{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5e2ebcfe-3dea-47e2-b47d-231e217d1d47",
          "code": "C61738",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61738",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "b8bc071b-3949-4435-ba3e-f4bc793552ef",
          "code": "D004319",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68004319",
          "code_system": "MESH",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "c44c4e55-eeb5-481e-a3d1-6be13e25bf01",
          "code": "NBK548828",
          "comments": "LiverTox|CNS|Sedative/Hypnotic|Antihistamine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548828/",
          "code_system": "LIVERTOX",
          "references": [
            "72f85a0c-a8f2-66fb-a6b7-38180e206281"
          ]
        },
        {
          "uuid": "c887a349-0784-4ab9-beec-54b8fee46b33",
          "code": "DOXYLAMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Doxylamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "34f1aeab-74a6-466e-b871-0e61d0b5f1ac",
          "code": "R06AA59",
          "comments": "ATC|RESPIRATORY SYSTEM|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Aminoalkyl ethers|doxylamine, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R06AA59&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "0b1cedc6-ebb9-4a57-907e-4cbadb89d02f",
          "code": "SUB06394MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "c92bcec9-4484-4198-b40b-9066a27789ca",
          "code": "1782",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1782",
          "code_system": "INN",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "7e8f2539-346d-4dd4-a294-148caf548429",
          "code": "207-414-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.742",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "3d15f155-f5a8-4875-a1eb-b35bf09f1bd1",
          "code": "7171",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7171",
          "code_system": "IUPHAR",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "d104d4f2-71e4-46a2-a5a7-de521c3c9a90",
          "code": "3642",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3642/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "bca4aa04-bdb7-40b3-8c94-3f45e3c583ad",
          "code": "m4759",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4759?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "187f8454-b1a4-4848-87d1-cdb4031eb4cc",
          "code": "DB00366",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00366",
          "code_system": "DRUG BANK",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "99a1a370-fe08-4d82-a20f-efc192b03d29",
          "code": "102737-83-7",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=102737-83-7",
          "code_system": "CAS",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f",
            "e5a782f6-e9ac-491d-8906-19cd62192f51"
          ]
        },
        {
          "uuid": "782f7a45-0332-4491-b068-c0391a2e9a35",
          "code": "21 CFR 520.784",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.784 Doxylamine.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.784",
          "code_system": "CFR",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "ffd9349e-9954-429e-9704-48f15f14af2f",
          "code": "CHEMBL1004",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1004",
          "code_system": "ChEMBL",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "a85d9030-a5c5-480f-a158-941bb9f10d68",
          "code": "3162",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3162",
          "code_system": "PUBCHEM",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "c430085e-294e-48e5-89bb-f2db614523d0",
          "code": "R06AA09",
          "comments": "ATC|RESPIRATORY SYSTEM|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Aminoalkyl ethers|doxylamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R06AA09&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "b62e0da2-01ed-480f-86f6-48f5e2cea385",
          "code": "QR06AA59",
          "comments": "VATC|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Aminoalkyl ethers|doxylamine, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR06AA59&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "f2ba12f2-e31c-4bcc-9b63-9610d840fa3e",
          "code": "QR06AA09",
          "comments": "VATC|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Aminoalkyl ethers|doxylamine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR06AA09&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f"
          ]
        },
        {
          "uuid": "70e8df34-8fdc-4098-9293-1690564677da",
          "code": "469-21-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=469-21-6",
          "code_system": "CAS",
          "references": [
            "6b057e13-6097-44b9-a106-dbef6263261f",
            "11b4ffcc-041a-470f-9a3a-5c43641eba6f"
          ]
        },
        {
          "uuid": "cb04bef8-adc4-cd6d-b3ca-ad99898e68df",
          "code": "5184",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5184",
          "code_system": "HSDB",
          "references": [
            "96e332a2-d750-2c6f-82ba-e1d4fb67bdd8"
          ]
        },
        {
          "uuid": "c57d8975-5490-85d2-4b2b-86c053e5bec7",
          "code": "DTXSID1022970",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1022970",
          "code_system": "EPA CompTox",
          "references": [
            "8d8d1832-d94c-e165-7931-9e4ff1454442"
          ]
        },
        {
          "uuid": "e8f4576d-bf91-0340-1c64-9fcf11c993bd",
          "code": "Doxylamine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM1058/",
          "code_system": "LACTMED",
          "references": [
            "72f85a0c-a8f2-66fb-a6b7-38180e206281"
          ]
        },
        {
          "uuid": "d7bf655e-1bcc-9855-0c35-7ae9317c9b24",
          "code": "C29578",
          "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578",
          "code_system": "NCI_THESAURUS",
          "references": [
            "72f85a0c-a8f2-66fb-a6b7-38180e206281"
          ]
        },
        {
          "uuid": "e4d8d9ca-bfce-9553-c650-de289a2dc09a",
          "code": "N0000175750",
          "comments": "Established Pharmacologic Class [EPC]|Antihistamine [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175750",
          "code_system": "NDF-RT",
          "references": [
            "72f85a0c-a8f2-66fb-a6b7-38180e206281"
          ]
        },
        {
          "uuid": "1b59cd93-57b3-4ccc-9cb4-6d3e55e9658c",
          "code": "95QB77JKPL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4010e67c-c5ee-b07f-bd2b-f3bc879a34b4",
          "code": "962",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/962",
          "code_system": "DRUG CENTRAL",
          "references": [
            "72f85a0c-a8f2-66fb-a6b7-38180e206281"
          ]
        },
        {
          "uuid": "67bc1f63-532c-a81d-97a6-44bf58454c8b",
          "code": "51380",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:51380",
          "code_system": "CHEBI",
          "references": [
            "72f85a0c-a8f2-66fb-a6b7-38180e206281"
          ]
        },
        {
          "uuid": "d121d727-be1b-2258-691d-8cc6a0696a6f",
          "code": "100000080796",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5c264a61-823c-1568-d9c7-5496a1415b18"
          ]
        },
        {
          "uuid": "f40fa7a7-b778-c81f-8171-df995d1a180e",
          "code": "95QB77JKPL",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=95QB77JKPL",
          "code_system": "DAILYMED",
          "references": [
            "782e8556-e651-25e2-dc60-d4d55d2b6f21"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "90f47c7e-79d4-4f25-8df6-3ce9f7b1cff2",
          "citation": "DOXYLAMINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "388bb5ce-78de-4d01-81e1-042d332c956d",
          "citation": "DOXYLAMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b4b6bbf2-aa5e-4297-a046-dd8dcd6242ca",
          "citation": "DOXYLAMINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f5d15c36-dde9-41dd-b7f3-689cac56f397",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "24b09942-ae8e-4436-9f60-30952e73849f",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec4032cc-b1e7-477e-85c3-8606f8965923",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "add7a035-5be0-4086-89c1-252d78712836",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fdb3c0a-2729-4b23-b30b-707b4ecc4a0b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00534022-5bad-4887-9081-80ae62d1adcd",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4f81686-41f0-4a91-9ff4-3043277a666b",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5653defc-95e2-4f0c-a006-80a71643b255",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b057e13-6097-44b9-a106-dbef6263261f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcba990b-642a-4d50-b66c-671cb4d93658",
          "citation": "http://www.accessdata.fda.gov/spl/data/fe18a6fd-e343-45c6-ae57-76ea1d649259/fe18a6fd-e343-45c6-ae57-76ea1d649259.xml",
          "url": "http://www.accessdata.fda.gov/spl/data/fe18a6fd-e343-45c6-ae57-76ea1d649259/fe18a6fd-e343-45c6-ae57-76ea1d649259.xml",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a06e6452-b31e-4592-811e-5c79527fd767",
          "citation": "XENOBIOTICA, 1987, VOL. 17. NO. 8,993-999",
          "url": "http://informahealthcare.com/doi/pdf/10.3109/00498258709044198",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4dd5fb7-8a9d-430f-85d5-d2674abba0f9",
          "citation": "https://en.wikipedia.org/wiki/Doxylamine",
          "url": "https://en.wikipedia.org/wiki/Doxylamine",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0844247-8e80-43cb-b448-bcb26339002f",
          "citation": "SRS import [95QB77JKPL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=95QB77JKPL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391891000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "770b7c44-72d8-441e-bc08-f2278e890c6c",
          "citation": "DOXYLAMINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8c86864c-3ed5-4ec0-a66a-fd0f29650962",
          "citation": "DOXYLAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "96e332a2-d750-2c6f-82ba-e1d4fb67bdd8",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+469-21-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8d8d1832-d94c-e165-7931-9e4ff1454442",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=469-21-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cca200c8-7027-1c4a-3c00-765a8e3b6788",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+469-21-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b6b63440-7db7-0bd9-fe0e-f7858f434615",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/2421?sec=monphar",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "72f85a0c-a8f2-66fb-a6b7-38180e206281",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "11b4ffcc-041a-470f-9a3a-5c43641eba6f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e5a782f6-e9ac-491d-8906-19cd62192f51",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "fd454bb8-69ed-4539-8711-91112fd47894",
          "citation": "https://en.wikipedia.org/wiki/Doxylamine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f5e9593f-ffcc-55fd-0ca7-714a91602dc0",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "782e8556-e651-25e2-dc60-d4d55d2b6f21",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5c264a61-823c-1568-d9c7-5496a1415b18",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "721eedbb-710e-44e9-94e8-d78445bae5e7",
          "id": "721eedbb-710e-44e9-94e8-d78445bae5e7",
          "molfile": "\n  Marvin  06122309122D          \n\n 20 21  0  0  0  0            999 V2000\n   13.0768   -3.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3770   -3.4552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6477   -3.8693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7767   -3.4552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0636   -4.7070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1466   -5.1604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7570   -5.1210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3725   -4.4447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9478   -3.4453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4007   -4.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3869   -2.6174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5125   -3.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7700   -2.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1334   -6.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9384   -4.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9577   -2.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2123   -3.4092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4665   -2.2002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6674   -2.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1991   -2.5879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  1  8  1  0  0  0  0\n  3  2  1  0  0  0  0\n 11  2  2  0  0  0  0\n  9  3  2  0  0  0  0\n 12  4  2  0  0  0  0\n 13  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  6 10  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  6  1  0  0  0  0\n 10  7  1  0  0  0  0\n  9 16  1  0  0  0  0\n 19 11  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 13  2  0  0  0  0\n 16 19  2  0  0  0  0\n 17 20  2  0  0  0  0\n 20 18  1  0  0  0  0\nM  END",
          "smiles": "CC(c1ccccc1)(c2ccccn2)OCCN(C)C",
          "formula": "C17H22N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f38b2ca4-e3b6-4ec5-9dc5-901152ced599"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.37",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c6f7bdba-48ef-4f81-9413-e7788b667639",
      "version": "26",
      "structure": {
        "id": "061359f2-d7b4-44af-a032-af1c63277b1e",
        "molfile": "\n   JSDraw206122309122D\n\n 20 21  0  0  0  0              0 V2000\n   24.4823   -7.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1721   -6.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8066   -7.2440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.7925   -6.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4576   -8.8124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3572   -9.6613    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.7556   -9.5874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1637   -8.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4964   -6.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.9608   -8.7386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1906   -4.9002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1701   -7.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.7800   -4.9373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3326  -11.2728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8396   -8.6463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5149   -4.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4802   -6.3827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0840   -4.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8435   -4.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4556   -4.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  5  1  0  0  0  0\n  1  8  1  0  0  0  0\n  9  3  2  0  0  0  0\n 10  7  1  0  0  0  0\n 11  2  2  0  0  0  0\n 12  4  2  0  0  0  0\n 13  4  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  6  1  0  0  0  0\n 16 19  2  0  0  0  0\n 17 12  1  0  0  0  0\n 18 13  2  0  0  0  0\n 19 11  1  0  0  0  0\n 20 18  1  0  0  0  0\n 17 20  2  0  0  0  0\n  9 16  1  0  0  0  0\nM  END",
        "smiles": "CC(c1ccccc1)(c2ccccn2)OCCN(C)C",
        "formula": "C17H22N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.37",
        "optical_activity": "( + / - )",
        "references": [
          "a0844247-8e80-43cb-b448-bcb26339002f",
          "f5d15c36-dde9-41dd-b7f3-689cac56f397",
          "ec4032cc-b1e7-477e-85c3-8606f8965923"
        ],
        "stereo_centers": 1
      },
      "unii": "95QB77JKPL",
      "relationships": [
        {
          "uuid": "e7a78f5b-1a8d-4c70-9e90-991fdd3ab837",
          "amount": {
            "uuid": "089ecd1c-9278-4172-a87d-c06fbdab57bc"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a9136d7f-2bef-4281-b572-25baa558ec6f",
            "refuuid": "c6f7bdba-48ef-4f81-9413-e7788b667639",
            "name": "DOXYLAMINE",
            "unii": "95QB77JKPL",
            "linking_id": "95QB77JKPL",
            "ref_pname": "DOXYLAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c88262f1-3893-45da-8e1d-8d43fbfa0974",
          "amount": {
            "uuid": "b5735ce7-7715-4909-9c8d-60897ad22e3a"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f9bae7d0-ddbc-4610-8f95-99a6e2b7669d",
            "refuuid": "33c61976-7369-43ca-8dea-fd3165649cf2",
            "name": "DOXYLAMINE CHLOROTHEOPHYLLINATE",
            "unii": "POI7XGQ1HN",
            "linking_id": "POI7XGQ1HN",
            "ref_pname": "DOXYLAMINE CHLOROTHEOPHYLLINATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7e4499e6-8ad7-4af1-8a6f-69205b6582ca",
          "amount": {
            "uuid": "0be5ebc9-15c1-4d79-b490-5b9adeeab1db"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "971746d0-5166-4883-a685-39cce4c9223a",
            "refuuid": "cd5a1a78-294f-4210-b9ba-d5e0e030b0e1",
            "name": "DOXYLAMINE SUCCINATE",
            "unii": "V9BI9B5YI2",
            "linking_id": "V9BI9B5YI2",
            "ref_pname": "DOXYLAMINE SUCCINATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b85d8905-c581-450f-a3b2-550e287fc649",
          "type": "METABOLITE->PARENT",
          "references": [
            "dcba990b-642a-4d50-b66c-671cb4d93658"
          ],
          "related_substance": {
            "uuid": "0ceb073f-3447-4a43-80bb-6a8a558acc5e",
            "refuuid": "83db0ae4-b2fe-408b-be70-82da2eeb85dd",
            "name": "N-DESMETHYLDOXYLAMINE",
            "unii": "M36G349I9I",
            "linking_id": "M36G349I9I",
            "ref_pname": "N-DESMETHYLDOXYLAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0ecdf015-7d95-4a81-b832-1eb940326392",
          "comments": "Could be free or glucuronide conjugate",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "references": [
            "a06e6452-b31e-4592-811e-5c79527fd767"
          ],
          "related_substance": {
            "uuid": "2c6ef146-ea7f-48cf-a9ad-88ff2b1737dd",
            "refuuid": "83db0ae4-b2fe-408b-be70-82da2eeb85dd",
            "name": "N-DESMETHYLDOXYLAMINE",
            "unii": "M36G349I9I",
            "linking_id": "M36G349I9I",
            "ref_pname": "N-DESMETHYLDOXYLAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0e20ce14-82ca-46f6-97c2-03f2c1008b1b",
          "type": "METABOLITE->PARENT",
          "references": [
            "dcba990b-642a-4d50-b66c-671cb4d93658"
          ],
          "related_substance": {
            "uuid": "eed69770-fc73-4295-811b-78be3340bca7",
            "refuuid": "42b10551-a497-4593-b811-87e86e73d8ac",
            "name": "N,N-DIDESMETHYLDOXYLAMINE",
            "unii": "5P0QF5KR0F",
            "linking_id": "5P0QF5KR0F",
            "ref_pname": "N,N-DIDESMETHYLDOXYLAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c594bda1-ce5c-4d6d-8b49-3bf7c5091422",
          "comments": "Could be free or glucuronide conjugate",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "references": [
            "a06e6452-b31e-4592-811e-5c79527fd767"
          ],
          "related_substance": {
            "uuid": "0b9e6364-a374-40b8-9140-8db227cfed48",
            "refuuid": "42b10551-a497-4593-b811-87e86e73d8ac",
            "name": "N,N-DIDESMETHYLDOXYLAMINE",
            "unii": "5P0QF5KR0F",
            "linking_id": "5P0QF5KR0F",
            "ref_pname": "N,N-DIDESMETHYLDOXYLAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3afc8426-3d30-4773-ba88-269fdd5dbf04",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "references": [
            "a06e6452-b31e-4592-811e-5c79527fd767"
          ],
          "related_substance": {
            "uuid": "b7c51205-7490-440f-8525-d9e201725796",
            "refuuid": "010c3c7c-5b5d-4aa1-a0cd-46fea1d3dea1",
            "name": "N,N-DIDESMETHYL-N-ACETYLDOXYLAMINE",
            "unii": "YG2C85DJEF",
            "linking_id": "YG2C85DJEF",
            "ref_pname": "N,N-DIDESMETHYL-N-ACETYLDOXYLAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4087cf17-1273-420d-90a5-8d16912c62a3",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "references": [
            "a06e6452-b31e-4592-811e-5c79527fd767"
          ],
          "related_substance": {
            "uuid": "464fbea0-2526-45c7-b77d-dfd118c1289f",
            "refuuid": "d2216136-282f-43eb-8ab8-1338e47fc168",
            "name": "N-DESMETHYL-N-ACETYLDOXYLAMINE",
            "unii": "HBP663F15H",
            "linking_id": "HBP663F15H",
            "ref_pname": "N-DESMETHYL-N-ACETYLDOXYLAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4430d3d2-453e-4392-942f-186e3ffd3d1b",
          "type": "TARGET->INHIBITOR",
          "references": [
            "e4dd5fb7-8a9d-430f-85d5-d2674abba0f9"
          ],
          "related_substance": {
            "uuid": "c1785ef1-0e50-4ee3-99bf-76594551d9b3",
            "refuuid": "23559f52-21c8-4b43-92f1-981b36cdfe1d",
            "name": "HISTAMINE H1 RECEPTOR",
            "unii": "28XBT591QG",
            "linking_id": "28XBT591QG",
            "ref_pname": "HISTAMINE H1 RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d9ad095d-25c9-44a1-a5d6-fb4997d28c8e",
          "type": "ACTIVE ENANTIOMER->RACEMATE",
          "references": [
            "fd454bb8-69ed-4539-8711-91112fd47894"
          ],
          "related_substance": {
            "uuid": "4b7ffe35-e58e-4318-84aa-f393441959d5",
            "refuuid": "1169ecf6-d544-4ec7-a6e2-ab28c35c796d",
            "name": "DOXYLAMINE, (R)-",
            "unii": "WC177DTO9Q",
            "linking_id": "WC177DTO9Q",
            "ref_pname": "DOXYLAMINE, (R)-"
          }
        }
      ],
      "names": [
        {
          "uuid": "63bafabd-0a1a-46f9-bfe2-9fca9d735eed",
          "name": "(±)-DOXYLAMINE",
          "stdName": "(+/-)-DOXYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5653defc-95e2-4f0c-a006-80a71643b255"
          ],
          "display_name": false
        },
        {
          "uuid": "569f05d9-f976-4052-b6d5-d293d0bf150c",
          "name": "2-(.ALPHA.(2-(DIMETHYLAMINO)ETHOXY)-.ALPHA.-METHYLBENZYL)PYRIDINE",
          "stdName": "2-(.ALPHA.(2-(DIMETHYLAMINO)ETHOXY)-.ALPHA.-METHYLBENZYL)PYRIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24b09942-ae8e-4436-9f60-30952e73849f"
          ],
          "display_name": false
        },
        {
          "uuid": "d6849dcb-324e-4483-b4a8-2de3dd31a75a",
          "name": "DOXYLAMINE",
          "stdName": "DOXYLAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fdb3c0a-2729-4b23-b30b-707b4ecc4a0b",
            "ec4032cc-b1e7-477e-85c3-8606f8965923",
            "00534022-5bad-4887-9081-80ae62d1adcd",
            "add7a035-5be0-4086-89c1-252d78712836",
            "388bb5ce-78de-4d01-81e1-042d332c956d",
            "770b7c44-72d8-441e-bc08-f2278e890c6c",
            "90f47c7e-79d4-4f25-8df6-3ce9f7b1cff2",
            "b4b6bbf2-aa5e-4297-a046-dd8dcd6242ca",
            "8c86864c-3ed5-4ec0-a66a-fd0f29650962",
            "f5d15c36-dde9-41dd-b7f3-689cac56f397",
            "f4f81686-41f0-4a91-9ff4-3043277a666b"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e33f611d-b3f3-4e94-9847-a6dfe192e476",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "bd6bd8e2-da18-4ad9-81a8-2f899b2411ff",
          "name": "DOXYLAMINE [HSDB]",
          "stdName": "DOXYLAMINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fdb3c0a-2729-4b23-b30b-707b4ecc4a0b"
          ],
          "display_name": false
        },
        {
          "uuid": "b1b86685-bc15-4ec8-beb9-35f7141d95e3",
          "name": "DOXYLAMINE [MI]",
          "stdName": "DOXYLAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "add7a035-5be0-4086-89c1-252d78712836"
          ],
          "display_name": false
        },
        {
          "uuid": "4487417d-c4cc-40ef-ab4d-0b8250921c5d",
          "name": "DOXYLAMINE [VANDF]",
          "stdName": "DOXYLAMINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4f81686-41f0-4a91-9ff4-3043277a666b"
          ],
          "display_name": false
        },
        {
          "uuid": "e39a5293-f1e6-6d16-3731-b34f126f51f4",
          "name": "Doxylamine [WHO-DD]",
          "stdName": "DOXYLAMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5e9593f-ffcc-55fd-0ca7-714a91602dc0"
          ],
          "display_name": false
        },
        {
          "uuid": "a356199d-0710-48a8-b406-16648a8184d4",
          "name": "ETHANAMINE, N,N-DIMETHYL-2-(1-PHENYL-1-(2-PYRIDINYL)ETHOXY)-",
          "stdName": "ETHANAMINE, N,N-DIMETHYL-2-(1-PHENYL-1-(2-PYRIDINYL)ETHOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5653defc-95e2-4f0c-a006-80a71643b255"
          ],
          "display_name": false
        },
        {
          "uuid": "f7ef135a-30d4-48b2-b556-c445969ede93",
          "name": "N,N-DIMETHYL-2-(1-PHENYL-1-(2-PYRIDINYL)ETHOXY)ETHANAMINE",
          "stdName": "N,N-DIMETHYL-2-(1-PHENYL-1-(2-PYRIDINYL)ETHOXY)ETHANAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5653defc-95e2-4f0c-a006-80a71643b255"
          ],
          "display_name": false
        },
        {
          "uuid": "448dc091-f60f-404b-918c-98d3806078c9",
          "name": "PYRIDINE, 2-(.ALPHA.-(2-(DIMETHYLAMINO)ETHOXY)-.ALPHA.-METHYLBENZYL)-",
          "stdName": "PYRIDINE, 2-(.ALPHA.-(2-(DIMETHYLAMINO)ETHOXY)-.ALPHA.-METHYLBENZYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5653defc-95e2-4f0c-a006-80a71643b255"
          ],
          "display_name": false
        },
        {
          "uuid": "95b1903f-b4bd-4cd5-b45f-7146e32a03cc",
          "name": "doxylamine [INN]",
          "stdName": "DOXYLAMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec4032cc-b1e7-477e-85c3-8606f8965923"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "af97e3a2-e390-4be5-8555-6b1cb43bdc0b",
          "name": "Biological Half-life",
          "value": {
            "uuid": "8c2857fb-84c0-448d-91bc-508d60edeb77",
            "average": 10,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "b6b63440-7db7-0bd9-fe0e-f7858f434615"
          ]
        }
      ]
    }
  ]
}