{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8c3ba36f-98ff-4fe9-b348-d86dff11677f", "code": "3257-28-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3257-28-1", "code_system": "CAS", "references": [ "42d446f6-1c88-4bdc-a867-54a81384b5f5", "016f641b-d993-402a-8008-6fbf8efd7e19" ] }, { "uuid": "959ffeb5-a4ce-41b2-90ff-5bd7e45ae82a", "code": "221-856-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.870", "code_system": "ECHA (EC/EINECS)", "references": [ "42d446f6-1c88-4bdc-a867-54a81384b5f5" ] }, { "uuid": "5b1d8429-0f39-842b-8396-d7abda1453c1", "code": "DTXSID9062938", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9062938", "code_system": "EPA CompTox", "references": [ "0b6dccf7-48ed-4efa-4a38-373424b353a1" ] }, { "uuid": "41cee449-69ff-4f19-99bd-f792cd42bbab", "code": "92NT7608O0", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "498bf0d4-cf00-4a2d-b4a9-aaf9ba3f08c5", "name": "1-NAPHTHALENESULFONIC ACID, 6-((2,4-DIMETHYL-6-SULFOPHENYL)AZO)-5-HYDROXY-, DISODIUM SALT", "stdName": "1-NAPHTHALENESULFONIC ACID, 6-((2,4-DIMETHYL-6-SULFOPHENYL)AZO)-5-HYDROXY-, DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "65495443-148f-4274-a969-91981d0ee8b4", "d4988b4d-856d-47f2-9d34-0c64143a6653" ], "display_name": false }, { "uuid": "b1fca06d-fcd7-461c-9322-34e29aa55adf", "name": "1-NAPHTHALENESULFONIC ACID, 6-(2-(2,4-DIMETHYL-6-SULFOPHENYL)DIAZENYL)-5-HYDROXY-, SODIUM SALT (1:2)", "stdName": "1-NAPHTHALENESULFONIC ACID, 6-(2-(2,4-DIMETHYL-6-SULFOPHENYL)DIAZENYL)-5-HYDROXY-, SODIUM SALT (1:2)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "65495443-148f-4274-a969-91981d0ee8b4", "d4988b4d-856d-47f2-9d34-0c64143a6653" ], "display_name": false }, { "uuid": "793027bd-3d04-41e8-af81-ce89ed1aab99", "name": "C.I. FOOD RED 2", "stdName": "C.I. FOOD RED 2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "37449ce3-0b17-4f37-b321-afc1acc81628" ], "display_name": false }, { "uuid": "204529ae-14ab-4709-b8c8-5ebdcd9cbf30", "name": "C.I. FOOD RED 2, DISODIUM SALT", "stdName": "C.I. FOOD RED 2, DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "65495443-148f-4274-a969-91981d0ee8b4", "d4988b4d-856d-47f2-9d34-0c64143a6653" ], "display_name": false }, { "uuid": "beb7e024-c476-4c4c-96bf-62dc7be3f8c2", "name": "CI 14815", "stdName": "CI 14815", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "88891125-997a-4e68-b5a2-9eedcfb87076", "65495443-148f-4274-a969-91981d0ee8b4", "200c311d-27db-4494-ada7-d1088e5ed5a8", "df9c21a3-80d2-4970-a3d3-757eb5743fcc" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "6fbcbc86-9d62-4fd7-9268-60aeee6259c0", "name_org": "INCI" } ] }, { "uuid": "b5b21cee-0ab9-453a-a698-134b48832950", "name": "FOOD RED 2", "stdName": "FOOD RED 2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "65495443-148f-4274-a969-91981d0ee8b4", "ee7306f0-eda0-4d85-8acf-6e1c05309a52" ], "display_name": true }, { "uuid": "20eccfa0-83dc-4511-8bbc-0ee84eb16b85", "name": "FOOD RED NO. 2", "stdName": "FOOD RED NO. 2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "65495443-148f-4274-a969-91981d0ee8b4", "d4988b4d-856d-47f2-9d34-0c64143a6653" ], "display_name": false } ], "references": [ { "uuid": "37449ce3-0b17-4f37-b321-afc1acc81628", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "88891125-997a-4e68-b5a2-9eedcfb87076", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "65495443-148f-4274-a969-91981d0ee8b4", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d4988b4d-856d-47f2-9d34-0c64143a6653", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "200c311d-27db-4494-ada7-d1088e5ed5a8", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ee7306f0-eda0-4d85-8acf-6e1c05309a52", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "42d446f6-1c88-4bdc-a867-54a81384b5f5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390999000, "tags": [ "NOMEN" ] }, { "uuid": "b4effaf2-a38d-4fb6-ba04-206d8b784906", "citation": "SRS import [92NT7608O0]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=92NT7608O0", "doc_type": "SRS", "public_domain": true, "document_date": 1493390999000, "tags": [ "NOMEN" ] }, { "uuid": "0d1ad975-3a8b-448f-ae18-49564594876f", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "df9c21a3-80d2-4970-a3d3-757eb5743fcc", "citation": "CI 14815 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "0b6dccf7-48ed-4efa-4a38-373424b353a1", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3257-28-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "016f641b-d993-402a-8008-6fbf8efd7e19", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "8552fcd3-8958-4d00-8ebb-f2ead5f900f5", "id": "8552fcd3-8958-4d00-8ebb-f2ead5f900f5", "molfile": "\n Marvin 01132106552D \n\n 1 0 0 0 0 0 999 V2000\n 10.4130 -8.5479 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "ee8d0445-a9e3-49c1-a936-a323b2baeba4" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "5faecf41-d1af-4860-bc6e-499a91b27f01", "id": "5faecf41-d1af-4860-bc6e-499a91b27f01", "molfile": "\n Marvin 01132104572D \n\n 29 31 0 0 0 0 999 V2000\n 3.8626 -2.8540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5790 -3.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5790 -4.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2908 -4.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2908 -5.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0051 -4.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7200 -4.4965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7200 -5.3181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4351 -5.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4351 -6.5562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1472 -6.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8612 -6.5562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5832 -6.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2918 -6.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2918 -5.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5737 -5.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8612 -5.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1472 -5.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1472 -4.4949 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 9.5832 -7.8726 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5832 -8.6989 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.4048 -7.8726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7568 -7.8726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0051 -3.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2852 -2.8477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7174 -2.8465 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4297 -2.4300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1339 -3.5588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3009 -2.1343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 25 2 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 24 6 2 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 18 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 2 0 0 0 0\n 13 14 2 0 0 0 0\n 13 20 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 2 0 0 0 0\n 20 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 24 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 2 0 0 0 0\n 26 29 2 0 0 0 0\nM CHG 2 19 -1 21 -1\nM END", "smiles": "Cc1cc(C)c(c(c1)S(=O)(=O)O)/N=N/c2ccc3c(cccc3S(=O)(=O)[O-])c2[O-]", "formula": "C18H14N2O7S2", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8300af8b-d419-4f90-a760-c7ae4e576a05" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "434.4458", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2d5c2afc-c532-432c-9f02-877fbc1e1275", "version": "4", "structure": { "id": "3be94bf6-b234-452e-924b-a66112eae722", "molfile": "\n Marvin 01132103112D \n\n 31 31 0 0 0 0 999 V2000\n 10.4130 -8.5479 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 8.2868 -2.3783 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 8.8612 -5.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1472 -5.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1472 -4.4949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4351 -5.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7200 -5.3181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7200 -4.4965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0051 -4.0848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2908 -4.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2908 -5.3220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5790 -4.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5790 -3.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8626 -2.8540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2852 -2.8477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0051 -3.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7174 -2.8465 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1339 -3.5588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3009 -2.1343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4297 -2.4300 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.4351 -6.5562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1472 -6.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8612 -6.5562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5832 -6.9673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5832 -7.8726 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4048 -7.8726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7568 -7.8726 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5832 -8.6989 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.2918 -6.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2918 -5.7257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5737 -5.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 9 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 2 0 0 0 0\n 17 20 1 0 0 0 0\n 6 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 3 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 2 0 0 0 0\n 25 28 1 0 0 0 0\n 24 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 3 2 0 0 0 0\nM CHG 4 1 1 2 1 20 -1 28 -1\nM END", "smiles": "Cc1cc(C)c(c(c1)S(=O)(=O)[O-])/N=N/c2ccc3c(cccc3S(=O)(=O)[O-])c2O.[Na+].[Na+]", "formula": "C18H14N2O7S2.2Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "480.4254", "optical_activity": "NONE", "references": [ "b4effaf2-a38d-4fb6-ba04-206d8b784906", "0d1ad975-3a8b-448f-ae18-49564594876f" ], "stereo_centers": 0 }, "unii": "92NT7608O0" } ] }