{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "3185544c-bf9d-47f0-aa2f-8dac46bd3576", "code": "521-17-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=521-17-5", "code_system": "CAS", "references": [ "9df1b3b9-feb2-4dd2-8e24-acdf73d099ed", "f0ae9642-b0fb-4a5c-adf7-0decaff38153" ] }, { "uuid": "07934b1c-92de-4114-a3dc-62c6174c0e02", "code": "C95979", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C95979", "code_system": "NCI_THESAURUS", "references": [ "9df1b3b9-feb2-4dd2-8e24-acdf73d099ed" ] }, { "uuid": "8afb42c5-d735-4bf4-a2f8-1be62213d1d2", "code": "D015114", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68015114", "code_system": "MESH", "references": [ "9df1b3b9-feb2-4dd2-8e24-acdf73d099ed" ] }, { "uuid": "9cfaa912-24df-4663-b2bc-82990a64228d", "code": "4000", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "9df1b3b9-feb2-4dd2-8e24-acdf73d099ed" ] }, { "uuid": "2db15a3c-ceb4-4f0c-a015-61479e1be3a3", "code": "208-306-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.553", "code_system": "ECHA (EC/EINECS)", "references": [ "9df1b3b9-feb2-4dd2-8e24-acdf73d099ed" ] }, { "uuid": "913fcc97-3180-4d15-aa96-9c8409d8c56a", "code": "m1900", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m1900?q=authorize", "code_system": "MERCK INDEX", "references": [ "9df1b3b9-feb2-4dd2-8e24-acdf73d099ed" ] }, { "uuid": "b2f79b7f-9b9d-43e4-b6e0-fa6536cb7131", "code": "SUB12899MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "9df1b3b9-feb2-4dd2-8e24-acdf73d099ed" ] }, { "uuid": "906f7a54-1495-4c59-b8c0-fa65950fc22d", "code": "CHEMBL440283", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL440283", "code_system": "ChEMBL", "references": [ "9df1b3b9-feb2-4dd2-8e24-acdf73d099ed" ] }, { "uuid": "b9d153a5-c9a3-4962-ba7c-88609a62b472", "code": "10634", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10634", "code_system": "PUBCHEM", "references": [ "9df1b3b9-feb2-4dd2-8e24-acdf73d099ed" ] }, { "uuid": "881bcc08-4faf-034e-372f-71852f8990aa", "code": "DTXSID9022609", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9022609", "code_system": "EPA CompTox", "references": [ "db216303-fc61-f320-a84c-03c5cbdd28ac" ] }, { "uuid": "0dbcfe7c-9cd3-689e-c6e1-28cb51de6fb8", "code": "C2360", "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360", "code_system": "NCI_THESAURUS", "references": [ "3cc129e4-4919-2c64-1a15-158dbb3bf2ed" ] }, { "uuid": "c5d82676-5390-81bb-4c7d-8583beb31340", "code": "34237-8", "comments": "LOINC|ACTIVE|CHEM|Urine|Androstenediol [Moles/volume] in 24 hour Urine", "type": "PRIMARY", "url": "https://loinc.org/34237-8/", "code_system": "LOINC", "references": [ "3cc129e4-4919-2c64-1a15-158dbb3bf2ed" ] }, { "uuid": "572f3d5f-9995-3664-ded3-cef877d519e6", "code": "55851-0", "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|Androstenediol [Moles/volume] in Serum or Plasma", "type": "PRIMARY", "url": "https://loinc.org/55851-0/", "code_system": "LOINC", "references": [ "3cc129e4-4919-2c64-1a15-158dbb3bf2ed" ] }, { "uuid": "e6a3e0e6-e7d2-aaca-f8ae-c7a8a51b4e49", "code": "34236-0", "comments": "LOINC|ACTIVE|CHEM|Urine|Androstenediol [Moles/volume] in Urine", "type": "PRIMARY", "url": "https://loinc.org/34236-0/", "code_system": "LOINC", "references": [ "3cc129e4-4919-2c64-1a15-158dbb3bf2ed" ] }, { "uuid": "91db6f33-319e-ddfd-dfc0-e52375e9b344", "code": "34238-6", "comments": "LOINC|ACTIVE|CHEM|Urine|Androstenediol/Creatinine [Molar ratio] in Urine", "type": "PRIMARY", "url": "https://loinc.org/34238-6/", "code_system": "LOINC", "references": [ "3cc129e4-4919-2c64-1a15-158dbb3bf2ed" ] }, { "uuid": "89d6695e-3a6a-0f15-7863-9b7d5246ff9c", "code": "25314-6", "comments": "LOINC|ACTIVE|CHEM|Urine|Androstenediol [Moles/time] in 24 hour Urine", "type": "PRIMARY", "url": "https://loinc.org/25314-6/", "code_system": "LOINC", "references": [ "3cc129e4-4919-2c64-1a15-158dbb3bf2ed" ] }, { "uuid": "e0470c7b-9643-1d3b-4f52-6017e6486d4f", "code": "56033-4", "comments": "LOINC|ACTIVE|CHEM|Urine|Androstenediol [Mass/time] in 24 hour Urine", "type": "PRIMARY", "url": "https://loinc.org/56033-4/", "code_system": "LOINC", "references": [ "3cc129e4-4919-2c64-1a15-158dbb3bf2ed" ] }, { "uuid": "38d49056-bc0b-549a-46ad-87d2533574d1", "code": "214", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/214", "code_system": "DRUG CENTRAL", "references": [ "3cc129e4-4919-2c64-1a15-158dbb3bf2ed" ] }, { "uuid": "da1c521d-989d-5313-cc26-fcd26ca8569c", "code": "DB01524", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB01524", "code_system": "DRUG BANK", "references": [ "3cc129e4-4919-2c64-1a15-158dbb3bf2ed" ] }, { "uuid": "2f04cf0a-b467-4dd1-8671-3e0a3a426481", "code": "95PS51EMXY", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8269d8ff-9d7b-ba00-ff40-eb2d7ba0f2fd", "code": "2710", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2710", "code_system": "CHEBI", "references": [ "3cc129e4-4919-2c64-1a15-158dbb3bf2ed" ] }, { "uuid": "6601245e-9831-f247-fc09-bf0271676408", "code": "Androstenediol", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Androstenediol", "code_system": "WIKIPEDIA", "references": [ "c2b961e1-d1ae-6195-c901-4d73dac203dd" ] }, { "uuid": "a1af5f8f-3fb3-775f-eac8-5b92922b9f99", "code": "100000077399", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "6cbeb500-c241-0cc1-0b55-8a1b279da823" ] }, { "uuid": "72832680-2994-d734-f5dc-661c368708a8", "code": "12163", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=12163", "code_system": "NSC", "references": [ "cf89b549-c189-e561-f735-fd07e00642dc" ] } ], "substance_class": "chemical", "references": [ { "uuid": "52da8860-69fd-46e7-bb96-aa57ede5282a", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3fdb0277-b6f3-4b7f-b2c2-b3e6746e714a", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4c8cedd3-8c0e-4fe8-a5b7-dfedb3562e2c", "citation": "KEGG 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8a0e32b1-ded5-494e-8152-13098e50889b", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7a3c4bb2-7436-4143-acef-beca8d67a5ed", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9e041d4d-c7d4-4141-8217-0dcb366024aa", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dc41a5f7-1868-439c-8a73-111ab698f3da", "citation": "dea listg", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "97700a3c-0083-480f-a076-65a8d0be7279", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2e81b906-2d2d-43ac-a6c8-270fc74dbc59", "citation": "http://www.koelnerliste.com/fileadmin/user_upload/medien/pdf/ioc_studie_2004.pdf", "url": "http://www.koelnerliste.com/fileadmin/user_upload/medien/pdf/ioc_studie_2004.pdf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dec464ff-7d9c-4996-abac-7de516c2271e", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9df1b3b9-feb2-4dd2-8e24-acdf73d099ed", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389646000, "tags": [ "NOMEN" ] }, { "uuid": "e431a7ec-e0bd-4cc6-8cb6-f70e0be7312b", "citation": "SRS import [95PS51EMXY]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=95PS51EMXY", "doc_type": "SRS", "public_domain": true, "document_date": 1493389646000, "tags": [ "NOMEN" ] }, { "uuid": "10d213b0-9ee0-4ef2-a281-f357bd94a91a", "citation": "ANDROSTENEDIOL [JAN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "db96d95f-1d29-453e-8740-dfd199d5ec39", "citation": "ANDROSTENEDIOL [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "abdc912e-f501-439f-b96e-3dadd53c80ac", "citation": "ANDROSTENEDIOL [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "dbd3a436-f965-46f5-8504-fea1638f321f", "citation": "ANDROSTENEDIOL [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "db216303-fc61-f320-a84c-03c5cbdd28ac", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=521-17-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6cbeb500-c241-0cc1-0b55-8a1b279da823", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "3cc129e4-4919-2c64-1a15-158dbb3bf2ed", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "e6f5b9c8-96e6-47ad-b9ae-db147454fd89", "citation": "Stickney, Dwight R., et al. \"Preliminary clinical findings on NEUMUNE as a potential treatment for acute radiation syndrome.\" Journal of Radiological Protection 30.4 (2010): 687.", "url": "https://pubmed.ncbi.nlm.nih.gov/21149931/", "doc_type": "JA", "public_domain": true }, { "uuid": "f0ae9642-b0fb-4a5c-adf7-0decaff38153", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "c2b961e1-d1ae-6195-c901-4d73dac203dd", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "c6a3d076-2932-60e2-3e0c-7f26018e7142", "citation": "Chalbot, Sonia, and Robert Morfin. \"Human liver S9 fractions: metabolism of dehydroepiandrosterone, epiandrosterone, and related 7-hydroxylated derivatives.\" Drug metabolism and disposition 33.4 (2005): 563-569.", "url": "https://dmd.aspetjournals.org/content/dmd/33/4/563.full.pdf", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6839fc98-b8f8-5b37-21a0-7546e89ea5d1", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "cf89b549-c189-e561-f735-fd07e00642dc", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "1217fccb-0e82-444c-a44c-fe5a65d1a87e", "id": "1217fccb-0e82-444c-a44c-fe5a65d1a87e", "molfile": "\n Marvin 01132101092D \n\n 21 24 0 0 1 0 999 V2000\n 9.8940 -2.7128 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.8940 -1.8878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3707 -3.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8848 -4.0466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1103 -3.7853 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.3815 -4.1887 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.3815 -5.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6665 -5.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9607 -5.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2457 -5.4170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5353 -5.0045 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.8203 -5.4170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5353 -4.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2457 -3.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9607 -4.1795 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.9607 -3.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6711 -3.7715 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.6711 -2.9420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4044 -2.5387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1103 -2.9603 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.1103 -2.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 20 1 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 1 0 0 0\n 6 5 1 0 0 0 0\n 5 20 1 0 0 0 0\n 6 7 1 6 0 0 0\n 6 17 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 9 1 0 0 0 0\n 15 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 1 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 1 0 0 0\n 17 15 1 0 0 0 0\n 17 18 1 1 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 1 0 0 0\nM END", "smiles": "C[C@@]12CC[C@@H](CC2=CC[C@H]3[C@@H]4CC[C@@H]([C@@]4(C)CC[C@@H]31)O)O", "formula": "C19H30O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0cd24163-393f-4768-af6f-57a0329ef058" }, "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "290.441", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "d270332d-2c30-492a-9371-308d4c7ab0fb", "version": "25", "structure": { "id": "da8fe265-ea90-4c5f-b4a1-b4974f6020b2", "molfile": "\n Marvin 01132111202D \n\n 24 27 0 0 1 0 999 V2000\n 6.9607 -4.1795 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.9607 -5.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6665 -5.4215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3815 -5.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3815 -4.1887 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.1103 -3.7853 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.1103 -2.9603 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 9.8940 -2.7128 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.8940 -1.8878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3707 -3.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8848 -4.0466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1103 -2.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4044 -2.5387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6711 -2.9420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6711 -3.7715 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.6711 -4.5920 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1103 -4.6103 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3815 -3.3637 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2457 -5.4170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5353 -5.0045 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.8203 -5.4170 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5353 -4.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2457 -3.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9607 -3.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 1 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 6 1 0 0 0 0\n 7 12 1 1 0 0 0\n 13 7 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 1 1 0 0 0 0\n 5 15 1 0 0 0 0\n 15 16 1 6 0 0 0\n 6 17 1 6 0 0 0\n 5 18 1 1 0 0 0\n 19 2 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 1 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 1 1 0 0 0 0\n 1 24 1 1 0 0 0\nM END", "smiles": "C[C@@]12CC[C@@H](CC2=CC[C@@]3([H])[C@]4([H])CC[C@@H]([C@@]4(C)CC[C@@]31[H])O)O", "formula": "C19H30O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "290.441", "optical_activity": "UNSPECIFIED", "references": [ "52da8860-69fd-46e7-bb96-aa57ede5282a", "e431a7ec-e0bd-4cc6-8cb6-f70e0be7312b" ], "stereo_centers": 7 }, "unii": "95PS51EMXY", "relationships": [ { "uuid": "1d17a21a-8ee8-429d-8bc6-b840ad2e5c24", "amount": { "uuid": "d80eed6a-7620-4b46-90a5-620ca602191f" }, "type": "ACTIVE MOIETY", "related_substance": { "uuid": "d8c85b80-bd5a-422e-9255-9dc0ecf51d73", "refuuid": "d270332d-2c30-492a-9371-308d4c7ab0fb", "name": "ANDROSTENEDIOL", "unii": "95PS51EMXY", "linking_id": "95PS51EMXY", "ref_pname": "ANDROSTENEDIOL", "substance_class": "reference" } }, { "uuid": "d623de04-e8c3-4996-8da2-f3e7bd78d5c7", "amount": { "uuid": "de5659a9-890e-4a2a-ae37-e8a8e0dfb5f2" }, "comments": "IN VITRO", "type": "PARENT->METABOLITE", "references": [ "c6a3d076-2932-60e2-3e0c-7f26018e7142" ], "related_substance": { "uuid": "e4eae71d-0b84-4db2-a6df-8bd2b1f826a7", "refuuid": "b331d3c4-1d2a-4868-ae54-33988b31c01f", "name": "PRASTERONE", "unii": "459AG36T1B", "linking_id": "459AG36T1B", "ref_pname": "PRASTERONE", "substance_class": "reference" } } ], "names": [ { "uuid": "b831e8a8-5ba9-4d8c-904d-e4cfc1a5cec9", "name": "(3.BETA.,17.BETA.)-ANDROST-5-ENE-3,17-DIOL", "stdName": "(3.BETA.,17.BETA.)-ANDROST-5-ENE-3,17-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3fdb0277-b6f3-4b7f-b2c2-b3e6746e714a" ], "display_name": false }, { "uuid": "734ba653-76a2-4209-8ce5-5adb95762df3", "name": "5-ANDENDIOL", "stdName": "5-ANDENDIOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2e81b906-2d2d-43ac-a6c8-270fc74dbc59" ], "display_name": false }, { "uuid": "33109749-a013-43dc-9b79-d311b646b67e", "name": "5-ANDROSTENE-3.BETA.,17.BETA.-DIOL", "stdName": "5-ANDROSTENE-3.BETA.,17.BETA.-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "97700a3c-0083-480f-a076-65a8d0be7279" ], "display_name": false }, { "uuid": "c8a518fc-acc3-4db5-9561-95dc77b56e83", "name": "5-ANDROSTENE-3.BETA.O,17.BETA.-DIOL", "stdName": "5-ANDROSTENE-3.BETA.O,17.BETA.-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2e81b906-2d2d-43ac-a6c8-270fc74dbc59" ], "display_name": false }, { "uuid": "329599a8-940f-4094-a788-5ca50556aa11", "name": "5-ANDROSTENEDIOL", "stdName": "5-ANDROSTENEDIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dc41a5f7-1868-439c-8a73-111ab698f3da" ], "display_name": false }, { "uuid": "5568f696-3ae1-4785-85df-5f90a23ab0a9", "name": "ANDROSTENEDIOL", "stdName": "ANDROSTENEDIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8a0e32b1-ded5-494e-8152-13098e50889b", "52da8860-69fd-46e7-bb96-aa57ede5282a", "9e041d4d-c7d4-4141-8217-0dcb366024aa", "4c8cedd3-8c0e-4fe8-a5b7-dfedb3562e2c", "dbd3a436-f965-46f5-8504-fea1638f321f", "10d213b0-9ee0-4ef2-a281-f357bd94a91a", "db96d95f-1d29-453e-8740-dfd199d5ec39", "abdc912e-f501-439f-b96e-3dadd53c80ac", "7a3c4bb2-7436-4143-acef-beca8d67a5ed" ], "display_name": true }, { "uuid": "3df53bac-6df3-4950-b130-973479b4a963", "name": "ANDROSTENEDIOL [JAN]", "stdName": "ANDROSTENEDIOL [JAN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4c8cedd3-8c0e-4fe8-a5b7-dfedb3562e2c" ], "display_name": false }, { "uuid": "0f767b21-9ff8-4473-8ca1-7194186a3a46", "name": "ANDROSTENEDIOL [MART.]", "stdName": "ANDROSTENEDIOL [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8a0e32b1-ded5-494e-8152-13098e50889b" ], "display_name": false }, { "uuid": "4c6384bd-33b0-47ef-8669-6e5dd0a77930", "name": "ANDROSTENEDIOL [MI]", "stdName": "ANDROSTENEDIOL [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7a3c4bb2-7436-4143-acef-beca8d67a5ed" ], "display_name": false }, { "uuid": "ba689598-29ac-4910-ac82-c406752f139d", "name": "ANDROSTENEDIOL, (-)-", "stdName": "ANDROSTENEDIOL, (-)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "97700a3c-0083-480f-a076-65a8d0be7279" ], "display_name": false }, { "uuid": "a8302ada-e465-8cc8-6739-8d09f9becc25", "name": "Androstenediol [WHO-DD]", "stdName": "ANDROSTENEDIOL [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6839fc98-b8f8-5b37-21a0-7546e89ea5d1" ], "display_name": false }, { "uuid": "4ef3e27a-216c-4847-9880-5ff5102b5edf", "name": "HE-2100", "stdName": "HE-2100", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f0ae9642-b0fb-4a5c-adf7-0decaff38153" ], "display_name": false }, { "uuid": "3b3108c2-0ef5-43c7-a23a-0f1628aebffd", "name": "HE2100", "stdName": "HE2100", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f0ae9642-b0fb-4a5c-adf7-0decaff38153" ], "display_name": false }, { "uuid": "e91f64e3-ac30-459a-8f00-2b981730e0eb", "name": "NEUMUNE", "stdName": "NEUMUNE", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e6f5b9c8-96e6-47ad-b9ae-db147454fd89" ], "display_name": false }, { "uuid": "6ff923d6-c829-4e27-b784-7a75b25be01b", "name": "NSC-12163", "stdName": "NSC-12163", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "dec464ff-7d9c-4996-abac-7de516c2271e" ], "display_name": false } ], "modifications": { "uuid": "3125a029-140a-488a-9e29-815739de4bf1" } } ] }