{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "164c2b20-bf1c-4b1a-87c6-3df7a09f35d1",
          "code": "2141-17-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2141-17-5",
          "code_system": "CAS",
          "references": [
            "1d35e68c-0fe0-45bc-a556-5c5a3aa00e82",
            "6b88dbe7-d440-4bc0-b559-d15eb6ca21c7"
          ]
        },
        {
          "uuid": "353c5218-a1b6-446d-bf29-8642905c5b15",
          "code": "4-HYDROXYTESTOSTERONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/4-Hydroxytestosterone",
          "code_system": "WIKIPEDIA",
          "references": [
            "1d35e68c-0fe0-45bc-a556-5c5a3aa00e82"
          ]
        },
        {
          "uuid": "01d6142c-af72-4a19-9fbe-77af59523c4b",
          "code": "160615",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/160615",
          "code_system": "PUBCHEM",
          "references": [
            "1d35e68c-0fe0-45bc-a556-5c5a3aa00e82"
          ]
        },
        {
          "uuid": "1f9340a3-1880-4249-8d28-b875cc9a0473",
          "code": "C2017",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Protein Inhibitor[C129824]|Antineoplastic Enzyme Inhibitor[C129825]|Aromatase Inhibitor[C1740]|Steroidal Aromatase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2017",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1a72b336-9555-dccb-94a6-aaad97d575a7"
          ]
        },
        {
          "uuid": "9f4fa5e6-4caa-0200-9149-b65e3068c1ea",
          "code": "DB01485",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01485",
          "code_system": "DRUG BANK",
          "references": [
            "1a72b336-9555-dccb-94a6-aaad97d575a7"
          ]
        },
        {
          "uuid": "774abb0d-dc2a-4487-b97a-73d915c5a244",
          "code": "912GOZ167T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ed6226ee-8f67-5684-6f83-96fce6283f12",
          "code": "C113835",
          "comments": "NCIT",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C113835",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cf38c634-4a2c-b2c9-942f-c97362fa2fb3"
          ]
        },
        {
          "uuid": "02719906-b01b-42e5-e5f1-eda8f9fbf34b",
          "code": "DTXSID80902477",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80902477",
          "code_system": "EPA CompTox",
          "references": [
            "1a72b336-9555-dccb-94a6-aaad97d575a7"
          ]
        },
        {
          "uuid": "686c497c-ed6d-4607-8d4e-7af85e7cdee7",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "GENERIC (FAMILY)",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "code_system": "DEA NO.",
          "references": [
            "b0c44084-c6dd-4844-aa05-30ebbd2c9cc4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8dea925c-e182-4605-b9c6-f971a4b6c229",
          "amount": {
            "uuid": "e02e5c2f-4cd7-4b81-a97c-e2e62faaad42"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6ad5fbde-84b2-4a18-a321-e743b1e4aaf3",
            "refuuid": "256fb4fd-49ed-4b1a-8b97-c77a36d8b8b5",
            "name": "4-HYDROXYTESTOSTERONE",
            "unii": "912GOZ167T",
            "linking_id": "912GOZ167T",
            "ref_pname": "4-HYDROXYTESTOSTERONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5e46a07a-6869-452d-9395-79d8f4c0ea5b",
          "name": "4,17.BETA.-DIHYDROXYANDROST-4-EN-3-ONE",
          "stdName": "4,17.BETA.-DIHYDROXYANDROST-4-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a802a5b-b0db-4cd2-a074-dcf00c391225",
            "0d49f892-a063-41ba-8b05-5d8c25d3c117"
          ],
          "display_name": false
        },
        {
          "uuid": "f8237f9a-ea17-4d32-ae5b-d0baa8688690",
          "name": "4-HYDROXYTESTOSTERONE",
          "stdName": "4-HYDROXYTESTOSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a802a5b-b0db-4cd2-a074-dcf00c391225",
            "b420a2ee-226d-445b-af7c-d6a760e32083",
            "0d49f892-a063-41ba-8b05-5d8c25d3c117"
          ],
          "display_name": true
        },
        {
          "uuid": "846f75a7-cf26-4960-a759-035183e5e920",
          "name": "4-HYDROXYTESTOSTERONE [MART.]",
          "stdName": "4-HYDROXYTESTOSTERONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a802a5b-b0db-4cd2-a074-dcf00c391225",
            "0d49f892-a063-41ba-8b05-5d8c25d3c117"
          ],
          "display_name": false
        },
        {
          "uuid": "47ef5a6c-31a6-48c1-8a7b-6f3a816d0a88",
          "name": "4-OH-TESTOSTERONE",
          "stdName": "4-OH-TESTOSTERONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a802a5b-b0db-4cd2-a074-dcf00c391225",
            "3a31d8f4-cd67-4e7b-b904-5f037296f92e"
          ],
          "display_name": false
        },
        {
          "uuid": "6ec0929f-96ee-44b2-b0a7-a6742b9ea4bd",
          "name": "ANDROST-4-EN-3-ONE, 4,17-DIHYDROXY-, (17.BETA.)-",
          "stdName": "ANDROST-4-EN-3-ONE, 4,17-DIHYDROXY-, (17.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a802a5b-b0db-4cd2-a074-dcf00c391225",
            "e41566d8-e7f9-4b90-85cf-744a460a4b08"
          ],
          "display_name": false
        },
        {
          "uuid": "b3b02c55-e9f1-4d3d-bd11-b82ece0f215e",
          "name": "ANDROST-4-EN-3-ONE, 4,17.BETA.-DIHYDROXY-",
          "stdName": "ANDROST-4-EN-3-ONE, 4,17.BETA.-DIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a802a5b-b0db-4cd2-a074-dcf00c391225",
            "e41566d8-e7f9-4b90-85cf-744a460a4b08"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0d49f892-a063-41ba-8b05-5d8c25d3c117",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0a802a5b-b0db-4cd2-a074-dcf00c391225",
          "citation": "MARTINDALE",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e41566d8-e7f9-4b90-85cf-744a460a4b08",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a31d8f4-cd67-4e7b-b904-5f037296f92e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d35e68c-0fe0-45bc-a556-5c5a3aa00e82",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392186000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26d4cb5f-a2bb-480b-922e-5d018d11ecfb",
          "citation": "SRS import [912GOZ167T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=912GOZ167T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392186000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ccdb3967-606c-4d7e-9dd2-355cc3e22784",
          "citation": "AFLURIA 2013",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b420a2ee-226d-445b-af7c-d6a760e32083",
          "citation": "4-HYDROXYTESTOSTERONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1a72b336-9555-dccb-94a6-aaad97d575a7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6b88dbe7-d440-4bc0-b559-d15eb6ca21c7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cf38c634-4a2c-b2c9-942f-c97362fa2fb3",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "b0c44084-c6dd-4844-aa05-30ebbd2c9cc4",
          "citation": "CFR",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "88a63525-0883-4996-9974-7bdc21eaea7d",
          "id": "88a63525-0883-4996-9974-7bdc21eaea7d",
          "molfile": "\n  Marvin  01132107052D          \n\n 22 25  0  0  1  0            999 V2000\n    6.8068   -5.5285    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.0617   -4.7439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2917   -6.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8068   -6.8634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0221   -6.6085    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.3077   -7.0209    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.3077   -7.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5932   -8.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8787   -7.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1643   -8.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1643   -9.0835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4499   -7.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7354   -8.2585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4499   -7.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1643   -6.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8787   -7.0209    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.8787   -6.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5932   -6.6085    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.5932   -5.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3077   -5.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0221   -5.7835    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.1084   -4.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 21  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 21  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 18  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 16  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12CCC(=O)C(=C2CC[C@H]3[C@@H]4CC[C@@H]([C@@]4(C)CC[C@@H]31)O)O",
          "formula": "C19H28O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "63d21632-4050-4211-83cd-18cceb03964a"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "304.4245",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "256fb4fd-49ed-4b1a-8b97-c77a36d8b8b5",
      "version": "8",
      "structure": {
        "id": "26bd6656-e373-4a0d-aff2-81c254fc1ebd",
        "molfile": "\n  Marvin  01132102082D          \n\n 25 28  0  0  1  0            999 V2000\n    2.4499   -7.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4499   -7.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1643   -6.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8787   -7.0209    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.5932   -6.6085    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.5932   -5.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3077   -5.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0221   -5.7835    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8068   -5.5285    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2917   -6.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8068   -6.8634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0221   -6.6085    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3077   -7.0209    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3077   -7.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5932   -8.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8787   -7.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1643   -8.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1643   -9.0835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3077   -6.1959    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1084   -7.4289    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0617   -4.7439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1084   -4.9630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5932   -7.4335    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8787   -6.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7354   -8.2585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n  1 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 16  4  1  0  0  0  0\n 13  5  1  0  0  0  0\n 13 19  1  1  0  0  0\n 12  8  1  0  0  0  0\n 12 20  1  6  0  0  0\n  9 21  1  1  0  0  0\n  8 22  1  1  0  0  0\n  5 23  1  6  0  0  0\n  4 24  1  1  0  0  0\n  1 25  2  0  0  0  0\nM  END",
        "smiles": "C[C@@]12CCC(=O)C(=C2CC[C@@]3([H])[C@]4([H])CC[C@@H]([C@@]4(C)CC[C@@]31[H])O)O",
        "formula": "C19H28O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "304.4245",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "26d4cb5f-a2bb-480b-922e-5d018d11ecfb",
          "ccdb3967-606c-4d7e-9dd2-355cc3e22784"
        ],
        "stereo_centers": 6
      },
      "unii": "912GOZ167T"
    }
  ]
}