{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "260f30c4-9a14-406b-9472-d788f0dac547",
          "code": "6451",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6451",
          "code_system": "PUBCHEM",
          "references": [
            "e5e46b3f-5e4e-41d6-a049-bb03ef4172a5"
          ]
        },
        {
          "uuid": "443c5756-af4a-4e27-a8f7-e625384c9be9",
          "code": "76-60-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=76-60-8",
          "code_system": "CAS",
          "references": [
            "e5e46b3f-5e4e-41d6-a049-bb03ef4172a5",
            "a289ccd2-a83a-4fda-9798-aad623070c33"
          ]
        },
        {
          "uuid": "ad10d0f3-e2f0-4ad3-ba34-657df4e87873",
          "code": "D001961",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001961",
          "code_system": "MESH",
          "references": [
            "e5e46b3f-5e4e-41d6-a049-bb03ef4172a5"
          ]
        },
        {
          "uuid": "21fae98e-e896-4417-88a6-be23f59f3413",
          "code": "BROMOCRESOL GREEN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bromocresol_green",
          "code_system": "WIKIPEDIA",
          "references": [
            "e5e46b3f-5e4e-41d6-a049-bb03ef4172a5"
          ]
        },
        {
          "uuid": "0e2573e1-7c4e-421c-8f05-29bdae4b381e",
          "code": "200-972-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.885",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e5e46b3f-5e4e-41d6-a049-bb03ef4172a5"
          ]
        },
        {
          "uuid": "9e027108-6f48-4974-8cec-9b38436cf79b",
          "code": "m2663",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2663?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e5e46b3f-5e4e-41d6-a049-bb03ef4172a5"
          ]
        },
        {
          "uuid": "feb19870-b3a5-e36f-4c15-5881646f72ea",
          "code": "DTXSID9044459",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9044459",
          "code_system": "EPA CompTox",
          "references": [
            "ade8115e-5745-81fa-de12-8caa513ff4ad"
          ]
        },
        {
          "uuid": "db3c6983-313e-43c7-ae41-a8c60e199c05",
          "code": "8YGN0Y942M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "aa918cb9-eb1e-7024-14e3-8a103e1ccca9",
          "code": "7817",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7817",
          "code_system": "NSC",
          "references": [
            "24ca7637-51a8-c389-d298-cde62aae569c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "655376e4-a437-4085-bc9a-d602a4a7b87d",
          "name": "3',3'',5',5''-TETRABROMO-M-CRESOLSULFONEPHTHALEIN",
          "stdName": "3',3'',5',5''-TETRABROMO-M-CRESOLSULFONEPHTHALEIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d88b5a-6e91-4c35-92a9-574508424559",
            "b842092a-c331-49bd-adf3-52246a2a87a0"
          ],
          "display_name": false
        },
        {
          "uuid": "80dc8e3d-9577-4f53-b2a4-f6d4f3a45d8d",
          "name": "BROMCRESOL GREEN",
          "stdName": "BROMCRESOL GREEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48e0bfda-a77f-4197-be00-ced08b6ee021",
            "92d88b5a-6e91-4c35-92a9-574508424559",
            "acbae425-37bf-4255-90af-19533044ff8a",
            "b842092a-c331-49bd-adf3-52246a2a87a0"
          ],
          "display_name": false
        },
        {
          "uuid": "c8a9f460-5f9c-4580-b4be-7dc5008ca863",
          "name": "BROMCRESOL GREEN [MI]",
          "stdName": "BROMCRESOL GREEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48e0bfda-a77f-4197-be00-ced08b6ee021",
            "92d88b5a-6e91-4c35-92a9-574508424559"
          ],
          "display_name": false
        },
        {
          "uuid": "7dc9a8d0-c70b-45a7-83de-b77a471e6a24",
          "name": "BROMOCRESOL GREEN",
          "stdName": "BROMOCRESOL GREEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d88b5a-6e91-4c35-92a9-574508424559",
            "0b9954e2-8e49-4e38-ae49-5404f40c8106",
            "f9b8df90-527c-4866-843e-822a0fa456f4"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6ed5ca7f-c393-49f8-880e-5eaaee86a461",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "bf95d750-9b76-4490-b608-409e709ba9f4",
          "name": "M-CRESOL, 4,4'-(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMO-, S,S-DIOXIDE",
          "stdName": "M-CRESOL, 4,4'-(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMO-, S,S-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d88b5a-6e91-4c35-92a9-574508424559",
            "b842092a-c331-49bd-adf3-52246a2a87a0"
          ],
          "display_name": false
        },
        {
          "uuid": "98bf4436-910f-471e-8d0c-c63d22c409b1",
          "name": "NSC-7817",
          "stdName": "NSC-7817",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d88b5a-6e91-4c35-92a9-574508424559",
            "b842092a-c331-49bd-adf3-52246a2a87a0"
          ],
          "display_name": false
        },
        {
          "uuid": "edad536f-8c9e-46c2-ab3c-ddf45394dfa8",
          "name": "O-TOLUENESULFONIC ACID, .ALPHA.,.ALPHA.-BIS(3,5-DIBROMO-4-HYDROXY-O-TOLYL)-.ALPHA.-HYDROXY-, .GAMMA.-SULTONE",
          "stdName": "O-TOLUENESULFONIC ACID, .ALPHA.,.ALPHA.-BIS(3,5-DIBROMO-4-HYDROXY-O-TOLYL)-.ALPHA.-HYDROXY-, .GAMMA.-SULTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d88b5a-6e91-4c35-92a9-574508424559",
            "b842092a-c331-49bd-adf3-52246a2a87a0"
          ],
          "display_name": false
        },
        {
          "uuid": "d8081553-c8d9-44a5-9d6e-fda551b427c9",
          "name": "PHENOL, 4,4'-(1,1-DIOXIDO-3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMO-3-METHYL-",
          "stdName": "PHENOL, 4,4'-(1,1-DIOXIDO-3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMO-3-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d88b5a-6e91-4c35-92a9-574508424559",
            "b842092a-c331-49bd-adf3-52246a2a87a0"
          ],
          "display_name": false
        },
        {
          "uuid": "e5a7572e-b574-4140-bbae-3f111322b26c",
          "name": "PHENOL, 4,4'-(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMO-3-METHYL-, S,S-DIOXIDE",
          "stdName": "PHENOL, 4,4'-(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS(2,6-DIBROMO-3-METHYL-, S,S-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d88b5a-6e91-4c35-92a9-574508424559",
            "b842092a-c331-49bd-adf3-52246a2a87a0"
          ],
          "display_name": false
        },
        {
          "uuid": "14fad998-c7e3-4b29-8eb7-c9273c1d6214",
          "name": "TETRABROMO-M-CRESOLPHTHALEIN SULFONE",
          "stdName": "TETRABROMO-M-CRESOLPHTHALEIN SULFONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92d88b5a-6e91-4c35-92a9-574508424559",
            "b842092a-c331-49bd-adf3-52246a2a87a0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0b9954e2-8e49-4e38-ae49-5404f40c8106",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "92d88b5a-6e91-4c35-92a9-574508424559",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b842092a-c331-49bd-adf3-52246a2a87a0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48e0bfda-a77f-4197-be00-ced08b6ee021",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5e46b3f-5e4e-41d6-a049-bb03ef4172a5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391413000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5640717-8b13-4324-9c4e-3fd625363f1e",
          "citation": "SRS import [8YGN0Y942M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8YGN0Y942M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391413000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9b8df90-527c-4866-843e-822a0fa456f4",
          "citation": "BROMOCRESOL GREEN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "acbae425-37bf-4255-90af-19533044ff8a",
          "citation": "BROMCRESOL GREEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ade8115e-5745-81fa-de12-8caa513ff4ad",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=76-60-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a289ccd2-a83a-4fda-9798-aad623070c33",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "24ca7637-51a8-c389-d298-cde62aae569c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "64ed1c1a-63e6-44e3-b33d-493f60aca45a",
          "id": "64ed1c1a-63e6-44e3-b33d-493f60aca45a",
          "molfile": "\n  Marvin  01132105152D          \n\n 31 34  0  0  0  0            999 V2000\n   10.2682   -5.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7650   -5.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7650   -6.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0354   -7.0650    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   11.4609   -7.0754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4609   -7.9059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1724   -6.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8864   -7.0858    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   12.1724   -5.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4765   -5.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4765   -4.6099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4765   -3.7872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2293   -3.5078    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8800   -2.7601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9434   -3.0758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7389   -4.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5617   -4.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9187   -4.9773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4504   -5.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6277   -5.5801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2707   -4.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6719   -4.5478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1984   -5.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3757   -5.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9049   -5.8284    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.0187   -4.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1960   -4.3537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4870   -3.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1351   -2.9904    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   10.3096   -3.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7830   -3.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 10  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 21  1  0  0  0  0\n 11 22  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 15  2  0  0  0  0\n 16 13  1  0  0  0  0\n 16 17  1  0  0  0  0\n 21 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 30  2  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 26  2  0  0  0  0\n 28 29  1  0  0  0  0\n 30 28  1  0  0  0  0\n 30 31  1  0  0  0  0\nM  END",
          "smiles": "Cc1c(cc(c(c1Br)O)Br)C2(c3ccccc3S(=O)(=O)O2)c4cc(c(c(c4C)Br)O)Br",
          "formula": "C21H14Br4O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0c276892-b60b-4663-bb21-8555ecae9ab7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "698.0138",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b8db6449-6bfa-4604-a7b1-b8567fb162e2",
      "version": "6",
      "structure": {
        "id": "42d5c45c-03b5-4172-a071-27bbedfe5e82",
        "molfile": "\n  Marvin  01132103312D          \n\n 31 34  0  0  0  0            999 V2000\n   11.4609   -7.9059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1960   -4.3537    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8864   -7.0858    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   10.0354   -7.0650    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n   11.4609   -7.0754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9049   -5.8284    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.1351   -2.9904    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.0187   -4.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9187   -4.9773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8800   -2.7601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9434   -3.0758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1724   -6.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2682   -5.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7650   -6.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3757   -5.1661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7830   -3.1171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4870   -3.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4504   -5.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5617   -4.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2293   -3.5078    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1724   -5.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7650   -5.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1984   -5.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3096   -3.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6277   -5.5801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7389   -4.1649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4765   -3.7872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4765   -5.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6719   -4.5478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2707   -4.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4765   -4.6099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 12  5  1  0  0  0  0\n 15  8  1  0  0  0  0\n 18  9  1  0  0  0  0\n 26 20  1  0  0  0  0\n  5  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n 12  3  1  0  0  0  0\n 14  4  1  0  0  0  0\n 14  5  2  0  0  0  0\n 15  6  1  0  0  0  0\n 17  7  1  0  0  0  0\n 17  8  2  0  0  0  0\n 19  9  2  0  0  0  0\n 20 10  2  0  0  0  0\n 20 11  2  0  0  0  0\n 21 12  2  0  0  0  0\n 22 13  1  0  0  0  0\n 22 14  1  0  0  0  0\n 23 15  2  0  0  0  0\n 24 16  1  0  0  0  0\n 24 17  1  0  0  0  0\n 25 18  2  0  0  0  0\n 26 19  1  0  0  0  0\n 27 20  1  0  0  0  0\n 28 21  1  0  0  0  0\n 28 22  2  0  0  0  0\n 29 23  1  0  0  0  0\n 29 24  2  0  0  0  0\n 30 25  1  0  0  0  0\n 30 26  2  0  0  0  0\n 31 27  1  0  0  0  0\n 31 28  1  0  0  0  0\n 31 29  1  0  0  0  0\n 31 30  1  0  0  0  0\nM  END",
        "smiles": "Cc1c(cc(c(c1Br)O)Br)C2(c3ccccc3S(=O)(=O)O2)c4cc(c(c(c4C)Br)O)Br",
        "formula": "C21H14Br4O5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "698.0138",
        "optical_activity": "NONE",
        "references": [
          "b842092a-c331-49bd-adf3-52246a2a87a0",
          "a5640717-8b13-4324-9c4e-3fd625363f1e"
        ],
        "stereo_centers": 0
      },
      "unii": "8YGN0Y942M"
    }
  ]
}