{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bac54762-d5b7-43cf-9583-3b272b3e2cc7",
          "code": "12225-18-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=12225-18-2",
          "code_system": "CAS",
          "references": [
            "75cdcd8b-32ee-4227-bc48-9154366e578e",
            "e20bb6ec-9923-414f-93fe-0c13606f3c9f"
          ]
        },
        {
          "uuid": "c4005e8b-497f-4f6c-8b55-32f82dd988b5",
          "code": "235-427-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.032.195",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "75cdcd8b-32ee-4227-bc48-9154366e578e"
          ]
        },
        {
          "uuid": "f03c62d8-1972-4f26-828f-802f89b21dbc",
          "code": "61559",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61559",
          "code_system": "PUBCHEM",
          "references": [
            "75cdcd8b-32ee-4227-bc48-9154366e578e"
          ]
        },
        {
          "uuid": "48e7283c-7627-0bda-f36b-3ede899b3f1c",
          "code": "DTXSID9041736",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9041736",
          "code_system": "EPA CompTox",
          "references": [
            "2028bd57-f941-cc5c-e3aa-7ed535a0763e"
          ]
        },
        {
          "uuid": "5db527fe-8710-4164-979e-661da6df0515",
          "code": "8ZNH60AHS0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c390f35a-9c46-4c65-85b0-52a09f5d0a8e",
          "name": "BUTANAMIDE, N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((2,5-DIMETHOXY-4-((PHENYLAMINO)SULFONYL)PHENYL)AZO)-3-OXO-",
          "stdName": "BUTANAMIDE, N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((2,5-DIMETHOXY-4-((PHENYLAMINO)SULFONYL)PHENYL)AZO)-3-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acf05d71-a91d-49ea-ab14-4a4bd1a0e012"
          ],
          "display_name": false
        },
        {
          "uuid": "45343c12-6e51-4679-9e10-0e1bdd088517",
          "name": "BUTANAMIDE, N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((E)-2-(2,5-DIMETHOXY-4-((PHENYLAMINO)SULFONYL)PHENYL)DIAZENYL)-3-OXO-",
          "stdName": "BUTANAMIDE, N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((E)-2-(2,5-DIMETHOXY-4-((PHENYLAMINO)SULFONYL)PHENYL)DIAZENYL)-3-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e7fbab0-7805-45e6-b134-9ec1d4a057d5"
          ],
          "display_name": false
        },
        {
          "uuid": "19fdb64a-6150-4746-968c-3d1b71133ec9",
          "name": "BUTANAMIDE, N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-(2-(2,5-DIMETHOXY-4-((PHENYLAMINO)SULFONYL)PHENYL)DIAZENYL)-3-OXO-",
          "stdName": "BUTANAMIDE, N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-(2-(2,5-DIMETHOXY-4-((PHENYLAMINO)SULFONYL)PHENYL)DIAZENYL)-3-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acf05d71-a91d-49ea-ab14-4a4bd1a0e012"
          ],
          "display_name": false
        },
        {
          "uuid": "52be9fef-76d4-492a-81a4-f05c0dbfe58f",
          "name": "C.I. PIGMENT YELLOW 97",
          "stdName": "C.I. PIGMENT YELLOW 97",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68d8fe49-21c1-4cf2-8134-94748b0c378d"
          ],
          "display_name": false
        },
        {
          "uuid": "4730f3d5-19cf-4a65-bad5-9e8890d12334",
          "name": "C.I.11767",
          "stdName": "C.I.11767",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fef57a5-644b-4aef-b777-0b834acab994"
          ],
          "display_name": false
        },
        {
          "uuid": "ce6cd1d0-b8d4-44ec-ba70-05f0031d8d4d",
          "name": "COLANYL YELLOW FGL 30",
          "stdName": "COLANYL YELLOW FGL 30",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acf05d71-a91d-49ea-ab14-4a4bd1a0e012"
          ],
          "display_name": false
        },
        {
          "uuid": "2fed11b1-b1a8-4b44-a35b-d8bf0efb77e4",
          "name": "FAST YELLOW FGL",
          "stdName": "FAST YELLOW FGL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acf05d71-a91d-49ea-ab14-4a4bd1a0e012"
          ],
          "display_name": false
        },
        {
          "uuid": "060f5cec-0068-4ca2-9e7c-97f12ea9639a",
          "name": "J34.088J",
          "stdName": "J34.088J",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fef57a5-644b-4aef-b777-0b834acab994"
          ],
          "display_name": false
        },
        {
          "uuid": "774edc8b-247d-4111-86de-276d074cc250",
          "name": "N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((2,5-DIMETHOXY-4-((PHENYLAMINO)SULFONYL)PHENYL)AZO)-3-OXOBUTANAMIDE",
          "stdName": "N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((2,5-DIMETHOXY-4-((PHENYLAMINO)SULFONYL)PHENYL)AZO)-3-OXOBUTANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fef57a5-644b-4aef-b777-0b834acab994"
          ],
          "display_name": false
        },
        {
          "uuid": "e5908c04-9788-47f5-a555-94b16afe893b",
          "name": "N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((2,5-DIMETHOXY-4-((PHENYLAMINO)SULPHONYL)PHENYL)AZO)-3-OXOBUTYRAMIDE",
          "stdName": "N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((2,5-DIMETHOXY-4-((PHENYLAMINO)SULPHONYL)PHENYL)AZO)-3-OXOBUTYRAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80ba48d2-6d44-4b27-b638-db20d210c7b8"
          ],
          "display_name": false
        },
        {
          "uuid": "0ca267a1-d7b3-4683-8366-780aefc26f05",
          "name": "N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((2,5-DIMETHOXY-4-(PHENYLSULFAMOYL)PHENYL)DIAZENYL)-3-OXOBUTANAMIDE",
          "stdName": "N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((2,5-DIMETHOXY-4-(PHENYLSULFAMOYL)PHENYL)DIAZENYL)-3-OXOBUTANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e9e196e-ba82-4cb8-b229-5ffcd3cae538"
          ],
          "display_name": false
        },
        {
          "uuid": "c31e4860-da2d-41ce-9982-3de5f3b0644c",
          "name": "N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((E)-(2,5-DIMETHOXY-4-(PHENYLSULFAMOYL)PHENYL)DIAZENYL)-3-OXOBUTANAMIDE",
          "stdName": "N-(4-CHLORO-2,5-DIMETHOXYPHENYL)-2-((E)-(2,5-DIMETHOXY-4-(PHENYLSULFAMOYL)PHENYL)DIAZENYL)-3-OXOBUTANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e9e196e-ba82-4cb8-b229-5ffcd3cae538"
          ],
          "display_name": false
        },
        {
          "uuid": "3a17dde2-9318-46c4-aeab-45a20aa3d812",
          "name": "NOVAPERM YELLOW FGL",
          "stdName": "NOVAPERM YELLOW FGL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acf05d71-a91d-49ea-ab14-4a4bd1a0e012"
          ],
          "display_name": false
        },
        {
          "uuid": "a220e9dc-91d4-4d6b-9f24-0a3fbd0232bd",
          "name": "NOVOPERM YELLOW FGL",
          "stdName": "NOVOPERM YELLOW FGL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acf05d71-a91d-49ea-ab14-4a4bd1a0e012"
          ],
          "display_name": false
        },
        {
          "uuid": "4d072cb2-bf7b-4fb6-b323-56520620cbee",
          "name": "PERMANENT YELLOW FGL",
          "stdName": "PERMANENT YELLOW FGL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acf05d71-a91d-49ea-ab14-4a4bd1a0e012"
          ],
          "display_name": false
        },
        {
          "uuid": "0d1b7273-2ffb-482a-9abe-94a68a693733",
          "name": "PIGMENT YELLOW 97",
          "stdName": "PIGMENT YELLOW 97",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acf05d71-a91d-49ea-ab14-4a4bd1a0e012"
          ],
          "display_name": true
        },
        {
          "uuid": "3ba54f4e-d5ce-4cd0-b573-edac76833ce7",
          "name": "SM-9819",
          "stdName": "SM-9819",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acf05d71-a91d-49ea-ab14-4a4bd1a0e012"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "68d8fe49-21c1-4cf2-8134-94748b0c378d",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "acf05d71-a91d-49ea-ab14-4a4bd1a0e012",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fef57a5-644b-4aef-b777-0b834acab994",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J34.088J",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J34.088J",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80ba48d2-6d44-4b27-b638-db20d210c7b8",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/12225-18-2",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/12225-18-2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e9e196e-ba82-4cb8-b229-5ffcd3cae538",
          "citation": "http://pubchem.ncbi.nlm.nih.gov/compound/61559#section=Top",
          "url": "http://pubchem.ncbi.nlm.nih.gov/compound/61559#section=Top",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e7fbab0-7805-45e6-b134-9ec1d4a057d5",
          "citation": "http://www.chemspider.com/Chemical-Structure.55473.html?rid=2e54bb3f-0f69-4205-9729-49ad8608c8ec",
          "url": "http://www.chemspider.com/Chemical-Structure.55473.html?rid=2e54bb3f-0f69-4205-9729-49ad8608c8ec",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75cdcd8b-32ee-4227-bc48-9154366e578e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392140000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a98e4450-84f1-4ece-9090-f3046ad3a61e",
          "citation": "SRS import [8ZNH60AHS0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8ZNH60AHS0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392140000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2028bd57-f941-cc5c-e3aa-7ed535a0763e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=12225-18-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e20bb6ec-9923-414f-93fe-0c13606f3c9f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8585f398-eb00-43d2-9a0b-7232ae26f2e6",
          "id": "8585f398-eb00-43d2-9a0b-7232ae26f2e6",
          "molfile": "\n  Marvin  01132106562D          \n\n 40 42  0  0  0  0            999 V2000\n    9.0660   -6.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0660   -5.7207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3499   -5.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6518   -5.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9355   -5.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2193   -5.7207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5122   -5.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5122   -4.4968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7960   -5.7207    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.0797   -5.3218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0797   -4.4968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3725   -4.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3725   -3.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6563   -2.8467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6563   -2.0308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3725   -1.6137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9492   -3.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9492   -4.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6563   -4.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6563   -5.3218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9492   -5.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2421   -2.8467    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250   -3.5539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5258   -2.4388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6410   -2.1396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2421   -1.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4170   -1.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4170    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2421    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6410   -0.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7960   -6.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0797   -6.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5122   -6.9627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9355   -4.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2193   -4.0797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2193   -3.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6518   -4.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3499   -4.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0660   -4.0797    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 39  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  5 35  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 32  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 19  2  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 17 22  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  2  0  0  0  0\n 22 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 31  2  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 32 33  1  0  0  0  0\n 32 34  2  0  0  0  0\n 35 36  1  0  0  0  0\n 35 38  2  0  0  0  0\n 36 37  1  0  0  0  0\n 38 39  1  0  0  0  0\n 39 40  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)C(C(=O)Nc1cc(c(cc1OC)Cl)OC)/N=N/c2cc(c(cc2OC)S(=O)(=O)Nc3ccccc3)OC",
          "formula": "C26H27ClN4O8S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3a500228-eb96-444a-936a-fe102620c28e"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "591.0346",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a201751d-6d1b-499b-be4b-0fc79cbac8ad",
      "version": "3",
      "structure": {
        "id": "40c7e3d7-ea52-4f17-b202-05afc5b01746",
        "molfile": "\n  Marvin  01132103252D          \n\n 40 42  0  0  0  0            999 V2000\n    3.3725   -4.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6563   -4.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9492   -4.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9492   -3.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2421   -2.8467    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6410   -2.1396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2421   -1.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4170   -1.4234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4170    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2421    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6410   -0.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250   -3.5539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5258   -2.4388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6563   -2.8467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3725   -3.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6563   -2.0308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3725   -1.6137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6563   -5.3218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9492   -5.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0797   -4.4968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0797   -5.3218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7960   -5.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5122   -5.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2193   -5.7207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9355   -5.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9355   -4.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6518   -4.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3499   -4.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0660   -4.0797    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3499   -5.3218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6518   -5.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0660   -5.7207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0660   -6.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2193   -4.0797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2193   -3.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5122   -4.4968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7960   -6.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0797   -6.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5122   -6.9627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 16  2  0  0  0  0\n  1 21  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2 19  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 15  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5 13  2  0  0  0  0\n  5 14  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 38  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 37  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 32  2  0  0  0  0\n 27 28  2  0  0  0  0\n 27 35  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  2  0  0  0  0\n 31 32  1  0  0  0  0\n 31 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 35 36  1  0  0  0  0\n 38 39  1  0  0  0  0\n 38 40  2  0  0  0  0\nM  END",
        "smiles": "CC(=O)C(C(=O)Nc1cc(c(cc1OC)Cl)OC)/N=N/c2cc(c(cc2OC)S(=O)(=O)Nc3ccccc3)OC",
        "formula": "C26H27ClN4O8S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "591.0346",
        "optical_activity": "( + / - )",
        "references": [
          "a98e4450-84f1-4ece-9090-f3046ad3a61e",
          "68d8fe49-21c1-4cf2-8134-94748b0c378d"
        ],
        "stereo_centers": 1
      },
      "unii": "8ZNH60AHS0"
    }
  ]
}