{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "aa0fd908-e0d1-4c68-a72f-af222763f12c",
          "code": "94-18-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94-18-8",
          "code_system": "CAS",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f",
            "f1c767e6-3687-4970-9722-1a4603d6076b"
          ]
        },
        {
          "uuid": "0f928cd5-ec3f-41de-aab6-f13b189648c1",
          "code": "C95327",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C95327",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "404b89ee-fda7-430a-906d-fa7f0b95358c",
          "code": "C057775",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67057775",
          "code_system": "MESH",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "8455cb4d-55cd-480f-b38d-87ad6497bafc",
          "code": "N0000185508",
          "comments": "Established Pharmacologic Class [EPC]|Standardized Chemical Allergen [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000185508",
          "code_system": "NDF-RT",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "42c1c271-a0d2-4aaf-a932-8f77d12e3cb0",
          "code": "202-311-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.102",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "9d8392c8-8339-48f5-b4e8-e7363ef2a0b4",
          "code": "BENZYLPARABEN",
          "comments": "Description: A white to creamy white, crystalline powder; odourless or almost odourless. Solubility: Practically insoluble in water; soluble in ethanol (~750 g/l) TS and ether R; dissolves in solutions of alkali hydroxides. Category: Antimicrobial preservative. Storage: Benzyl hydroxybenzoate should be kept in a well-closed container. Requirement: Benzyl hydroxybenzoate contains not less than 99.0% and not more than the equivalent of 101.0% of C14H12O3.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.52.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "e3dfb3c5-ba6c-465b-8f0d-139dc062decf",
          "code": "19075",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/19075/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "37e64d7c-9aed-423c-a1ff-3f07d50f258a",
          "code": "SUB61024",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "27e14fc5-3717-4ad5-93b9-298e15efd49e",
          "code": "SUB13025MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "7dbabf8d-a076-4239-8d7f-6decfaabb79b",
          "code": "N0000171131",
          "comments": "Allergens [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000171131",
          "code_system": "NDF-RT",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "256cef33-4b32-4b41-8483-276bfd2f888e",
          "code": "N0000184306",
          "comments": "Cell-mediated Immunity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000184306",
          "code_system": "NDF-RT",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "b1087f18-c8f6-45ea-8220-ece85a8c69d4",
          "code": "N0000175629",
          "comments": "Increased Histamine Release [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175629",
          "code_system": "NDF-RT",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "a7625da6-d540-4f5e-961c-43d244e51d0d",
          "code": "7180",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7180",
          "code_system": "PUBCHEM",
          "references": [
            "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f"
          ]
        },
        {
          "uuid": "b3c58d6a-41c0-d97f-c374-472b9fa225ca",
          "code": "DTXSID9022526",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9022526",
          "code_system": "EPA CompTox",
          "references": [
            "635a2cbb-b1c1-68eb-2a24-c89cfc256293"
          ]
        },
        {
          "uuid": "b6c602e1-5da0-e44b-4310-96c291cbfa4f",
          "code": "C92608",
          "comments": "Industrial Aid[C45678]|Paraben",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C92608",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8238c0cf-4d8c-a039-de6b-9016dc69db8d"
          ]
        },
        {
          "uuid": "a98056b4-1302-34b4-6855-cd4e60a40d34",
          "code": "DB14176",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB14176",
          "code_system": "DRUG BANK",
          "references": [
            "8238c0cf-4d8c-a039-de6b-9016dc69db8d"
          ]
        },
        {
          "uuid": "c9bc80e4-58cf-417a-9353-3e71063ab3be",
          "code": "8Y41DYV4VG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e0082bc1-e658-ccd4-a046-399f1e7bd495",
          "code": "100000134265",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d7aaf698-996b-b521-d6d3-d597231a0db6"
          ]
        },
        {
          "uuid": "1c95fdc2-4b82-4d70-bc20-bb6c94e71d6f",
          "code": "8080",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8080",
          "code_system": "NSC",
          "references": [
            "1044ed88-35e6-f029-a1be-cbd236424ec5"
          ]
        },
        {
          "uuid": "319809dc-2196-131f-2df9-51cfee359c00",
          "code": "8Y41DYV4VG",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=8Y41DYV4VG",
          "code_system": "DAILYMED",
          "references": [
            "b4ad9010-9cb4-7cac-a65e-1370729b6803"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8af1a2b6-a3c1-41f6-8f98-92262e6ddb40",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "92ab4077-4306-4ab1-815e-6009f1f20fdb",
            "refuuid": "9cd07fc1-cc19-442d-a967-42359ff49fa5",
            "name": "BENZYLPARABEN SODIUM",
            "unii": "82W7I990AN",
            "linking_id": "82W7I990AN",
            "ref_pname": "BENZYLPARABEN SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d613c52c-0335-46f1-a84f-c98e2db5807e",
          "comments": "http://apps.who.int/phint/pdf/b/Jb.6.1.52.pdf",
          "type": "ACTIVE MOIETY",
          "references": [
            "7ddc1ee2-c9b8-4c9e-add2-50610d233486"
          ],
          "related_substance": {
            "uuid": "fe25999f-13df-4408-8d33-0a88960e4152",
            "refuuid": "2dcc16fe-ee7f-4c3a-ae8d-6821c1d1960d",
            "name": "BENZYLPARABEN",
            "unii": "8Y41DYV4VG",
            "linking_id": "8Y41DYV4VG",
            "ref_pname": "BENZYLPARABEN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "501607ed-4e06-4970-b26e-19e1a8aabd21",
          "name": "4-HYDROXYBENZOIC ACID, BENZYL ESTER",
          "stdName": "4-HYDROXYBENZOIC ACID, BENZYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64a8e0e1-2405-407e-a6e6-bc7ecf931640",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": false
        },
        {
          "uuid": "c1e761e7-bcb4-4ccc-bb49-12167cab8853",
          "name": "BENZYL 4-HYDROXYBENZOATE",
          "stdName": "BENZYL 4-HYDROXYBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ec690d8-7e2e-475e-94d7-709ecbabb1af",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": false
        },
        {
          "uuid": "a02f4bbb-4fe4-4120-9564-81b2bcd91dad",
          "name": "BENZYL HYDROXYBENZOATE",
          "stdName": "BENZYL HYDROXYBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8340a679-543a-4d1e-bef8-a7a9536360e5",
            "cbcc8be0-39b6-41f5-892b-1bac34f116be",
            "a3c3fdb9-3a8e-4409-89ae-b812197ba455",
            "12867d16-8c86-4e68-8fa2-17579bf4ad1f",
            "aed603bf-3111-4ea4-bb12-8acfb8d8f786",
            "1ec690d8-7e2e-475e-94d7-709ecbabb1af",
            "b5e133d2-404d-4ce7-bea8-919630874a12",
            "0427824f-80cc-4c41-939a-32df5a4ad581"
          ],
          "display_name": false
        },
        {
          "uuid": "5626a579-649d-404d-a8e6-f522da4c83f6",
          "name": "BENZYL HYDROXYBENZOATE [MART.]",
          "stdName": "BENZYL HYDROXYBENZOATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3c3fdb9-3a8e-4409-89ae-b812197ba455"
          ],
          "display_name": false
        },
        {
          "uuid": "b78a45a6-efc3-4c98-b01c-110f56cf8a1d",
          "name": "BENZYL HYDROXYBENZOATE [WHO-IP]",
          "stdName": "BENZYL HYDROXYBENZOATE [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8340a679-543a-4d1e-bef8-a7a9536360e5",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": false
        },
        {
          "uuid": "55c251b5-4264-4dfe-a435-55390c9f150d",
          "name": "BENZYL P-HYDROXYBENZOATE",
          "stdName": "BENZYL P-HYDROXYBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64a8e0e1-2405-407e-a6e6-bc7ecf931640",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": false
        },
        {
          "uuid": "8e59092a-72d4-4901-a366-2f824e5efd8d",
          "name": "BENZYL PARABEN",
          "stdName": "BENZYL PARABEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80b5f6cd-31fa-44ea-baf7-a0569c40145b",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": false
        },
        {
          "uuid": "632b4a64-2a39-4ab2-97b8-968f0abc4c9f",
          "name": "BENZYL PARAHYDROXYBENZOATE",
          "stdName": "BENZYL PARAHYDROXYBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "047e824d-9820-4c75-b548-74bcf8ec54ad",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": false
        },
        {
          "uuid": "06243c3e-e2e6-489d-931f-cc082294f37b",
          "name": "BENZYL TEGOSEPT",
          "stdName": "BENZYL TEGOSEPT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6a40420-e439-4b68-89b3-fcac9824dfe3",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": false
        },
        {
          "uuid": "57636606-f780-45d5-8f6e-48560022e6ed",
          "name": "BENZYLIS HYDROXYBENZOAS [WHO-IP LATIN]",
          "stdName": "BENZYLIS HYDROXYBENZOAS [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8340a679-543a-4d1e-bef8-a7a9536360e5",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": false
        },
        {
          "uuid": "6095957e-8302-4d37-9a80-19781d3d2056",
          "name": "BENZYLPARABEN",
          "stdName": "BENZYLPARABEN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83cd45bc-974c-4e17-86d8-b43321e02f4e",
            "64a8e0e1-2405-407e-a6e6-bc7ecf931640",
            "752a8e44-4bbd-479b-b65a-c993274b80f9",
            "cc06f292-c2e3-420d-9dd8-15081b3b9cc8",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d5291304-164e-4fc0-880c-23446e188c7b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "228f7916-ff3d-7c59-9750-5744396dc2a5",
          "name": "Benzyl hydroxybenzoate [WHO-DD]",
          "stdName": "BENZYL HYDROXYBENZOATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "738f2fd8-ab09-d897-0f4d-895ea9eed4ac"
          ],
          "display_name": false
        },
        {
          "uuid": "fc8e1479-dc18-4e87-b74f-6573bde0ebb6",
          "name": "NIPABENZYL",
          "stdName": "NIPABENZYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6a40420-e439-4b68-89b3-fcac9824dfe3",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": false
        },
        {
          "uuid": "099a8912-f18f-4c2b-8145-cd4d9c656e3a",
          "name": "NSC-8080",
          "stdName": "NSC-8080",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6a40420-e439-4b68-89b3-fcac9824dfe3",
            "b5e133d2-404d-4ce7-bea8-919630874a12"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a3c3fdb9-3a8e-4409-89ae-b812197ba455",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc06f292-c2e3-420d-9dd8-15081b3b9cc8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aed603bf-3111-4ea4-bb12-8acfb8d8f786",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "047e824d-9820-4c75-b548-74bcf8ec54ad",
          "citation": "ema",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80b5f6cd-31fa-44ea-baf7-a0569c40145b",
          "citation": "BLA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8340a679-543a-4d1e-bef8-a7a9536360e5",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6a40420-e439-4b68-89b3-fcac9824dfe3",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cb4eda9-001b-4e1c-ad3f-c66ef79b2d5f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390462000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ddc1ee2-c9b8-4c9e-add2-50610d233486",
          "citation": "THE INTERNATIONAL PHARMACOPOEIA FIFTH EDITION",
          "url": "http://apps.who.int/phint/en/p/docf/",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11695850-56ad-4db6-b986-094ef3b40d28",
          "citation": "SRS import [8Y41DYV4VG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=8Y41DYV4VG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390462000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12867d16-8c86-4e68-8fa2-17579bf4ad1f",
          "citation": "BENZYL HYDROXYBENZOATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "752a8e44-4bbd-479b-b65a-c993274b80f9",
          "citation": "BENZYLPARABEN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0427824f-80cc-4c41-939a-32df5a4ad581",
          "citation": "BENZYL HYDROXYBENZOATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cbcc8be0-39b6-41f5-892b-1bac34f116be",
          "citation": "BENZYL HYDROXYBENZOATE [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "64a8e0e1-2405-407e-a6e6-bc7ecf931640",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "83cd45bc-974c-4e17-86d8-b43321e02f4e",
          "citation": "DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ec690d8-7e2e-475e-94d7-709ecbabb1af",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5e133d2-404d-4ce7-bea8-919630874a12",
          "citation": "MARTINDALE",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "635a2cbb-b1c1-68eb-2a24-c89cfc256293",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=94-18-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8238c0cf-4d8c-a039-de6b-9016dc69db8d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f1c767e6-3687-4970-9722-1a4603d6076b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1044ed88-35e6-f029-a1be-cbd236424ec5",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "738f2fd8-ab09-d897-0f4d-895ea9eed4ac",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b4ad9010-9cb4-7cac-a65e-1370729b6803",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d7aaf698-996b-b521-d6d3-d597231a0db6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f63867b2-2e07-4c33-be51-bfa58310fa7d",
          "id": "f63867b2-2e07-4c33-be51-bfa58310fa7d",
          "molfile": "\n  Marvin  01132112462D          \n\n 17 18  0  0  0  0            999 V2000\n    0.0000   -2.4758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140   -2.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1447   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1447   -2.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -2.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8587   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8587    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5727   -1.2340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2919   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0059   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0059   -2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7226   -2.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4366   -2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4366   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7226   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)COC(=O)c2ccc(cc2)O",
          "formula": "C14H12O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1af5fad3-91ec-4750-8f06-827283f857c4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "228.2438",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2dcc16fe-ee7f-4c3a-ae8d-6821c1d1960d",
      "version": "13",
      "structure": {
        "id": "40b050fe-b738-464a-8e3a-e77ff9b420c9",
        "molfile": "\n  Marvin  01132103252D          \n\n 17 18  0  0  0  0            999 V2000\n    2.8587   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1447   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5727   -1.2340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8587    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1447   -2.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2919   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140   -2.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4307   -2.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0059   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7226   -0.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0059   -2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7226   -2.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4366   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4366   -2.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  2  2  0  0  0  0\n  6  2  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  6  2  0  0  0  0\n 11  7  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 13  2  0  0  0  0\n 17 15  2  0  0  0  0\n  8  9  2  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)COC(=O)c2ccc(cc2)O",
        "formula": "C14H12O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "228.2438",
        "optical_activity": "NONE",
        "references": [
          "64a8e0e1-2405-407e-a6e6-bc7ecf931640",
          "11695850-56ad-4db6-b986-094ef3b40d28"
        ],
        "stereo_centers": 0
      },
      "unii": "8Y41DYV4VG"
    }
  ]
}