{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ee3ac4c2-985e-43c7-b2f9-e0a81d64c149",
          "code": "469-78-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=469-78-3",
          "code_system": "CAS",
          "references": [
            "7cba9ced-8d3c-4df5-9625-d6270a665cb3",
            "75dd94f1-1d11-4284-a3a3-71c050ad53ac"
          ]
        },
        {
          "uuid": "a56a1005-acee-4278-ad7f-b241ab67121a",
          "code": "C91046",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C91046",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7cba9ced-8d3c-4df5-9625-d6270a665cb3"
          ]
        },
        {
          "uuid": "a31f51d8-c948-4688-adff-e364c1b3e39c",
          "code": "SUB08846MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7cba9ced-8d3c-4df5-9625-d6270a665cb3"
          ]
        },
        {
          "uuid": "5ad13d1d-f0bb-4eff-a1bd-21d057a15072",
          "code": "571",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=571",
          "code_system": "INN",
          "references": [
            "7cba9ced-8d3c-4df5-9625-d6270a665cb3"
          ]
        },
        {
          "uuid": "0d6b9977-0171-438d-9d83-e5f62286d5f7",
          "code": "CHEMBL2104520",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104520",
          "code_system": "ChEMBL",
          "references": [
            "7cba9ced-8d3c-4df5-9625-d6270a665cb3"
          ]
        },
        {
          "uuid": "386670ff-a0ba-409d-9352-0076a012e2c0",
          "code": "3047717",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3047717",
          "code_system": "PUBCHEM",
          "references": [
            "7cba9ced-8d3c-4df5-9625-d6270a665cb3"
          ]
        },
        {
          "uuid": "0a066835-7519-c272-3c6b-0c349c71cec9",
          "code": "Metheptazine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Metheptazine",
          "code_system": "WIKIPEDIA",
          "references": [
            "a6e0a4b6-9850-7287-aa67-cac93b2b1ea1"
          ]
        },
        {
          "uuid": "078e22c8-9ade-8db3-b22f-bd8c01cf8ed7",
          "code": "C67413",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d576d99d-82bf-f4e4-f2de-264b515a5d67"
          ]
        },
        {
          "uuid": "054e4834-8bbe-43a5-8e06-082f522362fb",
          "code": "93X4R66P5A",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "55c1b3ca-e197-2d70-7928-73e16414a6c0",
          "code": "DTXSID10861967",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10861967",
          "code_system": "EPA CompTox",
          "references": [
            "d576d99d-82bf-f4e4-f2de-264b515a5d67"
          ]
        },
        {
          "uuid": "d2997b1b-0bd7-52a2-e067-18284e67adf9",
          "code": "100000081411",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "025640b8-3f27-2d5a-0d5f-b2593e839203"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9123a913-2eef-445c-88da-71be7e7835ce",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ec8ec962-262d-4595-909c-76061979ca52",
            "refuuid": "c032cfb8-d559-4a46-8e50-76146e2e7ad8",
            "name": "METHEPTAZINE",
            "unii": "93X4R66P5A",
            "linking_id": "93X4R66P5A",
            "ref_pname": "METHEPTAZINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1ba7f129-30e6-4ecf-9534-d82ecd98d88d",
          "name": "HEXAHYDRO-1,2-DIMETHYL-4-PHENYL-4-AZEPINECARBOXYLIC ACID METHYL ESTER",
          "stdName": "HEXAHYDRO-1,2-DIMETHYL-4-PHENYL-4-AZEPINECARBOXYLIC ACID METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "374e7c11-4430-4327-ac1e-365e40f8049d"
          ],
          "display_name": false
        },
        {
          "uuid": "37635b36-7249-489b-9483-2e47fd0a30af",
          "name": "METHEPTAZINE",
          "stdName": "METHEPTAZINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e131c6db-1805-40af-964c-affb28a8791b",
            "374e7c11-4430-4327-ac1e-365e40f8049d",
            "7d8e5f24-b134-4722-9ce3-204f6039908c"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "5401b3e0-6373-4483-b45d-76861d6c26a1",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ea753cbd-e697-4dff-9c17-22285d04b91c",
          "name": "metheptazine [INN]",
          "stdName": "METHEPTAZINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d8e5f24-b134-4722-9ce3-204f6039908c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "374e7c11-4430-4327-ac1e-365e40f8049d",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7d8e5f24-b134-4722-9ce3-204f6039908c",
          "citation": "INN Proposed List 5",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL05.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7cba9ced-8d3c-4df5-9625-d6270a665cb3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390757000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7087c510-f2c1-4dae-8a2f-93af55c29877",
          "citation": "SRS import [93X4R66P5A]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=93X4R66P5A",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390757000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e131c6db-1805-40af-964c-affb28a8791b",
          "citation": "METHEPTAZINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a6e0a4b6-9850-7287-aa67-cac93b2b1ea1",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Metheptazine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "025640b8-3f27-2d5a-0d5f-b2593e839203",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d576d99d-82bf-f4e4-f2de-264b515a5d67",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "75dd94f1-1d11-4284-a3a3-71c050ad53ac",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "42164e2e-0289-4654-9348-8dd157d65286",
          "id": "42164e2e-0289-4654-9348-8dd157d65286",
          "molfile": "\n  Marvin  01132103292D          \n\n 19 20  0  0  0  0            999 V2000\n    6.5822   -1.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5365   -0.7703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8176   -0.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1092   -0.7719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8176    0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.8176    1.2899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4601    1.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2571    1.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6149    0.8725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4401    0.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2590    0.1358    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.7698   -0.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4581   -0.0482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9926    0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5808    1.1805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7526    1.1805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3407    0.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7526   -0.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5808   -0.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "CC1CC(CCCN1C)(c2ccccc2)C(=O)OC",
          "formula": "C16H23NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0498043d-4360-4d55-81ae-9857203ca6cd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "261.3599",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c032cfb8-d559-4a46-8e50-76146e2e7ad8",
      "version": "7",
      "structure": {
        "id": "41fa7074-5241-4e1d-9ab9-6b7a3da234d5",
        "molfile": "\n  Marvin  01132103292D          \n\n 19 20  0  0  0  0            999 V2000\n    5.8176   -0.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8176    0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4581   -0.0482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2590    0.1358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6149    0.8725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2571    1.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4601    1.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8176    1.2899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4401    0.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7698   -0.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9926    0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5808    1.1805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7526    1.1805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3407    0.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7526   -0.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5808   -0.2493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1092   -0.7719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5365   -0.7703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5822   -1.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n 11  2  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 11 16  1  0  0  0  0\n  1 17  2  0  0  0  0\n  1 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "CC1CC(CCCN1C)(c2ccccc2)C(=O)OC",
        "formula": "C16H23NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "261.3599",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "374e7c11-4430-4327-ac1e-365e40f8049d",
          "7087c510-f2c1-4dae-8a2f-93af55c29877",
          "7d8e5f24-b134-4722-9ce3-204f6039908c"
        ],
        "stereo_centers": 2
      },
      "unii": "93X4R66P5A"
    }
  ]
}