{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "508bf837-9ca7-4db9-a3d4-800530389170",
          "code": "23513-14-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23513-14-6",
          "code_system": "CAS",
          "references": [
            "99e3aab0-4dd7-41c4-915d-b2b4f84a17d9",
            "25c73421-f029-4967-a111-b5d07cc29412"
          ]
        },
        {
          "uuid": "51953301-5bcb-48a9-846f-5242c57836f0",
          "code": "C007845",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67007845",
          "code_system": "MESH",
          "references": [
            "99e3aab0-4dd7-41c4-915d-b2b4f84a17d9"
          ]
        },
        {
          "uuid": "3a8b88fe-b6dd-4b61-b936-12b2737f3d1c",
          "code": "GINGEROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Gingerol",
          "code_system": "WIKIPEDIA",
          "references": [
            "99e3aab0-4dd7-41c4-915d-b2b4f84a17d9"
          ]
        },
        {
          "uuid": "59906c2f-32f7-4941-944d-614c1b6e39f9",
          "code": "m5729",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5729?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "99e3aab0-4dd7-41c4-915d-b2b4f84a17d9"
          ]
        },
        {
          "uuid": "18cb00f5-fc3f-499a-923d-4eeadab4d005",
          "code": "442793",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/442793",
          "code_system": "PUBCHEM",
          "references": [
            "99e3aab0-4dd7-41c4-915d-b2b4f84a17d9"
          ]
        },
        {
          "uuid": "7f3c8722-3479-ae6a-9622-cd21a4c96624",
          "code": "DTXSID3041035",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3041035",
          "code_system": "EPA CompTox",
          "references": [
            "7a7621d6-8ab0-2524-672f-8dc3689b6f50"
          ]
        },
        {
          "uuid": "6959d99a-05f6-5596-aafc-89967d549520",
          "code": "1626 (Number of products:14)",
          "comments": "Dietary Supplement Label Database|Chemical|Gingerol",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1626&item=Gingerol",
          "code_system": "DSLD",
          "references": [
            "571f46f8-7393-a69f-e128-e40900f5d752"
          ]
        },
        {
          "uuid": "d91df694-f155-4b46-9d14-a552b82007e6",
          "code": "925QK2Z900",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4f4b4ba7-1b62-cac6-2a9f-05e76d99e289",
          "code": "10136",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:10136",
          "code_system": "CHEBI",
          "references": [
            "571f46f8-7393-a69f-e128-e40900f5d752"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1ad4f014-5c2e-4345-a96b-19f2b3902628",
          "amount": {
            "uuid": "8c31f2d9-721e-4172-a890-90bfb9a60a3e"
          },
          "qualification": "USP",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "interaction_type": "MAJOR",
          "references": [
            "253e652c-93a5-4a05-8440-1cf081295c23"
          ],
          "related_substance": {
            "uuid": "e8a046f9-6888-4835-95cd-34cd450fd84c",
            "refuuid": "7213b960-5b37-4deb-bac4-bfbd9911eae6",
            "name": "GINGER",
            "unii": "C5529G5JPQ",
            "linking_id": "C5529G5JPQ",
            "ref_pname": "GINGER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "718e4d01-6068-4926-8102-214aaae42d09",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "230b21cd-2356-46d0-a842-79ec5fc2ab64"
          ],
          "related_substance": {
            "uuid": "8ef2a5eb-e809-499a-a4f4-5ea87eb0eb2b",
            "refuuid": "7213b960-5b37-4deb-bac4-bfbd9911eae6",
            "name": "GINGER",
            "unii": "C5529G5JPQ",
            "linking_id": "C5529G5JPQ",
            "ref_pname": "GINGER",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9da26ac8-c535-4ee3-921a-8d34575a036b",
          "name": "(5S)-5-HYDROXY-1-(4-HYDROXY-3-METHOXYPHENYL)-3-DECANONE",
          "stdName": "(5S)-5-HYDROXY-1-(4-HYDROXY-3-METHOXYPHENYL)-3-DECANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "016660c8-0167-4b0c-935c-065eff9d85d5",
            "5ad61711-e63e-4eaf-baab-d14485c64569"
          ],
          "display_name": false
        },
        {
          "uuid": "42234eab-c109-464f-a5cd-b199d5b71341",
          "name": "(6)-GINGEROL",
          "stdName": "(6)-GINGEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b07c4da-800d-4702-ba32-ea66503a8a52",
            "7aa6a8ce-84a8-4c1c-a70b-7cb977711930",
            "d734b614-8c0b-4561-8193-026f8b6c44ff",
            "5ad61711-e63e-4eaf-baab-d14485c64569"
          ],
          "display_name": false
        },
        {
          "uuid": "274e81a7-7502-426d-88f4-3f0d347132bb",
          "name": "(6)-GINGEROL [MI]",
          "stdName": "(6)-GINGEROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7aa6a8ce-84a8-4c1c-a70b-7cb977711930",
            "5ad61711-e63e-4eaf-baab-d14485c64569"
          ],
          "display_name": false
        },
        {
          "uuid": "d44ad56f-2ba3-40f9-b29e-b3cc45bed2ae",
          "name": "(S)-5-HYDROXY-1-(4-HYDROXY-3-METHOXYPHENYL)-3-DECANONE",
          "stdName": "(S)-5-HYDROXY-1-(4-HYDROXY-3-METHOXYPHENYL)-3-DECANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6321a9ac-7b78-4630-b177-8615c604346b",
            "5ad61711-e63e-4eaf-baab-d14485c64569"
          ],
          "display_name": false
        },
        {
          "uuid": "37fd7fc1-76e9-48a4-a292-9c0fc0b0f8b6",
          "name": "3-DECANONE, 5-HYDROXY-1-(4-HYDROXY-3-METHOXYPHENYL)-, (S)-",
          "stdName": "3-DECANONE, 5-HYDROXY-1-(4-HYDROXY-3-METHOXYPHENYL)-, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbf09b05-2a9f-4331-8a75-fcaa748beb11",
            "5ad61711-e63e-4eaf-baab-d14485c64569"
          ],
          "display_name": false
        },
        {
          "uuid": "de3a6d58-1eec-42ea-a902-430034ca6fb2",
          "name": "6-GINGEROL",
          "stdName": "6-GINGEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbf09b05-2a9f-4331-8a75-fcaa748beb11",
            "5ad61711-e63e-4eaf-baab-d14485c64569"
          ],
          "display_name": false
        },
        {
          "uuid": "39845671-9faa-4d01-822e-f0c10c38193d",
          "name": "6-GINGEROL (CONSTITUENT OF GINGER) [DSC]",
          "stdName": "6-GINGEROL (CONSTITUENT OF GINGER) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "979180eb-4f67-4b14-a908-932d00e79bf6",
            "5ad61711-e63e-4eaf-baab-d14485c64569"
          ],
          "display_name": false
        },
        {
          "uuid": "9f7bd47c-99c4-4f31-9443-6f235dcdd9be",
          "name": "C17-H26-O4",
          "stdName": "C17-H26-O4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbf09b05-2a9f-4331-8a75-fcaa748beb11",
            "5ad61711-e63e-4eaf-baab-d14485c64569"
          ],
          "display_name": false
        },
        {
          "uuid": "44bb4f3b-d4c1-4946-b4a9-21fde9635e4c",
          "name": "GINGEROL",
          "stdName": "GINGEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "016660c8-0167-4b0c-935c-065eff9d85d5",
            "5ad61711-e63e-4eaf-baab-d14485c64569"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "016660c8-0167-4b0c-935c-065eff9d85d5",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5ad61711-e63e-4eaf-baab-d14485c64569",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6321a9ac-7b78-4630-b177-8615c604346b",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7aa6a8ce-84a8-4c1c-a70b-7cb977711930",
          "citation": "MI 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b07c4da-800d-4702-ba32-ea66503a8a52",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbf09b05-2a9f-4331-8a75-fcaa748beb11",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "979180eb-4f67-4b14-a908-932d00e79bf6",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99e3aab0-4dd7-41c4-915d-b2b4f84a17d9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390887000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "828fa374-d741-486a-bf10-da0a6f07916f",
          "citation": "SRS import [925QK2Z900]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=925QK2Z900",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390887000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d734b614-8c0b-4561-8193-026f8b6c44ff",
          "citation": "(6)-GINGEROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7a7621d6-8ab0-2524-672f-8dc3689b6f50",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=23513-14-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "571f46f8-7393-a69f-e128-e40900f5d752",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "25c73421-f029-4967-a111-b5d07cc29412",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9ec00e2a-3783-4b91-a480-c65bfb9baa3e",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "230b21cd-2356-46d0-a842-79ec5fc2ab64",
          "citation": "GINGER MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "253e652c-93a5-4a05-8440-1cf081295c23",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7291bd2a-a08b-4624-8f3b-03ccb81c6769",
          "id": "7291bd2a-a08b-4624-8f3b-03ccb81c6769",
          "molfile": "\n  Marvin  01132105562D          \n\n 21 21  0  0  1  0            999 V2000\n    1.5926   -0.6913    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    1.6269    0.3953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3044   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0235   -0.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7410   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4659   -0.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1692   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8562   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1717   -0.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1717    0.1433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5589   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2563   -0.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9741   -1.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6872   -0.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4049   -1.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4049   -1.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1327   -2.3403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6872   -2.3403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6872   -3.1691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4049   -3.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9741   -1.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  8  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 21  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  2  0  0  0  0\n 18 19  1  0  0  0  0\n 21 18  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CCCCC[C@@H](CC(=O)CCc1ccc(c(c1)OC)O)O",
          "formula": "C17H26O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "11d5444f-215f-4cb5-8575-cd522c889b48"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "294.3866",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6da11115-b546-4ac7-a6eb-c29beeb04b26",
      "version": "9",
      "structure": {
        "id": "1bcd67b8-3b09-4290-b6cc-4e38c6e6d594",
        "molfile": "\n  Marvin  01132101372D          \n\n 21 21  0  0  1  0            999 V2000\n   -3.4049   -3.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6872   -3.1691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6872   -2.3403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4049   -1.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1327   -2.3403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4049   -1.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6872   -0.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9741   -1.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9741   -1.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2563   -0.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5589   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1717   -0.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8562   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5926   -0.6913    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.6269    0.3953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3044   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0235   -0.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7410   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4659   -0.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1692   -1.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1717    0.1433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  3  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 12 21  2  0  0  0  0\nM  END",
        "smiles": "CCCCC[C@@H](CC(=O)CCc1ccc(c(c1)OC)O)O",
        "formula": "C17H26O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "294.3866",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "016660c8-0167-4b0c-935c-065eff9d85d5",
          "828fa374-d741-486a-bf10-da0a6f07916f"
        ],
        "stereo_centers": 1
      },
      "unii": "925QK2Z900"
    }
  ]
}