{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f8d8c0b3-2d22-45f7-b722-7a44b8b235cf", "code": "923TYK19HG", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "84f65a9f-23ed-4e50-a304-7228f962fa38", "code": "47724-48-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=47724-48-1", "code_system": "CAS", "references": [ "88c28105-c9bc-4955-ada5-fde612af13e7", "d02cc09b-f9ee-4857-99aa-e8d1a68f462f" ] }, { "uuid": "df12c182-7191-595b-c5d0-efe7dfd38142", "code": "DTXSID70872498", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70872498", "code_system": "EPA CompTox", "references": [ "faea828d-16b2-abe8-c3e4-e3d46da8735b" ] }, { "uuid": "72357d0c-d64b-81d7-9398-6f1d35b155de", "code": "52895", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:52895", "code_system": "CHEBI", "references": [ "64df940b-1665-bda9-56c9-000e7e2aa5b7" ] } ], "substance_class": "chemical", "names": [ { "uuid": "79ee43ef-a29a-4fa1-9e25-d6541bc26fe6", "name": "RHODAMINE 6G CATION", "stdName": "RHODAMINE 6G CATION", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a164bb6c-c254-4fd1-9b14-c7d1f86aeed6", "d77ce2ec-27d6-47d2-8fca-f02c37a55240" ], "display_name": true }, { "uuid": "c4b8deab-cc23-4c78-836f-256e6fec2b83", "name": "RHODAMINE 6G ION(1+)", "stdName": "RHODAMINE 6G ION(1+)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a164bb6c-c254-4fd1-9b14-c7d1f86aeed6", "d77ce2ec-27d6-47d2-8fca-f02c37a55240" ], "display_name": false }, { "uuid": "4e195bd7-1c72-476f-891d-c05ed71218c3", "name": "XANTHYLIUM, 9-(2-(ETHOXYCARBONYL)PHENYL)-3,6-BIS(ETHYLAMINO)-2,7-DIMETHYL-", "stdName": "XANTHYLIUM, 9-(2-(ETHOXYCARBONYL)PHENYL)-3,6-BIS(ETHYLAMINO)-2,7-DIMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a164bb6c-c254-4fd1-9b14-c7d1f86aeed6", "d77ce2ec-27d6-47d2-8fca-f02c37a55240" ], "display_name": false } ], "references": [ { "uuid": "a164bb6c-c254-4fd1-9b14-c7d1f86aeed6", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d77ce2ec-27d6-47d2-8fca-f02c37a55240", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "88c28105-c9bc-4955-ada5-fde612af13e7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392169000, "tags": [ "NOMEN" ] }, { "uuid": "0b69a0fc-4d00-498c-aebe-c7291671bf17", "citation": "SRS import [923TYK19HG]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=923TYK19HG", "doc_type": "SRS", "public_domain": true, "document_date": 1493392169000, "tags": [ "NOMEN" ] }, { "uuid": "0a5ddcc2-a282-40e2-b1c9-2eaef362020e", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "faea828d-16b2-abe8-c3e4-e3d46da8735b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=47724-48-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d02cc09b-f9ee-4857-99aa-e8d1a68f462f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "64df940b-1665-bda9-56c9-000e7e2aa5b7", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ee0aa7ad-f605-44fa-89fd-cf115c72c35c", "id": "ee0aa7ad-f605-44fa-89fd-cf115c72c35c", "molfile": "\n Marvin 01132112192D \n\n 33 36 0 0 0 0 999 V2000\n 8.6939 -4.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9810 -4.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2594 -4.9642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5378 -4.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8162 -4.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0946 -4.5121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3817 -4.9121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6601 -4.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9385 -4.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2169 -4.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4953 -4.8599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6608 -4.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2169 -3.6427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4953 -3.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9472 -3.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6601 -3.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3817 -3.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3730 -1.6518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0946 -1.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0946 -0.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3817 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6601 -0.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6514 -1.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9298 -1.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9385 -2.4517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2169 -1.1998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4953 -1.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7737 -1.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0946 -3.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8162 -3.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5378 -3.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2594 -3.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 32 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 30 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 17 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 3 0 0 0\n 10 14 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 18 30 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 24 2 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 2 0 0 0 0\n 32 33 1 0 0 0 0\nM END", "smiles": "CCNc1cc2c(cc1C)c(-c3ccccc3C(=O)OCC)c-4cc(C)c(=NCC)cc4o2", "formula": "C28H30N2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5fb093f2-b988-4161-aacb-79b92aa81d33" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "442.5504", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "a0269b46-1fe2-4604-9f79-61c576540545", "version": "5", "structure": { "id": "3fcdc80c-cdd1-43cf-8f60-8814fa81397a", "molfile": "\n Marvin 01132103222D \n\n 33 36 0 0 0 0 999 V2000\n 4.3730 -1.6518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6514 -1.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9298 -1.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9385 -2.4517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2169 -1.1998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0946 -1.2519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6601 -0.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4953 -1.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0946 -0.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3817 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7737 -1.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3817 -3.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6601 -3.6688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6601 -4.4861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0946 -3.6949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0946 -4.5121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9385 -4.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3817 -4.9121 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0\n 2.2169 -4.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9472 -3.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2169 -3.6427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8162 -3.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8162 -4.9381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5378 -4.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5378 -3.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4953 -4.8599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2594 -4.9642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4953 -3.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2594 -3.3211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6608 -4.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9810 -4.5643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6939 -4.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 12 1 0 0 0 0\n 1 2 2 0 0 0 0\n 1 6 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 7 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 5 1 0 0 0 0\n 5 8 1 0 0 0 0\n 6 9 2 0 0 0 0\n 7 10 2 0 0 0 0\n 8 11 1 0 0 0 0\n 9 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 15 2 0 0 0 0\n 13 14 2 0 0 0 0\n 13 20 1 0 0 0 0\n 14 17 1 0 0 0 0\n 14 18 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 22 1 0 0 0 0\n 16 18 2 0 0 0 0\n 16 23 1 0 0 0 0\n 17 19 2 0 0 0 0\n 19 21 1 0 0 0 0\n 19 26 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 28 1 0 0 0 0\n 22 25 2 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 24 27 1 0 0 0 0\n 25 29 1 0 0 0 0\n 26 30 1 0 0 0 0\n 27 31 1 0 0 0 0\n 30 32 1 0 0 0 0\n 31 33 1 0 0 0 0\nM CHG 1 18 1\nM END", "smiles": "CCNc1cc2c(cc1C)c(-c3ccccc3C(=O)OCC)c4cc(C)c(cc4[o+]2)NCC", "formula": "C28H31N2O3", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "443.5584", "optical_activity": "NONE", "references": [ "0a5ddcc2-a282-40e2-b1c9-2eaef362020e", "0b69a0fc-4d00-498c-aebe-c7291671bf17" ], "stereo_centers": 0 }, "unii": "923TYK19HG" } ] }