{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5120fcd8-cc52-42c1-98f3-21b7b17e9dd6",
          "code": "533-00-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=533-00-6",
          "code_system": "CAS",
          "references": [
            "08694e0c-80fd-4730-a690-580b67bc6ad4",
            "a8df5b3a-aef5-4b86-95d4-c78e1f1dc3c8"
          ]
        },
        {
          "uuid": "1cba885e-edfa-4984-af52-9747d516ed10",
          "code": "208-551-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.775",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "08694e0c-80fd-4730-a690-580b67bc6ad4"
          ]
        },
        {
          "uuid": "6da5521a-f7be-10d3-9c3a-11438c4c9427",
          "code": "160513",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/160513",
          "code_system": "PUBCHEM",
          "references": [
            "3ef3ebc4-fbbe-0f16-f588-f3009d473416"
          ]
        },
        {
          "uuid": "128402a9-6086-47bb-9d07-35ccf0aa82a4",
          "code": "923N33416I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ea707176-f1f5-562a-4fc4-d3ba5dd84efa",
          "code": "DTXSID60890500",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60890500",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "a08cf6f7-2938-3a34-c27f-768fe7a50c2c",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "a8df5b3a-aef5-4b86-95d4-c78e1f1dc3c8"
          ],
          "related_substance": {
            "uuid": "b888d874-9eec-42c1-8ce0-a0ba36d33ba9",
            "refuuid": "ce6e4fb2-60ef-415b-9441-74762a0e8e32",
            "name": "BARIUM BENZOATE DIHYDRATE",
            "unii": "76C9VB7ZEO",
            "linking_id": "76C9VB7ZEO",
            "ref_pname": "BARIUM BENZOATE DIHYDRATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "35a26f5d-788b-4887-9736-6a078c26aa62",
          "name": "BARIUM BENZOATE",
          "stdName": "BARIUM BENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f19366e-51f3-40df-8dc8-6355db0e6e96",
            "125cfc43-5646-46fc-8b82-281da65d80e5"
          ],
          "display_name": true
        },
        {
          "uuid": "c4f62b7e-8571-4ef4-b8fa-2862b090e0e4",
          "name": "BARIUM DIBENZOATE",
          "stdName": "BARIUM DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f19366e-51f3-40df-8dc8-6355db0e6e96",
            "125cfc43-5646-46fc-8b82-281da65d80e5"
          ],
          "display_name": false
        },
        {
          "uuid": "51815922-876c-4d71-b98d-f7f7b17e8ebe",
          "name": "BENZOIC ACID, BARIUM SALT",
          "stdName": "BENZOIC ACID, BARIUM SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f19366e-51f3-40df-8dc8-6355db0e6e96",
            "125cfc43-5646-46fc-8b82-281da65d80e5"
          ],
          "display_name": false
        },
        {
          "uuid": "66e55d5c-19ca-4081-88ac-db0690db817c",
          "name": "BENZOIC ACID, BARIUM SALT (2:1)",
          "stdName": "BENZOIC ACID, BARIUM SALT (2:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c29e1b8a-e811-44b2-9ca2-12871738ad2f",
            "9f19366e-51f3-40df-8dc8-6355db0e6e96"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "125cfc43-5646-46fc-8b82-281da65d80e5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9f19366e-51f3-40df-8dc8-6355db0e6e96",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c29e1b8a-e811-44b2-9ca2-12871738ad2f",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08694e0c-80fd-4730-a690-580b67bc6ad4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391993000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f96d6276-54b3-4275-bca5-3290481dee1b",
          "citation": "SRS import [923N33416I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=923N33416I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391993000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ef3ebc4-fbbe-0f16-f588-f3009d473416",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "a8df5b3a-aef5-4b86-95d4-c78e1f1dc3c8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "26cace09-69e2-4a0a-932d-d51e703fbe4f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9908da3b-0df1-40fb-9ccd-cfcc36c7462d",
          "id": "9908da3b-0df1-40fb-9ccd-cfcc36c7462d",
          "molfile": "\n  Marvin  01132107572D          \n\n  1  0  0  0  0  0            999 V2000\n    5.6406   -4.8944    0.0000 Ba  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ba+2]",
          "formula": "Ba",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e7d5aece-f86e-417b-847d-cdabe1d915a8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "137.3269",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "88afd98d-acd5-4a6f-b381-0344514f9689",
          "id": "88afd98d-acd5-4a6f-b381-0344514f9689",
          "molfile": "\n  Marvin  01132107052D          \n\n  9  9  0  0  0  0            999 V2000\n    8.9886   -4.0466    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.9886   -4.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2739   -5.2895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6952   -5.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6952   -6.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4146   -6.5240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1295   -6.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1295   -5.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4146   -4.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "c1ccc(cc1)C(=O)[O-]",
          "formula": "C7H5O2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "9814005a-cb9b-473c-a066-0cf0cb24d5b5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "121.1137",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e96a5f27-c09a-44ee-8182-33c166b755e3",
      "version": "6",
      "structure": {
        "id": "32c5f088-12c9-4d25-8660-21128299a4a6",
        "molfile": "\n  Marvin  01132102432D          \n\n 19 18  0  0  0  0            999 V2000\n    5.6406   -4.8944    0.0000 Ba  0  2  0  0  0  0  0  0  0  0  0  0\n    8.9886   -4.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6952   -5.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6952   -6.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4146   -6.5240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1295   -6.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1295   -5.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4146   -4.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9886   -4.0466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2739   -5.2895    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.9886   -4.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6952   -5.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6952   -6.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4146   -6.5240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1295   -6.1123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1295   -5.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4146   -4.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9886   -4.0466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2739   -5.2895    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  3  8  2  0  0  0  0\n  2  9  2  0  0  0  0\n  2 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 18  2  0  0  0  0\n 11 19  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  CHG  3   1   2  10  -1  19  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  3  17  18  19\nM  SPA   1  9   2   3   4   5   6   7   8   9  10\nM  SDI   1  4    7.8539   -6.9440    7.8539   -3.6266\nM  SDI   1  4   11.5495   -3.6266   11.5495   -6.9440\nM  SMT   1 2\nM  END",
        "smiles": "c1ccc(cc1)C(=O)[O-].c1ccc(cc1)C(=O)[O-].[Ba+2]",
        "formula": "2C7H5O2.Ba",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "379.5542",
        "optical_activity": "NONE",
        "references": [
          "c29e1b8a-e811-44b2-9ca2-12871738ad2f",
          "f96d6276-54b3-4275-bca5-3290481dee1b"
        ],
        "stereo_centers": 0
      },
      "unii": "923N33416I"
    }
  ]
}