{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e7322196-5f70-4b0c-8246-8943299e4c58",
          "code": "VALENCENE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4459",
          "code_system": "JECFA EVALUATION",
          "references": [
            "07d6f1e0-4496-46b8-981a-91fcc9fb9ec4"
          ]
        },
        {
          "uuid": "07674e23-5fe1-4623-ad5e-861c7918ca6f",
          "code": "4630-07-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4630-07-3",
          "code_system": "CAS",
          "references": [
            "07d6f1e0-4496-46b8-981a-91fcc9fb9ec4",
            "4e55f2b8-3677-4483-99a0-d4451f1e5e93"
          ]
        },
        {
          "uuid": "c41789b7-0535-46f9-9ad8-5db3743231d9",
          "code": "C506706",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67506706",
          "code_system": "MESH",
          "references": [
            "07d6f1e0-4496-46b8-981a-91fcc9fb9ec4"
          ]
        },
        {
          "uuid": "646bb1ed-28e7-444c-9528-9ffb741f871e",
          "code": "VALENCENE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Valencene",
          "code_system": "WIKIPEDIA",
          "references": [
            "07d6f1e0-4496-46b8-981a-91fcc9fb9ec4"
          ]
        },
        {
          "uuid": "47cf4081-68c1-4611-88ff-697e1874a739",
          "code": "SUB179380",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "07d6f1e0-4496-46b8-981a-91fcc9fb9ec4"
          ]
        },
        {
          "uuid": "b8a033b9-166c-4866-9166-2e09bcd11146",
          "code": "9855795",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9855795",
          "code_system": "PUBCHEM",
          "references": [
            "07d6f1e0-4496-46b8-981a-91fcc9fb9ec4"
          ]
        },
        {
          "uuid": "8b4272f9-3eb3-42a3-9b22-69ca87cbc2ec",
          "code": "225-047-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.770",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "07d6f1e0-4496-46b8-981a-91fcc9fb9ec4"
          ]
        },
        {
          "uuid": "1a4f473e-94d0-fc60-5534-041c4f59c493",
          "code": "DTXSID8047052",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8047052",
          "code_system": "EPA CompTox",
          "references": [
            "284e8d11-0a4c-6e39-14da-d57d68431bf8"
          ]
        },
        {
          "uuid": "154d4250-2d0f-4e74-8498-349defbbaff6",
          "code": "96H21P91IG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1ace006a-a2c5-fde9-5f37-0ab95e7d5c67",
          "code": "61700",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:61700",
          "code_system": "CHEBI",
          "references": [
            "21cb9152-bb0c-46a3-b396-46f083b1e95f"
          ]
        },
        {
          "uuid": "016af173-9933-81b8-84fe-1109f3a966b9",
          "code": "148969",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=148969",
          "code_system": "NSC",
          "references": [
            "878d758c-19d0-4e4d-ccac-87b2b5f2df28"
          ]
        },
        {
          "uuid": "5fe9821d-254a-2be7-00eb-1c6eb6c6527e",
          "code": "96H21P91IG",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=96H21P91IG",
          "code_system": "DAILYMED",
          "references": [
            "72ba4eb5-5a2a-4bf6-8a65-6ea271bd8f3d"
          ]
        },
        {
          "uuid": "5892c42f-0a2c-9362-e661-8c27f81e7cac",
          "code": "100000164813",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "86a707d4-4191-e8d8-df70-53e428e510b2"
          ]
        },
        {
          "uuid": "e5dc37cf-5d0e-0930-7a4c-be6ab57f3a25",
          "code": "2569979",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2569979/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "74e87ce0-ea76-193d-294f-dcf34ce3a293"
          ]
        },
        {
          "uuid": "c71bffa5-e3f6-5eaa-2db8-d8e8904097dc",
          "code": "1336",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1336/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "001efcf2-edc4-46c4-c5b2-71942f7d2342"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "73e9bcf7-4040-4229-b3cd-4d563ae7fe2f",
          "name": "(+)-VALENCENE",
          "stdName": "(+)-VALENCENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6597bb05-4e17-43f9-a85d-e8d74babe77b",
            "aecf77a8-97c7-4347-aec5-c45b2f173cd4"
          ],
          "display_name": false
        },
        {
          "uuid": "3957a547-e0be-416c-8a08-451884174758",
          "name": "4.BETA.H,5.ALPHA.-EREMOPHILA-1(10),11-DIENE",
          "stdName": "4.BETA.H,5.ALPHA.-EREMOPHILA-1(10),11-DIENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6597bb05-4e17-43f9-a85d-e8d74babe77b",
            "aecf77a8-97c7-4347-aec5-c45b2f173cd4"
          ],
          "display_name": false
        },
        {
          "uuid": "91f52e4f-e667-403c-8700-756a3f6e8335",
          "name": "FEMA NO. 3443",
          "stdName": "FEMA NO. 3443",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96efd52a-1ff7-41c9-87a8-2cc65c41461d",
            "6597bb05-4e17-43f9-a85d-e8d74babe77b"
          ],
          "display_name": false
        },
        {
          "uuid": "aa4d4cd8-6637-44be-a648-66889102bd69",
          "name": "NAPHTHALENE, 1,2,3,5,6,7,8,8A-OCTAHYDRO-1,8A-DIMETHYL-7-(1-METHYLETHENYL)-, (1R,7R,8AS)-",
          "stdName": "NAPHTHALENE, 1,2,3,5,6,7,8,8A-OCTAHYDRO-1,8A-DIMETHYL-7-(1-METHYLETHENYL)-, (1R,7R,8AS)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6597bb05-4e17-43f9-a85d-e8d74babe77b",
            "aecf77a8-97c7-4347-aec5-c45b2f173cd4"
          ],
          "display_name": false
        },
        {
          "uuid": "403e8803-a874-4356-aa35-e817e7c27a48",
          "name": "NAPHTHALENE, 1,2,3,5,6,7,8,8A-OCTAHYDRO-1,8A-DIMETHYL-7-(1-METHYLETHENYL)-, (1R-(1.ALPHA.,7.BETA.,8A.ALPHA.))-",
          "stdName": "NAPHTHALENE, 1,2,3,5,6,7,8,8A-OCTAHYDRO-1,8A-DIMETHYL-7-(1-METHYLETHENYL)-, (1R-(1.ALPHA.,7.BETA.,8A.ALPHA.))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6597bb05-4e17-43f9-a85d-e8d74babe77b",
            "aecf77a8-97c7-4347-aec5-c45b2f173cd4"
          ],
          "display_name": false
        },
        {
          "uuid": "4f6ebdb5-42a5-403a-942e-0512bfd02e07",
          "name": "NSC-148969",
          "stdName": "NSC-148969",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96efd52a-1ff7-41c9-87a8-2cc65c41461d",
            "6597bb05-4e17-43f9-a85d-e8d74babe77b"
          ],
          "display_name": false
        },
        {
          "uuid": "45d280f2-97bf-427f-bc61-9db5d4be5b91",
          "name": "VALENCEN",
          "stdName": "VALENCEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6597bb05-4e17-43f9-a85d-e8d74babe77b",
            "aecf77a8-97c7-4347-aec5-c45b2f173cd4"
          ],
          "display_name": false
        },
        {
          "uuid": "33d612af-04d5-49a8-86d6-112d8e905f9b",
          "name": "VALENCENE",
          "stdName": "VALENCENE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01f0638d-780b-4afe-8e98-c536cb59eebc",
            "96efd52a-1ff7-41c9-87a8-2cc65c41461d",
            "cd067f51-f4ff-4d42-a0c4-4daab2a48d3c",
            "ad6046f4-526d-4db9-bcfd-aaae3d510fca",
            "6597bb05-4e17-43f9-a85d-e8d74babe77b",
            "27ffa5bb-935b-4818-a6df-dfbd21e2ae27"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a7c17668-fde8-40b1-b05e-a1c5becb8a4c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8355bdab-ef32-4182-9b09-8f39edd85c8f",
          "name": "VALENCENE [FHFI]",
          "stdName": "VALENCENE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd067f51-f4ff-4d42-a0c4-4daab2a48d3c",
            "6597bb05-4e17-43f9-a85d-e8d74babe77b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "96efd52a-1ff7-41c9-87a8-2cc65c41461d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6597bb05-4e17-43f9-a85d-e8d74babe77b",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aecf77a8-97c7-4347-aec5-c45b2f173cd4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd067f51-f4ff-4d42-a0c4-4daab2a48d3c",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01f0638d-780b-4afe-8e98-c536cb59eebc",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07d6f1e0-4496-46b8-981a-91fcc9fb9ec4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391107000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08b1167d-f150-4816-8d57-e86079c32802",
          "citation": "SRS import [96H21P91IG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=96H21P91IG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391107000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27ffa5bb-935b-4818-a6df-dfbd21e2ae27",
          "citation": "VALENCENE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad6046f4-526d-4db9-bcfd-aaae3d510fca",
          "citation": "VALENCENE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "284e8d11-0a4c-6e39-14da-d57d68431bf8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4630-07-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "86a707d4-4191-e8d8-df70-53e428e510b2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "74e87ce0-ea76-193d-294f-dcf34ce3a293",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "21cb9152-bb0c-46a3-b396-46f083b1e95f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "878d758c-19d0-4e4d-ccac-87b2b5f2df28",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4e55f2b8-3677-4483-99a0-d4451f1e5e93",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "72ba4eb5-5a2a-4bf6-8a65-6ea271bd8f3d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "001efcf2-edc4-46c4-c5b2-71942f7d2342",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5d744d0a-19dc-489b-b902-2b187d62f42e",
          "id": "5d744d0a-19dc-489b-b902-2b187d62f42e",
          "molfile": "\n  Marvin  01132104502D          \n\n 15 16  0  0  1  0            999 V2000\n    2.5462   -2.7078    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.5462   -3.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2631   -3.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9800   -3.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6990   -3.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4179   -3.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4179   -2.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6990   -2.3016    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.6990   -1.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9800   -2.7078    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.9800   -1.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2631   -2.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8254   -2.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8254   -1.4213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1323   -2.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 12  1  1  0  0  0  0\n  1 13  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n 10  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  6  0  0  0\n 10 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\nM  END",
          "smiles": "C=C(C)[C@@H]1CCC2=CCC[C@@H](C)[C@]2(C)C1",
          "formula": "C15H24",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c74e54d2-a0c4-4bad-bf2a-68196723c5f1"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "204.3516",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4b91b976-bac0-463a-9955-472452bdee9a",
      "version": "10",
      "structure": {
        "id": "2a9180b0-81e7-405f-8690-85b87cda07ff",
        "molfile": "\n  Marvin  01132102192D          \n\n 15 16  0  0  1  0            999 V2000\n    1.1323   -2.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8254   -1.4213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8254   -2.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4179   -3.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5462   -3.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6990   -1.4831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4179   -2.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5462   -2.7078    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.6990   -3.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2631   -3.9346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9800   -1.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6990   -2.3016    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.2631   -2.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9800   -3.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9800   -2.7078    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n  7  4  1  0  0  0  0\n  8  5  1  0  0  0  0\n  3  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  8  3  1  1  0  0  0\n  9  4  1  0  0  0  0\n 10  5  1  0  0  0  0\n 12  6  1  6  0  0  0\n 12  7  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14  9  2  0  0  0  0\n 14 10  1  0  0  0  0\n 15 11  1  6  0  0  0\n 15 12  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
        "smiles": "C=C(C)[C@@H]1CCC2=CCC[C@@H](C)[C@]2(C)C1",
        "formula": "C15H24",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "204.3516",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "08b1167d-f150-4816-8d57-e86079c32802",
          "aecf77a8-97c7-4347-aec5-c45b2f173cd4"
        ],
        "stereo_centers": 3
      },
      "unii": "96H21P91IG"
    }
  ]
}