{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4d8b269f-a495-48ff-8df5-432933880b5d",
          "code": "84930-15-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=84930-15-4",
          "code_system": "CAS",
          "references": [
            "b5620739-617f-409e-84b2-fd2849f2d891",
            "92b16b6f-cc36-40ae-924c-b0d5143f9a2e"
          ]
        },
        {
          "uuid": "0f21a4a1-c262-4054-867d-bbd93199763a",
          "code": "23662515",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23662515",
          "code_system": "PUBCHEM",
          "references": [
            "b5620739-617f-409e-84b2-fd2849f2d891"
          ]
        },
        {
          "uuid": "d863db3a-de07-d02b-eb24-dd061ba56c01",
          "code": "DTXSID20233974",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20233974",
          "code_system": "EPA CompTox",
          "references": [
            "a4741a7a-e623-965e-c940-8a622043b094"
          ]
        },
        {
          "uuid": "c5d19cbb-3b61-4d17-896d-81d3ee4c142f",
          "code": "9687QN0ZSY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b9478195-7d6e-48c6-be46-0dbfd97fff6e",
          "name": "BENZOIC ACID, 4-HYDROXY-, 2-METHYLPROPYL ESTER, SODIUM SALT (1:1)",
          "stdName": "BENZOIC ACID, 4-HYDROXY-, 2-METHYLPROPYL ESTER, SODIUM SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24610078-a11f-46b7-98ef-089da1e2bbe5",
            "a58db5fc-26b9-4089-86b0-6fe5ec4d40b1"
          ],
          "display_name": false
        },
        {
          "uuid": "f7dd6cb3-66a5-4bc4-a66a-91ee9f1f2742",
          "name": "SODIUM ISOBUTYL 4-OXIDOBENZOATE",
          "stdName": "SODIUM ISOBUTYL 4-OXIDOBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ed8480f-17ba-4eee-bfe4-d1eacdb21687",
            "a58db5fc-26b9-4089-86b0-6fe5ec4d40b1"
          ],
          "display_name": false
        },
        {
          "uuid": "9f1db9b0-e343-46ce-ac8a-41b09ac41abe",
          "name": "SODIUM ISOBUTYLPARABEN",
          "stdName": "SODIUM ISOBUTYLPARABEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fc9dc8a-242f-49ba-8298-c1178d9ec684",
            "e70275c9-5e27-4210-9836-165fcd5ca6c3",
            "a58db5fc-26b9-4089-86b0-6fe5ec4d40b1"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "27ba9aff-1bc0-4933-9af6-e237319ea59f",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "e70275c9-5e27-4210-9836-165fcd5ca6c3",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a58db5fc-26b9-4089-86b0-6fe5ec4d40b1",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ed8480f-17ba-4eee-bfe4-d1eacdb21687",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24610078-a11f-46b7-98ef-089da1e2bbe5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5620739-617f-409e-84b2-fd2849f2d891",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392041000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f06389f-b202-4735-8a64-3687355ab834",
          "citation": "SRS import [9687QN0ZSY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9687QN0ZSY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392041000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fc9dc8a-242f-49ba-8298-c1178d9ec684",
          "citation": "SODIUM ISOBUTYLPARABEN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a4741a7a-e623-965e-c940-8a622043b094",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=84930-15-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "92b16b6f-cc36-40ae-924c-b0d5143f9a2e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c3269e6f-2f52-305e-c689-7f5b567bd300",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7928ca39-3d47-49c6-957e-33526aed4da8",
          "id": "7928ca39-3d47-49c6-957e-33526aed4da8",
          "molfile": "\n  Marvin  01132106182D          \n\n  1  0  0  0  0  0            999 V2000\n    0.0569   -4.5936    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6c3a2fc4-c4fe-4ccd-9370-7b2245012b3c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "12a29ff6-fa0f-44b5-b7ae-79b7455cbc12",
          "id": "12a29ff6-fa0f-44b5-b7ae-79b7455cbc12",
          "molfile": "\n  Marvin  01132101112D          \n\n 14 14  0  0  0  0            999 V2000\n    4.9802   -2.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9745   -1.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6851   -0.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2582   -0.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5475   -1.2280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8312   -0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8198    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1263   -1.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4042   -0.8471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6936   -1.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7049   -2.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.5298    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    1.4270   -2.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1319   -2.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 14  2  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  2  0  0  0  0\n 13 14  1  0  0  0  0\nM  CHG  1  12  -1\nM  END",
          "smiles": "CC(C)COC(=O)c1ccc(cc1)[O-]",
          "formula": "C11H13O3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2dd1db73-57fc-4165-ae88-7237d48f0dd2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "193.2195",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "39f6c0f2-32ed-4aa7-9f46-2fc70125ba58",
      "version": "6",
      "structure": {
        "id": "fe404986-3bff-4fe1-82a2-f88a6e4fd32b",
        "molfile": "\n  Marvin  01132113102D          \n\n 15 14  0  0  0  0            999 V2000\n    1.4042   -0.8471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4270   -2.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7049   -2.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6936   -1.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.5298    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1263   -1.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1319   -2.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8312   -0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5475   -1.2280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8198    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2582   -0.8130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9745   -1.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9802   -2.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6851   -0.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0569   -4.5936    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  6  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  3  2  0  0  0  0\n  2  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\nM  CHG  2   5  -1  15   1\nM  END",
        "smiles": "CC(C)COC(=O)c1ccc(cc1)[O-].[Na+]",
        "formula": "C11H13O3.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "216.2093",
        "optical_activity": "NONE",
        "references": [
          "6ed8480f-17ba-4eee-bfe4-d1eacdb21687",
          "7f06389f-b202-4735-8a64-3687355ab834"
        ],
        "stereo_centers": 0
      },
      "unii": "9687QN0ZSY"
    }
  ]
}