{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e5bd422e-b8ab-474e-a139-ea574e550922", "code": "6706-82-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6706-82-7", "code_system": "CAS", "references": [ "c88c9d08-17ec-4860-8397-f8f681f5a152", "7481b814-148e-4198-82b5-21fef2ea52f1" ] }, { "uuid": "a5a0cc12-2128-4e08-8f25-b2b0aa37e2fa", "code": "229-754-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.050", "code_system": "ECHA (EC/EINECS)", "references": [ "c88c9d08-17ec-4860-8397-f8f681f5a152" ] }, { "uuid": "00aa80f6-9476-4d44-8be9-23bafd694d06", "code": "944C4896N7", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8115821a-f40f-6126-0e4d-9c02741cdf54", "code": "DTXSID50879809", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50879809", "code_system": "EPA CompTox" }, { "uuid": "943d11f2-1ad2-7d00-ac13-7c9a328cd1f5", "code": "2604572", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2604572/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "d57e4736-cd47-8824-8155-786f501ec57a" ] }, { "uuid": "a1ed7aa4-458e-9e4e-fefa-51bbcd1d3ab9", "code": "944C4896N7", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=944C4896N7", "code_system": "DAILYMED", "references": [ "b2d8065d-86da-1179-b2d0-6a2249210085" ] } ], "substance_class": "chemical", "names": [ { "uuid": "710881b4-a4ed-4df0-928c-66bb574b0bce", "name": "C.I. 21230", "stdName": "C.I. 21230", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": false }, { "uuid": "73a8424b-d434-4e78-a563-4491ccb9b34a", "name": "C.I. SOLVENT YELLOW 29", "stdName": "C.I. SOLVENT YELLOW 29", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "cad13620-919c-4bc9-8b3a-184a6157bcb6" ], "display_name": false }, { "uuid": "e7c41b64-d6e2-4c99-880e-9bae0c7f1a57", "name": "CERES YELLOW GRN", "stdName": "CERES YELLOW GRN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": false }, { "uuid": "f863b825-9082-4cf9-a8d0-bbedc697b1ff", "name": "CI 21230", "stdName": "CI 21230", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f", "079e9b6e-7b0b-4908-8c07-6d3ed138c02f", "1f344582-0212-426e-bd71-2bd722f31118" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "cc4e6de0-deaf-49b6-b4b1-814e5784a4a4", "name_org": "INCI" } ] }, { "uuid": "ac0adb0f-266b-49e0-8640-6a2f90d6bcf6", "name": "CI SOLVENT YELLOW 29", "stdName": "CI SOLVENT YELLOW 29", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e4c9f194-a2d0-48a4-a684-a398aeb9cc3a", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": false }, { "uuid": "74a401f0-c06d-461b-b718-8285511db141", "name": "OIL YELLOW 129", "stdName": "OIL YELLOW 129", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": false }, { "uuid": "08103ac1-0559-4599-9835-e5c3603be55d", "name": "OIL YELLOW GR", "stdName": "OIL YELLOW GR", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": false }, { "uuid": "dad70514-9a33-489a-982e-9e0e22070ac3", "name": "ORIENT OIL YELLOW 129", "stdName": "ORIENT OIL YELLOW 129", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": false }, { "uuid": "d948dbe6-cf8f-4701-9472-5e8a26b87497", "name": "ORIENT YELLOW 129", "stdName": "ORIENT YELLOW 129", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": false }, { "uuid": "c2c427e8-d93c-4230-9a25-10cc10b8e1da", "name": "PHENOL, 2,2'-(CYCLOHEXYLIDENEBIS((2-METHYL-4,1-PHENYLENE)-2,1-DIAZENEDIYL))BIS(4-CYCLOHEXYL-", "stdName": "PHENOL, 2,2'-(CYCLOHEXYLIDENEBIS((2-METHYL-4,1-PHENYLENE)-2,1-DIAZENEDIYL))BIS(4-CYCLOHEXYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": false }, { "uuid": "27546c93-5f91-4390-9415-e80d10af58a4", "name": "PHENOL, 2,2'-(CYCLOHEXYLIDENEBIS((2-METHYL-4,1-PHENYLENE)AZO))BIS(4-CYCLOHEXYL-", "stdName": "PHENOL, 2,2'-(CYCLOHEXYLIDENEBIS((2-METHYL-4,1-PHENYLENE)AZO))BIS(4-CYCLOHEXYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": false }, { "uuid": "622f3657-20f3-4d2f-8f2e-3d3b7c820b9e", "name": "SOLVENT YELLOW 29", "stdName": "SOLVENT YELLOW 29", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "a5f6a280-e491-41a9-8ffa-45a24a2fa099", "7929476e-483b-4ff9-a041-5228bbf7e324", "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "40c9db68-9125-4e34-b45f-0a53161d6725", "name_org": "INCI" } ] }, { "uuid": "aa789060-1915-4f9e-919b-5b62926048eb", "name": "SUDAN YELLOW GRN", "stdName": "SUDAN YELLOW GRN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "8470fbe8-a782-4f75-9788-80fbad7f135f" ], "display_name": false } ], "references": [ { "uuid": "cad13620-919c-4bc9-8b3a-184a6157bcb6", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "1f344582-0212-426e-bd71-2bd722f31118", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8470fbe8-a782-4f75-9788-80fbad7f135f", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a5f6a280-e491-41a9-8ffa-45a24a2fa099", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9d6b2784-66fb-40d1-8313-46dc5ce51b2b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e4c9f194-a2d0-48a4-a684-a398aeb9cc3a", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c88c9d08-17ec-4860-8397-f8f681f5a152", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391009000, "tags": [ "NOMEN" ] }, { "uuid": "1b3d7071-8fec-4b03-8d9d-9bbc718490b1", "citation": "SRS import [944C4896N7]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=944C4896N7", "doc_type": "SRS", "public_domain": true, "document_date": 1493391009000, "tags": [ "NOMEN" ] }, { "uuid": "20cf50b9-0c09-4561-8893-95505e2a0f8e", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "079e9b6e-7b0b-4908-8c07-6d3ed138c02f", "citation": "CI 21230 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "7929476e-483b-4ff9-a041-5228bbf7e324", "citation": "SOLVENT YELLOW 29 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "d57e4736-cd47-8824-8155-786f501ec57a", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "7481b814-148e-4198-82b5-21fef2ea52f1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "b2d8065d-86da-1179-b2d0-6a2249210085", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "59b080ed-f584-45e7-a428-744ece693d12", "id": "59b080ed-f584-45e7-a428-744ece693d12", "molfile": "\n Marvin 01132104392D \n\n 50 56 0 0 0 0 999 V2000\n 9.4592 -7.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1817 -6.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7160 -5.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4360 -5.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6215 -4.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0932 -5.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3732 -6.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8372 -7.0275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0273 -6.8836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4914 -7.5116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7688 -8.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2324 -8.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4245 -8.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1469 -7.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6775 -7.3635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3973 -6.5875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5073 -9.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9666 -10.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2462 -11.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0552 -11.2540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5939 -10.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3208 -9.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0765 -4.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6087 -5.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4186 -4.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7025 -4.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1809 -3.4694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3603 -3.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2212 -3.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2212 -3.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5101 -2.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7935 -3.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0796 -2.6419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0796 -1.8151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3646 -1.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6446 -1.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9358 -1.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9358 -0.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6446 -0.1619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3646 -0.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0796 -0.1610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2195 -1.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5009 -1.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7906 -1.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7906 -2.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4952 -3.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2195 -2.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7935 -3.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0783 -4.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5045 -4.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 23 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 15 2 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 12 17 1 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 22 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 28 23 1 0 0 0 0\n 29 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 50 29 2 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 33 32 1 0 0 0 0\n 32 48 2 0 0 0 0\n 34 33 2 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 35 40 2 0 0 0 0\n 37 36 2 0 0 0 0\n 38 37 1 0 0 0 0\n 37 42 1 0 0 0 0\n 39 38 2 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 1 0 0 0 0\n 42 43 1 0 0 0 0\n 47 42 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\n 48 49 1 0 0 0 0\n 48 50 1 0 0 0 0\nM END", "smiles": "Cc1cc(ccc1/N=N/c2cc(ccc2O)C3CCCCC3)C4(CCCCC4)c5ccc(c(C)c5)/N=N/c6cc(ccc6O)C7CCCCC7", "formula": "C44H52N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5048e7e0-bc49-44bb-a500-be35ba17b6b7" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "668.9109", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "7b3e3463-ecff-47c0-b763-ba10cc5368a1", "version": "7", "structure": { "id": "718a54eb-3ae0-4946-b408-49dd67658dc0", "molfile": "\n Marvin 01132105532D \n\n 50 56 0 0 0 0 999 V2000\n 7.0796 -0.1610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3646 -0.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6446 -0.1619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9358 -0.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9358 -1.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6446 -1.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3646 -1.4022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0796 -1.8151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0796 -2.6419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7935 -3.0521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7935 -3.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5045 -4.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2212 -3.8819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2212 -3.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5101 -2.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0765 -4.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4360 -5.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6215 -4.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0932 -5.6236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3732 -6.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8372 -7.0275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0273 -6.8836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4914 -7.5116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6775 -7.3635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3973 -6.5875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1469 -7.9931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4245 -8.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2324 -8.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5073 -9.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9666 -10.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2462 -11.1051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0552 -11.2540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5939 -10.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3208 -9.8487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7688 -8.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.1817 -6.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4592 -7.3256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7160 -5.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6087 -5.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4186 -4.8748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7025 -4.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1809 -3.4694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3603 -3.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0783 -4.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2195 -1.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5009 -1.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7906 -1.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7906 -2.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4952 -3.0510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2195 -2.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 2 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 10 2 0 0 0 0\n 13 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 29 1 0 0 0 0\n 28 35 1 0 0 0 0\n 35 23 2 0 0 0 0\n 20 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 38 17 2 0 0 0 0\n 16 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 16 1 0 0 0 0\n 11 44 1 0 0 0 0\n 5 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 45 1 0 0 0 0\nM END", "smiles": "Cc1cc(ccc1/N=N/c2cc(ccc2O)C3CCCCC3)C4(CCCCC4)c5ccc(c(C)c5)/N=N/c6cc(ccc6O)C7CCCCC7", "formula": "C44H52N4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "668.9109", "optical_activity": "NONE", "references": [ "1b3d7071-8fec-4b03-8d9d-9bbc718490b1", "20cf50b9-0c09-4561-8893-95505e2a0f8e" ], "stereo_centers": 0 }, "unii": "944C4896N7" } ] }