{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d1824230-e23e-4b09-b2b3-8aac3bdfc79f",
          "code": "56095-64-8",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=56095-64-8",
          "code_system": "CAS",
          "references": [
            "ed8f39ee-dbd2-41a0-8171-8de6aa7af214",
            "02625468-c2da-468e-a95c-151967b26567"
          ]
        },
        {
          "uuid": "ee4a2eac-33ea-4be8-819a-0cffaa0b7594",
          "code": "71686-01-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=71686-01-6",
          "code_system": "CAS",
          "references": [
            "ed8f39ee-dbd2-41a0-8171-8de6aa7af214",
            "fdba3c7a-8799-4169-958f-63da4199d26c"
          ]
        },
        {
          "uuid": "496d56e2-924e-4316-a097-5175515387fe",
          "code": "SUB13190MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ed8f39ee-dbd2-41a0-8171-8de6aa7af214"
          ]
        },
        {
          "uuid": "850d062c-7d0c-465d-90b3-4e779e7fec7a",
          "code": "275-843-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.068.927",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ed8f39ee-dbd2-41a0-8171-8de6aa7af214"
          ]
        },
        {
          "uuid": "d5916916-9c03-c1d6-f98c-32b9c11b52ed",
          "code": "3018235",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3018235",
          "code_system": "PUBCHEM",
          "references": [
            "d2f8923a-2b95-4bdd-c6a7-4142229efd24"
          ]
        },
        {
          "uuid": "74c6c117-2b3f-4430-8c4d-d5cdd8b4471d",
          "code": "95PE00B13W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "10a2a086-6df3-aeef-90bf-b9b798e97895",
          "code": "DTXSID00992299",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00992299",
          "code_system": "EPA CompTox",
          "references": [
            "f31d5c9b-4219-b5d8-0b68-58c09a13773e"
          ]
        },
        {
          "uuid": "a30141d5-3978-823b-da13-945868638ab1",
          "code": "100000076572",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cea02660-7727-3da6-37ec-4d0f3168fe7b"
          ]
        },
        {
          "uuid": "8d47b033-5d11-2e09-0238-bf3641379fbb",
          "code": "95PE00B13W",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(95PE00B13W)",
          "code_system": "DAILYMED",
          "references": [
            "686e8a04-7719-72f0-6b66-0eb437308bfd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7c3ba9b3-4b60-4790-8010-0e8054437dc6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e0a263d5-06b5-4c3e-ba41-93bf4501ce07",
            "refuuid": "1c8a5cbe-4530-4f80-bdd4-724b796c7d19",
            "name": "CALCIUM CATION",
            "unii": "2M83C4R6ZB",
            "linking_id": "2M83C4R6ZB",
            "ref_pname": "CALCIUM CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "befe93c7-f942-46ec-889c-d485d86c1099",
          "name": "CALCIUM .ALPHA.-KETOGLUTARATE",
          "stdName": "CALCIUM .ALPHA.-KETOGLUTARATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b00c606-efb2-4b39-a95a-b850f4477013",
            "ffae2111-0c12-4b77-842e-a3bc6065bcfd"
          ],
          "display_name": false
        },
        {
          "uuid": "b2429cdc-296b-40c7-aa86-9425c899ba36",
          "name": "CALCIUM OXOGLURATE",
          "stdName": "CALCIUM OXOGLURATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efc253a3-c75a-4e72-b51d-74b9b697acbd",
            "ffae2111-0c12-4b77-842e-a3bc6065bcfd",
            "03f79828-fdcf-406b-a98b-69b3c23cad3d"
          ],
          "display_name": true
        },
        {
          "uuid": "453bf486-ed90-587a-a03e-92a8306095ea",
          "name": "Calcium oxoglurate [WHO-DD]",
          "stdName": "CALCIUM OXOGLURATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6577efe5-f63e-eac7-616d-50ecafe965a7"
          ],
          "display_name": false
        },
        {
          "uuid": "dda8696f-a516-4d1b-96bb-9a1b3c658b55",
          "name": "PENTANEDIOIC ACID, 2-OXO-, CALCIUM SALT",
          "stdName": "PENTANEDIOIC ACID, 2-OXO-, CALCIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffae2111-0c12-4b77-842e-a3bc6065bcfd",
            "188b3cd5-0073-4cd7-adb5-3ea12168e071"
          ],
          "display_name": false
        },
        {
          "uuid": "4b541041-e4d0-4c18-a59f-613d9ab055f2",
          "name": "PENTANEDIOIC ACID, 2-OXO-, CALCIUM SALT (1:1)",
          "stdName": "PENTANEDIOIC ACID, 2-OXO-, CALCIUM SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffae2111-0c12-4b77-842e-a3bc6065bcfd",
            "188b3cd5-0073-4cd7-adb5-3ea12168e071"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "03f79828-fdcf-406b-a98b-69b3c23cad3d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ffae2111-0c12-4b77-842e-a3bc6065bcfd",
          "citation": "WHO DRUG DICTIONARY",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "188b3cd5-0073-4cd7-adb5-3ea12168e071",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b00c606-efb2-4b39-a95a-b850f4477013",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed8f39ee-dbd2-41a0-8171-8de6aa7af214",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392226000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8bdad38-6ffc-472c-b318-8ad27a600d7e",
          "citation": "SRS import [95PE00B13W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=95PE00B13W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392226000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efc253a3-c75a-4e72-b51d-74b9b697acbd",
          "citation": "CALCIUM OXOGLURATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f31d5c9b-4219-b5d8-0b68-58c09a13773e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fdba3c7a-8799-4169-958f-63da4199d26c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "02625468-c2da-468e-a95c-151967b26567",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d2f8923a-2b95-4bdd-c6a7-4142229efd24",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "6577efe5-f63e-eac7-616d-50ecafe965a7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cea02660-7727-3da6-37ec-4d0f3168fe7b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "686e8a04-7719-72f0-6b66-0eb437308bfd",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "97c39677-af00-488c-b66c-1d8b1089dff2",
          "id": "97c39677-af00-488c-b66c-1d8b1089dff2",
          "molfile": "\n  Marvin  01132107532D          \n\n  1  0  0  0  0  0            999 V2000\n    3.4758   -3.3390    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a89502e9-f670-4ca0-afec-f61a5e88eb6c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "5752b5a4-98fd-470e-a9c0-eac3754e8f3a",
          "id": "5752b5a4-98fd-470e-a9c0-eac3754e8f3a",
          "molfile": "\n  Marvin  01132104322D          \n\n 10  9  0  0  0  0            999 V2000\n   11.5583   -5.7632    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.8153   -5.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8153   -4.5557    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1001   -5.7957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3757   -5.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6883   -5.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6883   -6.6502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9545   -5.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9545   -4.5743    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.2347   -5.8467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  CHG  2   1  -1   9  -1\nM  END",
          "smiles": "C(CC(=O)[O-])C(=O)C(=O)[O-]",
          "formula": "C5H4O5",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "75227c95-638d-4dfc-a6dc-9fee7513cf81"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "144.0825",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "38441660-83fa-42d9-b077-3a8446ebfae5",
      "version": "10",
      "structure": {
        "id": "d51b0a27-0168-4426-bee4-b96e02a85a7c",
        "molfile": "\n  Marvin  01132111032D          \n\n 11  9  0  0  0  0            999 V2000\n    7.9545   -5.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6883   -5.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6883   -6.6502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3757   -5.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1001   -5.7957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8153   -5.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5583   -5.7632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8153   -4.5557    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    7.9545   -4.5743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2347   -5.8467    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.4758   -3.3390    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  1  2  0  0  0  0\n 10  1  1  0  0  0  0\nM  CHG  3   8  -1  10  -1  11   2\nM  END",
        "smiles": "C(CC(=O)[O-])C(=O)C(=O)[O-].[Ca+2]",
        "formula": "C5H4O5.Ca",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "184.1605",
        "optical_activity": "NONE",
        "references": [
          "e8bdad38-6ffc-472c-b318-8ad27a600d7e",
          "188b3cd5-0073-4cd7-adb5-3ea12168e071"
        ],
        "stereo_centers": 0
      },
      "unii": "95PE00B13W"
    }
  ]
}