL1215923", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1215923", "code_system": "ChEMBL", "references": [ "72565575-db98-4627-987a-e62b3f371f0d" ] }, { "uuid": "6e21537c-b89e-4c57-adbe-74699a9356e6", "code": "9811353", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9811353", "code_system": "PUBCHEM", "references": [ "72565575-db98-4627-987a-e62b3f371f0d" ] }, { "uuid": "e4fee449-df96-61c4-ae6c-0f434c96e7d6", "code": "DTXSID8048783", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8048783", "code_system": "EPA CompTox", "references": [ "04787aa2-8569-aa7b-795a-d6f355f9d86a" ] }, { "uuid": "cd716dc2-842e-7ec2-7fe1-3f795079d06f", "code": "C257", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257", "code_system": "NCI_THESAURUS", "references": [ "bb8921ce-1a98-c23a-4b34-1daa483e587c" ] }, { "uuid": "89a240b0-f962-1b7b-6809-23c6d7963ccb", "code": "C29712", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Respiratory System[C78273]|Anti-asthmatic Agent", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29712", "code_system": "NCI_THESAURUS", "references": [ "bb8921ce-1a98-c23a-4b34-1daa483e587c" ] }, { "uuid": "f60cb63b-6add-4795-86cc-7e1b64fd6edf", "code": "97B5KCW80W", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "7ef6cc2d-4b78-593d-9f8d-0ea620fb8497", "code": "DB06197", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB06197", "code_system": "DRUG BANK", "references": [ "bb8921ce-1a98-c23a-4b34-1daa483e587c" ] }, { "uuid": "d439130b-a4bb-aeb8-144f-132f029090e9", "code": "100000177260", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "497f315a-8105-873b-afee-7b6b13088f90" ] } ], "relationships": [ { "uuid": "f963ef4e-6ed1-4b78-8326-0b78d4965b50", "amount": { "uuid": "a561d900-b5f0-491d-a82a-77cce5e5056a" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "b025468c-3481-429b-b0ea-6567752eda2b", "refuuid": "7f8d1dab-2130-4f55-9358-63d473b443b1", "name": "BIMOSIAMOSE", "unii": "97B5KCW80W", "linking_id": "97B5KCW80W", "ref_pname": "BIMOSIAMOSE", "substance_class": "reference" } }, { "uuid": "3a929567-c171-47e4-9386-bd4b5253d16e", "amount": { "uuid": "26d57dea-51e7-472c-bdce-92f02dfb6075" }, "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "fe484247-93dc-4e04-8d36-a62358a211dd", "refuuid": "7bb973c7-168c-4019-9e51-01716ff5beca", "name": "BIMOSIAMOSE DISODIUM", "unii": "7AK2FKB9AW", "linking_id": "7AK2FKB9AW", "ref_pname": "BIMOSIAMOSE DISODIUM", "substance_class": "reference" } }, { "uuid": "051b366e-cd08-4964-8edd-f19dfd913153", "amount": { "uuid": "4aa00214-7647-401b-8511-752036208360" }, "type": "TARGET->INHIBITOR", "references": [ "676c15c2-d5f8-4127-99f9-28aaf92531eb" ], "related_substance": { "uuid": "a4f8ad28-0aa3-4776-b2bb-8ef0eb601169", "refuuid": "5597cc36-2b99-4e84-b666-d42f749573f5", "name": "E-SELECTIN", "unii": "5SR86BY38M", "linking_id": "5SR86BY38M", "ref_pname": "E-SELECTIN", "substance_class": "reference" } }, { "uuid": "3630617c-f8ed-4155-908d-9cce5b74cb99", "amount": { "uuid": "db345ef2-6d34-4ff4-a6da-13a0a9ad8ec9" }, "type": "TARGET->INHIBITOR", "references": [ "676c15c2-d5f8-4127-99f9-28aaf92531eb" ], "related_substance": { "uuid": "3cd622b3-8770-4bd2-9960-ee340fd55122", "refuuid": "d63715e8-7e61-4d65-bc62-4b8c688a6ed8", "name": "P-SELECTIN", "unii": "Q7C1CQ328P", "linking_id": "Q7C1CQ328P", "ref_pname": "P-SELECTIN", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "45f1053e-e12b-4b80-9dc2-9dbdf5ce3b62", "name": "(HEXANE-1,6-DIYLBIS(6'-(.ALPHA.-D-MANNOPYRANOSYLOXY)BIPHENYL-3',3-DIYL))DIACETIC ACID", "stdName": "(HEXANE-1,6-DIYLBIS(6'-(.ALPHA.-D-MANNOPYRANOSYLOXY)BIPHENYL-3',3-DIYL))DIACETIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9c3497c2-5f0f-44fe-983a-a96dc4edd2f4" ], "display_name": false }, { "uuid": "3e4f2446-f00f-47f2-819a-a37954b58172", "name": "BIMOSIAMOSE", "stdName": "BIMOSIAMOSE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "2bdc0fc7-6ba5-406f-a6df-5e75ecd5f223", "d82a8f8d-a86e-40d9-88b7-cfe61da8baa9", "c591959b-0d95-4b91-a8b8-14c54dcf58ec", "7b822514-8ac2-4962-b1f1-5578a6bf0a44", "d28abfe8-7dd2-441c-9a8c-5c6ddd6ac3fa", "9c3497c2-5f0f-44fe-983a-a96dc4edd2f4" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "7f5e1c6a-4172-40da-bbe5-bff87a2d659e", "name_org": "INN" } ] }, { "uuid": "5d8e7892-2625-4fc5-adc8-e13ed3bb511f", "name": "BIMOSIAMOSE [MI]", "stdName": "BIMOSIAMOSE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c591959b-0d95-4b91-a8b8-14c54dcf58ec", "d28abfe8-7dd2-441c-9a8c-5c6ddd6ac3fa" ], "display_name": false }, { "uuid": "cf8baf6c-aa15-43eb-8052-b2297d37c761", "name": "bimosiamose [INN]", "stdName": "BIMOSIAMOSE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d82a8f8d-a86e-40d9-88b7-cfe61da8baa9" ], "display_name": false } ], "references": [ { "uuid": "9c3497c2-5f0f-44fe-983a-a96dc4edd2f4", "citation": "USP Dictionary 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d82a8f8d-a86e-40d9-88b7-cfe61da8baa9", "citation": "INN Proposed List 84", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL84.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c591959b-0d95-4b91-a8b8-14c54dcf58ec", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d28abfe8-7dd2-441c-9a8c-5c6ddd6ac3fa", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "72565575-db98-4627-987a-e62b3f371f0d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390553000, "tags": [ "NOMEN" ] }, { "uuid": "2b51a0f3-2e86-4f05-9244-fcbed338fac1", "citation": "SRS import [97B5KCW80W]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=97B5KCW80W", "doc_type": "SRS", "public_domain": true, "document_date": 1493390553000, "tags": [ "NOMEN" ] }, { "uuid": "7b822514-8ac2-4962-b1f1-5578a6bf0a44", "citation": "BIMOSIAMOSE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2bdc0fc7-6ba5-406f-a6df-5e75ecd5f223", "citation": "BIMOSIAMOSE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "04787aa2-8569-aa7b-795a-d6f355f9d86a", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=187269-40-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "497f315a-8105-873b-afee-7b6b13088f90", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "bb8921ce-1a98-c23a-4b34-1daa483e587c", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "a57213e5-057c-49fa-b433-7b54346b459e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "676c15c2-d5f8-4127-99f9-28aaf92531eb", "citation": "https://www.sciencedirect.com/topics/medicine-and-dentistry/bimosiamose", "url": "https://www.sciencedirect.com/topics/medicine-and-dentistry/bimosiamose", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1a98befa-3b6c-48c6-b8ed-c0031457bb5b", "id": "1a98befa-3b6c-48c6-b8ed-c0031457bb5b", "molfile": "\n Marvin 01132101342D \n\n 62 67 0 0 1 0 999 V2000\n -0.9127 -0.6872 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -1.3155 0.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8918 0.7442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0863 -0.6987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3255 -1.4177 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 1.1520 -1.4280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7239 -2.0955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7196 -2.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4274 -3.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1440 -2.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8528 -3.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5708 -2.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2804 -3.3561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9984 -2.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7080 -3.3686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4260 -2.9637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1356 -3.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8469 -2.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5563 -3.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5523 -4.2170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2645 -4.6334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0910 -4.6334 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 11.5001 -3.9176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3286 -3.9196 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 12.7429 -3.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3307 -2.4881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7417 -4.6358 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 13.5682 -4.6374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3263 -5.3500 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 12.7382 -6.0665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5040 -5.3496 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 11.0905 -6.0652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8350 -4.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1262 -4.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8279 -5.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5390 -5.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5351 -6.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8134 -7.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1007 -6.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3801 -7.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6704 -6.6663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9525 -7.0712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6780 -5.8398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1082 -5.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1483 -2.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4360 -1.6848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4392 -0.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7264 -0.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7264 0.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4461 0.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1608 0.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8737 0.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5875 0.3799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5901 -0.4466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3019 0.7953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1573 -0.4521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1059 -2.1293 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 0.2946 -2.8522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9324 -2.1180 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -1.3558 -2.8277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3356 -1.3948 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n -2.1621 -1.3824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 4 1 0 0 0 0\n 61 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 6 0 0 0\n 57 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 46 2 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 45 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 34 2 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 33 20 2 0 0 0 0\n 22 21 1 1 0 0 0\n 22 23 1 0 0 0 0\n 31 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 6 0 0 0\n 27 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 1 1 0 0 0\n 29 27 1 0 0 0 0\n 29 30 1 6 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 6 0 0 0\n 34 33 1 0 0 0 0\n 33 35 1 0 0 0 0\n 36 35 1 0 0 0 0\n 35 44 2 0 0 0 0\n 37 36 2 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 2 0 0 0 0\n 39 40 1 0 0 0 0\n 44 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 41 43 2 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\n 48 47 1 0 0 0 0\n 47 56 2 0 0 0 0\n 49 48 2 0 0 0 0\n 50 49 1 0 0 0 0\n 51 50 2 0 0 0 0\n 51 52 1 0 0 0 0\n 56 51 1 0 0 0 0\n 52 53 1 0 0 0 0\n 53 54 1 0 0 0 0\n 53 55 2 0 0 0 0\n 57 58 1 1 0 0 0\n 59 57 1 0 0 0 0\n 59 60 1 1 0 0 0\n 61 59 1 0 0 0 0\n 61 62 1 6 0 0 0\nM END", "smiles": "C(CCCc1ccc(c(c1)-c2cccc(c2)CC(=O)O)O[C@@H]3[C@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)CCc4ccc(c(c4)-c5cccc(c5)CC(=O)O)O[C@@H]6[C@H]([C@H]([C@@H]([C@@H](CO)O6)O)O)O", "formula": "C46H54O16", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7f055725-9515-419a-9bc9-3b93bc5682e4" }, "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "862.9131", "optical_activity": "UNSPECIFIED", "stereo_centers": 10 } ], "definition_level": "COMPLETE", "uuid": "7f8d1dab-2130-4f55-9358-63d473b443b1", "version": "9", "structure": { "id": "496f0b34-f430-4792-84a9-325bfb56873d", "molfile": "\n Marvin 01132103512D \n\n 62 67 0 0 1 0 999 V2000\n -0.0863 -0.6987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9127 -0.6872 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.3356 -1.3948 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -0.9324 -2.1180 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.1059 -2.1293 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 0.3255 -1.4177 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.1520 -1.4280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7239 -2.0955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7196 -2.9197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4274 -3.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1440 -2.9272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1483 -2.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4360 -1.6848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4392 -0.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1573 -0.4521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1608 0.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4461 0.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7264 0.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7264 -0.4489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8737 0.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5875 0.3799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5901 -0.4466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3019 0.7953 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8528 -3.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5708 -2.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2804 -3.3561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9984 -2.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7080 -3.3686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4260 -2.9637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1356 -3.3811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1262 -4.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8350 -4.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5523 -4.2170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5563 -3.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8469 -2.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8279 -5.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1082 -5.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1007 -6.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8134 -7.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5351 -6.6886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5390 -5.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3801 -7.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6704 -6.6663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9525 -7.0712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6780 -5.8398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0910 -4.6334 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.5040 -5.3496 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.3263 -5.3500 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.7417 -4.6358 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.3286 -3.9196 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.5001 -3.9176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1621 -1.3824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3155 0.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3558 -2.8277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2946 -2.8522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5682 -4.6374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7429 -3.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7382 -6.0665 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0905 -6.0652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8918 0.7442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3307 -2.4881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2645 -4.6334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 29 30 1 0 0 0 0\n 6 7 1 6 0 0 0\n 30 31 2 0 0 0 0\n 14 15 2 0 0 0 0\n 31 32 1 0 0 0 0\n 1 2 1 0 0 0 0\n 32 33 2 0 0 0 0\n 15 16 1 0 0 0 0\n 33 34 1 0 0 0 0\n 7 8 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 30 1 0 0 0 0\n 16 17 2 0 0 0 0\n 32 36 1 0 0 0 0\n 33 62 1 0 0 0 0\n 8 9 2 0 0 0 0\n 36 37 2 0 0 0 0\n 17 18 1 0 0 0 0\n 37 38 1 0 0 0 0\n 1 6 1 0 0 0 0\n 38 39 2 0 0 0 0\n 18 19 2 0 0 0 0\n 39 40 1 0 0 0 0\n 19 14 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 36 1 0 0 0 0\n 2 3 1 0 0 0 0\n 38 42 1 0 0 0 0\n 16 20 1 0 0 0 0\n 42 43 1 0 0 0 0\n 3 4 1 0 0 0 0\n 43 44 1 0 0 0 0\n 20 21 1 0 0 0 0\n 43 45 2 0 0 0 0\n 4 5 1 0 0 0 0\n 46 47 1 0 0 0 0\n 21 22 1 0 0 0 0\n 5 6 1 0 0 0 0\n 21 23 2 0 0 0 0\n 8 13 1 0 0 0 0\n 11 24 1 0 0 0 0\n 46 51 1 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 9 10 1 0 0 0 0\n 3 52 1 6 0 0 0\n 24 25 1 0 0 0 0\n 2 53 1 1 0 0 0\n 10 11 2 0 0 0 0\n 4 54 1 1 0 0 0\n 25 26 1 0 0 0 0\n 5 55 1 1 0 0 0\n 11 12 1 0 0 0 0\n 49 56 1 1 0 0 0\n 26 27 1 0 0 0 0\n 50 57 1 6 0 0 0\n 12 13 2 0 0 0 0\n 48 58 1 6 0 0 0\n 27 28 1 0 0 0 0\n 47 59 1 6 0 0 0\n 53 60 1 0 0 0 0\n 28 29 1 0 0 0 0\n 57 61 1 0 0 0 0\n 13 14 1 0 0 0 0\n 46 62 1 1 0 0 0\nM END", "smiles": "C(CCCc1ccc(c(c1)-c2cccc(c2)CC(=O)O)O[C@@H]3[C@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)CCc4ccc(c(c4)-c5cccc(c5)CC(=O)O)O[C@@H]6[C@H]([C@H]([C@@H]([C@@H](CO)O6)O)O)O", "formula": "C46H54O16", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "862.9131", "optical_activity": "UNSPECIFIED", "references": [ "9c3497c2-5f0f-44fe-983a-a96dc4edd2f4", "2b51a0f3-2e86-4f05-9244-fcbed338fac1", "d82a8f8d-a86e-40d9-88b7-cfe61da8baa9" ], "stereo_centers": 10 }, "unii": "97B5KCW80W" } ] }