{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f4ed300b-51cd-e33d-5689-fcf1a03b9b66", "code": "59318451", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/59318451", "code_system": "PUBCHEM", "references": [ "b049e152-c239-2cbd-3ddc-c94a1dc05bb8" ] }, { "uuid": "111f3b44-caf7-4028-93e9-b5e368bd3a51", "code": "1038925-00-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1038925-00-6", "code_system": "CAS", "references": [ "b16b7373-b6db-4bbb-b69d-e813a87ecd34" ] }, { "uuid": "237f0e16-498d-4193-ad46-c83169c47a80", "code": "96L674J6LR", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "4cde7f8f-6093-4377-8f60-f2d90ee54c9e" ] } ], "substance_class": "chemical", "names": [ { "uuid": "d2e705ba-1ba9-41a7-bd8f-289b99321605", "name": "(3S,5S)-5-([1,1′-Biphenyl]-4-ylmethyl)-3-methyl-2-pyrrolidinone", "stdName": "(3S,5S)-5-((1,1'-BIPHENYL)-4-YLMETHYL)-3-METHYL-2-PYRROLIDINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4cde7f8f-6093-4377-8f60-f2d90ee54c9e" ], "display_name": false }, { "uuid": "8ec691d2-899b-4f51-b907-cdfa267fe1ae", "name": "(3S,5S)-5-[(Biphenyl-4-yl)methyl]-3-methylpyrrolidin-2-one", "stdName": "(3S,5S)-5-((BIPHENYL-4-YL)METHYL)-3-METHYLPYRROLIDIN-2-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4cde7f8f-6093-4377-8f60-f2d90ee54c9e" ], "display_name": false }, { "uuid": "39bd6f20-1e61-4734-8469-63718b7792f1", "name": "2-Pyrrolidinone, 5-([1,1′-biphenyl]-4-ylmethyl)-3-methyl-, (3S,5S)-", "stdName": "2-PYRROLIDINONE, 5-((1,1'-BIPHENYL)-4-YLMETHYL)-3-METHYL-, (3S,5S)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4cde7f8f-6093-4377-8f60-f2d90ee54c9e" ], "display_name": false }, { "uuid": "12baf4c0-e129-41b1-9b5d-9eac1f5c650b", "name": "5-([1,1′-Biphenyl]-4-ylmethyl)-3-methyl-2-pyrrolidinone, (3S,5S)-", "stdName": "5-((1,1'-BIPHENYL)-4-YLMETHYL)-3-METHYL-2-PYRROLIDINONE, (3S,5S)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4cde7f8f-6093-4377-8f60-f2d90ee54c9e" ], "display_name": true }, { "uuid": "edc7a3ec-08f2-4fa1-8386-eefe552de077", "name": "5-[(Biphenyl-4-yl)methyl]-3-methylpyrrolidin-2-one, (3S,5S)-", "stdName": "5-((BIPHENYL-4-YL)METHYL)-3-METHYLPYRROLIDIN-2-ONE, (3S,5S)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4cde7f8f-6093-4377-8f60-f2d90ee54c9e" ], "display_name": false }, { "uuid": "45b6fd60-1bdc-4086-8da0-1407e4d640f7", "name": "Sacubitril (3S,5S)-Pyrrolidinone Impurity", "stdName": "SACUBITRIL (3S,5S)-PYRROLIDINONE IMPURITY", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4cde7f8f-6093-4377-8f60-f2d90ee54c9e" ], "display_name": false }, { "uuid": "0ff998d0-e911-495b-939c-d6597d673009", "name": "Sacubitril Impurity 3", "stdName": "SACUBITRIL IMPURITY 3", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4cde7f8f-6093-4377-8f60-f2d90ee54c9e" ], "display_name": false } ], "references": [ { "uuid": "b16b7373-b6db-4bbb-b69d-e813a87ecd34", "citation": "System generated", "doc_type": "SYSTEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4cde7f8f-6093-4377-8f60-f2d90ee54c9e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b049e152-c239-2cbd-3ddc-c94a1dc05bb8", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4a80d3e7-ebcb-415f-b787-5e2e515677b1", "id": "4a80d3e7-ebcb-415f-b787-5e2e515677b1", "molfile": "\n CDK 02172320572D\n\n 20 22 0 0 1 0 0 0 0 0999 V2000\n 8.0023 5.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3050 4.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6297 1.3614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0012 3.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3348 2.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0012 4.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6685 3.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3348 5.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6685 4.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6675 2.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3337 3.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6675 0.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 2.3101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3337 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 0.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3360 4.6201 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.7428 5.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4969 3.0885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7734 4.1020 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.0034 2.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 9 1 0 0 0 0\n 16 1 1 6 0 0 0\n 19 2 1 6 0 0 0\n 3 20 2 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 4 10 1 0 0 0 0\n 5 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 7 9 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 13 15 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "C[C@H]1C[C@@H](Cc2ccc(cc2)-c3ccccc3)NC1=O", "formula": "C18H19NO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6a2f6929-5785-416d-8133-5d063d170824" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "265.3502", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "32ca4071-206c-4966-942d-c55ff624dfbe", "version": "5", "structure": { "id": "71bc0670-66c4-4ded-95d4-dc7026b18fbb", "molfile": "(3S,5S)-5-([1,1'-Biphenyl]-4-ylmethyl)-3-methyl-2-pyrrolidinone\n JSDraw202172315572D\n\n 20 22 0 0 1 0 0 V2000\n 26.5353 -4.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.9067 -6.1077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2097 -9.0469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4823 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8332 -8.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4823 -5.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1842 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8332 -4.9660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1842 -5.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1313 -8.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7803 -7.3060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1313 -9.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4293 -8.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7803 -10.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4293 -9.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8863 -5.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3113 -5.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0493 -7.2975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 30.3553 -6.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.5753 -7.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 9 1 0 0 0 0\n 16 1 1 6 0 0 0\n 19 2 1 6 0 0 0\n 3 20 2 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 4 10 1 0 0 0 0\n 5 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 7 9 2 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 13 15 2 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "C[C@H]1C[C@@H](Cc2ccc(cc2)-c3ccccc3)NC1=O", "formula": "C18H19NO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "265.3502", "optical_activity": "UNSPECIFIED", "references": [ "4cde7f8f-6093-4377-8f60-f2d90ee54c9e" ], "stereo_centers": 2 }, "unii": "96L674J6LR" } ] }