{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1c288cbc-0d71-4799-a705-bc00716a2643",
          "code": "379685-96-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=379685-96-8",
          "code_system": "CAS",
          "references": [
            "f9d48c4d-15d8-4167-b5e9-557c080e195b",
            "95f4ca48-f313-4270-a43f-b7d3d3982e32"
          ]
        },
        {
          "uuid": "07bae4b2-86fb-4a4a-8d8e-4fc453dfbaad",
          "code": "10269877",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10269877",
          "code_system": "PUBCHEM",
          "references": [
            "f9d48c4d-15d8-4167-b5e9-557c080e195b"
          ]
        },
        {
          "uuid": "c87f676f-5942-609d-5f92-f8c08bbc010a",
          "code": "1922906",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1922906/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "733a7c1a-1d4e-408f-aa8d-14f0a4fc6ee5",
          "code": "95SP8380V9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b39ebb82-6ad1-b412-6fdd-a56a98d61c0c",
          "code": "DTXSID901021309",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901021309",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "4d675d17-f5fd-6b90-1250-af892a19936b",
          "code": "95SP8380V9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=95SP8380V9",
          "code_system": "DAILYMED",
          "references": [
            "2c698807-e2bd-8a75-a238-737c19717f7d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "27c5bb25-5dcd-409f-8a23-8329c0696ad7",
          "name": "(±)-ACETYL TRIFLUOROMETHYLPHENYL VALYLGLYCINE",
          "stdName": "(+/-)-ACETYL TRIFLUOROMETHYLPHENYL VALYLGLYCINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8824e941-357c-46ce-9e7b-5b89fb828845",
            "549b96cf-3a0a-40c6-bd64-84b45ab093e4"
          ],
          "display_name": false
        },
        {
          "uuid": "e9f8053c-cb73-464d-97ac-82fa8fd4ac50",
          "name": "ACETYL TRIFLUOROMETHYLPHENYL VALYLGLYCINE",
          "stdName": "ACETYL TRIFLUOROMETHYLPHENYL VALYLGLYCINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "dd5fc27d-7956-4855-a535-19d4ca4a4816",
            "2c408870-e45f-4e46-8190-6cb1a94ab80f",
            "549b96cf-3a0a-40c6-bd64-84b45ab093e4"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7d109b55-918d-4eac-90d7-d326bb2f3829",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e70f7b32-0d99-44be-a925-6c2c0ac6bc23",
          "name": "ACETYL TRIFLUOROMETHYLPHENYL VALYLGLYCINE, DL-",
          "stdName": "ACETYL TRIFLUOROMETHYLPHENYL VALYLGLYCINE, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a24e390-ccd3-4062-9db5-717d391b67b4",
            "549b96cf-3a0a-40c6-bd64-84b45ab093e4"
          ],
          "display_name": true
        },
        {
          "uuid": "0dcf89f6-ece8-4364-a2b4-bad18f5fbc4f",
          "name": "GLYCINE, N-ACETYL-N-(3-(TRIFLUOROMETHYL)PHENYL)VALYL-",
          "stdName": "GLYCINE, N-ACETYL-N-(3-(TRIFLUOROMETHYL)PHENYL)VALYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8824e941-357c-46ce-9e7b-5b89fb828845",
            "549b96cf-3a0a-40c6-bd64-84b45ab093e4"
          ],
          "display_name": false
        },
        {
          "uuid": "d136f315-67bd-41b2-8295-94dc8580c4e2",
          "name": "MEXORYL SAR",
          "stdName": "MEXORYL SAR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c408870-e45f-4e46-8190-6cb1a94ab80f",
            "549b96cf-3a0a-40c6-bd64-84b45ab093e4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8824e941-357c-46ce-9e7b-5b89fb828845",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "549b96cf-3a0a-40c6-bd64-84b45ab093e4",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a24e390-ccd3-4062-9db5-717d391b67b4",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c408870-e45f-4e46-8190-6cb1a94ab80f",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9d48c4d-15d8-4167-b5e9-557c080e195b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391405000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "33c99236-b856-4e1e-9e5b-1a901968d76f",
          "citation": "SRS import [95SP8380V9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=95SP8380V9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391405000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efd505f1-65d6-470f-80d8-4ec2417ecb1e",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd5fc27d-7956-4855-a535-19d4ca4a4816",
          "citation": "ACETYL TRIFLUOROMETHYLPHENYL VALYLGLYCINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2c698807-e2bd-8a75-a238-737c19717f7d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "95f4ca48-f313-4270-a43f-b7d3d3982e32",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b61256d1-e20b-41f2-91f8-53d5ceac8704",
          "id": "b61256d1-e20b-41f2-91f8-53d5ceac8704",
          "molfile": "\n  Marvin  01132109262D          \n\n 25 25  0  0  0  0            999 V2000\n    6.5433   -7.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5433   -6.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2577   -5.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8289   -5.9520    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.1144   -6.3645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3999   -5.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6854   -6.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3999   -5.1269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1144   -7.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8289   -7.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8289   -8.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1144   -8.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3999   -8.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3999   -7.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6854   -8.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9709   -8.4270    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9709   -9.2520    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6854   -9.6645    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8289   -5.1269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1144   -4.7145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5432   -4.7145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5432   -3.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2577   -3.4769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9722   -3.8894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2577   -2.6519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 19  1  0  0  0  0\n  5  6  1  0  0  0  0\n  9  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 14  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\nM  END",
          "smiles": "CC(C)C(C(=O)NCC(=O)O)N(C(=O)C)c1cccc(c1)C(F)(F)F",
          "formula": "C16H19F3N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b34613d6-9215-4e38-8e93-6503e966f1b2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "360.3289",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2f82964c-ffd3-4734-8959-f30d45869c98",
      "version": "6",
      "structure": {
        "id": "5c38ec75-6d75-45e9-84dc-9814ff0effb9",
        "molfile": "\n  Marvin  01132104472D          \n\n 25 25  0  0  0  0            999 V2000\n    4.3999   -8.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6854   -8.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9709   -8.4270    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1144   -8.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8289   -8.4270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8289   -7.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1144   -7.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1144   -6.3645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8289   -5.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5433   -6.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5433   -7.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2577   -5.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8289   -5.1269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5432   -4.7145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1144   -4.7145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3999   -5.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3999   -5.1269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6854   -6.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3999   -7.6019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9709   -9.2520    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6854   -9.6645    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5432   -3.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2577   -3.4769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9722   -3.8894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2577   -2.6519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n  8 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n  7 19  1  0  0  0  0\n 19  1  2  0  0  0  0\n  2 20  1  0  0  0  0\n  2 21  1  0  0  0  0\n 14 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C(C(=O)NCC(=O)O)N(C(=O)C)c1cccc(c1)C(F)(F)F",
        "formula": "C16H19F3N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "360.3289",
        "optical_activity": "( + / - )",
        "references": [
          "efd505f1-65d6-470f-80d8-4ec2417ecb1e",
          "33c99236-b856-4e1e-9e5b-1a901968d76f"
        ],
        "stereo_centers": 1
      },
      "unii": "95SP8380V9"
    }
  ]
}