{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a8d7d5b4-3a87-4665-b70e-02d44059dde3",
          "code": "140923-17-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=140923-17-7",
          "code_system": "CAS",
          "references": [
            "35a23f69-ec0e-454a-98a4-52fe43294ebf",
            "f6d77db0-448c-43e5-8bc8-5c14b7500055"
          ]
        },
        {
          "uuid": "329b5ec5-fe1e-4ff9-90f9-ce44f1b49626",
          "code": "m6394",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6394?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "35a23f69-ec0e-454a-98a4-52fe43294ebf"
          ]
        },
        {
          "uuid": "78a40c62-7d5a-4f27-9e67-c3eb0be83497",
          "code": "10958189",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10958189",
          "code_system": "PUBCHEM",
          "references": [
            "35a23f69-ec0e-454a-98a4-52fe43294ebf"
          ]
        },
        {
          "uuid": "5056be9e-2424-0d1d-b927-67b62a0b6d95",
          "code": "DTXSID0047662",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0047662",
          "code_system": "EPA CompTox",
          "references": [
            "c945604b-21cf-68eb-1574-98feeb2fd67d"
          ]
        },
        {
          "uuid": "0d3f3572-d54e-4fb0-a3ab-69785a2e7e31",
          "code": "94Q9V45M9B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4b6b3c68-571a-0693-148a-4514ac98aeb4",
          "code": "iprovalicarb",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/iprovalicarb.html",
          "code_system": "ALANWOOD",
          "references": [
            "53d0b9a7-8607-421c-1089-64aa0c60c576"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "30b0198f-54e3-4939-8bcc-ed07512df1fd",
          "name": "CARBAMIC ACID, N-((1S)-2-METHYL-1-(((1-(4-METHYLPHENYL)ETHYL)AMINO)CARBONYL)PROPYL)-, 1-METHYLETHYL ESTER",
          "stdName": "CARBAMIC ACID, N-((1S)-2-METHYL-1-(((1-(4-METHYLPHENYL)ETHYL)AMINO)CARBONYL)PROPYL)-, 1-METHYLETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0887060a-f2da-4b3b-8028-9427881bcb40"
          ],
          "display_name": false
        },
        {
          "uuid": "611fc9a0-528f-40b4-8e23-dc9a9f2b5acd",
          "name": "FENCARAMID",
          "stdName": "FENCARAMID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0887060a-f2da-4b3b-8028-9427881bcb40"
          ],
          "display_name": false
        },
        {
          "uuid": "f791894b-7d80-46a5-9fcb-0bc7cd80a0f3",
          "name": "IPROVALICARB",
          "stdName": "IPROVALICARB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aab01d7c-b42b-4761-a78e-d8c15a3514ac",
            "0887060a-f2da-4b3b-8028-9427881bcb40",
            "62ce4a51-f163-4e71-bc46-f9a7b16f8292",
            "35fc4c85-7ec4-4341-814a-675832f5d54a",
            "3a899a2e-31b0-425a-a2cd-78827c7f6b6e"
          ],
          "display_name": true
        },
        {
          "uuid": "7a2cc06d-610b-49dd-ac77-d34a34eefe92",
          "name": "IPROVALICARB [ISO]",
          "stdName": "IPROVALICARB [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35fc4c85-7ec4-4341-814a-675832f5d54a"
          ],
          "display_name": false
        },
        {
          "uuid": "627f5883-a11f-4db1-8239-16a8523236a3",
          "name": "IPROVALICARB [MI]",
          "stdName": "IPROVALICARB [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62ce4a51-f163-4e71-bc46-f9a7b16f8292"
          ],
          "display_name": false
        },
        {
          "uuid": "50599bdd-c1c9-4583-b1b5-3abd617289c2",
          "name": "MELODY",
          "stdName": "MELODY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62ce4a51-f163-4e71-bc46-f9a7b16f8292"
          ],
          "display_name": false
        },
        {
          "uuid": "d1987b78-8ef4-4388-bd4f-d6486a43c3ef",
          "name": "SZX-0722",
          "stdName": "SZX-0722",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0887060a-f2da-4b3b-8028-9427881bcb40"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0887060a-f2da-4b3b-8028-9427881bcb40",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "62ce4a51-f163-4e71-bc46-f9a7b16f8292",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35fc4c85-7ec4-4341-814a-675832f5d54a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35a23f69-ec0e-454a-98a4-52fe43294ebf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391538000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e14fce4d-0aab-4124-aa2f-67ad0957fd0d",
          "citation": "SRS import [94Q9V45M9B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=94Q9V45M9B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391538000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b35bc732-5b9b-409f-8b73-913f16da2a5e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aab01d7c-b42b-4761-a78e-d8c15a3514ac",
          "citation": "IPROVALICARB [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3a899a2e-31b0-425a-a2cd-78827c7f6b6e",
          "citation": "IPROVALICARB [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c945604b-21cf-68eb-1574-98feeb2fd67d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=140923-17-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "53d0b9a7-8607-421c-1089-64aa0c60c576",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "f6d77db0-448c-43e5-8bc8-5c14b7500055",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5ac944c6-d703-4137-914f-4d4cae43ff6b",
          "id": "5ac944c6-d703-4137-914f-4d4cae43ff6b",
          "molfile": "\n  Marvin  01132104422D          \n\n 23 23  0  0  1  0            999 V2000\n    4.9900   -1.2325    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.7090   -1.6519    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4108   -1.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4108   -0.4023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1298   -1.6519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8402   -1.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8402   -0.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5591   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9900   -0.4194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2710    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7090    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2881   -1.6348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2881   -2.4651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5777   -1.2325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8587   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.8587   -2.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1483   -1.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4294   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7190   -1.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7190   -0.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4294    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1483   -0.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  9  1  0  0  0  0\n  1 12  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 23  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  2  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H](C(=O)NC(C)c1ccc(C)cc1)NC(=O)OC(C)C",
          "formula": "C18H28N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6a21bf43-7392-42be-b9a9-ab7c0b6627db"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "320.4272",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4e6d1b43-6272-41eb-83ce-557e438f5edc",
      "version": "4",
      "structure": {
        "id": "c7f14b1e-4cb8-467a-a5d4-e8779a1aa695",
        "molfile": "\n  Marvin  01132110202D          \n\n 23 23  0  0  1  0            999 V2000\n    6.4108   -1.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4108   -0.4023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1298   -1.6519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7090   -1.6519    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9900   -1.2325    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.9900   -0.4194    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.2710    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7090    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2881   -1.6348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2881   -2.4651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5777   -1.2325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8587   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8587   -2.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1483   -1.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4294   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1483   -0.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7190   -1.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4294    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7190   -0.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8402   -1.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8402   -0.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5591   -1.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  3 21  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 17 19  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\nM  END",
        "smiles": "C[C@H](C)[C@@H](C(=O)NC(C)c1ccc(C)cc1)NC(=O)OC(C)C",
        "formula": "C18H28N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "320.4272",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b35bc732-5b9b-409f-8b73-913f16da2a5e",
          "e14fce4d-0aab-4124-aa2f-67ad0957fd0d"
        ],
        "stereo_centers": 2
      },
      "unii": "94Q9V45M9B"
    }
  ]
}