{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f56297ce-5eca-4ed3-8115-fe55a9ed85d4",
          "code": "61-51-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=61-51-8",
          "code_system": "CAS",
          "references": [
            "01624e6d-171a-4c72-b147-2e067fd216cd",
            "388be4c7-75b9-49ff-80b0-0ef20af3e445"
          ]
        },
        {
          "uuid": "4d58471e-7e83-48d1-9245-275cd0334926",
          "code": "C038927",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67038927",
          "code_system": "MESH",
          "references": [
            "01624e6d-171a-4c72-b147-2e067fd216cd"
          ]
        },
        {
          "uuid": "7600cae3-e161-4bae-a15a-e11c4485a68f",
          "code": "7434",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "01624e6d-171a-4c72-b147-2e067fd216cd"
          ]
        },
        {
          "uuid": "b0de96f0-dc32-4a1d-8768-1abfc91c1e70",
          "code": "PD 001",
          "type": "PRIMARY",
          "code_system": "INCB IDS CODE",
          "references": [
            "01624e6d-171a-4c72-b147-2e067fd216cd"
          ]
        },
        {
          "uuid": "2469627e-a95b-423e-8e80-0203ad25a2a3",
          "code": "6090",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6090",
          "code_system": "PUBCHEM",
          "references": [
            "01624e6d-171a-4c72-b147-2e067fd216cd"
          ]
        },
        {
          "uuid": "fa8ff100-b07f-2652-c17e-5fef362a8733",
          "code": "Diethyltryptamine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diethyltryptamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "ff2cab75-8d7a-e429-6411-606bada1badd"
          ]
        },
        {
          "uuid": "2174108d-b346-b638-0eef-acbbe7a0e346",
          "code": "DTXSID9052763",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9052763",
          "code_system": "EPA CompTox",
          "references": [
            "b8cdb7f4-9757-c90c-566a-4caab3f8ab4e"
          ]
        },
        {
          "uuid": "9259f26a-fc21-1eb2-3a59-072e337bd04d",
          "code": "DB01460",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB01460",
          "code_system": "DRUG BANK",
          "references": [
            "b18eb659-c9ea-360d-4bab-5157d83b42db"
          ]
        },
        {
          "uuid": "c66a3d52-10b9-4784-b4f1-e8b739c645e3",
          "code": "916E8V4S2V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "222c040e-80bc-ade5-5165-6b687cec5ac7",
          "code": "Designer-drugs- Diethyltryptamine",
          "comments": "Wikipedia|List of designer drugs|Psychedelics|Tryptamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "b18eb659-c9ea-360d-4bab-5157d83b42db"
          ]
        },
        {
          "uuid": "a473d65a-af7a-4bae-b3de-3b2c7a18d11b",
          "code": "TiHKAL",
          "comments": "Wikipedia|TiHKAL|Tryptoamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/TiHKAL",
          "code_system": "WIKIPEDIA"
        }
      ],
      "relationships": [
        {
          "uuid": "6557ce1d-4be4-4b4d-8000-f035402a08fe",
          "amount": {
            "uuid": "fef16a54-8330-44b9-b1c8-5f1b935922d7"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0b7107b8-1b27-459e-9dae-2708976a4716",
            "refuuid": "014c539c-eb3c-435f-9b01-be54b5cb65b2",
            "name": "N,N-DIETHYLTRYPTAMINE",
            "unii": "916E8V4S2V",
            "linking_id": "916E8V4S2V",
            "ref_pname": "N,N-DIETHYLTRYPTAMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f8b93f2b-e9f0-4ad7-8dee-fc43a9301a05",
          "amount": {
            "uuid": "6ff7ed69-5baf-49ab-bca9-ffd503ab22d4",
            "average": 1258,
            "units": "NANOMOLAR"
          },
          "comments": "Hallucinogenic, 31% of the stimulation of 5-hydroxytryptamine. Stimulation of phosphoinositide hydrolysis.",
          "qualification": "EC50",
          "type": "TARGET->WEAK AGONIST",
          "related_substance": {
            "uuid": "b8a5b313-ce33-49d3-ab40-56b7644bfa60",
            "refuuid": "d78d31c8-4aa9-4058-b1bc-4b11d2e862e3",
            "name": "5-HYDROXYTRYPTAMINE RECEPTOR 2A",
            "unii": "NQI5D806LC",
            "linking_id": "NQI5D806LC",
            "ref_pname": "5-HYDROXYTRYPTAMINE RECEPTOR 2A",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f6b62da3-a383-4640-bdb8-b69a28a175b9",
          "name": "1H-INDOLE-3-ETHANAMINE, N,N-DIETHYL-",
          "stdName": "1H-INDOLE-3-ETHANAMINE, N,N-DIETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c7b2a8c-3439-41ac-82f2-798267d451dc"
          ],
          "display_name": false
        },
        {
          "uuid": "4428c5ea-cd9f-4c52-acfe-af2a9c16479e",
          "name": "3-(2-(DIETHYLAMINO)ETHYL)INDOLE",
          "stdName": "3-(2-(DIETHYLAMINO)ETHYL)INDOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36b5c2c6-4e50-445a-bda4-1954c10fce28"
          ],
          "display_name": false
        },
        {
          "uuid": "16c8da98-73ab-47f0-a982-e09f2772d9ea",
          "name": "DET",
          "stdName": "DET",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c7b2a8c-3439-41ac-82f2-798267d451dc"
          ],
          "display_name": false
        },
        {
          "uuid": "01e2b6ba-c6c3-4917-b7e8-d4656b87b498",
          "name": "DIETHYLTRYPTAMINE",
          "stdName": "DIETHYLTRYPTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c7b2a8c-3439-41ac-82f2-798267d451dc"
          ],
          "display_name": false
        },
        {
          "uuid": "01350508-2d86-4317-aa99-572262088cb4",
          "name": "N,N-DIETHYLTRYPTAMINE",
          "stdName": "N,N-DIETHYLTRYPTAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fb5af98a-00b9-4a00-8126-02ab3ac4f99c"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "fb5af98a-00b9-4a00-8126-02ab3ac4f99c",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4c7b2a8c-3439-41ac-82f2-798267d451dc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36b5c2c6-4e50-445a-bda4-1954c10fce28",
          "citation": "INCB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "01624e6d-171a-4c72-b147-2e067fd216cd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389661000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f236ed5-183e-4ea9-8558-a1096d0094e8",
          "citation": "SRS import [916E8V4S2V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=916E8V4S2V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389661000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff2cab75-8d7a-e429-6411-606bada1badd",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/N-Methyltryptamine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b8cdb7f4-9757-c90c-566a-4caab3f8ab4e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=61-51-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b18eb659-c9ea-360d-4bab-5157d83b42db",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "388be4c7-75b9-49ff-80b0-0ef20af3e445",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b97855c2-e7c6-4027-a758-eea0726eaa35",
          "id": "b97855c2-e7c6-4027-a758-eea0726eaa35",
          "molfile": "\n  Marvin  01132109362D          \n\n 16 17  0  0  0  0            999 V2000\n    9.2529   -6.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6663   -5.4294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8675   -5.6041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2808   -5.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4930   -4.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6178   -6.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8148   -6.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5652   -7.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0562   -8.0089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5735   -8.6788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7872   -8.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0674   -8.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3560   -8.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3560   -7.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0674   -7.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7831   -7.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 16  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)CCc1c[nH]c2ccccc12",
          "formula": "C14H20N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1c71b6cf-705a-4e64-92bd-b293ccfcd454"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "216.3225",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "014c539c-eb3c-435f-9b01-be54b5cb65b2",
      "version": "9",
      "structure": {
        "id": "efc2acc6-3f64-4cec-959d-db6adaf0a8e3",
        "molfile": "\n  Marvin  01132112262D          \n\n 16 17  0  0  0  0            999 V2000\n    6.5735   -8.6788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5652   -7.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0562   -8.0089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7831   -7.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7872   -8.4291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8148   -6.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8675   -5.6041    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6178   -6.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0674   -7.1935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0674   -8.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6663   -5.4294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2808   -5.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2529   -6.0077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4930   -4.2187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3560   -7.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3560   -8.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  4  2  0  0  0  0\n 10  5  2  0  0  0  0\n 11  7  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 10  1  0  0  0  0\n  4  2  1  0  0  0  0\n 15  9  1  0  0  0  0\nM  END",
        "smiles": "CCN(CC)CCc1c[nH]c2ccccc12",
        "formula": "C14H20N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "216.3225",
        "optical_activity": "NONE",
        "references": [
          "6f236ed5-183e-4ea9-8558-a1096d0094e8",
          "fb5af98a-00b9-4a00-8126-02ab3ac4f99c"
        ],
        "stereo_centers": 0
      },
      "unii": "916E8V4S2V"
    }
  ]
}