{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4b67edd9-559a-4e07-b333-b3cb92ea82ec",
          "code": "131-57-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=131-57-7",
          "code_system": "CAS",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f",
            "be9fe091-4e5c-400c-aedd-61c3935c215b"
          ]
        },
        {
          "uuid": "f3e1cbdd-4d0e-4d94-87a8-95f126231ae2",
          "code": "C005290",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005290",
          "code_system": "MESH",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "2ceddf81-f00e-4bed-89d2-27dae7a0983b",
          "code": "21 CFR 352.10",
          "comments": "PART 352 -- SUNSCREEN DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE [STAYED INDEFINITELY]|Subpart B--Active Ingredients|Sec. 352.10 Sunscreen active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=352.10",
          "code_system": "CFR",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "52e3baa3-9005-4361-9466-a5a175ce40ee",
          "code": "21 CFR 352.20",
          "comments": "PART 352 -- SUNSCREEN DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE [STAYED INDEFINITELY]|Subpart B--Active Ingredients|Sec. 352.20 Permitted combinations of active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=352.20",
          "code_system": "CFR",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "06a8ed52-0a83-4b5a-a0fa-35683f21dc14",
          "code": "OXYBENZONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Oxybenzone",
          "code_system": "WIKIPEDIA",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "677b0dcd-21a4-4034-bd6c-9bc6361213b0",
          "code": "SUB09556MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "48192741-bfa8-4ecd-a6ab-86584d85014b",
          "code": "691",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2847",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "7e9647d1-773c-4ea0-961c-5d1ad47c1df8",
          "code": "C47646",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47646",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "29dd8b91-8a5e-47f4-a930-512b9d4b1569",
          "code": "32673",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/32673/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "fcf48dd2-9914-4348-b325-5100176fc5ec",
          "code": "m8323",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8323?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "6ec16c23-62ad-48c4-a829-979713073b03",
          "code": "DB01428",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01428",
          "code_system": "DRUG BANK",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "2f592187-8bc7-4e0c-bd96-3b2eb93e82af",
          "code": "CHEMBL1625",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1625",
          "code_system": "ChEMBL",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "9eb5c8a3-1a59-4608-b0e6-370e3aa27b40",
          "code": "205-031-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.575",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "3b2b5f51-775d-4086-8d8b-d825856a8d22",
          "code": "2096",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2096",
          "code_system": "INN",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "883e6955-05be-4dc1-8ba8-8973e44575ad",
          "code": "4632",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4632",
          "code_system": "PUBCHEM",
          "references": [
            "9461de85-3d82-4342-8115-b11575ba052f"
          ]
        },
        {
          "uuid": "866af207-5dd8-26fb-20cd-2a39cdd59105",
          "code": "4503",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4503",
          "code_system": "HSDB",
          "references": [
            "924a2a94-f9d1-7d51-baa9-1dee6fc67303"
          ]
        },
        {
          "uuid": "5a579359-f046-c5da-8970-2691eb9d643b",
          "code": "DTXSID3022405",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3022405",
          "code_system": "EPA CompTox",
          "references": [
            "d9b45f4f-bd12-d560-fb06-cef968fa9d3d"
          ]
        },
        {
          "uuid": "8f984075-6a8d-5f32-2b99-1153fa4fa1c0",
          "code": "142401",
          "comments": "ORPHAN DRUG|Designated|For the prevention of visible light induced skin photosensitivity as a result of porfimer sodium photodynamic therapy",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=142401",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "96f4ff87-7ebc-53d6-d224-01f12fd754c3",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "67a72028-ec2b-40c4-7215-b03af8ecdf10"
          ]
        },
        {
          "uuid": "b78ace26-4ba2-4853-932e-25d0ead720e8",
          "code": "95OOS7VE0Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "40e0738d-f620-5d27-aa57-3086c42b5a2c",
          "code": "3412",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3412",
          "code_system": "DRUG CENTRAL",
          "references": [
            "67a72028-ec2b-40c4-7215-b03af8ecdf10"
          ]
        },
        {
          "uuid": "81613ad3-a828-91c3-c488-f8782f6968c1",
          "code": "34283",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34283",
          "code_system": "CHEBI",
          "references": [
            "67a72028-ec2b-40c4-7215-b03af8ecdf10"
          ]
        },
        {
          "uuid": "70b37796-6936-9a57-85e1-b68b1fb4a113",
          "code": "1485001",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1485001",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "67a72028-ec2b-40c4-7215-b03af8ecdf10"
          ]
        },
        {
          "uuid": "ba471499-8ff9-24e4-f2e5-b836ec5c92df",
          "code": "95OOS7VE0Y",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=95OOS7VE0Y",
          "code_system": "DAILYMED",
          "references": [
            "187e2198-4b93-f60c-6a79-cd47edb76194"
          ]
        },
        {
          "uuid": "47707f33-20b9-e964-442a-fd63759bc5b2",
          "code": "100000083280",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2c26eaf7-3939-2296-3d08-2b38cc2ffbef"
          ]
        },
        {
          "uuid": "5f176877-75c1-1649-5f62-492c08503bd2",
          "code": "7778",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7778",
          "code_system": "NSC",
          "references": [
            "7bfe1256-db04-492d-aeb8-580fca86fb4b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8f0883f2-8675-4593-aa3f-47e3ea6ecb43",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7ddcbbf0-5873-4535-ab54-89af3c297186",
            "refuuid": "41662fec-1cb2-445b-a6e0-f38dc69210a7",
            "name": "OXYBENZONE",
            "unii": "95OOS7VE0Y",
            "linking_id": "95OOS7VE0Y",
            "ref_pname": "OXYBENZONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d16afc93-694e-4969-8864-25580be3edff",
          "name": "2-Hydroxy-4-methoxybenzophenone",
          "stdName": "2-HYDROXY-4-METHOXYBENZOPHENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c6ceeca-4666-48af-8dc6-a09f6733fd3f"
          ],
          "display_name": false
        },
        {
          "uuid": "3c7a6524-ab71-444c-a597-e9c3ffd5d15e",
          "name": "ADVASTAB 45",
          "stdName": "ADVASTAB 45",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3bad29b-d5b1-43fe-971f-d42ac0b1a30d",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false
        },
        {
          "uuid": "63a2ec3d-e873-49b6-a6db-943a0636f443",
          "name": "BENZOPHENONE-3",
          "stdName": "BENZOPHENONE-3",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "342c47dc-2823-4400-beab-71a61a93f37b",
            "64e8a22d-d97f-4fbe-ab6a-7cd4d16aae5a",
            "a2655276-6c2f-42d1-af8a-e3d6daa727b1",
            "6d7b0517-9a89-4c99-9dd3-51572047faf3",
            "87411cb2-80b2-43cb-a120-cafe67850062",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5f14cffd-4429-42f8-9217-8f594fc7f1ff",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5bfcd1c4-7367-4f7a-a620-bbaa5ae9887d",
          "name": "BENZOPHENONE-3 [VANDF]",
          "stdName": "BENZOPHENONE-3 [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64e8a22d-d97f-4fbe-ab6a-7cd4d16aae5a",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false
        },
        {
          "uuid": "c33da59f-f5a8-44bb-afd2-d32696036e9a",
          "name": "NSC-7778",
          "stdName": "NSC-7778",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3bad29b-d5b1-43fe-971f-d42ac0b1a30d",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false
        },
        {
          "uuid": "1ec36e4e-826a-4e74-a5f3-bb34d8b6eb54",
          "name": "ONGROSTAB HMB",
          "stdName": "ONGROSTAB HMB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3bad29b-d5b1-43fe-971f-d42ac0b1a30d",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false
        },
        {
          "uuid": "cf932347-dcbd-46b4-b9f5-2852aad51034",
          "name": "OXYBENZONE",
          "stdName": "OXYBENZONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb940aff-de64-4378-b700-d38f2c2e4b8b",
            "c22f6ed0-9b09-448e-8f4a-b88fe47c4c34",
            "20846247-b375-469e-a62c-0ec2fcf13305",
            "f83b0d6f-8a92-4973-a7e5-d0275810165a",
            "22e5c6c4-2a20-4eae-bc24-5e0bf9872e63",
            "97782955-ad31-4b2b-8f56-aea20f106334",
            "0c885364-cbc0-4eee-b4d3-9b7aff25065a",
            "f2d2dd2b-f953-4a58-9817-963ac9828787",
            "735d12a9-df9d-46fb-893f-6956bbdeb523",
            "fad72382-15fb-4ff6-9013-31d0618448de",
            "66ac4f76-2373-4e20-a481-955a2a4e2ff4",
            "81ee4e15-336d-44d6-88f3-76a541ba03f0",
            "a3e7ff11-7c12-48d4-bf81-489236fa3d4f",
            "dc41000f-ec78-4b15-a241-356c93f7460e",
            "ad61783d-cb54-4b20-8fcf-f4225f9c15c6",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97",
            "ec7bfeaf-4414-494b-9506-ba623bc39d40",
            "434bc01d-774c-4088-ad51-1dab6ac302ea",
            "64e8a22d-d97f-4fbe-ab6a-7cd4d16aae5a",
            "bbb4d09c-4e71-4d73-bceb-73bfe9e56b08",
            "0c9e20ec-963b-464c-aae8-51add9821906",
            "cf8cbf49-bb2a-4c90-b637-f8f17173db29"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "0ab776b4-7150-4c16-a6d9-d3ac3c2b93a2",
              "name_org": "INN"
            },
            {
              "uuid": "7dd7789d-1e6f-4b8a-976b-50f8111949ce",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "c1b6ae06-cc06-4248-a847-89c1e640b5c5",
          "name": "OXYBENZONE [HSDB]",
          "stdName": "OXYBENZONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad61783d-cb54-4b20-8fcf-f4225f9c15c6",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false
        },
        {
          "uuid": "8633f4d4-49ec-43a7-96c5-51ba72e9c437",
          "name": "OXYBENZONE [MART.]",
          "stdName": "OXYBENZONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc41000f-ec78-4b15-a241-356c93f7460e"
          ],
          "display_name": false
        },
        {
          "uuid": "acd7b8f1-4f3b-4161-8ff3-7f0df19cee10",
          "name": "OXYBENZONE [MI]",
          "stdName": "OXYBENZONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c885364-cbc0-4eee-b4d3-9b7aff25065a",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false
        },
        {
          "uuid": "c7bc64b4-da80-42e8-9d73-eb767779aa54",
          "name": "OXYBENZONE [ORANGE BOOK]",
          "stdName": "OXYBENZONE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "735d12a9-df9d-46fb-893f-6956bbdeb523"
          ],
          "display_name": false
        },
        {
          "uuid": "ce0347ed-ae18-46e6-a5b7-fbaa3ea21ee8",
          "name": "OXYBENZONE [USAN]",
          "stdName": "OXYBENZONE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81ee4e15-336d-44d6-88f3-76a541ba03f0"
          ],
          "display_name": false
        },
        {
          "uuid": "b3d79c80-8e00-3d30-07fa-043be8736837",
          "name": "OXYBENZONE [USP MONOGRAPH]",
          "stdName": "OXYBENZONE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e807845f-b8f9-cf3a-0f42-667b1a2cd365"
          ],
          "display_name": false
        },
        {
          "uuid": "3984d489-82aa-4260-9bf0-af9dd5accbcd",
          "name": "OXYBENZONE [USP-RS]",
          "stdName": "OXYBENZONE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c9e20ec-963b-464c-aae8-51add9821906",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false
        },
        {
          "uuid": "e25d1027-5ad6-4707-8ba1-4844e43d5b6c",
          "name": "OXYBENZONE [VANDF]",
          "stdName": "OXYBENZONE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64e8a22d-d97f-4fbe-ab6a-7cd4d16aae5a",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false
        },
        {
          "uuid": "58a075d8-a2f6-0dc5-747b-7624d690fdb3",
          "name": "Oxybenzone [WHO-DD]",
          "stdName": "OXYBENZONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a57f090f-d7a5-d602-e6fe-2eb0863337b7"
          ],
          "display_name": false
        },
        {
          "uuid": "34d8d606-ac35-46af-b75b-d7009a5d514c",
          "name": "SHADE UVAGUARD COMPONENT OXYBENZONE",
          "stdName": "SHADE UVAGUARD COMPONENT OXYBENZONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cd28445-50cc-412a-9ae3-b20d4269774d",
            "c3764430-8ee2-4ff6-b5bd-1891415f857a"
          ],
          "display_name": false
        },
        {
          "uuid": "d5e48d5e-abec-4e3a-8fb3-092e8d6d709e",
          "name": "TINOSORB B 3",
          "stdName": "TINOSORB B 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3bad29b-d5b1-43fe-971f-d42ac0b1a30d",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false
        },
        {
          "uuid": "c81894ca-1dc8-4cf7-a4fb-f469f8dd9004",
          "name": "UVINUL 40",
          "stdName": "UVINUL 40",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86554164-a48f-496e-97e2-5f4f6f4161d3",
            "6396b3d3-973c-4e16-ae32-5faa182394f2"
          ],
          "display_name": false
        },
        {
          "uuid": "4eae0358-6a33-4dec-92af-4132b5a1d013",
          "name": "VIOSORB 110",
          "stdName": "VIOSORB 110",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3bad29b-d5b1-43fe-971f-d42ac0b1a30d",
            "46815ff2-00e8-43df-a68f-a9827a5cfe97"
          ],
          "display_name": false
        },
        {
          "uuid": "3b776951-8c12-42b3-8d43-45524bbf81d9",
          "name": "oxybenzone [INN]",
          "stdName": "OXYBENZONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97782955-ad31-4b2b-8f56-aea20f106334"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cf8cbf49-bb2a-4c90-b637-f8f17173db29",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6d7b0517-9a89-4c99-9dd3-51572047faf3",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c6ceeca-4666-48af-8dc6-a09f6733fd3f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97782955-ad31-4b2b-8f56-aea20f106334",
          "citation": "INN Proposed List 16",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "81ee4e15-336d-44d6-88f3-76a541ba03f0",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66ac4f76-2373-4e20-a481-955a2a4e2ff4",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cd28445-50cc-412a-9ae3-b20d4269774d",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3764430-8ee2-4ff6-b5bd-1891415f857a",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "735d12a9-df9d-46fb-893f-6956bbdeb523",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc41000f-ec78-4b15-a241-356c93f7460e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c885364-cbc0-4eee-b4d3-9b7aff25065a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46815ff2-00e8-43df-a68f-a9827a5cfe97",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86554164-a48f-496e-97e2-5f4f6f4161d3",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6396b3d3-973c-4e16-ae32-5faa182394f2",
          "citation": "D05309",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "342c47dc-2823-4400-beab-71a61a93f37b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad61783d-cb54-4b20-8fcf-f4225f9c15c6",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c9e20ec-963b-464c-aae8-51add9821906",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20846247-b375-469e-a62c-0ec2fcf13305",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64e8a22d-d97f-4fbe-ab6a-7cd4d16aae5a",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b3bad29b-d5b1-43fe-971f-d42ac0b1a30d",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9461de85-3d82-4342-8115-b11575ba052f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "635a1316-749c-4b71-8ec1-43f54e2d0897",
          "citation": "SRS import [95OOS7VE0Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=95OOS7VE0Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389710000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3e7ff11-7c12-48d4-bf81-489236fa3d4f",
          "citation": "OXYBENZONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "22e5c6c4-2a20-4eae-bc24-5e0bf9872e63",
          "citation": "OXYBENZONE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f2d2dd2b-f953-4a58-9817-963ac9828787",
          "citation": "OXYBENZONE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fb940aff-de64-4378-b700-d38f2c2e4b8b",
          "citation": "OXYBENZONE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ec7bfeaf-4414-494b-9506-ba623bc39d40",
          "citation": "OXYBENZONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f83b0d6f-8a92-4973-a7e5-d0275810165a",
          "citation": "OXYBENZONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "87411cb2-80b2-43cb-a120-cafe67850062",
          "citation": "BENZOPHENONE-3 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bbb4d09c-4e71-4d73-bceb-73bfe9e56b08",
          "citation": "OXYBENZONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "434bc01d-774c-4088-ad51-1dab6ac302ea",
          "citation": "OXYBENZONE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c22f6ed0-9b09-448e-8f4a-b88fe47c4c34",
          "citation": "OXYBENZONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a2655276-6c2f-42d1-af8a-e3d6daa727b1",
          "citation": "BENZOPHENONE-3 [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fad72382-15fb-4ff6-9013-31d0618448de",
          "citation": "OXYBENZONE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "924a2a94-f9d1-7d51-baa9-1dee6fc67303",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+131-57-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d9b45f4f-bd12-d560-fb06-cef968fa9d3d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=131-57-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "67a72028-ec2b-40c4-7215-b03af8ecdf10",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "be9fe091-4e5c-400c-aedd-61c3935c215b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e807845f-b8f9-cf3a-0f42-667b1a2cd365",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "7bfe1256-db04-492d-aeb8-580fca86fb4b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "187e2198-4b93-f60c-6a79-cd47edb76194",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a57f090f-d7a5-d602-e6fe-2eb0863337b7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2c26eaf7-3939-2296-3d08-2b38cc2ffbef",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "67758af5-8026-468d-b9ff-96c795db675b",
          "id": "67758af5-8026-468d-b9ff-96c795db675b",
          "molfile": "\n  Marvin  01132105232D          \n\n 17 18  0  0  0  0            999 V2000\n    0.0077    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7142   -1.2324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4258   -0.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1425   -1.2324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1425   -2.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8541   -2.4777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8541   -3.2975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5682   -2.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5682   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2927   -0.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9965   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9965   -2.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2798   -2.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4258   -2.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4258   -3.2872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7142   -2.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 17  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n 15  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc(c(c1)O)C(=O)c2ccccc2",
          "formula": "C14H12O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d471c493-8b5e-4f28-8038-69cccb6b48d5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "228.2438",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "41662fec-1cb2-445b-a6e0-f38dc69210a7",
      "version": "24",
      "structure": {
        "id": "0582cce5-609f-4b21-bcbf-a905cde32c8d",
        "molfile": "\n  Marvin  01132100352D          \n\n 17 18  0  0  0  0            999 V2000\n    2.1425   -2.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8541   -2.4777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4258   -2.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1425   -1.2324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7142   -2.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8541   -3.2975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5682   -2.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7142   -1.2324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4258   -3.2872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4258   -0.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.8147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2798   -2.4673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5682   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0077    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2927   -0.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9965   -2.0574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9965   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  2  2  0  0  0  0\n  7  2  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  4  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n 13  7  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 12  1  0  0  0  0\n 17 15  1  0  0  0  0\n  8  5  2  0  0  0  0\n 17 16  2  0  0  0  0\nM  END",
        "smiles": "COc1ccc(c(c1)O)C(=O)c2ccccc2",
        "formula": "C14H12O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "228.2438",
        "optical_activity": "NONE",
        "references": [
          "635a1316-749c-4b71-8ec1-43f54e2d0897",
          "cf8cbf49-bb2a-4c90-b637-f8f17173db29",
          "97782955-ad31-4b2b-8f56-aea20f106334"
        ],
        "stereo_centers": 0
      },
      "unii": "95OOS7VE0Y"
    }
  ]
}