{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a7fb21b4-5d05-43bf-885a-5377878c432e",
          "code": "175413-23-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=175413-23-7",
          "code_system": "CAS",
          "references": [
            "72f225d6-0a3b-4ab8-affa-0405140b0c3c",
            "e9665e18-408b-434d-9f47-2d11248c48e8"
          ]
        },
        {
          "uuid": "e0438bc7-fddc-4547-b8c8-0e47c70ec5c0",
          "code": "9958939",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9958939",
          "code_system": "PUBCHEM",
          "references": [
            "72f225d6-0a3b-4ab8-affa-0405140b0c3c"
          ]
        },
        {
          "uuid": "c2000afe-4d39-f838-7e7d-96e61b412bd3",
          "code": "DTXSID00169984",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00169984",
          "code_system": "EPA CompTox",
          "references": [
            "7a2b643a-9423-a141-81aa-e12b6a6724a2"
          ]
        },
        {
          "uuid": "f12c7b40-a3de-4fce-b0ae-e265114969ed",
          "code": "9611Y0JY0W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9f670967-6df3-4ea1-a6b4-008c7bbe09d9",
          "name": "4H-1-BENZOPYRAN-4-ONE, 2-((2R)-2-HYDROXYPROPYL)-7-METHOXY-5-METHYL-8-(2-O-((2E)-1-OXO-3-PHENYL-2-PROPEN-1-YL)-.BETA.-D-GLUCOPYRANOSYL)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 2-((2R)-2-HYDROXYPROPYL)-7-METHOXY-5-METHYL-8-(2-O-((2E)-1-OXO-3-PHENYL-2-PROPEN-1-YL)-.BETA.-D-GLUCOPYRANOSYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96ee2a42-ba43-4d56-96c2-cbf21258b51e",
            "efb45ce0-3618-4c75-b54e-713fbebfc9cc"
          ],
          "display_name": false
        },
        {
          "uuid": "eb02b35e-37b2-4355-9cee-c29f4db74107",
          "name": "4H-1-BENZOPYRAN-4-ONE, 2-((2R)-2-HYDROXYPROPYL)-7-METHOXY-5-METHYL-8-(2-O-((2E)-1-OXO-3-PHENYL-2-PROPENYL)-.BETA.-D-GLUCOPYRANOSYL)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 2-((2R)-2-HYDROXYPROPYL)-7-METHOXY-5-METHYL-8-(2-O-((2E)-1-OXO-3-PHENYL-2-PROPENYL)-.BETA.-D-GLUCOPYRANOSYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96ee2a42-ba43-4d56-96c2-cbf21258b51e",
            "efb45ce0-3618-4c75-b54e-713fbebfc9cc"
          ],
          "display_name": false
        },
        {
          "uuid": "fb6ce62b-2067-422b-a2aa-452bc8f0984d",
          "name": "4H-1-BENZOPYRAN-4-ONE, 2-(2-HYDROXYPROPYL)-7-METHOXY-5-METHYL-8-((E)-2-O-(1-OXO-3-PHENYL-2-PROPENYL)-.BETA.-D-GLUCOPYRANOSYL)-, (R)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 2-(2-HYDROXYPROPYL)-7-METHOXY-5-METHYL-8-((E)-2-O-(1-OXO-3-PHENYL-2-PROPENYL)-.BETA.-D-GLUCOPYRANOSYL)-, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96ee2a42-ba43-4d56-96c2-cbf21258b51e",
            "efb45ce0-3618-4c75-b54e-713fbebfc9cc"
          ],
          "display_name": false
        },
        {
          "uuid": "d3a0a3b9-0894-42e6-a58d-6c49392733a0",
          "name": "METHYL ALOESINYL CINNAMATE",
          "stdName": "METHYL ALOESINYL CINNAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e3579c9-e0f0-43f0-9b32-89c0acead5fc",
            "96ee2a42-ba43-4d56-96c2-cbf21258b51e",
            "53860e1a-ae36-4d8f-9381-095002776995"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f847a568-bf8a-4a08-ad8c-3f186c46464a",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "3e3579c9-e0f0-43f0-9b32-89c0acead5fc",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "96ee2a42-ba43-4d56-96c2-cbf21258b51e",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efb45ce0-3618-4c75-b54e-713fbebfc9cc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72f225d6-0a3b-4ab8-affa-0405140b0c3c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391527000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b82b152e-3e33-4a73-b9c0-d7b4ef6dd179",
          "citation": "SRS import [9611Y0JY0W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9611Y0JY0W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391527000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53860e1a-ae36-4d8f-9381-095002776995",
          "citation": "METHYL ALOESINYL CINNAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3261ccdc-8d51-1772-7e61-55f4f3bd1351",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=175413-23-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e9665e18-408b-434d-9f47-2d11248c48e8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7a2b643a-9423-a141-81aa-e12b6a6724a2",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a2b19ba4-78e2-4554-b94a-ce114f52eb4a",
          "id": "a2b19ba4-78e2-4554-b94a-ce114f52eb4a",
          "molfile": "\n  Marvin  01132108272D          \n\n 39 42  0  0  1  0            999 V2000\n   10.1684   -5.6925    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.8829   -5.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1684   -6.5175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4539   -5.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7395   -5.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7395   -6.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0250   -6.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0250   -7.7550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3105   -6.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -6.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -7.7551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8816   -6.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8816   -5.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1671   -5.2800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4526   -5.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -5.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3105   -5.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0250   -5.2800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -4.4550    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8816   -4.0426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8816   -3.2176    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.1671   -2.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4526   -3.2176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -2.8050    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.5960   -1.9800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3105   -3.2176    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.0250   -2.8050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3105   -4.0426    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.0250   -4.4550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6570   -3.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4322   -4.2069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5137   -3.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1457   -2.5820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0024   -1.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6344   -1.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4912   -0.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7159   -0.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0839   -0.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2272   -1.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  1  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5 18  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 17  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 16 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 19 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  6  0  0  0\n 28 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  6  0  0  0\n 21 24  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  1  1  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  6  0  0  0\n 26 28  1  0  0  0  0\n 28 29  1  1  0  0  0\n 29 30  1  0  0  0  0\n 30 31  2  0  0  0  0\n 30 32  1  0  0  0  0\n 32 33  2  0  0  0  0\n 33 34  1  0  0  0  0\n 35 34  1  0  0  0  0\n 34 39  2  0  0  0  0\n 36 35  2  0  0  0  0\n 37 36  1  0  0  0  0\n 38 37  2  0  0  0  0\n 39 38  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(c(c2c1c(=O)cc(C[C@@H](C)O)o2)[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)OC(=O)/C=C/c4ccccc4)OC",
          "formula": "C29H32O10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fa3e0015-b513-4e89-956e-136a952e623f"
          },
          "defined_stereo": 6,
          "ez_centers": 1,
          "molecular_weight": "540.5595",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "867f018a-53ed-420f-929f-1ed9c2911096",
      "version": "6",
      "structure": {
        "id": "bc036375-573b-4b94-95bb-0b48025f2a6c",
        "molfile": "\n  Marvin  01132109432D          \n\n 39 42  0  0  1  0            999 V2000\n    9.4912   -0.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0839   -0.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6344   -1.2392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0024   -1.7695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2272   -1.4874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1457   -2.5820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0250   -2.8050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8829   -5.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5137   -3.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4322   -4.2069    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1684   -5.6925    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.6570   -3.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -1.9800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4539   -5.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1684   -6.5175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3105   -3.2176    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.0250   -4.4550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7395   -5.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0250   -5.2800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -2.8050    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.3105   -4.0426    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.7395   -6.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0250   -6.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0250   -7.7550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -4.4550    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3105   -6.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3105   -5.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8816   -3.2176    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.5960   -5.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8816   -4.0426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -6.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5960   -7.7551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8816   -5.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8816   -6.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1671   -5.2800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1671   -2.8050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4526   -5.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4526   -3.2176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7159   -0.1446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  2  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  9  6  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12  9  1  0  0  0  0\n 12 10  2  0  0  0  0\n 14 11  1  0  0  0  0\n 11 15  1  1  0  0  0\n 16  7  1  6  0  0  0\n 17 12  1  0  0  0  0\n 18 14  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 13  1  1  0  0  0\n 16 20  1  0  0  0  0\n 21 16  1  0  0  0  0\n 21 17  1  1  0  0  0\n 22 18  2  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 25 21  1  0  0  0  0\n 26 23  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27 19  1  0  0  0  0\n 28 20  1  0  0  0  0\n 27 29  1  0  0  0  0\n 25 29  1  6  0  0  0\n 30 25  1  0  0  0  0\n 28 30  1  0  0  0  0\n 31 26  1  0  0  0  0\n 31 32  1  0  0  0  0\n 29 33  2  0  0  0  0\n 33 34  1  0  0  0  0\n 34 31  2  0  0  0  0\n 33 35  1  0  0  0  0\n 28 36  1  6  0  0  0\n 35 37  1  0  0  0  0\n 36 38  1  0  0  0  0\n  2 39  1  0  0  0  0\n 39  1  2  0  0  0  0\nM  END",
        "smiles": "Cc1cc(c(c2c1c(=O)cc(C[C@@H](C)O)o2)[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)OC(=O)/C=C/c4ccccc4)OC",
        "formula": "C29H32O10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 1,
        "molecular_weight": "540.5595",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b82b152e-3e33-4a73-b9c0-d7b4ef6dd179",
          "efb45ce0-3618-4c75-b54e-713fbebfc9cc"
        ],
        "stereo_centers": 6
      },
      "unii": "9611Y0JY0W"
    }
  ]
}