{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "18b0dbe6-0bd4-431d-af81-20d4f3a84f85", "code": "36175-05-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=36175-05-0", "code_system": "CAS", "references": [ "9d0b5623-4f76-41de-b2a7-3004ca4ad39c", "f534fedd-0852-4b2d-8df3-a2f02dbf24b8" ] }, { "uuid": "74fcd308-4f7f-4e78-85d4-c14f9083dc64", "code": "C80955", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80955", "code_system": "NCI_THESAURUS", "references": [ "9d0b5623-4f76-41de-b2a7-3004ca4ad39c" ] }, { "uuid": "e0c58ac1-937f-4ebd-bd1c-3c9a3d039d37", "code": "SUB10568MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "9d0b5623-4f76-41de-b2a7-3004ca4ad39c" ] }, { "uuid": "9143e53f-7a08-448f-820d-3cd719044977", "code": "4136", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4136", "code_system": "INN", "references": [ "9d0b5623-4f76-41de-b2a7-3004ca4ad39c" ] }, { "uuid": "a9670615-807d-46d8-9b04-9e03e8ea613b", "code": "CHEMBL2111180", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2111180", "code_system": "ChEMBL", "references": [ "9d0b5623-4f76-41de-b2a7-3004ca4ad39c" ] }, { "uuid": "d63590a7-9deb-4c23-9fc0-ee6504e192a8", "code": "10256292", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10256292", "code_system": "PUBCHEM", "references": [ "9d0b5623-4f76-41de-b2a7-3004ca4ad39c" ] }, { "uuid": "b8c51f71-cf6f-1a79-a5f7-a9f8a9adb903", "code": "C29697", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Laxative", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29697", "code_system": "NCI_THESAURUS", "references": [ "dc5b995c-468a-a082-7ff7-44241f962102" ] }, { "uuid": "d421b531-2ebc-44c1-ad24-5c89f7ee3199", "code": "9164VT6ANB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "31a45ebb-ca45-935d-ec71-f04b7cb55946", "code": "100000083532", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "2f02b6a2-8fa1-ef74-03a9-0081e9eeade7" ] }, { "uuid": "ad94b1c2-9262-9980-9d07-9c487b6ecb46", "code": "DTXSID80189746", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80189746", "code_system": "EPA CompTox", "references": [ "afc5828e-c476-4778-8f82-60c9556362e5" ] } ], "relationships": [ { "uuid": "b1cab29d-c963-455b-b52b-7db178ac4d46", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "b32a166b-cde5-497a-b3e1-3354d5dfb2e2", "refuuid": "9cc77cce-5311-4d19-b94d-fe5459a03963", "name": "PICOFOSFORIC ACID", "unii": "WB84F9658Q", "linking_id": "WB84F9658Q", "ref_pname": "PICOFOSFORIC ACID", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "6742d29f-dd03-40e4-8b4e-a80af08b3068", "name": "4,4'-(2-PYRIDYLMETHYLENE)DIPHENOL BIS(DIHYDROGEN PHOSPHATE) TETRASODIUM SALT", "stdName": "4,4'-(2-PYRIDYLMETHYLENE)DIPHENOL BIS(DIHYDROGEN PHOSPHATE) TETRASODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0fa30c41-5441-4ca1-bacd-a0513306b168" ], "display_name": false }, { "uuid": "69766209-3a2d-403e-8793-2d8144d80848", "name": "PICOFOSFATE SODIUM", "stdName": "PICOFOSFATE SODIUM", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f0fd53a3-4359-4d22-ad1c-bfedcdc05162", "3d41a4a4-418a-417d-a63a-16710cf93fc0" ], "display_name": false }, { "uuid": "97d67768-21b1-4662-9e20-5ce5a5c699c0", "name": "SODIUM PICOFOSFATE", "stdName": "SODIUM PICOFOSFATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "a89825a7-b85a-4ce1-8f70-b1840ef759fe", "596d1733-d1a3-469b-a065-2fe163634a5c", "0fa30c41-5441-4ca1-bacd-a0513306b168" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "1222520d-f5e9-41a1-9315-0a5b3cef0e7c", "name_org": "INN" } ] }, { "uuid": "ec64edbf-23f1-4405-a391-510137bbb480", "name": "sodium picofosfate [INN]", "stdName": "SODIUM PICOFOSFATE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a89825a7-b85a-4ce1-8f70-b1840ef759fe", "f24d3742-c596-448b-96c7-b02eaf9eb1db" ], "display_name": false } ], "references": [ { "uuid": "0fa30c41-5441-4ca1-bacd-a0513306b168", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "a89825a7-b85a-4ce1-8f70-b1840ef759fe", "citation": "INN 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f0fd53a3-4359-4d22-ad1c-bfedcdc05162", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3d41a4a4-418a-417d-a63a-16710cf93fc0", "citation": "INN", "doc_type": "INN", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9d0b5623-4f76-41de-b2a7-3004ca4ad39c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390711000, "tags": [ "NOMEN" ] }, { "uuid": "c406c343-b455-4461-ad86-92973c57b7d4", "citation": "SRS import [9164VT6ANB]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9164VT6ANB", "doc_type": "SRS", "public_domain": true, "document_date": 1493390711000, "tags": [ "NOMEN" ] }, { "uuid": "596d1733-d1a3-469b-a065-2fe163634a5c", "citation": "SODIUM PICOFOSFATE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1466132e-58e4-14b2-83c3-f79b02463cdd", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=36175-05-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "dc5b995c-468a-a082-7ff7-44241f962102", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "f24d3742-c596-448b-96c7-b02eaf9eb1db", "citation": "INN Proposed List 37", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL37.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f534fedd-0852-4b2d-8df3-a2f02dbf24b8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "afc5828e-c476-4778-8f82-60c9556362e5", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "2f02b6a2-8fa1-ef74-03a9-0081e9eeade7", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "be05858b-b696-459a-9918-719220d4d70f", "id": "be05858b-b696-459a-9918-719220d4d70f", "molfile": "\n Marvin 01132109492D \n\n 1 0 0 0 0 0 999 V2000\n 9.3914 -2.5802 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 4, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 4, "units": "MOL RATIO", "uuid": "28746302-d49a-4b92-8665-c991e0dfd0b0" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "933e85c1-dd69-438e-a024-d793f3f573b8", "id": "933e85c1-dd69-438e-a024-d793f3f573b8", "molfile": "\n Marvin 01132107382D \n\n 29 31 0 0 0 0 999 V2000\n 2.8247 -5.9580 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 3.5392 -5.5455 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9517 -6.2600 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 3.1267 -4.8311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2536 -5.1330 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2536 -4.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5392 -3.8955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5392 -3.0759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2536 -2.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9681 -3.0759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9681 -3.8955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2536 -1.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9681 -1.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9681 -0.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6826 -0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3971 -0.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1116 -0.1884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1116 0.6367 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3385 1.5236 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.1635 0.6985 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.2866 0.6367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3971 -1.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6826 -1.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5392 -1.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8247 -1.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1101 -1.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1101 -0.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8247 -0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5392 -0.6009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 2 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 11 2 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 9 12 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 24 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 23 2 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 22 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 18 21 2 0 0 0 0\n 23 22 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 29 2 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\nM CHG 4 1 -1 3 -1 19 -1 20 -1\nM END", "smiles": "c1ccnc(c1)C(c2ccc(cc2)OP(=O)([O-])[O-])c3ccc(cc3)OP(=O)([O-])[O-]", "formula": "C18H13NO8P2", "atropisomerism": "No", "charge": -4, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "651616a5-1cac-4474-af14-b1d24d4db0e0" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "433.2459", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "016581b5-4100-4e69-986c-052ec4983af2", "version": "8", "structure": { "id": "ac11fd71-c2ea-4ba3-89c3-8779332e626f", "molfile": "\n Marvin 01132108562D \n\n 33 31 0 0 0 0 999 V2000\n 9.3914 -2.5802 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 2.8247 -5.9580 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 3.5392 -5.5455 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9517 -6.2600 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 3.1267 -4.8311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2536 -5.1330 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2536 -4.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9681 -3.8955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9681 -3.0759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2536 -2.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5392 -3.0759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5392 -3.8955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2536 -1.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9681 -1.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6826 -1.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3971 -1.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3971 -0.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1116 -0.1884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1116 0.6367 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3385 1.5236 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.1635 0.6985 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.2866 0.6367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6826 -0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9681 -0.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5392 -1.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5392 -0.6009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8247 -0.1884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1101 -0.6009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1101 -1.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8247 -1.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3914 -2.5802 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 9.3914 -2.5802 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 9.3914 -2.5802 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 2 0 0 0 0\n 3 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 7 12 1 0 0 0 0\n 10 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 19 22 2 0 0 0 0\n 17 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 14 24 1 0 0 0 0\n 13 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 25 30 1 0 0 0 0\nM CHG 8 1 1 2 -1 4 -1 20 -1 21 -1 31 1 32 1 33 1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 4 1 31 32 33\nM SPA 1 1 1\nM SDI 1 4 8.9714 -3.0002 8.9714 -2.1602\nM SDI 1 4 9.8114 -2.1602 9.8114 -3.0002\nM SMT 1 4\nM END", "smiles": "c1ccnc(c1)C(c2ccc(cc2)OP(=O)([O-])[O-])c3ccc(cc3)OP(=O)([O-])[O-].[Na+].[Na+].[Na+].[Na+]", "formula": "C18H13NO8P2.4Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "525.205", "optical_activity": "NONE", "references": [ "c406c343-b455-4461-ad86-92973c57b7d4", "0fa30c41-5441-4ca1-bacd-a0513306b168", "f24d3742-c596-448b-96c7-b02eaf9eb1db" ], "stereo_centers": 0 }, "unii": "9164VT6ANB" } ] }