{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f057a1d8-e29b-410a-a8f3-f2aee3a2f7c4",
          "code": "14050-01-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14050-01-2",
          "code_system": "CAS",
          "references": [
            "a0d261d1-7bfe-4a6c-a141-96c43fbeac9c",
            "bfceab0d-6ff8-4932-bbee-312df88e5085"
          ]
        },
        {
          "uuid": "ee290043-64f3-746d-99cf-42206df996d9",
          "code": "14963587",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/14963587",
          "code_system": "PUBCHEM",
          "references": [
            "f772c13a-36fb-d480-7070-9a625206c221"
          ]
        },
        {
          "uuid": "de157527-2d12-436c-a249-c06478b547fb",
          "code": "96E596PYPP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3cdb3513-2c3d-131f-5a2c-fdd54eb94bfc",
          "code": "DTXSID10930864",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10930864",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "f0f97041-3ac1-c543-e917-062c02ea344a",
          "code": "21209",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=21209",
          "code_system": "NSC",
          "references": [
            "7bba17fe-379b-a3e0-79ca-afbcadc09296"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ef9b8ef9-2992-992a-9773-a15c923dd915",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "bfceab0d-6ff8-4932-bbee-312df88e5085"
          ],
          "related_substance": {
            "uuid": "a7a8fa8d-35e5-435b-8423-251600fe9162",
            "refuuid": "28f27a9d-caaa-419d-a73c-e472302158df",
            "name": "COPPER PICOLINATE DIHYDRATE",
            "unii": "OAR053I14K",
            "linking_id": "OAR053I14K",
            "ref_pname": "COPPER PICOLINATE DIHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1c32c3cb-75d1-4aa4-8a68-5377ffe76b12",
          "name": "COPPER PICOLINATE ANHYDROUS",
          "stdName": "COPPER PICOLINATE ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06cb1676-6e8f-42a5-9972-cde5b4493caf",
            "69103c63-d280-4598-a195-c7faf04c4e49"
          ],
          "display_name": true
        },
        {
          "uuid": "119ea8be-6b06-4030-bc09-1715a10780b3",
          "name": "COPPER(II) PICOLINATE",
          "stdName": "COPPER(II) PICOLINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06cb1676-6e8f-42a5-9972-cde5b4493caf",
            "acc8666c-3772-415a-b0df-c01134d1184c"
          ],
          "display_name": false
        },
        {
          "uuid": "2d853b37-7562-4879-a4a4-12f5f44346bf",
          "name": "COPPER, BIS(2-PYRIDINECARBOXYLATO-.KAPPA.N1,.KAPPA.O2)-",
          "stdName": "COPPER, BIS(2-PYRIDINECARBOXYLATO-.KAPPA.N1,.KAPPA.O2)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06cb1676-6e8f-42a5-9972-cde5b4493caf",
            "acc8666c-3772-415a-b0df-c01134d1184c"
          ],
          "display_name": false
        },
        {
          "uuid": "a2b092e2-c57b-4b5e-9827-e24f76014452",
          "name": "COPPER, BIS(PICOLINATO)-",
          "stdName": "COPPER, BIS(PICOLINATO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06cb1676-6e8f-42a5-9972-cde5b4493caf",
            "acc8666c-3772-415a-b0df-c01134d1184c"
          ],
          "display_name": false
        },
        {
          "uuid": "5e55d2f8-1838-4796-8c5a-5c9536e20a85",
          "name": "NSC-21209",
          "stdName": "NSC-21209",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06cb1676-6e8f-42a5-9972-cde5b4493caf",
            "acc8666c-3772-415a-b0df-c01134d1184c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "69103c63-d280-4598-a195-c7faf04c4e49",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "06cb1676-6e8f-42a5-9972-cde5b4493caf",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acc8666c-3772-415a-b0df-c01134d1184c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0d261d1-7bfe-4a6c-a141-96c43fbeac9c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393195000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efb44ed3-1141-4e56-82d0-142e58ed2d9c",
          "citation": "SRS import [96E596PYPP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=96E596PYPP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393195000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f772c13a-36fb-d480-7070-9a625206c221",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "bfceab0d-6ff8-4932-bbee-312df88e5085",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7bba17fe-379b-a3e0-79ca-afbcadc09296",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "494cd251-ef75-44f9-93d2-7c545cb8d418",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "39cc1f95-7db5-47be-be39-695a3a4da74a",
          "id": "39cc1f95-7db5-47be-be39-695a3a4da74a",
          "molfile": "\n  Marvin  01132103042D          \n\n  1  0  0  0  0  0            999 V2000\n    6.6473   -2.9459    0.0000 Cu  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Cu+2]",
          "formula": "Cu",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c89cde47-aaaa-4721-9805-51add6f7c5d2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "63.5456",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "4cd69898-e0c9-4966-9620-217a17a11e87",
          "id": "4cd69898-e0c9-4966-9620-217a17a11e87",
          "molfile": "\n  Marvin  01132104012D          \n\n  9  9  0  0  0  0            999 V2000\n    2.9831   -1.6448    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.9831   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6976   -2.8823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2687   -2.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5542   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8398   -2.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8398   -3.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5542   -4.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2687   -3.7072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "c1ccnc(c1)C(=O)[O-]",
          "formula": "C6H4NO2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "4c66ca0d-001d-4799-b822-9faed5e30ecb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "122.1017",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9de71f40-7d5f-4e69-a216-1bc4bcbaef03",
      "version": "9",
      "structure": {
        "id": "79ed580a-f224-49f8-9ad8-748a80b69828",
        "molfile": "\n  Marvin  01132106202D          \n\n 19 18  0  0  0  0            999 V2000\n    6.6473   -2.9459    0.0000 Cu  0  2  0  0  0  0  0  0  0  0  0  0\n    2.9831   -1.6448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9831   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6976   -2.8823    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.2687   -3.7072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2687   -2.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5542   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8398   -2.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8398   -3.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5542   -4.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9831   -1.6448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9831   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6976   -2.8823    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.2687   -3.7072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2687   -2.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5542   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8398   -2.8823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8398   -3.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5542   -4.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  6  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 15  1  0  0  0  0\n 15 14  2  0  0  0  0\n 14 19  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\nM  CHG  3   1   2   4  -1  13  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  3  17  18  19\nM  SPA   1  9   2   3   4   5   6   7   8   9  10\nM  SDI   1  4    0.4198   -4.5397    0.4198   -1.2248\nM  SDI   1  4    4.1176   -1.2248    4.1176   -4.5397\nM  SMT   1 2\nM  END",
        "smiles": "c1ccnc(c1)C(=O)[O-].c1ccnc(c1)C(=O)[O-].[Cu+2]",
        "formula": "2C6H4NO2.Cu",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "307.749",
        "optical_activity": "NONE",
        "references": [
          "efb44ed3-1141-4e56-82d0-142e58ed2d9c",
          "acc8666c-3772-415a-b0df-c01134d1184c"
        ],
        "stereo_centers": 0
      },
      "unii": "96E596PYPP"
    }
  ]
}