{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "07b97c85-294d-4ced-874d-82e8fa305f62",
          "code": "113482-94-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=113482-94-3",
          "code_system": "CAS",
          "references": [
            "ff25634e-320e-4734-b783-18dc1a9118df",
            "8f4acc2d-a77e-40bf-b377-213ee684cf46"
          ]
        },
        {
          "uuid": "2f235394-c3c7-4781-9d32-5d70273a3987",
          "code": "C476662",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67476662",
          "code_system": "MESH",
          "references": [
            "ff25634e-320e-4734-b783-18dc1a9118df"
          ]
        },
        {
          "uuid": "b15e209d-5194-4fef-9b6c-a4d7fa5e1092",
          "code": "1376153",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1376153/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ff25634e-320e-4734-b783-18dc1a9118df"
          ]
        },
        {
          "uuid": "f84f94f3-b9bd-4a7a-a224-6be4a13e740e",
          "code": "9796792",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9796792",
          "code_system": "PUBCHEM",
          "references": [
            "ff25634e-320e-4734-b783-18dc1a9118df"
          ]
        },
        {
          "uuid": "30f1663e-447e-39a9-55a8-da0d4334a740",
          "code": "DTXSID60150419",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60150419",
          "code_system": "EPA CompTox",
          "references": [
            "ab0cbdca-4563-dc38-5cc9-23c7e50cbacf"
          ]
        },
        {
          "uuid": "58aa9dcf-b2a1-40fa-88f7-ec0d6981ade5",
          "code": "973IBV8W7I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b2c58d92-a50a-1a4e-31b2-42bdfdd02629",
          "code": "973IBV8W7I",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=973IBV8W7I",
          "code_system": "DAILYMED",
          "references": [
            "91dbc014-2f63-6efb-25f0-591c569fc4b8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "842ba82f-b2fe-433a-af23-1cf23552535b",
          "name": "1,7-BIS(4-HYDROXYPHENYL)-HEPTANE-3,5-DIONE",
          "stdName": "1,7-BIS(4-HYDROXYPHENYL)-HEPTANE-3,5-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c372d0e7-0ddd-42ea-abb4-410bf7e5bd54",
            "4de7cae2-bede-48bd-a865-3b148bc07728"
          ],
          "display_name": false
        },
        {
          "uuid": "7ebc49e4-079c-485e-9c3b-1966ad4dcca5",
          "name": "3,5-HEPTANEDIONE, 1,7-BIS(4-HYDROXYPHENYL)-",
          "stdName": "3,5-HEPTANEDIONE, 1,7-BIS(4-HYDROXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c372d0e7-0ddd-42ea-abb4-410bf7e5bd54",
            "4de7cae2-bede-48bd-a865-3b148bc07728"
          ],
          "display_name": false
        },
        {
          "uuid": "3a66ed07-8eea-423c-a90f-1ba820fdf251",
          "name": "BISDEMETHOXYTETRAHYDROCURCUMIN",
          "stdName": "BISDEMETHOXYTETRAHYDROCURCUMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c372d0e7-0ddd-42ea-abb4-410bf7e5bd54",
            "4de7cae2-bede-48bd-a865-3b148bc07728"
          ],
          "display_name": false
        },
        {
          "uuid": "225070a0-aee2-4a41-9832-fe0cbb59c85a",
          "name": "LETESTUIANIN C",
          "stdName": "LETESTUIANIN C",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c372d0e7-0ddd-42ea-abb4-410bf7e5bd54",
            "4de7cae2-bede-48bd-a865-3b148bc07728"
          ],
          "display_name": false
        },
        {
          "uuid": "df1e7da7-f6c0-4bed-9fa4-60f4c46b4551",
          "name": "TETRAHYDROBISDEMETHOXYCURCUMIN",
          "stdName": "TETRAHYDROBISDEMETHOXYCURCUMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c372d0e7-0ddd-42ea-abb4-410bf7e5bd54",
            "4de7cae2-bede-48bd-a865-3b148bc07728"
          ],
          "display_name": false
        },
        {
          "uuid": "9ac873aa-4004-48ad-9c43-2ae6a770ac7e",
          "name": "TETRAHYDROBISDEMETHOXYDIFERULOYLMETHANE",
          "stdName": "TETRAHYDROBISDEMETHOXYDIFERULOYLMETHANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "badd1e11-cee5-462d-8ad9-5a56e99da201",
            "0b97a3e2-f73b-4119-b075-a2996198e16a",
            "c372d0e7-0ddd-42ea-abb4-410bf7e5bd54"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "00112001-0418-4129-9eff-8a8ceaab2c60",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "badd1e11-cee5-462d-8ad9-5a56e99da201",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c372d0e7-0ddd-42ea-abb4-410bf7e5bd54",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4de7cae2-bede-48bd-a865-3b148bc07728",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff25634e-320e-4734-b783-18dc1a9118df",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391466000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d213e0b-406c-4b5e-a7ad-cfb4d9142c0d",
          "citation": "SRS import [973IBV8W7I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=973IBV8W7I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391466000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b97a3e2-f73b-4119-b075-a2996198e16a",
          "citation": "TETRAHYDROBISDEMETHOXYDIFERULOYLMETHANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ab0cbdca-4563-dc38-5cc9-23c7e50cbacf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=113482-94-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "91dbc014-2f63-6efb-25f0-591c569fc4b8",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8f4acc2d-a77e-40bf-b377-213ee684cf46",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f94a5b64-1ef6-4a52-bd6e-7aded7e34a2a",
          "id": "f94a5b64-1ef6-4a52-bd6e-7aded7e34a2a",
          "molfile": "\n  Marvin  01132112552D          \n\n 23 24  0  0  0  0            999 V2000\n   23.0766   -9.3085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3502   -8.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6238   -9.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8974   -8.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8974   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.1152   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3887   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6625   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6625   -6.7382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9360   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1538   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1538   -6.7382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4275   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7010   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9188   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9188   -8.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1923   -9.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4661   -8.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7396   -9.3085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4661   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1923   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6238   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3502   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 23  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 22  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 21  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1CCC(=O)CC(=O)CCc2ccc(cc2)O)O",
          "formula": "C19H20O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "00fc5ac7-9887-4845-a77d-a28293f2d91f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "312.3604",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "80ea4afc-312a-409c-9fbc-bce6b753a45a",
      "version": "5",
      "structure": {
        "id": "8494e269-0c82-4268-8764-b5ff46679a40",
        "molfile": "\n  Marvin  01132106532D          \n\n 23 24  0  0  0  0            999 V2000\n   18.6625   -6.7382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8974   -8.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6238   -9.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0766   -9.3085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3502   -8.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.3502   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6238   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8974   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.1152   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3887   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6625   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1538   -6.7382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9188   -8.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1923   -9.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7396   -9.3085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4661   -8.9174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4661   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1923   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9188   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7010   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4275   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1538   -7.6323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9360   -8.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 23 11  1  0  0  0  0\n 11  1  2  0  0  0  0\n  8  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  5  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 12  2  0  0  0  0\n 19 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 16 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1CCC(=O)CC(=O)CCc2ccc(cc2)O)O",
        "formula": "C19H20O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "312.3604",
        "optical_activity": "NONE",
        "references": [
          "4de7cae2-bede-48bd-a865-3b148bc07728",
          "5d213e0b-406c-4b5e-a7ad-cfb4d9142c0d"
        ],
        "stereo_centers": 0
      },
      "unii": "973IBV8W7I"
    }
  ]
}