{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2414417d-923d-4ec3-9890-db1fbe541322",
          "code": "122-27-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=122-27-0",
          "code_system": "CAS",
          "references": [
            "3c3e8122-e8c0-404e-92b9-ca92e1c53251",
            "b8dc7255-4372-4ec6-9616-e6a9bd68596e"
          ]
        },
        {
          "uuid": "5433fc85-8b71-49d4-a9c3-b022062ee110",
          "code": "204-531-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.120",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3c3e8122-e8c0-404e-92b9-ca92e1c53251"
          ]
        },
        {
          "uuid": "92e7ba7c-b1fd-42dc-b428-1aca8bf3dd22",
          "code": "67146",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/67146",
          "code_system": "PUBCHEM",
          "references": [
            "3c3e8122-e8c0-404e-92b9-ca92e1c53251"
          ]
        },
        {
          "uuid": "43b3a94d-d076-3213-d0d1-b1659290c339",
          "code": "DTXSID0059538",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0059538",
          "code_system": "EPA CompTox",
          "references": [
            "68dde12d-52cc-bc71-aea1-1845ae7cd474"
          ]
        },
        {
          "uuid": "458d98b1-240e-433d-9563-0066e7a15915",
          "code": "96RS9TI44Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8044dad8-1967-03c7-bcba-cc5d49880575",
          "code": "164907",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=164907",
          "code_system": "NSC",
          "references": [
            "fcc6f3c3-2e42-27c4-9772-49cf7dd6c047"
          ]
        },
        {
          "uuid": "0ba89a21-17e2-0fc1-1453-898d53f26b9c",
          "code": "46149",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=46149",
          "code_system": "NSC",
          "references": [
            "fcc6f3c3-2e42-27c4-9772-49cf7dd6c047"
          ]
        },
        {
          "uuid": "785cb86f-e442-4e40-8c17-153124fe7a0a",
          "code": "5980",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=5980",
          "code_system": "NSC",
          "references": [
            "fcc6f3c3-2e42-27c4-9772-49cf7dd6c047"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4b9cdc7a-e71a-4530-844b-59b2e252e1e6",
          "name": "3-TOLYL PHENYLACETATE",
          "stdName": "3-TOLYL PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566efc5f-f813-49dc-a127-d5b5ef3529bd",
            "5a90ef30-e1e2-416c-9172-29b1241868db"
          ],
          "display_name": true
        },
        {
          "uuid": "210ea52d-bc26-4c36-8ef6-5a3b8a28b72c",
          "name": "ACETIC ACID, PHENYL-, M-TOLYL ESTER",
          "stdName": "ACETIC ACID, PHENYL-, M-TOLYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566efc5f-f813-49dc-a127-d5b5ef3529bd",
            "5a90ef30-e1e2-416c-9172-29b1241868db"
          ],
          "display_name": false
        },
        {
          "uuid": "fa2ebf18-8e3b-46c5-b78a-fa8a3ae1b623",
          "name": "BENZENEACETIC ACID, 3-METHYLPHENYL ESTER",
          "stdName": "BENZENEACETIC ACID, 3-METHYLPHENYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566efc5f-f813-49dc-a127-d5b5ef3529bd",
            "5a90ef30-e1e2-416c-9172-29b1241868db"
          ],
          "display_name": false
        },
        {
          "uuid": "26d21159-7338-40a7-8e8c-2188a9ab613b",
          "name": "CRESYL PHENYLACETATE, M-",
          "stdName": "CRESYL PHENYLACETATE, M-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09065a4a-0a3b-4f2b-ae94-7a25c67e5dfe"
          ],
          "display_name": false
        },
        {
          "uuid": "f324fc59-80f8-4ff1-a1c0-ae11f041a630",
          "name": "M-CRESYL .ALPHA.-TOLUATE",
          "stdName": "M-CRESYL .ALPHA.-TOLUATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566efc5f-f813-49dc-a127-d5b5ef3529bd",
            "30ad9d73-3c9c-455e-921a-a476600de301"
          ],
          "display_name": false
        },
        {
          "uuid": "0fb3e23e-0089-4698-b949-ee2c90abaf8b",
          "name": "M-CRESYL PHENYLACETATE",
          "stdName": "M-CRESYL PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566efc5f-f813-49dc-a127-d5b5ef3529bd",
            "5a90ef30-e1e2-416c-9172-29b1241868db"
          ],
          "display_name": false
        },
        {
          "uuid": "2184b43b-fe31-4a55-bb17-cf5871dd2e25",
          "name": "M-TOLYL PHENYLACETATE",
          "stdName": "M-TOLYL PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566efc5f-f813-49dc-a127-d5b5ef3529bd",
            "5a90ef30-e1e2-416c-9172-29b1241868db"
          ],
          "display_name": false
        },
        {
          "uuid": "879c1a0a-1a96-431e-aff8-03edc421816c",
          "name": "NSC-164907",
          "stdName": "NSC-164907",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566efc5f-f813-49dc-a127-d5b5ef3529bd",
            "5a90ef30-e1e2-416c-9172-29b1241868db"
          ],
          "display_name": false
        },
        {
          "uuid": "5c528a08-50ee-4ef4-8ddc-d05eb08d44bd",
          "name": "NSC-46149",
          "stdName": "NSC-46149",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566efc5f-f813-49dc-a127-d5b5ef3529bd",
            "5a90ef30-e1e2-416c-9172-29b1241868db"
          ],
          "display_name": false
        },
        {
          "uuid": "3bb5febf-8a15-4fc9-a43d-c0b727d73f21",
          "name": "NSC-5980",
          "stdName": "NSC-5980",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566efc5f-f813-49dc-a127-d5b5ef3529bd",
            "5a90ef30-e1e2-416c-9172-29b1241868db"
          ],
          "display_name": false
        },
        {
          "uuid": "265c6146-8aea-4f22-9754-4fb9fcf2deda",
          "name": "PHENYLACETIC ACID, M-TOLYL ESTER",
          "stdName": "PHENYLACETIC ACID, M-TOLYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "566efc5f-f813-49dc-a127-d5b5ef3529bd",
            "5a90ef30-e1e2-416c-9172-29b1241868db"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "09065a4a-0a3b-4f2b-ae94-7a25c67e5dfe",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a90ef30-e1e2-416c-9172-29b1241868db",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "566efc5f-f813-49dc-a127-d5b5ef3529bd",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30ad9d73-3c9c-455e-921a-a476600de301",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3c3e8122-e8c0-404e-92b9-ca92e1c53251",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391097000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee58437c-0efb-4305-b44d-616d403c3f3f",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68dde12d-52cc-bc71-aea1-1845ae7cd474",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=122-27-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d76483ab-473a-7d4f-91f3-6461af719a01",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b8dc7255-4372-4ec6-9616-e6a9bd68596e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fcc6f3c3-2e42-27c4-9772-49cf7dd6c047",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6e5b2c29-dd38-4b49-ab5f-c61d4ed720f8",
          "id": "6e5b2c29-dd38-4b49-ab5f-c61d4ed720f8",
          "molfile": "\n  Marvin  01132105442D          \n\n 17 18  0  0  0  0            999 V2000\n    5.8541   -8.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8541   -7.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1465   -7.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1465   -6.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8541   -5.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5728   -6.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2854   -5.8158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2854   -4.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5667   -4.5842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0017   -4.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0017   -3.7577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7133   -3.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7133   -2.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9994   -2.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2842   -2.5169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2842   -3.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5728   -7.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 17  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n 17  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 16 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "Cc1cccc(c1)OC(=O)Cc2ccccc2",
          "formula": "C15H14O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "92fbbf5e-19b4-4a27-909f-1e24afd6c831"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "226.271",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9e5822f9-d06d-4e93-85fa-6f42b3038ee5",
      "version": "8",
      "structure": {
        "id": "110d4242-ba09-4358-ab48-65d72620a71a",
        "molfile": "\n  Marvin  01132101072D          \n\n 17 18  0  0  0  0            999 V2000\n    6.5667   -4.5842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2854   -4.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2854   -5.8158    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5728   -6.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8541   -5.8168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1465   -6.2293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1465   -7.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8541   -7.4668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8541   -8.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5728   -7.0543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0017   -4.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0017   -3.7577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7133   -3.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7133   -2.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9994   -2.1097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2842   -2.5169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2842   -3.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10  4  2  0  0  0  0\n  2 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 12  2  0  0  0  0\nM  END",
        "smiles": "Cc1cccc(c1)OC(=O)Cc2ccccc2",
        "formula": "C15H14O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "226.271",
        "optical_activity": "NONE",
        "references": [
          "d76483ab-473a-7d4f-91f3-6461af719a01"
        ],
        "stereo_centers": 0
      },
      "unii": "96RS9TI44Q"
    }
  ]
}