{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "0c11cddc-245a-42e1-963e-a21f771d3f25", "code": "58243-85-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=58243-85-9", "code_system": "CAS", "references": [ "988b037f-9ae0-4ff9-a815-fa8611bdab51", "099ba15d-057e-43f0-bba0-2b0ff4a8991c" ] }, { "uuid": "5c2329e7-02bd-4189-8601-fbcd5e81aeda", "code": "261-182-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.602", "code_system": "ECHA (EC/EINECS)", "references": [ "988b037f-9ae0-4ff9-a815-fa8611bdab51" ] }, { "uuid": "bea3cade-62b2-4c82-bac9-a564eb6967ca", "code": "42674", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/42674", "code_system": "PUBCHEM", "references": [ "988b037f-9ae0-4ff9-a815-fa8611bdab51" ] }, { "uuid": "fa3d140b-0af7-bf02-65d9-5938ef5bd798", "code": "DTXSID7069239", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7069239", "code_system": "EPA CompTox", "references": [ "502a8ebc-6219-e051-6a84-74348b7149d5" ] }, { "uuid": "e0384393-e11c-4b32-9a51-be63b1621132", "code": "8ZYP294N73", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "099ba15d-057e-43f0-bba0-2b0ff4a8991c" ] } ], "substance_class": "chemical", "names": [ { "uuid": "c94a93ec-674c-48ce-a171-11770eb46470", "name": "1,1,4,4-Tetramethyl-6-ethyl-7-formyltetralin", "stdName": "1,1,4,4-TETRAMETHYL-6-ETHYL-7-FORMYLTETRALIN", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "89d48fdb-0ea1-4fcf-bf3f-cfd87d7fa39b" ], "display_name": true }, { "uuid": "5bb1e129-da03-43c0-ae81-bf24b399c4b5", "name": "2-Naphthalenecarboxaldehyde, 3-ethyl-5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-", "stdName": "2-NAPHTHALENECARBOXALDEHYDE, 3-ETHYL-5,6,7,8-TETRAHYDRO-5,5,8,8-TETRAMETHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "099ba15d-057e-43f0-bba0-2b0ff4a8991c" ], "display_name": false }, { "uuid": "ec47238e-732c-45bb-a1af-c0f36d965be8", "name": "3-Ethyl-5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-naphthalenecarboxaldehyde", "stdName": "3-ETHYL-5,6,7,8-TETRAHYDRO-5,5,8,8-TETRAMETHYL-2-NAPHTHALENECARBOXALDEHYDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "099ba15d-057e-43f0-bba0-2b0ff4a8991c" ], "display_name": false } ], "references": [ { "uuid": "89d48fdb-0ea1-4fcf-bf3f-cfd87d7fa39b", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "988b037f-9ae0-4ff9-a815-fa8611bdab51", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392089000, "tags": [ "NOMEN" ] }, { "uuid": "502a8ebc-6219-e051-6a84-74348b7149d5", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58243-85-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "099ba15d-057e-43f0-bba0-2b0ff4a8991c", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "bf3be705-4894-45e8-8da5-430c250c63cb", "id": "bf3be705-4894-45e8-8da5-430c250c63cb", "molfile": "\n Marvin 01132109532D \n\n 18 19 0 0 0 0 999 V2000\n 4.1425 -0.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4293 -0.5391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8488 -1.1279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1356 -0.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4264 -1.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4223 -1.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1356 -2.3678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8488 -1.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4334 -2.5378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1467 -2.1231 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7132 -2.3678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2902 -3.0810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2938 -2.9524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.1320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7132 -0.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1196 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1203 -0.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 3 2 0 0 0 0\n 5 4 2 0 0 0 0\n 5 6 1 0 0 0 0\n 16 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 11 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 14 11 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\nM END", "smiles": "CCc1cc2c(cc1C=O)C(C)(C)CCC2(C)C", "formula": "C17H24O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9f4925dd-3c60-4f05-b5d0-703efc832020" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "244.3725", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "116e14fb-866e-4cbf-b7b6-ab0938edc4a3", "version": "6", "structure": { "id": "772c5573-a836-42eb-96f9-2048b86809f9", "molfile": "\n JSDraw211212320162D\n\n 18 19 0 0 0 0 0 V2000\n 17.0571 -6.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4082 -6.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7591 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1110 -6.1361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4630 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4630 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.1110 -9.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.7591 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4082 -9.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0571 -8.4764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8149 -9.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8123 -10.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8176 -10.4511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1669 -8.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1669 -6.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8149 -6.1361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.8176 -4.9409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.8123 -4.9409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 3 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 6 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 5 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\nM END", "smiles": "CCc1cc2c(cc1C=O)C(C)(C)CCC2(C)C", "formula": "C17H24O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "244.3725", "optical_activity": "NONE", "references": [ "89d48fdb-0ea1-4fcf-bf3f-cfd87d7fa39b" ], "stereo_centers": 0 }, "unii": "8ZYP294N73" } ] }