{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e2502062-764a-4216-aa91-4c3e6f147a23",
          "code": "A14AA04",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANABOLIC AGENTS FOR SYSTEMIC USE|ANABOLIC STEROIDS|Androstan derivatives|metenolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A14AA04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "ba3cd775-ff4e-4614-8054-9a2925e32dee",
          "code": "QA14AA04",
          "comments": "VATC|ANABOLIC AGENTS FOR SYSTEMIC USE|ANABOLIC STEROIDS|Androstan derivatives|metenolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA14AA04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "15c1d4b0-b4f1-47ed-9d32-11ca3b5457a4",
          "code": "153-00-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=153-00-4",
          "code_system": "CAS",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9",
            "fb2a85e5-afaf-4ba0-ab8d-e3ea498bbe07"
          ]
        },
        {
          "uuid": "fea9e871-4851-4f3c-8e26-3fac591508cc",
          "code": "D008710",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008710",
          "code_system": "MESH",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "0ff7698e-fdfd-4cdb-adac-98cd169eb8a8",
          "code": "616",
          "comments": "LiverTox|HDS: Anabolic steroid|Body building|Anabolic steroid",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/AndrogenicSteroids.htm",
          "code_system": "LIVERTOX",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "73f485a6-b6f9-46aa-a7a9-5ef163624e92",
          "code": "SUB08823MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "3ed86cf9-ae52-44cd-a0a9-6f6aac407b73",
          "code": "1223",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1223",
          "code_system": "INN",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "1898264d-11d9-418f-9b96-a12e74ca7e1c",
          "code": "205-812-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.285",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "54fa08c0-5125-421e-bcb4-7c2f32af874c",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "01f84d44-0c9f-4dc9-ac30-681faac2ce4c",
          "code": "6833",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6833/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "4d4a2f0b-f7b7-44af-a0d0-fe8e43e5485b",
          "code": "m7309",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7309?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "7a22a2d1-e785-418b-9a3c-07f67838b937",
          "code": "CHEMBL2106880",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106880",
          "code_system": "ChEMBL",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "b5d5ee0a-886e-4002-867c-1cf198cde61c",
          "code": "3037705",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3037705",
          "code_system": "PUBCHEM",
          "references": [
            "f4a90f69-1cd9-4c00-9026-fd230c2f16c9"
          ]
        },
        {
          "uuid": "cb75b4b4-fb28-60bd-4f06-5a10bf06cf7c",
          "code": "Methenolone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Methenolone",
          "code_system": "WIKIPEDIA",
          "references": [
            "3d2c0a7e-db2a-cc45-2eb3-ae683204688f"
          ]
        },
        {
          "uuid": "704b3b54-28b8-58c3-c275-2bdc44e2ff07",
          "code": "DTXSID10165179",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10165179",
          "code_system": "EPA CompTox",
          "references": [
            "eeff950e-1b68-252c-85af-a9f4da35e7c5"
          ]
        },
        {
          "uuid": "7e2043eb-94e2-4c16-8584-e62c3a1e4990",
          "code": "9062ZT8Q5C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3a72f646-ea8b-3b22-b9ed-a3fd5695f912",
          "code": "1743",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1743",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e50c25a6-232d-5fc4-19cd-d314de66079b"
          ]
        },
        {
          "uuid": "b20ae9f8-b4e8-fb2e-b86f-bf4ec3d08963",
          "code": "DB13710",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13710",
          "code_system": "DRUG BANK",
          "references": [
            "e50c25a6-232d-5fc4-19cd-d314de66079b"
          ]
        },
        {
          "uuid": "abd84ea1-006f-974c-3bed-0287a582aab5",
          "code": "C175130",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C175130",
          "code_system": "NCI_THESAURUS",
          "references": [
            "96192f73-9196-c079-351c-110f6c0192ce"
          ]
        },
        {
          "uuid": "819579b0-3e24-1486-f416-f36e0a8d9a8a",
          "code": "100000088226",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "bd064084-505a-2f27-869e-91dcb8060b51"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b21ed451-5813-4364-8926-7a709cc9fc02",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "92bbf297-e7db-4757-a369-615179afaddc",
            "refuuid": "3c161aa8-1ccf-4325-b24d-a5e4f442bba6",
            "name": "METHENOLONE",
            "unii": "9062ZT8Q5C",
            "linking_id": "9062ZT8Q5C",
            "ref_pname": "METHENOLONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e7876054-d158-4b9b-a9cf-b9e00037c59f",
          "name": "17.BETA.-HYDROXY-1-METHYL-5.ALPHA.-ANDROST-1-EN-3-ONE",
          "stdName": "17.BETA.-HYDROXY-1-METHYL-5.ALPHA.-ANDROST-1-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1cc8804-6e34-41df-b1b4-febfbe0b37cb"
          ],
          "display_name": false
        },
        {
          "uuid": "06fcba38-5d99-486e-ab4e-c8b92bdcc980",
          "name": "METENOLONE",
          "stdName": "METENOLONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b3e6e6f-824b-491b-b089-44d3fac81694",
            "0ec1e7fc-da0f-4c85-a43b-a3b371fbb747",
            "15b8080a-bc43-4ab8-a4ea-3a817cb66e5e",
            "d6e30ccb-b132-4c7a-ba79-0ae5a1770de4",
            "b1cc8804-6e34-41df-b1b4-febfbe0b37cb",
            "9c326b63-b0a3-4124-8cec-6886bcc4c607",
            "1dadfc43-09f3-4635-9bd9-1e3d8f98a843"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c5b96716-115c-442b-b60d-63b29d1eeff1",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "bd2ec2b7-9b56-4e34-ad9f-9f53f242b6b1",
          "name": "METENOLONE [MART.]",
          "stdName": "METENOLONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15b8080a-bc43-4ab8-a4ea-3a817cb66e5e"
          ],
          "display_name": false
        },
        {
          "uuid": "78467ce7-ea45-4657-bc30-c459430ab641",
          "name": "METHENOLONE",
          "stdName": "METHENOLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abfb81e2-1ebf-40ba-8b0c-f33f23bffaae",
            "5c121586-77d8-4fd1-a4c4-b9b4c68fb0ea",
            "b1cc8804-6e34-41df-b1b4-febfbe0b37cb"
          ],
          "display_name": true
        },
        {
          "uuid": "cbaeb733-ded0-4dd9-b83c-9253e57e5264",
          "name": "METHENOLONE [MI]",
          "stdName": "METHENOLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c121586-77d8-4fd1-a4c4-b9b4c68fb0ea"
          ],
          "display_name": false
        },
        {
          "uuid": "ab89ec14-6a02-ae07-1b15-442475ca07f3",
          "name": "Metenolone [WHO-DD]",
          "stdName": "METENOLONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85f07f2a-60d4-1706-be03-3f9c324e2510"
          ],
          "display_name": false
        },
        {
          "uuid": "a33084f9-f107-4ac7-a9e1-15ca7a7f70f8",
          "name": "PRIMOBOLAN S",
          "stdName": "PRIMOBOLAN S",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40012006-630e-4f5b-905c-6f1282acd934"
          ],
          "display_name": false
        },
        {
          "uuid": "b5b7946a-c2e2-4e88-a08d-3143ac68b2f6",
          "name": "metenolone [INN]",
          "stdName": "METENOLONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6e30ccb-b132-4c7a-ba79-0ae5a1770de4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b1cc8804-6e34-41df-b1b4-febfbe0b37cb",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d6e30ccb-b132-4c7a-ba79-0ae5a1770de4",
          "citation": "INN Proposed List 12",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL12.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "15b8080a-bc43-4ab8-a4ea-3a817cb66e5e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c121586-77d8-4fd1-a4c4-b9b4c68fb0ea",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ec1e7fc-da0f-4c85-a43b-a3b371fbb747",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40012006-630e-4f5b-905c-6f1282acd934",
          "citation": "dea list",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4a90f69-1cd9-4c00-9026-fd230c2f16c9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389661000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43e2fb4c-6b52-4ca0-bcc8-cf7dd0744430",
          "citation": "SRS import [9062ZT8Q5C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=9062ZT8Q5C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389661000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b3e6e6f-824b-491b-b089-44d3fac81694",
          "citation": "METENOLONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9c326b63-b0a3-4124-8cec-6886bcc4c607",
          "citation": "METENOLONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "abfb81e2-1ebf-40ba-8b0c-f33f23bffaae",
          "citation": "METHENOLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1dadfc43-09f3-4635-9bd9-1e3d8f98a843",
          "citation": "METENOLONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3d2c0a7e-db2a-cc45-2eb3-ae683204688f",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Methenolone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0a3a6d5c-7285-94ef-0d00-e798af22be91",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=153-00-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bd064084-505a-2f27-869e-91dcb8060b51",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e50c25a6-232d-5fc4-19cd-d314de66079b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fb2a85e5-afaf-4ba0-ab8d-e3ea498bbe07",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "96192f73-9196-c079-351c-110f6c0192ce",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "85f07f2a-60d4-1706-be03-3f9c324e2510",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "eeff950e-1b68-252c-85af-a9f4da35e7c5",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fa07bb76-9378-4e72-b32b-4e2bdfbe1252",
          "id": "fa07bb76-9378-4e72-b32b-4e2bdfbe1252",
          "molfile": "\n  Marvin  01132112572D          \n\n 22 25  0  0  1  0            999 V2000\n    9.7503   -2.1379    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.7503   -1.3100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2221   -2.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7271   -3.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9455   -3.2109    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.2286   -3.6132    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.2286   -4.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5119   -4.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7996   -4.4273    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.0965   -4.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3843   -4.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6675   -4.8343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3843   -3.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0965   -3.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0965   -2.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7996   -3.6040    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.7996   -2.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5164   -3.1924    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.5164   -2.3644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2518   -1.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9455   -2.3830    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.9455   -1.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 21  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 21  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 18  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 16  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\nM  END",
          "smiles": "CC1=CC(=O)C[C@@H]2CC[C@H]3[C@@H]4CC[C@@H]([C@@]4(C)CC[C@@H]3[C@@]12C)O",
          "formula": "C20H30O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e9966af8-5d2c-4d6e-89f0-daa6c691e88c"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "302.4518",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3c161aa8-1ccf-4325-b24d-a5e4f442bba6",
      "version": "14",
      "structure": {
        "id": "4f8caeb6-aa85-4b19-a30f-7b9030ce7db9",
        "molfile": "\n  Marvin  01132104092D          \n\n 26 29  0  0  1  0            999 V2000\n    6.7996   -3.6040    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.5164   -3.1924    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2286   -3.6132    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.9455   -3.2109    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.7271   -3.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2221   -2.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7503   -2.1379    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.9455   -2.3830    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2518   -1.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5164   -2.3644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9455   -1.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7503   -1.3100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9455   -4.0342    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2286   -4.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5119   -4.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7996   -4.4273    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0965   -4.8343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3843   -4.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6675   -4.8343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3843   -3.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0965   -3.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0965   -2.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7996   -5.2459    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2286   -2.7855    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5164   -4.0157    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7996   -2.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  2  1  0  0  0  0\n  8 11  1  1  0  0  0\n  4  8  1  0  0  0  0\n  7 12  1  1  0  0  0\n  4 13  1  6  0  0  0\n 14  3  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16  1  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21  1  1  0  0  0  0\n 22 21  1  0  0  0  0\n 16 23  1  6  0  0  0\n  3 24  1  1  0  0  0\n  2 25  1  6  0  0  0\n  1 26  1  1  0  0  0\nM  END",
        "smiles": "CC1=CC(=O)C[C@]2([H])CC[C@@]3([H])[C@]4([H])CC[C@@H]([C@@]4(C)CC[C@]3([H])[C@@]12C)O",
        "formula": "C20H30O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "302.4518",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "43e2fb4c-6b52-4ca0-bcc8-cf7dd0744430",
          "b1cc8804-6e34-41df-b1b4-febfbe0b37cb",
          "d6e30ccb-b132-4c7a-ba79-0ae5a1770de4"
        ],
        "stereo_centers": 7
      },
      "unii": "9062ZT8Q5C"
    }
  ]
}