{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "eb79f7cd-7cba-44a4-8ae4-3c18ef01b20b",
          "code": "46830-22-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=46830-22-2",
          "code_system": "CAS",
          "references": [
            "4e852db1-0a84-4ddd-a68d-bf722613ce64",
            "8c562b82-cdef-4d34-b0cd-2f8f01afe88c"
          ]
        },
        {
          "uuid": "92d5ca08-4e56-448c-bf63-abcc727d0177",
          "code": "256-283-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.051.150",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4e852db1-0a84-4ddd-a68d-bf722613ce64"
          ]
        },
        {
          "uuid": "ddb7095c-da67-4485-8835-e933f2294ab0",
          "code": "162073",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/162073",
          "code_system": "PUBCHEM",
          "references": [
            "4e852db1-0a84-4ddd-a68d-bf722613ce64"
          ]
        },
        {
          "uuid": "de8a9b2a-f0b1-a867-2416-0973044a5f8e",
          "code": "DTXSID9050430",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9050430",
          "code_system": "EPA CompTox",
          "references": [
            "24640aed-f6bb-5dc3-7766-5ec2cd45a8f8"
          ]
        },
        {
          "uuid": "36b98a9a-0af1-40e7-9f8e-afab681be8b8",
          "code": "9330J8T133",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1bd7f763-e7a9-4289-9265-8703ec5f6fdf",
          "name": "(2-ACRYLOXYETHYL)DIMETHYL(BENZYL)AMMONIUM CHLORIDE",
          "stdName": "(2-ACRYLOXYETHYL)DIMETHYL(BENZYL)AMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4189769-c10b-47ab-82f0-1a29f492e528"
          ],
          "display_name": false
        },
        {
          "uuid": "738f3b97-39a7-4497-a1aa-85ffc60774ee",
          "name": "(ACRYLOYLOXYETHYL)BENZYLDIMETHYLAMMONIUM CHLORIDE",
          "stdName": "(ACRYLOYLOXYETHYL)BENZYLDIMETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86679030-85e1-46cf-ad1e-4ce0561294a4"
          ],
          "display_name": false
        },
        {
          "uuid": "e403922f-244d-438c-b1e0-1ba08a23df65",
          "name": "2-(ACRYLOYLOXY)ETHYLDIMETHYLBENZYLAMMONIUM CHLORIDE",
          "stdName": "2-(ACRYLOYLOXY)ETHYLDIMETHYLBENZYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4189769-c10b-47ab-82f0-1a29f492e528"
          ],
          "display_name": false
        },
        {
          "uuid": "e7c6449b-51c8-4e46-a62f-2ac0e259fc10",
          "name": "ACRYLOYLOXYETHYLBENZYLDIMETHYLAMMONIUM CHLORIDE",
          "stdName": "ACRYLOYLOXYETHYLBENZYLDIMETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4189769-c10b-47ab-82f0-1a29f492e528"
          ],
          "display_name": false
        },
        {
          "uuid": "6d28a5f8-d93e-41ba-9519-c3950c1cb093",
          "name": "ADAMQUAT BZ 80",
          "stdName": "ADAMQUAT BZ 80",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4189769-c10b-47ab-82f0-1a29f492e528"
          ],
          "display_name": false
        },
        {
          "uuid": "bd557860-3a1e-431d-923c-fa941c250df5",
          "name": "BENZENEMETHANAMINIUM, N,N-DIMETHYL-N-(2-((1-OXO-2-PROPEN-1-YL)OXY)ETHYL)-, CHLORIDE (1:1)",
          "stdName": "BENZENEMETHANAMINIUM, N,N-DIMETHYL-N-(2-((1-OXO-2-PROPEN-1-YL)OXY)ETHYL)-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4189769-c10b-47ab-82f0-1a29f492e528"
          ],
          "display_name": false
        },
        {
          "uuid": "a94409b7-b574-4dda-a36a-80aaf4d73809",
          "name": "BENZENEMETHANAMINIUM, N,N-DIMETHYL-N-(2-((1-OXO-2-PROPENYL)OXY)ETHYL)-, CHLORIDE",
          "stdName": "BENZENEMETHANAMINIUM, N,N-DIMETHYL-N-(2-((1-OXO-2-PROPENYL)OXY)ETHYL)-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4189769-c10b-47ab-82f0-1a29f492e528"
          ],
          "display_name": false
        },
        {
          "uuid": "bedf5ea7-86ca-4f7c-857f-27a4226a00c1",
          "name": "DIMETHYLAMINOETHYL ACRYLATE BENZYL CHLORIDE",
          "stdName": "DIMETHYLAMINOETHYL ACRYLATE BENZYL CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92a08ef4-723b-44ee-a670-1475280f4554"
          ],
          "display_name": true
        },
        {
          "uuid": "65e865b3-c53f-4583-a4da-e5603bb5e940",
          "name": "DIMETHYLAMINOETHYL ACRYLATE BENZYL CHLORIDE QUATERNARY SALT",
          "stdName": "DIMETHYLAMINOETHYL ACRYLATE BENZYL CHLORIDE QUATERNARY SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4189769-c10b-47ab-82f0-1a29f492e528"
          ],
          "display_name": false
        },
        {
          "uuid": "4a97a3c3-b59d-4aab-aecc-19bfa3f5579a",
          "name": "FLOCKSTAR PCB 23",
          "stdName": "FLOCKSTAR PCB 23",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4189769-c10b-47ab-82f0-1a29f492e528"
          ],
          "display_name": false
        },
        {
          "uuid": "a0f0dc9a-c9ae-40a3-90b3-0e57840b382a",
          "name": "N-(2-ACRYLOYLOXYETHYL)-N-BENZYL-N,N-DIMETHYLAMMONIUM CHLORIDE",
          "stdName": "N-(2-ACRYLOYLOXYETHYL)-N-BENZYL-N,N-DIMETHYLAMMONIUM CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4189769-c10b-47ab-82f0-1a29f492e528"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "28b87615-73f3-40aa-b540-98492db653c7",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92a08ef4-723b-44ee-a670-1475280f4554",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "86679030-85e1-46cf-ad1e-4ce0561294a4",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4189769-c10b-47ab-82f0-1a29f492e528",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e852db1-0a84-4ddd-a68d-bf722613ce64",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391103000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81e176c1-d8b9-4639-8af8-21a939a0e2ff",
          "citation": "SRS import [9330J8T133]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9330J8T133",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391103000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24640aed-f6bb-5dc3-7766-5ec2cd45a8f8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=46830-22-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8c562b82-cdef-4d34-b0cd-2f8f01afe88c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7c77dc1b-41e9-4d28-b4a5-fd2d31900c05",
          "id": "7c77dc1b-41e9-4d28-b4a5-fd2d31900c05",
          "molfile": "\n  Marvin  01132106282D          \n\n  1  0  0  0  0  0            999 V2000\n    7.2519   -5.5957    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bcb1347a-902f-4ef6-9404-1c6b4182ee38"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "5b4da7c6-cd66-4b6e-a127-5a989537e5b1",
          "id": "5b4da7c6-cd66-4b6e-a127-5a989537e5b1",
          "molfile": "\n  Marvin  01132104442D          \n\n 17 17  0  0  0  0            999 V2000\n    7.0544   -4.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4645   -4.7997    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    8.1815   -4.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7524   -5.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0355   -4.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3233   -5.2145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6064   -4.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6064   -3.9748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8943   -5.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8943   -6.0395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8794   -5.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7043   -5.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1144   -6.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9394   -6.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3542   -5.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9394   -4.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1144   -4.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n 11  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\nM  CHG  1   2   1\nM  END",
          "smiles": "C=CC(=O)OCC[N+](C)(C)Cc1ccccc1",
          "formula": "C14H20NO2",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dce89c27-4ce7-4327-810c-7fc8ef727f42"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "234.3146",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c7e0030e-a010-4657-9dc8-a26ad5c4d748",
      "version": "3",
      "structure": {
        "id": "b9ec3fd5-6c07-4b94-8de4-7202a568d7a7",
        "molfile": "\n  Marvin  01132109372D          \n\n 18 17  0  0  0  0            999 V2000\n    8.7043   -5.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1144   -4.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9394   -4.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3542   -5.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9394   -6.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1144   -6.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8794   -5.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4645   -4.7997    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    6.7524   -5.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0355   -4.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3233   -5.2145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6064   -4.7997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8943   -5.2145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8943   -6.0395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6064   -3.9748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0544   -4.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1815   -4.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2519   -5.5957    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  2  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 12 15  2  0  0  0  0\n  8 16  1  0  0  0  0\n  8 17  1  0  0  0  0\nM  CHG  2   8   1  18  -1\nM  END",
        "smiles": "C=CC(=O)OCC[N+](C)(C)Cc1ccccc1.[Cl-]",
        "formula": "C14H20NO2.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "269.7676",
        "optical_activity": "NONE",
        "references": [
          "81e176c1-d8b9-4639-8af8-21a939a0e2ff",
          "28b87615-73f3-40aa-b540-98492db653c7"
        ],
        "stereo_centers": 0
      },
      "unii": "9330J8T133"
    }
  ]
}